Histogram

diff --git a/Modules/QmitkExt/resources/HighChartsHistogram.js b/Modules/QmitkExt/resources/HighChartsHistogram.js new file mode 100644 index 0000000000..afff8c2361 --- /dev/null +++ b/Modules/QmitkExt/resources/HighChartsHistogram.js @@ -0,0 +1,117 @@ +/*=================================================================== + +The Medical Imaging Interaction Toolkit (MITK) + +Copyright (c) German Cancer Research Center, +Division of Medical and Biological Informatics. +All rights reserved. + +This software is distributed WITHOUT ANY WARRANTY; without +even the implied warranty of MERCHANTABILITY or FITNESS FOR +A PARTICULAR PURPOSE. + +See LICENSE.txt or http://www.mitk.org for details. + +===================================================================*/ + +var connected = false; +var chart; +var histData; + +if (!connected) +{ + connected = true; + histogramData.DataChanged.connect(updateHistogram); +} + +$(function () { + chart = new Highcharts.Chart({ + chart: { + renderTo: 'container', + resetZoomButton: { + position: { + x:-10, + y:10 + }, + relativeTo: 'chart' + }, + animation: { + duration: 1500, + }, + zoomType: 'x' + }, + title: { + text: 'Histogram' + }, + plotOptions: { + column: { + borderWidth: 0.0, + shadow: false, + turboThreshold: 500.0, + enableMouseTracking: false + }, + spline: { + shadow: false, + lineWidth: 1.0, + marker: { + enabled: false + }, + visible: false + } + }, + xAxis: { + title: { + text: 'Greyvalue' + }, + allowDecimals: false, + endOnTick: true + }, + yAxis: { + title: { + text: 'Frequency (px)' + }, + allowDecimals: false, + endOnTick: true + }, + tooltip: { + shadow: false, + formatter: function() { + return 'Greyvalue: '+this.x+'
'+'Frequency: '+this.y; + } + }, + series: [{ + type: 'column', + data: histData, + name: 'Barchart' + }, { + type: 'spline', + data: histData, + name: 'Lineplot' + }], + credits: { + enabled: false + }, + navigation: { + buttonOptions: { + enabled: false + } + }, + legend: { + enabled: true + } + }); +}); + +updateHistogram(); + +function updateHistogram() { + histData = []; + for (var i = 0; i < histogramData.frequency.length; i++) + { + var tempArray = [histogramData.measurement[i], histogramData.frequency[i]] + histData[i] = tempArray; + } + chart.series[0].setData(histData); + chart.series[1].setData(histData); + chart.redraw(); +} diff --git a/Modules/QmitkExt/resources/Histogram.css b/Modules/QmitkExt/resources/Histogram.css index 2cef5d5084..da84a588bb 100644 --- a/Modules/QmitkExt/resources/Histogram.css +++ b/Modules/QmitkExt/resources/Histogram.css @@ -1,28 +1,28 @@ body { font: 10px sans-serif; } .bar { fill: steelblue; shape-rendering: crispEdges; } -.area { - fill: steelblue; - opacity: 0.5; -} - .line { fill: none; stroke: black; stroke-width: 1; } .axis path, .axis line { fill: none; stroke: #000; shape-rendering: crispEdges; } - - +.infobox { + background-color: rgba(255, 255, 255, 0.75); + padding: 10px; + position: absolute; + width: 200px; + display: none; +} diff --git a/Modules/QmitkExt/resources/Histogram.html b/Modules/QmitkExt/resources/Histogram.html index c296e5c856..45d4dfe555 100644 --- a/Modules/QmitkExt/resources/Histogram.html +++ b/Modules/QmitkExt/resources/Histogram.html @@ -1,12 +1,20 @@ Histogram - + + + + - + + + +

diff --git a/Modules/QmitkExt/resources/Histogram.js b/Modules/QmitkExt/resources/Histogram.js index 50a0c9718c..f7ad9a70ae 100644 --- a/Modules/QmitkExt/resources/Histogram.js +++ b/Modules/QmitkExt/resources/Histogram.js @@ -1,293 +1,330 @@ -/** - * @author Moritz Petry - */ -//var dataset = [1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 7, 18, 19, 22]; - -/*var indexNumber = Math.round(Math.random()*10+30); - for (var i = 0; i< indexNumber; i++) { - var newNumber = Math.random() * 100; - dataset.push(newNumber); - }*/ - -var dataset = new Array(); -var frequency = new Array(); -var measurement = new Array(); -var dataset; +/*=================================================================== + +The Medical Imaging Interaction Toolkit (MITK) + +Copyright (c) German Cancer Research Center, +Division of Medical and Biological Informatics. +All rights reserved. + +This software is distributed WITHOUT ANY WARRANTY; without +even the implied warranty of MERCHANTABILITY or FITNESS FOR +A PARTICULAR PURPOSE. + +See LICENSE.txt or http://www.mitk.org for details. + +===================================================================*/ var margin = { - top : 0, + top : 10, bottom : 50, left : 45, right : 20, }; var height = histogramData.height - margin.top - margin.bottom; var width = histogramData.width - margin.left - margin.right; var tension = 0.8; var connected = false; var dur = 1000; +var binSize = 0; // connecting signal from qt side with JavaScript method if (!connected) { connected = true; histogramData.DataChanged.connect(updateHistogram); } var xScale = d3.scale.linear() .domain([d3.min(histogramData.measurement),d3.max(histogramData.measurement)]) .range([0,width]); var yScale = d3.scale.linear() .domain([0,d3.max(histogramData.frequency)]) .range([height,margin.top]); var xAxis = d3.svg.axis() .scale(xScale) .orient("bottom"); var yAxis = d3.svg.axis() .scale(yScale) .orient("left"); -var zoombie = d3.behavior.zoom().x(xScale).y(yScale).scaleExtent([1, 10]).on("zoom", zoom); +var zoombie = d3.behavior.zoom().x(xScale).scaleExtent([1, 50]).on("zoom", zoom); var svg = d3.select("body") .append("svg") .attr("class", "svg") .attr("width", width + margin.right + margin.left) .attr("height", height + margin.top + margin.bottom) .append("g") .attr("transform", "translate (" + margin.left + "," + margin.top + ")") - .call(zoombie); - -var vis = svg.append("svg") - .attr("width", width) - .attr("height", height); + .call(zoombie) + .on("mousemove", myMouseMove); svg.append("rect") .attr("width", width + margin.left + margin.right) .attr("height", height + margin.top + margin.bottom) .attr("opacity", 0); +var vis = svg.append("svg") + .attr("width", width) + .attr("height", height); + updateHistogram(); // method to update and choose histogram function updateHistogram() { + calcBinSize(); + if (!histogramData.useLineGraph) { barChart(); } else if (histogramData.useLineGraph) { linePlot() } } +function calcBinSize() +{ + var min = d3.min(histogramData.measurement); + var max = d3.max(histogramData.measurement); + binSize = (max - min) / (histogramData.measurement.length); +} + // method to display histogram as barchart function barChart() { -// match scale to current data - xScale = d3.scale.linear() - .domain([d3.min(histogramData.measurement),d3.max(histogramData.measurement)]) - .range([0,width]); - - yScale = d3.scale.linear() - .domain([0,d3.max(histogramData.frequency)]) - .range([height,margin.top]); - - xAxis = d3.svg.axis() - .scale(xScale) - .ticks(5) - .orient("bottom"); - - yAxis = d3.svg.axis() - .scale(yScale) - .orient("left"); - - zoombie = d3.behavior.zoom().x(xScale).y(yScale).scaleExtent([1, 10]).on("zoom", zoom); + definition(); + zoombie = d3.behavior.zoom().x(xScale).scaleExtent([1, 50]).on("zoom", zoom); svg.call(zoombie); - var linenull = d3.svg.line() .interpolate("linear") .x(function(d,i) { return xScale(histogramData.measurement[i]); }) .y(function(d) { return yScale(0); }); // element to animate transition from linegraph to barchart vis.selectAll("path.line").transition().duration(dur).attr("d", linenull(histogramData.frequency)).remove(); var bar = vis.selectAll("rect.bar").data(histogramData.frequency); bar.enter().append("rect") .attr("class", "bar") - .on("mouseover", function (d) {d3.select(this).style('fill', "red");}) - .on("mouseout", function (d) {d3.select(this).style("fill", "steelblue");}) + .on("mouseover", myMouseOver) + .on("mouseout", myMouseOut) .attr("x", function(d,i) { return xScale(histogramData.measurement[i]); }) .attr("y", height) .attr("height", 0) .attr("width", barWidth) .transition().delay(dur).duration(dur*1.5) .attr("height", function(d) { return (height - yScale(d)); }) .attr("width", barWidth) .attr("y", function(d) { return yScale(d); }); bar.transition().delay(dur).duration(dur*1.5) .attr("x", function(d,i) { return xScale(histogramData.measurement[i]); }) .attr("y", function(d) { return yScale(d); }) .attr("height", function(d) { return (height - yScale(d)); }) - .attr("width", barWidth) + .attr("width", barWidth); bar.exit().transition().delay(dur).duration(dur*1.5) .attr("y", height) .attr("height", 0) .remove(); svg.selectAll("g") .transition() .duration(dur) .attr("opacity", 0) .remove(); svg.append("g") .attr("class", "x axis") .attr("transform", "translate(0," + height + ")") .transition().duration(dur) .attr("opacity", 100) .call(xAxis); svg.append("g") .attr("class", "y axis") .transition().duration(dur) .attr("opacity", 100) .call(yAxis); } // method to display histogram as linegraph function linePlot() { -// match scale to current data - xScale = d3.scale.linear() - .domain([d3.min(histogramData.measurement),d3.max(histogramData.measurement)]) - .range([0,width]); - - yScale = d3.scale.linear() - .domain([0,d3.max(histogramData.frequency)]) - .range([height,margin.top]); - - xAxis = d3.svg.axis() - .scale(xScale) - .ticks(5) - .orient("bottom"); - - yAxis = d3.svg.axis() - .scale(yScale) - .orient("left"); - - zoombie = d3.behavior.zoom().x(xScale).y(yScale).scaleExtent([1, 10]).on("zoom", zoom); + definition(); + zoombie = d3.behavior.zoom().x(xScale).y(yScale).scaleExtent([1, 50]).on("zoom", zoom); svg.call(zoombie); - // element to animate transition from barchart to linegraph vis.selectAll("rect.bar") .transition() .duration(dur) .attr("height", 0) .attr("fill", "black") .remove(); var line = d3.svg.line() .interpolate("cardinal") .x(function(d,i) { return xScale(histogramData.measurement[i]); }) .y(function(d) { return yScale(d); }) .tension(0.8); var linenull = d3.svg.line() .interpolate("cardinal") .x(function(d,i) { return xScale(histogramData.measurement[i]); }) .y(function(d) { return yScale(0); }) .tension(0.8); var graph = vis.selectAll("path.line").data([histogramData.frequency]); graph.enter() .append("path") .attr("class", "line") .attr("d", linenull) .transition() .duration(dur) .attr("d", line); graph.transition() .duration(dur) .attr("d", line); graph.exit().transition().duration(dur).attr("d", linenull); svg.selectAll("g") .transition() .duration(dur) .attr("opacity", 0) .remove(); svg.append("g") .attr("class", "x axis") .attr("transform", "translate(0," + height + ")") .transition().duration(dur) .attr("opacity", 100) .call(xAxis); svg.append("g") .attr("class", "y axis") .transition().duration(dur) .attr("opacity", 100) .call(yAxis); } +function definition() +{ +// match scale to current data + xScale = d3.scale.linear() + .domain([d3.min(histogramData.measurement),d3.max(histogramData.measurement)]) + .range([0,width]); + + yScale = d3.scale.linear() + .domain([0,d3.max(histogramData.frequency)]) + .range([height,margin.top]); + + xAxis = d3.svg.axis() + .scale(xScale) + .orient("bottom"); + + yAxis = d3.svg.axis() + .scale(yScale) + .orient("left"); +} + // method to ensure barwidth is not smaller than 1px -function barWidth() +function barWidth(d, i) { - var bw = width/histogramData.frequency.length - 1; - if (bw < 1) - { - bw = 1; - } + var bw; + bw =(xScale(histogramData.measurement[i + 1]) - xScale(histogramData.measurement[i])) * (histogramData.frequency.length / (histogramData.frequency.length + 1)) - 1; + bw = bw > 1 ? bw : 1; return bw; } +// zoom function, with plot focus by scale 1 and different zooming mode function zoom() { - if (zoombie.scale() == 1) { + if (zoombie.scale() == 1) + { zoombie.translate([0,0]); - //xScale.domain([d3.min(histogramData.measurement),d3.max(histogramData.measurement)]); - //yScale.domain([0,d3.max(histogramData.frequency)]); + xScale.domain([d3.min(histogramData.measurement),d3.max(histogramData.measurement)]); + yScale.domain([0,d3.max(histogramData.frequency)]); + } + if (!histogramData.useLineGraph) + { + svg.select(".x.axis").call(xAxis); + vis.selectAll(".bar") + .attr("width", barWidth) + .attr("x", function(d, i) { return xScale(histogramData.measurement[i])}); } - svg.select(".x.axis").call(xAxis); - svg.select(".y.axis").call(yAxis); - vis.selectAll(".bar").attr("transform", "translate(" + zoombie.translate() + ")scale(" + zoombie.scale() + ")"); - vis.selectAll("path.line").attr("transform", "translate(" + zoombie.translate() + ")scale(" + zoombie.scale() + ")"); + else + { + svg.select(".x.axis").call(xAxis); + svg.select(".y.axis").call(yAxis); + vis.selectAll("path.line").attr("transform", "translate(" + zoombie.translate() + ")scale(" + zoombie.scale() + ")").style("stroke-width", 1 / zoombie.scale()); + } +} + +// method to show infobox, while mouse is over a bin +function myMouseOver() +{ + var myBar = d3.select(this); + var reScale = d3.scale.linear() + .domain(xScale.range()) + .range(xScale.domain()); + var y = myBar.data(); + var x = reScale(myBar.attr("x")); + + myBar.style("fill", "red"); + d3.select(".infobox").style("display", "block"); + d3.select(".measurement").text("Greyvalue: " + (Math.round(x*100))/100 + " ... " + (Math.round((x+binSize)*100))/100); + d3.select(".frequency").text("Frequency: " + y); +} + +// hide infobox, when mouse not over a bin +function myMouseOut() +{ + var myBar = d3.select(this); + myBar.style("fill", "steelblue"); + d3.select(".infobox").style("display", "none"); +} + +// update mousecoordinates by mousemove +function myMouseMove() +{ + var infobox = d3.select(".infobox"); + var coords = d3.mouse(this); + infobox.style("left", coords[0] + 75 + "px"); + infobox.style("top", coords[1] + "px"); } diff --git a/Modules/QmitkExt/resources/QmitkResources.qrc b/Modules/QmitkExt/resources/QmitkResources.qrc index fe2dfcebfa..512b8e1678 100644 --- a/Modules/QmitkExt/resources/QmitkResources.qrc +++ b/Modules/QmitkExt/resources/QmitkResources.qrc @@ -1,22 +1,27 @@ Logo_mbiATdkfz_small.png cross.png QmitkStandardViewsDialogBar.xpm play.xpm stop.xpm logo_mint-medical.png Logo_mbiATdkfz_gross.png btnSetPoints.png btnAddPointSet.png btnMoveUp.png btnMoveDown.png btnRemovePoint.png btnSwapSets.png ModuleView.png Histogram.html Histogram.js Histogram.css d3.v2.js + exporting.js + highcharts.js + jquery-git.js + jquery-ui.js + HighChartsHistogram.js diff --git a/Modules/QmitkExt/resources/exporting.js b/Modules/QmitkExt/resources/exporting.js new file mode 100644 index 0000000000..6f7bc74299 --- /dev/null +++ b/Modules/QmitkExt/resources/exporting.js @@ -0,0 +1,23 @@ +/* + Highcharts JS v2.3.5 (2012-12-19) + Exporting module + + (c) 2010-2011 Torstein Hønsi + + License: www.highcharts.com/license +*/ +(function(e){function y(a){for(var b=a.length;b--;)typeof a[b]==="number"&&(a[b]=Math.round(a[b])-0.5);return a}var z=e.Chart,u=e.addEvent,B=e.removeEvent,j=e.createElement,v=e.discardElement,t=e.css,l=e.merge,k=e.each,o=e.extend,C=Math.max,i=document,D=window,E=e.isTouchDevice,A=e.Renderer.prototype.symbols,w=e.getOptions();o(w.lang,{downloadPNG:"Download PNG image",downloadJPEG:"Download JPEG image",downloadPDF:"Download PDF document",downloadSVG:"Download SVG vector image",exportButtonTitle:"Export to raster or vector image", +printButtonTitle:"Print the chart"});w.navigation={menuStyle:{border:"1px solid #A0A0A0",background:"#FFFFFF"},menuItemStyle:{padding:"0 5px",background:"none",color:"#303030",fontSize:E?"14px":"11px"},menuItemHoverStyle:{background:"#4572A5",color:"#FFFFFF"},buttonOptions:{align:"right",backgroundColor:{linearGradient:[0,0,0,20],stops:[[0.4,"#F7F7F7"],[0.6,"#E3E3E3"]]},borderColor:"#B0B0B0",borderRadius:3,borderWidth:1,height:20,hoverBorderColor:"#909090",hoverSymbolFill:"#81A7CF",hoverSymbolStroke:"#4572A5", +symbolFill:"#E0E0E0",symbolStroke:"#A0A0A0",symbolX:11.5,symbolY:10.5,verticalAlign:"top",width:24,y:10}};w.exporting={type:"image/png",url:"http://export.highcharts.com/",width:800,buttons:{exportButton:{symbol:"exportIcon",x:-10,symbolFill:"#A8BF77",hoverSymbolFill:"#768F3E",_id:"exportButton",_titleKey:"exportButtonTitle",menuItems:[{textKey:"downloadPNG",onclick:function(){this.exportChart()}},{textKey:"downloadJPEG",onclick:function(){this.exportChart({type:"image/jpeg"})}},{textKey:"downloadPDF", +onclick:function(){this.exportChart({type:"application/pdf"})}},{textKey:"downloadSVG",onclick:function(){this.exportChart({type:"image/svg+xml"})}}]},printButton:{symbol:"printIcon",x:-36,symbolFill:"#B5C9DF",hoverSymbolFill:"#779ABF",_id:"printButton",_titleKey:"printButtonTitle",onclick:function(){this.print()}}}};e.post=function(a,b){var c,d;d=j("form",{method:"post",action:a,enctype:"multipart/form-data"},{display:"none"},i.body);for(c in b)j("input",{type:"hidden",name:c,value:b[c]},null,d); +d.submit();v(d)};o(z.prototype,{getSVG:function(a){var b=this,c,d,f,g=l(b.options,a);if(!i.createElementNS)i.createElementNS=function(a,b){return i.createElement(b)};a=j("div",null,{position:"absolute",top:"-9999em",width:b.chartWidth+"px",height:b.chartHeight+"px"},i.body);o(g.chart,{renderTo:a,forExport:!0});g.exporting.enabled=!1;g.chart.plotBackgroundImage=null;g.series=[];k(b.series,function(a){f=l(a.options,{animation:!1,showCheckbox:!1,visible:a.visible});f.isInternal||g.series.push(f)});c= +new e.Chart(g);k(["xAxis","yAxis"],function(a){k(b[a],function(b,d){var f=c[a][d],g=b.getExtremes(),e=g.userMin,g=g.userMax;(e!==void 0||g!==void 0)&&f.setExtremes(e,g,!0,!1)})});d=c.container.innerHTML;g=null;c.destroy();v(a);d=d.replace(/zIndex="[^"]+"/g,"").replace(/isShadow="[^"]+"/g,"").replace(/symbolName="[^"]+"/g,"").replace(/jQuery[0-9]+="[^"]+"/g,"").replace(/isTracker="[^"]+"/g,"").replace(/url\([^#]+#/g,"url(#").replace(/").replace(/ /g,"� ").replace(//g,"").replace(//g,'xlink:href="$1"/>').replace(/id=([^" >]+)/g,'id="$1"').replace(/class=([^" ]+)/g,'class="$1"').replace(/ transform /g," ").replace(/:(path|rect)/g,"$1").replace(/style="([^"]+)"/g,function(a){return a.toLowerCase()});d=d.replace(/(url\(#highcharts-[0-9]+)"/g, +"$1").replace(/"/g,"'");d.match(/ xmlns="/g).length===2&&(d=d.replace(/xmlns="[^"]+"/,""));return d},exportChart:function(a,b){var c=this.options.exporting,d=this.getSVG(l(c.chartOptions,b)),a=l(c,a);e.post(a.url,{filename:a.filename||"chart",type:a.type,width:a.width,scale:a.scale||2,svg:d})},print:function(){var a=this,b=a.container,c=[],d=b.parentNode,f=i.body,g=f.childNodes;if(!a.isPrinting)a.isPrinting=!0,k(g,function(a,b){if(a.nodeType===1)c[b]=a.style.display,a.style.display="none"}), +f.appendChild(b),D.print(),setTimeout(function(){d.appendChild(b);k(g,function(a,b){if(a.nodeType===1)a.style.display=c[b]});a.isPrinting=!1},1E3)},contextMenu:function(a,b,c,d,f,g){var e=this,p=e.options.navigation,i=p.menuItemStyle,q=e.chartWidth,r=e.chartHeight,s="cache-"+a,h=e[s],m=C(f,g),x,n,l;if(!h)e[s]=h=j("div",{className:"highcharts-"+a},{position:"absolute",zIndex:1E3,padding:m+"px"},e.container),x=j("div",null,o({MozBoxShadow:"3px 3px 10px #888",WebkitBoxShadow:"3px 3px 10px #888",boxShadow:"3px 3px 10px #888"}, +p.menuStyle),h),n=function(){t(h,{display:"none"})},u(h,"mouseleave",function(){l=setTimeout(n,500)}),u(h,"mouseenter",function(){clearTimeout(l)}),k(b,function(a){if(a){var b=j("div",{onmouseover:function(){t(this,p.menuItemHoverStyle)},onmouseout:function(){t(this,i)},innerHTML:a.text||e.options.lang[a.textKey]},o({cursor:"pointer"},i),x);b.onclick=function(){n();a.onclick.apply(e,arguments)};e.exportDivElements.push(b)}}),e.exportDivElements.push(x,h),e.exportMenuWidth=h.offsetWidth,e.exportMenuHeight= +h.offsetHeight;a={display:"block"};c+e.exportMenuWidth>q?a.right=q-c-f-m+"px":a.left=c-m+"px";d+g+e.exportMenuHeight>r?a.bottom=r-d-m+"px":a.top=d+g-m+"px";t(h,a)},addButton:function(a){function b(){r.attr(k);q.attr(m)}var c=this,d=c.renderer,f=l(c.options.navigation.buttonOptions,a),e=f.onclick,i=f.menuItems,p=f.width,j=f.height,q,r,s,h,a=f.borderWidth,m={stroke:f.borderColor},k={stroke:f.symbolStroke,fill:f.symbolFill},n=f.symbolSize||12;if(!c.btnCount)c.btnCount=0;h=c.btnCount++;if(!c.exportDivElements)c.exportDivElements= +[],c.exportSVGElements=[];f.enabled!==!1&&(q=d.rect(0,0,p,j,f.borderRadius,a).align(f,!0).attr(o({fill:f.backgroundColor,"stroke-width":a,zIndex:19},m)).add(),s=d.rect(0,0,p,j,0).align(f).attr({id:f._id,fill:"rgba(255, 255, 255, 0.001)",title:c.options.lang[f._titleKey],zIndex:21}).css({cursor:"pointer"}).on("mouseover",function(){r.attr({stroke:f.hoverSymbolStroke,fill:f.hoverSymbolFill});q.attr({stroke:f.hoverBorderColor})}).on("mouseout",b).on("click",b).add(),i&&(e=function(){b();var a=s.getBBox(); +c.contextMenu("menu"+h,i,a.x,a.y,p,j)}),s.on("click",function(){e.apply(c,arguments)}),r=d.symbol(f.symbol,f.symbolX-n/2,f.symbolY-n/2,n,n).align(f,!0).attr(o(k,{"stroke-width":f.symbolStrokeWidth||1,zIndex:20})).add(),c.exportSVGElements.push(q,s,r))},destroyExport:function(){var a,b;for(a=0;a-1?b.split(".")[1].length:0):a=isNaN(b=M(b))?2:b;var b=a,c=c===void 0?e.decimalPoint:c,d=d===void 0?e.thousandsSep:d,e=f<0?"-":"",a=String(z(f=M(+f||0).toFixed(b))),g=a.length>3?a.length%3:0;return e+(g?a.substr(0,g)+d:"")+a.substr(g).replace(/(\d{3})(?=\d)/g, +"$1"+d)+(b?c+M(f-a).toFixed(b).slice(2):"")}function ua(a,b){return Array((b||2)+1-String(a).length).join(0)+a}function hb(a,b,c,d){var e,c=n(c,1);e=a/c;b||(b=[1,2,2.5,5,10],d&&d.allowDecimals===!1&&(c===1?b=[1,2,5,10]:c<=0.1&&(b=[1/c])));for(d=0;d=D[ib]&&(i.setMilliseconds(0),i.setSeconds(j>=D[Va]?0:k*U(i.getSeconds()/k)));if(j>=D[Va])i[Db](j>=D[Ka]?0:k*U(i[jb]()/k));if(j>=D[Ka])i[Eb](j>=D[ma]? +0:k*U(i[kb]()/k));if(j>=D[ma])i[lb](j>=D[La]?1:k*U(i[Ma]()/k));j>=D[La]&&(i[Fb](j>=D[va]?0:k*U(i[Xa]()/k)),h=i[Ya]());j>=D[va]&&(h-=h%k,i[Gb](h));if(j===D[Wa])i[lb](i[Ma]()-i[mb]()+n(d,1));b=1;h=i[Ya]();for(var d=i.getTime(),l=i[Xa](),m=i[Ma](),i=g?0:(864E5+i.getTimezoneOffset()*6E4)%864E5;dc&&(c=a[b]);return c}function Ga(a,b){for(var c in a)a[c]&&a[c]!==b&&a[c].destroy&&a[c].destroy(),delete a[c]}function Na(a){$a||($a=T(ga));a&&$a.appendChild(a);$a.innerHTML= +""}function Oa(a,b){var c="Highcharts error #"+a+": www.highcharts.com/errors/"+a;if(b)throw c;else L.console&&console.log(c)}function da(a){return parseFloat(a.toPrecision(14))}function xa(a,b){Pa=n(a,b.animation)}function Jb(){var a=N.global.useUTC,b=a?"getUTC":"get",c=a?"setUTC":"set";Za=a?Date.UTC:function(a,b,c,g,h,i){return(new Date(a,b,n(c,1),n(g,0),n(h,0),n(i,0))).getTime()};jb=b+"Minutes";kb=b+"Hours";mb=b+"Day";Ma=b+"Date";Xa=b+"Month";Ya=b+"FullYear";Db=c+"Minutes";Eb=c+"Hours";lb=c+"Date"; +Fb=c+"Month";Gb=c+"FullYear"}function ya(){}function Qa(a,b,c){this.axis=a;this.pos=b;this.type=c||"";this.isNew=!0;c||this.addLabel()}function nb(a,b){this.axis=a;if(b)this.options=b,this.id=b.id;return this}function Kb(a,b,c,d,e,f){var g=a.chart.inverted;this.axis=a;this.isNegative=c;this.options=b;this.x=d;this.stack=e;this.percent=f==="percent";this.alignOptions={align:b.align||(g?c?"left":"right":"center"),verticalAlign:b.verticalAlign||(g?"middle":c?"bottom":"top"),y:n(b.y,g?4:c?14:-6),x:n(b.x, +g?c?-6:6:0)};this.textAlign=b.textAlign||(g?c?"right":"left":"center")}function ob(){this.init.apply(this,arguments)}function pb(a,b){var c=b.borderWidth,d=b.style,e=z(d.padding);this.chart=a;this.options=b;this.crosshairs=[];this.now={x:0,y:0};this.isHidden=!0;this.label=a.renderer.label("",0,0,b.shape,null,null,b.useHTML,null,"tooltip").attr({padding:e,fill:b.backgroundColor,"stroke-width":c,r:b.borderRadius,zIndex:8}).css(d).css({padding:0}).hide().add();V||this.label.shadow(b.shadow);this.shared= +b.shared}function qb(a,b){var c=V?"":b.chart.zoomType;this.zoomX=/x/.test(c);this.zoomY=/y/.test(c);this.options=b;this.chart=a;this.init(a,b.tooltip)}function rb(a){this.init(a)}function sb(){this.init.apply(this,arguments)}var A,C=document,L=window,K=Math,u=K.round,U=K.floor,za=K.ceil,s=K.max,O=K.min,M=K.abs,W=K.cos,Z=K.sin,Aa=K.PI,ab=Aa*2/360,na=navigator.userAgent,Lb=L.opera,Ea=/msie/i.test(na)&&!Lb,Ra=C.documentMode===8,bb=/AppleWebKit/.test(na),cb=/Firefox/.test(na),Mb=/(Mobile|Android|Windows Phone)/.test(na), +oa="http://www.w3.org/2000/svg",ca=!!C.createElementNS&&!!C.createElementNS(oa,"svg").createSVGRect,Sb=cb&&parseInt(na.split("Firefox/")[1],10)<4,V=!ca&&!Ea&&!!C.createElement("canvas").getContext,Sa,Ba=C.documentElement.ontouchstart!==A,Nb={},tb=0,$a,N,db,Pa,ub,D,pa=function(){},Ha=[],ga="div",Q="none",vb="rgba(192,192,192,"+(ca?1.0E-4:0.002)+")",Bb="millisecond",ib="second",Va="minute",Ka="hour",ma="day",Wa="week",La="month",va="year",wb="stroke-width",Za,jb,kb,mb,Ma,Xa,Ya,Db,Eb,lb,Fb,Gb,$={};L.Highcharts= +{};db=function(a,b,c){if(!r(b)||isNaN(b))return"Invalid date";var a=n(a,"%Y-%m-%d %H:%M:%S"),d=new Date(b),e,f=d[kb](),g=d[mb](),h=d[Ma](),i=d[Xa](),j=d[Ya](),k=N.lang,l=k.weekdays,b={a:l[g].substr(0,3),A:l[g],d:ua(h),e:h,b:k.shortMonths[i],B:k.months[i],m:ua(i+1),y:j.toString().substr(2,2),Y:j,H:ua(f),I:ua(f%12||12),l:f%12||12,M:ua(d[jb]()),p:f<12?"AM":"PM",P:f<12?"am":"pm",S:ua(d.getSeconds()),L:ua(u(b%1E3),3)};for(e in b)for(;a.indexOf("%"+e)!==-1;)a=a.replace("%"+e,b[e]);return c?a.substr(0,1).toUpperCase()+ +a.substr(1):a};Hb.prototype={wrapColor:function(a){if(this.color>=a)this.color=0},wrapSymbol:function(a){if(this.symbol>=a)this.symbol=0}};D=ia(Bb,1,ib,1E3,Va,6E4,Ka,36E5,ma,864E5,Wa,6048E5,La,26784E5,va,31556952E3);ub={init:function(a,b,c){var b=b||"",d=a.shift,e=b.indexOf("C")>-1,f=e?7:3,g,b=b.split(" "),c=[].concat(c),h,i,j=function(a){for(g=a.length;g--;)a[g]==="M"&&a.splice(g+1,0,a[g+1],a[g+2],a[g+1],a[g+2])};e&&(j(b),j(c));a.isArea&&(h=b.splice(b.length-6,6),i=c.splice(c.length-6,6));if(d<= +c.length/f)for(;d--;)c=[].concat(c).splice(0,f).concat(c);a.shift=0;if(b.length)for(a=c.length;b.length{point.key}
',pointFormat:'{series.name}: {point.y}
',shadow:!0,shared:V,snap:Mb?25:10,style:{color:"#333333",fontSize:"12px",padding:"5px",whiteSpace:"nowrap"}},credits:{enabled:!0, +text:"Highcharts.com",href:"http://www.highcharts.com",position:{align:"right",x:-10,verticalAlign:"bottom",y:-5},style:{cursor:"pointer",color:"#909090",fontSize:"10px"}}};var X=N.plotOptions,ea=X.line;Jb();var qa=function(a){var b=[],c;(function(a){(c=/rgba$\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]?(?:\.[0-9]+)?)\s*$/.exec(a))?b=[z(c[1]),z(c[2]),z(c[3]),parseFloat(c[4],10)]:(c=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(a))&&(b=[z(c[1],16),z(c[2],16),z(c[3], +16),1])})(a);return{get:function(c){return b&&!isNaN(b[0])?c==="rgb"?"rgb("+b[0]+","+b[1]+","+b[2]+")":c==="a"?b[3]:"rgba("+b.join(",")+")":a},brighten:function(a){if(Da(a)&&a!==0){var c;for(c=0;c<3;c++)b[c]+=z(a*255),b[c]<0&&(b[c]=0),b[c]>255&&(b[c]=255)}return this},setOpacity:function(a){b[3]=a;return this}}};ya.prototype={init:function(a,b){this.element=b==="span"?T(b):C.createElementNS(oa,b);this.renderer=a;this.attrSetters={}},animate:function(a,b,c){b=n(b,Pa,!0);fb(this);if(b){b=B(b);if(c)b.complete= +c;xb(this,a,b)}else this.attr(a),c&&c()},attr:function(a,b){var c,d,e,f,g=this.element,h=g.nodeName.toLowerCase(),i=this.renderer,j,k=this.attrSetters,l=this.shadows,m,q,p=this;ja(a)&&r(b)&&(c=a,a={},a[c]=b);if(ja(a))c=a,h==="circle"?c={x:"cx",y:"cy"}[c]||c:c==="strokeWidth"&&(c="stroke-width"),p=w(g,c)||this[c]||0,c!=="d"&&c!=="visibility"&&(p=parseFloat(p));else for(c in a)if(j=!1,d=a[c],e=k[c]&&k[c].call(this,d,c),e!==!1){e!==A&&(d=e);if(c==="d")d&&d.join&&(d=d.join(" ")),/(NaN| {2}|^$)/.test(d)&& +(d="M 0 0");else if(c==="x"&&h==="text"){for(e=0;em&&/[ \-]/.test(b.textContent||b.innerText))I(b,{width:m+"px",display:"block",whiteSpace:"normal"}),k=m;m=a.fontMetrics(b.style.fontSize).b;t= +p<0&&-k;H=q<0&&-l;y=p*q<0;t+=q*m*(y?1-h:h);H-=p*m*(j?y?h:1-h:1);i&&(t-=k*h*(p<0?-1:1),j&&(H-=l*h*(q<0?-1:1)),I(b,{textAlign:g}));this.xCorr=t;this.yCorr=H}I(b,{left:e+t+"px",top:f+H+"px"});if(bb)l=b.offsetHeight;this.cTT=ra}}else this.alignOnAdd=!0},updateTransform:function(){var a=this.translateX||0,b=this.translateY||0,c=this.inverted,d=this.rotation,e=[];c&&(a+=this.attr("width"),b+=this.attr("height"));(a||b)&&e.push("translate("+a+","+b+")");c?e.push("rotate(90) scale(-1,1)"):d&&e.push("rotate("+ +d+" "+(this.x||0)+" "+(this.y||0)+")");e.length&&w(this.element,"transform",e.join(" "))},toFront:function(){var a=this.element;a.parentNode.appendChild(a);return this},align:function(a,b,c){a?(this.alignOptions=a,this.alignByTranslate=b,c||this.renderer.alignedObjects.push(this)):(a=this.alignOptions,b=this.alignByTranslate);var c=n(c,this.renderer),d=a.align,e=a.verticalAlign,f=(c.x||0)+(a.x||0),g=(c.y||0)+(a.y||0),h={};if(d==="right"||d==="center")f+=(c.width-(a.width||0))/{right:1,center:2}[d]; +h[b?"translateX":"x"]=u(f);if(e==="bottom"||e==="middle")g+=(c.height-(a.height||0))/({bottom:1,middle:2}[e]||1);h[b?"translateY":"y"]=u(g);this[this.placed?"animate":"attr"](h);this.placed=!0;this.alignAttr=h;return this},getBBox:function(){var a=this.bBox,b=this.renderer,c,d=this.rotation;c=this.element;var e=this.styles,f=d*ab;if(!a){if(c.namespaceURI===oa||b.forExport){try{a=c.getBBox?x({},c.getBBox()):{width:c.offsetWidth,height:c.offsetHeight}}catch(g){}if(!a||a.width<0)a={width:0,height:0}}else a= +this.htmlGetBBox();if(b.isSVG){b=a.width;c=a.height;if(Ea&&e&&e.fontSize==="11px"&&c===22.700000762939453)a.height=c=14;if(d)a.width=M(c*Z(f))+M(b*W(f)),a.height=M(c*W(f))+M(b*Z(f))}this.bBox=a}return a},show:function(){return this.attr({visibility:"visible"})},hide:function(){return this.attr({visibility:"hidden"})},add:function(a){var b=this.renderer,c=a||b,d=c.element||b.box,e=d.childNodes,f=this.element,g=w(f,"zIndex"),h;if(a)this.parentGroup=a;this.parentInverted=a&&a.inverted;this.textStr!== +void 0&&b.buildText(this);if(g)c.handleZ=!0,g=z(g);if(c.handleZ)for(c=0;cg||!r(g)&&r(b))){d.insertBefore(f,a);h=!0;break}h||d.appendChild(f);this.added=!0;F(this,"add");return this},safeRemoveChild:function(a){var b=a.parentNode;b&&b.removeChild(a)},destroy:function(){var a=this,b=a.element||{},c=a.shadows,d,e;b.onclick=b.onmouseout=b.onmouseover=b.onmousemove=null;fb(a);if(a.clipPath)a.clipPath=a.clipPath.destroy();if(a.stops){for(e=0;e/g,'').replace(/<(i|em)>/g,'').replace(//g,"").split(//g),d=b.childNodes,e=/style="([^"]+)"/,f=/href="([^"]+)"/,g=w(b,"x"),h=a.styles,i=h&&h.width&&z(h.width),j=h&&h.lineHeight,k,h=d.length,l=[];h--;)b.removeChild(d[h]);i&&!a.added&&this.box.appendChild(b);c[c.length-1]===""&&c.pop();o(c,function(c,d){var h,y=0,t,c=c.replace(//g,"|||");h=c.split("|||");o(h,function(c){if(c!==""||h.length===1){var m={},n=C.createElementNS(oa,"tspan"),o;e.test(c)&& +(o=c.match(e)[1].replace(/(;| |^)color([ :])/,"$1fill$2"),w(n,"style",o));f.test(c)&&(w(n,"onclick",'location.href="'+c.match(f)[1]+'"'),I(n,{cursor:"pointer"}));c=(c.replace(/<(.|\n)*?>/g,"")||" ").replace(/</g,"<").replace(/>/g,">");n.appendChild(C.createTextNode(c));y?m.dx=3:m.x=g;if(!y){if(d){!ca&&a.renderer.forExport&&I(n,{display:"block"});t=L.getComputedStyle&&z(L.getComputedStyle(k,null).getPropertyValue("line-height"));if(!t||isNaN(t)){var r;if(!(r=j))if(!(r=k.offsetHeight))l[d]=b.getBBox? +b.getBBox().height:a.renderer.fontMetrics(b.style.fontSize).h,r=u(l[d]-(l[d-1]||0))||18;t=r}w(n,"dy",t)}k=n}w(n,m);b.appendChild(n);y++;if(i)for(var c=c.replace(/([^\^])-/g,"$1- ").split(" "),E=[];c.length||E.length;)delete a.bBox,r=a.getBBox().width,m=r>i,!m||c.length===1?(c=E,E=[],c.length&&(n=C.createElementNS(oa,"tspan"),w(n,{dy:j||16,x:g}),o&&w(n,"style",o),b.appendChild(n),r>i&&(i=r))):(n.removeChild(n.firstChild),E.unshift(c.pop())),c.length&&n.appendChild(C.createTextNode(c.join(" ").replace(/- /g, +"-")))}})})},button:function(a,b,c,d,e,f,g){var h=this.label(a,b,c),i=0,j,k,l,m,q,a={x1:0,y1:0,x2:0,y2:1},e=B(ia(wb,1,"stroke","#999","fill",ia("linearGradient",a,"stops",[[0,"#FFF"],[1,"#DDD"]]),"r",3,"padding",3,"style",ia("color","black")),e);l=e.style;delete e.style;f=B(e,ia("stroke","#68A","fill",ia("linearGradient",a,"stops",[[0,"#FFF"],[1,"#ACF"]])),f);m=f.style;delete f.style;g=B(e,ia("stroke","#68A","fill",ia("linearGradient",a,"stops",[[0,"#9BD"],[1,"#CDF"]])),g);q=g.style;delete g.style; +J(h.element,"mouseenter",function(){h.attr(f).css(m)});J(h.element,"mouseleave",function(){j=[e,f,g][i];k=[l,m,q][i];h.attr(j).css(k)});h.setState=function(a){(i=a)?a===2&&h.attr(g).css(q):h.attr(e).css(l)};return h.on("click",function(){d.call(h)}).attr(e).css(x({cursor:"default"},l))},crispLine:function(a,b){a[1]===a[4]&&(a[1]=a[4]=u(a[1])-b%2/2);a[2]===a[5]&&(a[2]=a[5]=u(a[2])+b%2/2);return a},path:function(a){var b={fill:Q};Ia(a)?b.d=a:Y(a)&&x(b,a);return this.createElement("path").attr(b)},circle:function(a, +b,c){a=Y(a)?a:{x:a,y:b,r:c};return this.createElement("circle").attr(a)},arc:function(a,b,c,d,e,f){if(Y(a))b=a.y,c=a.r,d=a.innerR,e=a.start,f=a.end,a=a.x;return this.symbol("arc",a||0,b||0,c||0,c||0,{innerR:d||0,start:e||0,end:f||0})},rect:function(a,b,c,d,e,f){e=Y(a)?a.r:e;e=this.createElement("rect").attr({rx:e,ry:e,fill:Q});return e.attr(Y(a)?a:e.crisp(f,a,b,s(c,0),s(d,0)))},setSize:function(a,b,c){var d=this.alignedObjects,e=d.length;this.width=a;this.height=b;for(this.boxWrapper[n(c,!0)?"animate": +"attr"]({width:a,height:b});e--;)d[e].align()},g:function(a){var b=this.createElement("g");return r(a)?b.attr({"class":"highcharts-"+a}):b},image:function(a,b,c,d,e){var f={preserveAspectRatio:Q};arguments.length>1&&x(f,{x:b,y:c,width:d,height:e});f=this.createElement("image").attr(f);f.element.setAttributeNS?f.element.setAttributeNS("http://www.w3.org/1999/xlink","href",a):f.element.setAttribute("hc-svg-href",a);return f},symbol:function(a,b,c,d,e,f){var g,h=this.symbols[a],h=h&&h(u(b),u(c),d,e, +f),i=/^url$(.*?)$$/,j,k;h?(g=this.path(h),x(g,{symbolName:a,x:b,y:c,width:d,height:e}),f&&x(g,f)):i.test(a)&&(k=function(a,b){a.element&&(a.attr({width:b[0],height:b[1]}),a.alignByTranslate||a.translate(u((d-b[0])/2),u((e-b[1])/2)))},j=a.match(i)[1],a=Nb[j],g=this.image(j).attr({x:b,y:c}),a?k(g,a):(g.attr({width:0,height:0}),T("img",{onload:function(){k(g,Nb[j]=[this.width,this.height])},src:j})));return g},symbols:{circle:function(a,b,c,d){var e=0.166*c;return["M",a+c/2,b,"C",a+c+e,b,a+c+e,b+d, +a+c/2,b+d,"C",a-e,b+d,a-e,b,a+c/2,b,"Z"]},square:function(a,b,c,d){return["M",a,b,"L",a+c,b,a+c,b+d,a,b+d,"Z"]},triangle:function(a,b,c,d){return["M",a+c/2,b,"L",a+c,b+d,a,b+d,"Z"]},"triangle-down":function(a,b,c,d){return["M",a,b,"L",a+c,b,a+c/2,b+d,"Z"]},diamond:function(a,b,c,d){return["M",a+c/2,b,"L",a+c,b+d/2,a+c/2,b+d,a,b+d/2,"Z"]},arc:function(a,b,c,d,e){var f=e.start,c=e.r||c||d,g=e.end-1.0E-6,d=e.innerR,h=e.open,i=W(f),j=Z(f),k=W(g),g=Z(g),e=e.end-f');if(b)c=b===ga||b==="span"||b==="img"?c.join(""):a.prepVML(c),this.element=T(c);this.renderer=a;this.attrSetters={}},add:function(a){var b=this.renderer,c=this.element,d=b.box,d=a?a.element||a:d;a&&a.inverted&&b.invertChild(c,d);d.appendChild(c);this.added=!0;this.alignOnAdd&&!this.deferUpdateTransform&&this.updateTransform();F(this,"add");return this}, +updateTransform:ya.prototype.htmlUpdateTransform,attr:function(a,b){var c,d,e,f=this.element||{},g=f.style,h=f.nodeName,i=this.renderer,j=this.symbolName,k,l=this.shadows,m,q=this.attrSetters,p=this;ja(a)&&r(b)&&(c=a,a={},a[c]=b);if(ja(a))c=a,p=c==="strokeWidth"||c==="stroke-width"?this.strokeweight:this[c];else for(c in a)if(d=a[c],m=!1,e=q[c]&&q[c].call(this,d,c),e!==!1&&d!==null){e!==A&&(d=e);if(j&&/^(x|y|r|start|end|width|height|innerR|anchorX|anchorY)/.test(c))k||(this.symbolAttr(a),k=!0),m= +!0;else if(c==="d"){d=d||[];this.d=d.join(" ");e=d.length;for(m=[];e--;)m[e]=Da(d[e])?u(d[e]*10)-5:d[e]==="Z"?"x":d[e];d=m.join(" ")||"x";f.path=d;if(l)for(e=l.length;e--;)l[e].path=l[e].cutOff?this.cutOffPath(d,l[e].cutOff):d;m=!0}else if(c==="visibility"){if(l)for(e=l.length;e--;)l[e].style[c]=d;h==="DIV"&&(d=d==="hidden"?"-999em":0,c="top");g[c]=d;m=!0}else if(c==="zIndex")d&&(g[c]=d),m=!0;else if(c==="width"||c==="height")d=s(0,d),this[c]=d,this.updateClipping?(this[c]=d,this.updateClipping()): +g[c]=d,m=!0;else if(c==="x"||c==="y")this[c]=d,g[{x:"left",y:"top"}[c]]=d;else if(c==="class")f.className=d;else if(c==="stroke")d=i.color(d,f,c),c="strokecolor";else if(c==="stroke-width"||c==="strokeWidth")f.stroked=d?!0:!1,c="strokeweight",this[c]=d,Da(d)&&(d+="px");else if(c==="dashstyle")(f.getElementsByTagName("stroke")[0]||T(i.prepVML([""]),null,null,f))[c]=d||"solid",this.dashstyle=d,m=!0;else if(c==="fill")if(h==="SPAN")g.color=d;else{if(h!=="IMG")f.filled=d!==Q?!0:!1,d=i.color(d, +f,c,this),c="fillcolor"}else if(h==="shape"&&c==="rotation")this[c]=d,f.style.left=-u(Z(d*ab)+1)+"px",f.style.top=u(W(d*ab))+"px";else if(c==="translateX"||c==="translateY"||c==="rotation")this[c]=d,this.updateTransform(),m=!0;else if(c==="text")this.bBox=null,f.innerHTML=d,m=!0;m||(Ra?f[c]=d:w(f,c,d))}return p},clip:function(a){var b=this,c,d=b.element,e=d.parentNode;a?(c=a.members,ta(c,b),c.push(b),b.destroyClip=function(){ta(c,b)},e&&e.className==="highcharts-tracker"&&!Ra&&I(d,{visibility:"hidden"}), +a=a.getCSS(b)):(b.destroyClip&&b.destroyClip(),a={clip:Ra?"inherit":"rect(auto)"});return b.css(a)},css:ya.prototype.htmlCss,safeRemoveChild:function(a){a.parentNode&&Na(a)},destroy:function(){this.destroyClip&&this.destroyClip();return ya.prototype.destroy.apply(this)},empty:function(){for(var a=this.element.childNodes,b=a.length,c;b--;)c=a[b],c.parentNode.removeChild(c)},on:function(a,b){this.element["on"+a]=function(){var a=L.event;a.target=a.srcElement;b(a)};return this},cutOffPath:function(a, +b){var c,a=a.split(/[ ,]/);c=a.length;if(c===9||c===11)a[c-4]=a[c-2]=z(a[c-2])-10*b;return a.join(" ")},shadow:function(a,b,c){var d=[],e,f=this.element,g=this.renderer,h,i=f.style,j,k=f.path,l,m,q,p;k&&typeof k.value!=="string"&&(k="x");m=k;if(a){q=n(a.width,3);p=(a.opacity||0.15)/q;for(e=1;e<=3;e++){l=q*2+1-2*e;c&&(m=this.cutOffPath(k.value,l+0.5));j=[''];h=T(g.prepVML(j),null, +{left:z(i.left)+n(a.offsetX,1),top:z(i.top)+n(a.offsetY,1)});if(c)h.cutOff=l+1;j=[''];T(g.prepVML(j),null,null,h);b?b.element.appendChild(h):f.parentNode.insertBefore(h,f);d.push(h)}this.shadows=d}return this}};ha=ba(ya,ha);var fa={Element:ha,isIE8:na.indexOf("MSIE 8.0")>-1,init:function(a,b,c){var d,e;this.alignedObjects=[];d=this.createElement(ga);e=d.element;e.style.position="relative";a.appendChild(d.element);this.box=e;this.boxWrapper=d; +this.setSize(b,c,!1);if(!C.namespaces.hcv)C.namespaces.add("hcv","urn:schemas-microsoft-com:vml"),C.createStyleSheet().cssText="hcv\\:fill, hcv\\:path, hcv\\:shape, hcv\\:stroke{ behavior:url(#default#VML); display: inline-block; } "},isHidden:function(){return!this.box.offsetWidth},clipRect:function(a,b,c,d){var e=this.createElement(),f=Y(a);return x(e,{members:[],left:f?a.x:a,top:f?a.y:b,width:f?a.width:c,height:f?a.height:d,getCSS:function(a){var b=a.inverted,c=this.top,d=this.left,e=d+this.width, +f=c+this.height,c={clip:"rect("+u(b?d:c)+"px,"+u(b?f:e)+"px,"+u(b?e:f)+"px,"+u(b?c:d)+"px)"};!b&&Ra&&a.element.nodeName!=="IMG"&&x(c,{width:e+"px",height:f+"px"});return c},updateClipping:function(){o(e.members,function(a){a.css(e.getCSS(a))})}})},color:function(a,b,c,d){var e=this,f,g=/^rgba/,h,i,j=Q;a&&a.linearGradient?i="gradient":a&&a.radialGradient&&(i="pattern");if(i){var k,l,m=a.linearGradient||a.radialGradient,q,p,n,t,H,r="",a=a.stops,v,s=[],u=function(){h=[''];T(e.prepVML(h),null,null,b)};q=a[0];v=a[a.length-1];q[0]>0&&a.unshift([0,q[1]]);v[0]<1&&a.push([1,v[1]]);o(a,function(a,b){g.test(a[1])?(f=qa(a[1]),k=f.get("rgb"),l=f.get("a")):(k=a[1],l=1);s.push(a[0]*100+"% "+k);b?(n=l,t=k):(p=l,H=k)});if(c==="fill")if(i==="gradient")c=m.x1||m[0]||0,a=m.y1||m[1]||0,q=m.x2||m[2]||0,m=m.y2||m[3]||0,r='angle="'+(90-K.atan((m-a)/(q-c))*180/Aa)+'"',u();else{var j=m.r,E=j*2,S=j*2,x=m.cx,A=m.cy,w= +b.radialReference,z,j=function(){w&&(z=d.getBBox(),x+=(w[0]-z.x)/z.width-0.5,A+=(w[1]-z.y)/z.height-0.5,E*=w[2]/z.width,S*=w[2]/z.height);r='src="'+N.global.VMLRadialGradientURL+'" size="'+E+","+S+'" origin="0.5,0.5" position="'+x+","+A+'" color2="'+H+'" ';u()};d.added?j():J(d,"add",j);j=t}else j=k}else if(g.test(a)&&b.tagName!=="IMG")f=qa(a),h=["<",c,' opacity="',f.get("a"),'"/>'],T(this.prepVML(h),null,null,b),j=f.get("rgb");else{j=b.getElementsByTagName(c);if(j.length)j[0].opacity=1;j=a}return j}, +prepVML:function(a){var b=this.isIE8,a=a.join("");b?(a=a.replace("/>",' xmlns="urn:schemas-microsoft-com:vml" />'),a=a.indexOf('style="')===-1?a.replace("/>",' style="display:inline-block;behavior:url(#default#VML);" />'):a.replace('style="','style="display:inline-block;behavior:url(#default#VML);')):a=a.replace("<","1&&f.attr({x:b,y:c,width:d,height:e});return f},rect:function(a,b,c,d,e,f){if(Y(a))b=a.y,c=a.width,d=a.height,f=a.strokeWidth,a=a.x;var g=this.symbol("rect");g.r=e;return g.attr(g.crisp(f,a,b,s(c,0),s(d,0)))},invertChild:function(a,b){var c=b.style;I(a,{flip:"x", +left:z(c.width)-1,top:z(c.height)-1,rotation:-90})},symbols:{arc:function(a,b,c,d,e){var f=e.start,g=e.end,h=e.r||c||d,c=W(f),d=Z(f),i=W(g),j=Z(g),k=e.innerR,l=0.08/h,m=k&&0.1/k||0;if(g-f===0)return["x"];else 2*Aa-g+fj&&(c=!1)):h+k>m&&(h=m-k,d&&h+l0&&b.height>0){f=B({align:c&&k&&"center",x:c?!k&&4:10,verticalAlign:!c&&k&&"middle",y:c?k?16:10:k?6:-4,rotation:c&&!k&&90},f);if(!g)a.label=g=v.text(f.text,0,0).attr({align:f.textAlign||f.align,rotation:f.rotation,zIndex:o}).css(f.style).add();b=[p[1],p[4],n(p[6],p[1])];p=[p[2],p[5],n(p[7],p[2])];c=Fa(b);k=Fa(p);g.align(f,!1,{x:c,y:k,width:wa(b)-c,height:wa(p)-k});g.show()}else g&&g.hide();return a},destroy:function(){ta(this.axis.plotLinesAndBands, +this);Ga(this,this.axis)}};Kb.prototype={destroy:function(){Ga(this,this.axis)},setTotal:function(a){this.cum=this.total=a},render:function(a){var b=this.options.formatter.call(this);this.label?this.label.attr({text:b,visibility:"hidden"}):this.label=this.axis.chart.renderer.text(b,0,0).css(this.options.style).attr({align:this.textAlign,rotation:this.options.rotation,visibility:"hidden"}).add(a)},setOffset:function(a,b){var c=this.axis,d=c.chart,e=d.inverted,f=this.isNegative,g=c.translate(this.percent? +100:this.total,0,0,0,1),c=c.translate(0),c=M(g-c),h=d.xAxis[0].translate(this.x)+a,i=d.plotHeight,f={x:e?f?g:g-c:h,y:e?i-h-b:f?i-g-c:i-g,width:e?c:b,height:e?b:c};if(e=this.label)e.align(this.alignOptions,null,f),f=e.alignAttr,e.attr({visibility:this.options.crop===!1||d.isInsidePlot(f.x,f.y)?ca?"inherit":"visible":"hidden"})}};ob.prototype={defaultOptions:{dateTimeLabelFormats:{millisecond:"%H:%M:%S.%L",second:"%H:%M:%S",minute:"%H:%M",hour:"%H:%M",day:"%e. %b",week:"%e. %b",month:"%b '%y",year:"%Y"}, +endOnTick:!1,gridLineColor:"#C0C0C0",labels:G,lineColor:"#C0D0E0",lineWidth:1,minPadding:0.01,maxPadding:0.01,minorGridLineColor:"#E0E0E0",minorGridLineWidth:1,minorTickColor:"#A0A0A0",minorTickLength:2,minorTickPosition:"outside",startOfWeek:1,startOnTick:!1,tickColor:"#C0D0E0",tickLength:5,tickmarkPlacement:"between",tickPixelInterval:100,tickPosition:"outside",tickWidth:1,title:{align:"middle",style:{color:"#6D869F",fontWeight:"bold"}},type:"linear"},defaultYAxisOptions:{endOnTick:!0,gridLineWidth:1, +tickPixelInterval:72,showLastLabel:!0,labels:{align:"right",x:-8,y:3},lineWidth:0,maxPadding:0.05,minPadding:0.05,startOnTick:!0,tickWidth:0,title:{rotation:270,text:"Y-values"},stackLabels:{enabled:!1,formatter:function(){return this.total},style:G.style}},defaultLeftAxisOptions:{labels:{align:"right",x:-8,y:null},title:{rotation:270}},defaultRightAxisOptions:{labels:{align:"left",x:8,y:null},title:{rotation:90}},defaultBottomAxisOptions:{labels:{align:"center",x:0,y:14},title:{rotation:0}},defaultTopAxisOptions:{labels:{align:"center", +x:0,y:-5},title:{rotation:0}},init:function(a,b){var c=b.isX;this.horiz=a.inverted?!c:c;this.xOrY=(this.isXAxis=c)?"x":"y";this.opposite=b.opposite;this.side=this.horiz?this.opposite?0:2:this.opposite?1:3;this.setOptions(b);var d=this.options,e=d.type,f=e==="datetime";this.labelFormatter=d.labels.formatter||this.defaultLabelFormatter;this.staggerLines=this.horiz&&d.labels.staggerLines;this.userOptions=b;this.minPixelPadding=0;this.chart=a;this.reversed=d.reversed;this.categories=d.categories;this.isLog= +e==="logarithmic";this.isLinked=r(d.linkedTo);this.isDatetimeAxis=f;this.tickmarkOffset=d.categories&&d.tickmarkPlacement==="between"?0.5:0;this.ticks={};this.minorTicks={};this.plotLinesAndBands=[];this.alternateBands={};this.len=0;this.minRange=this.userMinRange=d.minRange||d.maxZoom;this.range=d.range;this.offset=d.offset||0;this.stacks={};this.min=this.max=null;var g,d=this.options.events;a.axes.push(this);a[c?"xAxis":"yAxis"].push(this);this.series=[];if(a.inverted&&c&&this.reversed===A)this.reversed= +!0;this.removePlotLine=this.removePlotBand=this.removePlotBandOrLine;this.addPlotLine=this.addPlotBand=this.addPlotBandOrLine;for(g in d)J(this,g,d[g]);if(this.isLog)this.val2lin=ka,this.lin2val=aa},setOptions:function(a){this.options=B(this.defaultOptions,this.isXAxis?{}:this.defaultYAxisOptions,[this.defaultTopAxisOptions,this.defaultRightAxisOptions,this.defaultBottomAxisOptions,this.defaultLeftAxisOptions][this.side],B(N[this.isXAxis?"xAxis":"yAxis"],a))},defaultLabelFormatter:function(){var a= +this.axis,b=this.value,c=this.dateTimeLabelFormat,d=N.lang.numericSymbols,e=d&&d.length,f,g=a.isLog?b:a.tickInterval;if(a.categories)f=b;else if(c)f=db(c,b);else if(e&&g>=1E3)for(;e--&&f===A;)a=Math.pow(1E3,e+1),g>=a&&d[e]!==null&&(f=Ja(b/a,-1)+d[e]);f===A&&(f=b>=1E3?Ja(b,0):Ja(b,-1));return f},getSeriesExtremes:function(){var a=this,b=a.chart,c=a.stacks,d=[],e=[],f;a.hasVisibleSeries=!1;a.dataMin=a.dataMax=null;o(a.series,function(g){if(g.visible||!b.options.chart.ignoreHiddenSeries){var h=g.options, +i,j,k,l,m,q,p,y,t,o=h.threshold,u,v=[],x=0;a.hasVisibleSeries=!0;if(a.isLog&&o<=0)o=h.threshold=null;if(a.isXAxis){if(h=g.xData,h.length)a.dataMin=O(n(a.dataMin,h[0]),Fa(h)),a.dataMax=s(n(a.dataMax,h[0]),wa(h))}else{var z,E,S,w=g.cropped,B=g.xAxis.getExtremes(),C=!!g.modifyValue;i=h.stacking;a.usePercentage=i==="percent";if(i)m=h.stack,l=g.type+n(m,""),q="-"+l,g.stackKey=l,j=d[l]||[],d[l]=j,k=e[q]||[],e[q]=k;if(a.usePercentage)a.dataMin=0,a.dataMax=99;h=g.processedXData;p=g.processedYData;u=p.length; +for(f=0;f=B.min&&(h[f-1]||y)<=B.max))if(y=t.length)for(;y--;)t[y]!==null&&(v[x++]=t[y]);else v[x++]=t;if(!a.usePercentage&&v.length)a.dataMin=O(n(a.dataMin,v[0]),Fa(v)),a.dataMax=s(n(a.dataMax,v[0]),wa(v));if(r(o))if(a.dataMin>=o)a.dataMin=o,a.ignoreMinPadding= +!0;else if(a.dataMaxe+this.width)l=!0}else if(c=e,h=k-this.right,gf+this.height)l=!0;return l?null:d.renderer.crispLine(["M",c,g,"L",h,i],b||0)},getPlotBandPath:function(a,b){var c=this.getPlotLinePath(b),d=this.getPlotLinePath(a);d&&c?d.push(c[4],c[5],c[1],c[2]):d=null;return d},getLinearTickPositions:function(a, +b,c){for(var d,b=da(U(b/a)*a),c=da(za(c/a)*a),e=[];b<=c;){e.push(b);b=da(b+a);if(b===d)break;d=b}return e},getLogTickPositions:function(a,b,c,d){var e=this.options,f=this.len,g=[];if(!d)this._minorAutoInterval=null;if(a>=0.5)a=u(a),g=this.getLinearTickPositions(a,b,c);else if(a>=0.08)for(var f=U(b),h,i,j,k,l,e=a>0.3?[1,2,4]:a>0.15?[1,2,4,6,8]:[1,2,3,4,5,6,7,8,9];fb&&g.push(k),k>c&&(l=!0),k=j}else if(b=aa(b),c=aa(c),a=e[d?"minorTickInterval": +"tickInterval"],a=n(a==="auto"?null:a,this._minorAutoInterval,(c-b)*(e.tickPixelInterval/(d?5:1))/((d?f/this.tickPositions.length:f)||1)),a=hb(a,null,K.pow(10,U(K.log(a)/K.LN10))),g=Ta(this.getLinearTickPositions(a,b,c),ka),!d)this._minorAutoInterval=a/5;if(!d)this.tickInterval=a;return g},getMinorTickPositions:function(){var a=this.options,b=this.tickPositions,c=this.minorTickInterval,d=[],e;if(this.isLog){e=b.length;for(a=1;a=this.minRange,f,g,h,i,j;if(this.isXAxis&&this.minRange===A&&!this.isLog)r(a.min)||r(a.max)?this.minRange=null:(o(this.series,function(a){i=a.xData;for(g=j=a.xIncrement?1:i.length-1;g>0;g--)if(h=i[g]-i[g-1],f===A||h0||!b.ignoreMaxPadding))b.max+=c*j}b.tickInterval=b.min===b.max||b.min===void 0||b.max===void 0?1:h&&!l&&q===b.linkedParent.options.tickPixelInterval?b.linkedParent.tickInterval:n(l,p?1:(b.max-b.min)*q/(b.len||1));g&&!a&&o(b.series,function(a){a.processData(b.min!==b.oldMin||b.max!==b.oldMax)});b.setAxisTranslation(a); +b.beforeSetTickPositions&&b.beforeSetTickPositions();if(b.postProcessTickInterval)b.tickInterval=b.postProcessTickInterval(b.tickInterval);if(!l&&b.tickIntervale&&i.shift(),d.endOnTick?b.max=f:b.max+hb[d]&&this.options.alignTicks!==!1)b[d]=c.length;a.maxTicks=b},adjustTickAmount:function(){var a=this.xOrY,b=this.tickPositions,c=this.chart.maxTicks;if(c&&c[a]&&!this.isDatetimeAxis&&!this.categories&&!this.isLinked&&this.options.alignTicks!==!1){var d=this.tickAmount,e=b.length;this.tickAmount=a=c[a];if(ea||a===null?a=c:b=a.min&&b<=a.max)j[b]||(j[b]=new Qa(a,b)),H&&j[b].isNew&&j[b].render(c,!0),j[b].isActive=!0,j[b].render(c)}),q&&o(g,function(b,c){if(c%2===0&&b1||M(b-f.y)>1))clearTimeout(this.tooltipTimeout),this.tooltipTimeout=setTimeout(function(){e&&e.move(a,b,c,d)},32)},hide:function(){if(!this.isHidden){var a=this.chart.hoverPoints;this.label.hide();a&&o(a,function(a){a.setState()});this.chart.hoverPoints=null;this.isHidden=!0}},hideCrosshairs:function(){o(this.crosshairs, +function(a){a&&a.hide()})},getAnchor:function(a,b){var c,d=this.chart,e=d.inverted,f=0,g=0,h,a=la(a);c=a[0].tooltipPos;c||(o(a,function(a){h=a.series.yAxis;f+=a.plotX;g+=(a.plotLow?(a.plotLow+a.plotHigh)/2:a.plotY)+(!e&&h?h.top-d.plotTop:0)}),f/=a.length,g/=a.length,c=[e?d.plotWidth-g:f,this.shared&&!e&&a.length>1&&b?b.chartY-d.plotTop:e?d.plotHeight-f:g]);return Ta(c,u)},getPosition:function(a,b,c){var d=this.chart,e=d.plotLeft,f=d.plotTop,g=d.plotWidth,h=d.plotHeight,i=n(this.options.distance,12), +j=c.plotX,c=c.plotY,d=j+e+(d.inverted?i:-a-i),k=c-b+f+15,l;d<7&&(d=e+s(j,0)+i);d+a>e+g&&(d-=d+a-(e+g),k=c-b+f-i,l=!0);k=k&&c<=k+b&&(k=c+f+i));k+b>f+h&&(k=s(f,f+h-b-i));return{x:d,y:k}},refresh:function(a,b){function c(){var a=this.points||la(this),b=a[0].series,c;c=[b.tooltipHeaderFormatter(a[0].key)];o(a,function(a){b=a.series;c.push(b.tooltipFormatter&&b.tooltipFormatter(a)||a.point.tooltipFormatter(b.tooltipOptions.pointFormat))});c.push(f.footerFormat||"");return c.join("")} +var d=this.chart,e=this.label,f=this.options,g,h,i,j={},k,l=[];k=f.formatter||c;var j=d.hoverPoints,m,q=f.crosshairs;i=this.shared;h=this.getAnchor(a,b);g=h[0];h=h[1];i&&(!a.series||!a.series.noSharedTooltip)?(d.hoverPoints=a,j&&o(j,function(a){a.setState()}),o(a,function(a){a.setState("hover");l.push(a.getLabelConfig())}),j={x:a[0].category,y:a[0].y},j.points=l,a=a[0]):j=a.getLabelConfig();k=k.call(j);j=a.series;i=i||!j.isCartesian||j.tooltipOutsidePlot||d.isInsidePlot(g,h);k===!1||!i?this.hide(): +(this.isHidden&&e.show(),e.attr({text:k}),m=f.borderColor||a.color||j.color||"#606060",e.attr({stroke:m}),e=(f.positioner||this.getPosition).call(this,e.width,e.height,{plotX:g,plotY:h}),this.move(u(e.x),u(e.y),g+d.plotLeft,h+d.plotTop),this.isHidden=!1);if(q){q=la(q);for(e=q.length;e--;)if(i=a.series[e?"yAxis":"xAxis"],q[e]&&i)if(i=i.getPlotLinePath(e?n(a.stackY,a.y):a.x,1),this.crosshairs[e])this.crosshairs[e].attr({d:i,visibility:"visible"});else{j={"stroke-width":q[e].width||1,stroke:q[e].color|| +"#C0C0C0",zIndex:q[e].zIndex||2};if(q[e].dashStyle)j.dashstyle=q[e].dashStyle;this.crosshairs[e]=d.renderer.path(i).attr(j).add()}}F(d,"tooltipRefresh",{text:k,x:g+d.plotLeft,y:h+d.plotTop,borderColor:m})}};qb.prototype={normalizeMouseEvent:function(a){var b,c,d,a=a||L.event;if(!a.target)a.target=a.srcElement;a=Pb(a);d=a.touches?a.touches.item(0):a;this.chartPosition=b=Vb(this.chart.container);d.pageX===A?(c=a.x,b=a.y):(c=d.pageX-b.left,b=d.pageY-b.top);return x(a,{chartX:u(c),chartY:u(b)})},getMouseCoordinates:function(a){var b= +{xAxis:[],yAxis:[]},c=this.chart;o(c.axes,function(d){var e=d.isXAxis;b[e?"xAxis":"yAxis"].push({axis:d,value:d.translate(((c.inverted?!e:e)?a.chartX-c.plotLeft:d.top+d.len-a.chartY)-d.minPixelPadding,!0)})});return b},getIndex:function(a){var b=this.chart;return b.inverted?b.plotHeight+b.plotTop-a.chartY:a.chartX-b.plotLeft},onmousemove:function(a){var b=this.chart,c=b.series,d=b.tooltip,e,f=b.hoverPoint,g=b.hoverSeries,h,i,j=b.chartWidth,k=this.getIndex(a);if(d&&this.options.tooltip.shared&&(!g|| +!g.noSharedTooltip)){e=[];h=c.length;for(i=0;ij&&e.splice(h,1);if(e.length&&e[0].plotX!==this.hoverX)d.refresh(e,a),this.hoverX=e[0].plotX}if(g&&g.tracker&&(b=g.tooltipPoints[k])&&b!==f)b.onMouseOver()},resetTracker:function(a){var b=this.chart, +c=b.hoverSeries,d=b.hoverPoint,e=b.tooltip,b=e&&e.shared?b.hoverPoints:d;(a=a&&e&&b)&&la(b)[0].plotX===A&&(a=!1);if(a)e.refresh(b);else{if(d)d.onMouseOut();if(c)c.onMouseOut();e&&(e.hide(),e.hideCrosshairs());this.hoverX=null}},setDOMEvents:function(){function a(){if(b.selectionMarker){var f={xAxis:[],yAxis:[]},g=b.selectionMarker.getBBox(),h=g.x-c.plotLeft,l=g.y-c.plotTop,m;e&&(o(c.axes,function(a){if(a.options.zoomEnabled!==!1){var b=a.isXAxis,d=c.inverted?!b:b,e=a.translate(d?h:c.plotHeight-l- +g.height,!0,0,0,1),d=a.translate((d?h+g.width:c.plotHeight-l)-2*a.minPixelPadding,!0,0,0,1);!isNaN(e)&&!isNaN(d)&&(f[b?"xAxis":"yAxis"].push({axis:a,min:O(e,d),max:s(e,d)}),m=!0)}}),m&&F(c,"selection",f,function(a){c.zoom(a)}));b.selectionMarker=b.selectionMarker.destroy()}if(c)I(d,{cursor:"auto"}),c.cancelClick=e,c.mouseIsDown=e=!1;R(C,"mouseup",a);Ba&&R(C,"touchend",a)}var b=this,c=b.chart,d=c.container,e,f=b.zoomX&&!c.inverted||b.zoomY&&c.inverted,g=b.zoomY&&!c.inverted||b.zoomX&&c.inverted;b.hideTooltipOnMouseMove= +function(a){a=Pb(a);b.chartPosition&&c.hoverSeries&&c.hoverSeries.isCartesian&&!c.isInsidePlot(a.pageX-b.chartPosition.left-c.plotLeft,a.pageY-b.chartPosition.top-c.plotTop)&&b.resetTracker()};b.hideTooltipOnMouseLeave=function(){b.resetTracker();b.chartPosition=null};d.onmousedown=function(d){d=b.normalizeMouseEvent(d);d.type.indexOf("touch")===-1&&d.preventDefault&&d.preventDefault();c.mouseIsDown=!0;c.cancelClick=!1;c.mouseDownX=b.mouseDownX=d.chartX;b.mouseDownY=d.chartY;J(C,"mouseup",a);Ba&& +J(C,"touchend",a)};var h=function(a){if(!a||!(a.touches&&a.touches.length>1)){var a=b.normalizeMouseEvent(a),d=a.type,h=a.chartX,l=a.chartY,m=!c.isInsidePlot(h-c.plotLeft,l-c.plotTop);if(d.indexOf("touch")===-1)a.returnValue=!1;d==="touchstart"&&(w(a.target,"isTracker")?c.runTrackerClick||a.preventDefault():!c.runChartClick&&!m&&a.preventDefault());if(m)hc.plotLeft+c.plotWidth&&(h=c.plotLeft+c.plotWidth),lc.plotTop+c.plotHeight&&(l=c.plotTop+c.plotHeight); +if(c.mouseIsDown&&d!=="touchstart"&&(e=Math.sqrt(Math.pow(b.mouseDownX-h,2)+Math.pow(b.mouseDownY-l,2)),e>10)){d=c.isInsidePlot(b.mouseDownX-c.plotLeft,b.mouseDownY-c.plotTop);if(c.hasCartesianSeries&&(b.zoomX||b.zoomY)&&d&&!b.selectionMarker)b.selectionMarker=c.renderer.rect(c.plotLeft,c.plotTop,f?1:c.plotWidth,g?1:c.plotHeight,0).attr({fill:b.options.chart.selectionMarkerFill||"rgba(69,114,167,0.25)",zIndex:7}).add();if(b.selectionMarker&&f){var q=h-b.mouseDownX;b.selectionMarker.attr({width:M(q), +x:(q>0?0:q)+b.mouseDownX})}b.selectionMarker&&g&&(l-=b.mouseDownY,b.selectionMarker.attr({height:M(l),y:(l>0?0:l)+b.mouseDownY}));d&&!b.selectionMarker&&b.options.chart.panning&&c.pan(h)}if(!m)b.onmousemove(a);return m||!c.hasCartesianSeries}};if(!/Android 4\.0/.test(na))d.onmousemove=h;J(d,"mouseleave",b.hideTooltipOnMouseLeave);Ba||J(C,"mousemove",b.hideTooltipOnMouseMove);d.ontouchstart=function(a){if(b.zoomX||b.zoomY)d.onmousedown(a);h(a)};d.ontouchmove=h;d.ontouchend=function(){e&&b.resetTracker()}; +d.onclick=function(a){var d=c.hoverPoint,e,f,a=b.normalizeMouseEvent(a);a.cancelBubble=!0;if(!c.cancelClick)d&&(w(a.target,"isTracker")||w(a.target.parentNode,"isTracker"))?(e=d.plotX,f=d.plotY,x(d,{pageX:b.chartPosition.left+c.plotLeft+(c.inverted?c.plotWidth-f:e),pageY:b.chartPosition.top+c.plotTop+(c.inverted?c.plotHeight-e:f)}),F(d.series,"click",x(a,{point:d})),d.firePointEvent("click",a)):(x(a,b.getMouseCoordinates(a)),c.isInsidePlot(a.chartX-c.plotLeft,a.chartY-c.plotTop)&&F(c,"click",a))}}, +destroy:function(){var a=this.chart,b=a.container;if(a.trackerGroup)a.trackerGroup=a.trackerGroup.destroy();R(b,"mouseleave",this.hideTooltipOnMouseLeave);R(C,"mousemove",this.hideTooltipOnMouseMove);b.onclick=b.onmousedown=b.onmousemove=b.ontouchstart=b.ontouchend=b.ontouchmove=null;clearInterval(this.tooltipTimeout)},init:function(a,b){if(!a.trackerGroup)a.trackerGroup=a.renderer.g("tracker").attr({zIndex:9}).add();if(b.enabled)a.tooltip=new pb(a,b);this.setDOMEvents()}};rb.prototype={init:function(a){var b= +this,c=b.options=a.options.legend;if(c.enabled){var d=c.itemStyle,e=n(c.padding,8),f=c.itemMarginTop||0;b.baseline=z(d.fontSize)+3+f;b.itemStyle=d;b.itemHiddenStyle=B(d,c.itemHiddenStyle);b.itemMarginTop=f;b.padding=e;b.initialItemX=e;b.initialItemY=e-5;b.maxItemWidth=0;b.chart=a;b.itemHeight=0;b.lastLineHeight=0;b.render();J(b.chart,"endResize",function(){b.positionCheckboxes()})}},colorizeItem:function(a,b){var c=this.options,d=a.legendItem,e=a.legendLine,f=a.legendSymbol,g=this.itemHiddenStyle.color, +c=b?c.itemStyle.color:g,h=b?a.color:g,g=a.options&&a.options.marker,i={stroke:h,fill:h},j;d&&d.css({fill:c});e&&e.attr({stroke:h});if(f){if(g)for(j in g=a.convertAttribs(g),g)d=g[j],d!==A&&(i[j]=d);f.attr(i)}},positionItem:function(a){var b=this.options,c=b.symbolPadding,b=!b.rtl,d=a._legendItemPos,e=d[0],d=d[1],f=a.checkbox;a.legendGroup&&a.legendGroup.translate(b?e:this.legendWidth-e-2*c-4,d);if(f)f.x=e,f.y=d},destroyItem:function(a){var b=a.checkbox;o(["legendItem","legendLine","legendSymbol", +"legendGroup"],function(b){a[b]&&a[b].destroy()});b&&Na(a.checkbox)},destroy:function(){var a=this.group,b=this.box;if(b)this.box=b.destroy();if(a)this.group=a.destroy()},positionCheckboxes:function(a){var b=this.group.alignAttr,c,d=this.clipHeight||this.legendHeight;if(b)c=b.translateY,o(this.allItems,function(e){var f=e.checkbox,g;f&&(g=c+f.y+(a||0)+3,I(f,{left:b.translateX+e.legendItemWidth+f.x-20+"px",top:g+"px",display:g>c-6&&g(m||c.chartWidth-2*k-o))b.itemX=o,b.itemY+=n+b.lastLineHeight+q,b.lastLineHeight=0;b.maxItemWidth=s(b.maxItemWidth,e);b.lastItemY=n+b.itemY+q;b.lastLineHeight=s(g,b.lastLineHeight);a._legendItemPos=[b.itemX,b.itemY];f?b.itemX+=e:(b.itemY+=n+g+q,b.lastLineHeight=g);b.offsetWidth= +m||s(f?b.itemX-o:e,b.offsetWidth)},render:function(){var a=this,b=a.chart,c=b.renderer,d=a.group,e,f,g,h,i=a.box,j=a.options,k=a.padding,l=j.borderWidth,m=j.backgroundColor;a.itemX=a.initialItemX;a.itemY=a.initialItemY;a.offsetWidth=0;a.lastItemY=0;if(!d)a.group=d=c.g("legend").attr({zIndex:7}).add(),a.contentGroup=c.g().attr({zIndex:1}).add(d),a.scrollGroup=c.g().add(a.contentGroup),a.clipRect=c.clipRect(0,0,9999,b.chartHeight),a.contentGroup.clip(a.clipRect);e=[];o(b.series,function(a){var b=a.options; +b.showInLegend&&(e=e.concat(a.legendItems||(b.legendType==="point"?a.data:a)))});Ib(e,function(a,b){return(a.options&&a.options.legendIndex||0)-(b.options&&b.options.legendIndex||0)});j.reversed&&e.reverse();a.allItems=e;a.display=f=!!e.length;o(e,function(b){a.renderItem(b)});g=j.width||a.offsetWidth;h=a.lastItemY+a.lastLineHeight;h=a.handleOverflow(h);if(l||m){g+=k;h+=k;if(i){if(g>0&&h>0)i[i.isNew?"attr":"animate"](i.crisp(null,null,null,g,h)),i.isNew=!1}else a.box=i=c.rect(0,0,g,h,j.borderRadius, +l||0).attr({stroke:j.borderColor,"stroke-width":l||0,fill:m||Q}).add(d).shadow(j.shadow),i.isNew=!0;i[f?"show":"hide"]()}a.legendWidth=g;a.legendHeight=h;o(e,function(b){a.positionItem(b)});f&&d.align(x({width:g,height:h},j),!0,b.spacingBox);b.isResizing||this.positionCheckboxes()},handleOverflow:function(a){var b=this,c=this.chart,d=c.renderer,e=this.options,f=e.y,f=c.spacingBox.height+(e.verticalAlign==="top"?-f:f)-this.padding,g=e.maxHeight,h=this.clipRect,i=e.navigation,j=n(i.animation,!0),k= +i.arrowSize||12,l=this.nav;e.layout==="horizontal"&&(f/=2);g&&(f=O(f,g));if(a>f){this.clipHeight=c=f-20;this.pageCount=za(a/c);this.currentPage=n(this.currentPage,1);this.fullHeight=a;h.attr({height:c});if(!l)this.nav=l=d.g().attr({zIndex:1}).add(this.group),this.up=d.symbol("triangle",0,0,k,k).on("click",function(){b.scroll(-1,j)}).add(l),this.pager=d.text("",15,10).css(i.style).add(l),this.down=d.symbol("triangle-down",0,0,k,k).on("click",function(){b.scroll(1,j)}).add(l);b.scroll(0);a=f}else if(l)h.attr({height:c.chartHeight}), +l.hide(),this.scrollGroup.attr({translateY:1}),this.clipHeight=0;return a},scroll:function(a,b){var c=this.pageCount,d=this.currentPage+a,e=this.clipHeight,f=this.options.navigation,g=f.activeColor,h=f.inactiveColor,f=this.pager,i=this.padding;d>c&&(d=c);if(d>0)b!==A&&xa(b,this.chart),this.nav.attr({translateX:i,translateY:e+7,visibility:"visible"}),this.up.attr({fill:d===1?h:g}).css({cursor:d===1?"default":"pointer"}),f.attr({text:d+"/"+this.pageCount}),this.down.attr({x:18+this.pager.getBBox().width, +fill:d===c?h:g}).css({cursor:d===c?"default":"pointer"}),e=-O(e*(d-1),this.fullHeight-e+i)+1,this.scrollGroup.animate({translateY:e}),f.attr({text:d+"/"+c}),this.currentPage=d,this.positionCheckboxes(e)}};sb.prototype={init:function(a,b){var c,d=a.series;a.series=null;c=B(N,a);c.series=a.series=d;var d=c.chart,e=d.margin,e=Y(e)?e:[e,e,e,e];this.optionsMarginTop=n(d.marginTop,e[0]);this.optionsMarginRight=n(d.marginRight,e[1]);this.optionsMarginBottom=n(d.marginBottom,e[2]);this.optionsMarginLeft= +n(d.marginLeft,e[3]);this.runChartClick=(e=d.events)&&!!e.click;this.callback=b;this.isResizing=0;this.options=c;this.axes=[];this.series=[];this.hasCartesianSeries=d.showAxes;var f;this.index=Ha.length;Ha.push(this);d.reflow!==!1&&J(this,"load",this.initReflow);if(e)for(f in e)J(this,f,e[f]);this.xAxis=[];this.yAxis=[];this.animation=V?!1:n(d.animation,!0);this.pointCount=0;this.counters=new Hb;this.firstRender()},initSeries:function(a){var b=this.options.chart,b=new $[a.type||b.type||b.defaultSeriesType]; +b.init(this,a);return b},addSeries:function(a,b,c){var d,e=this;a&&(xa(c,e),b=n(b,!0),F(e,"addSeries",{options:a},function(){d=e.initSeries(a);e.isDirtyLegend=!0;b&&e.redraw()}));return d},isInsidePlot:function(a,b,c){var d=c?b:a,a=c?a:b;return d>=0&&d<=this.plotWidth&&a>=0&&a<=this.plotHeight},adjustTickAmounts:function(){this.options.chart.alignTicks!==!1&&o(this.axes,function(a){a.adjustTickAmount()});this.maxTicks=null},redraw:function(a){var b=this.axes,c=this.series,d=this.tracker,e=this.legend, +f=this.isDirtyLegend,g,h=this.isDirtyBox,i=c.length,j=i,k=this.renderer,l=k.isHidden(),m=[];xa(a,this);for(l&&this.cloneRenderTo();j--;)if(a=c[j],a.isDirty&&a.options.stacking){g=!0;break}if(g)for(j=i;j--;)if(a=c[j],a.options.stacking)a.isDirty=!0;o(c,function(a){a.isDirty&&a.options.legendType==="point"&&(f=!0)});if(f&&e.options.enabled)e.render(),this.isDirtyLegend=!1;if(this.hasCartesianSeries){if(!this.isResizing)this.maxTicks=null,o(b,function(a){a.setScale()});this.adjustTickAmounts();this.getMargins(); +o(b,function(a){if(a.isDirtyExtremes)a.isDirtyExtremes=!1,m.push(function(){F(a,"afterSetExtremes",a.getExtremes())});if(a.isDirty||h||g)a.redraw(),h=!0})}h&&this.drawChartBox();o(c,function(a){a.isDirty&&a.visible&&(!a.isCartesian||a.xAxis)&&a.redraw()});d&&d.resetTracker&&d.resetTracker(!0);k.draw();F(this,"redraw");l&&this.cloneRenderTo(!0);o(m,function(a){a.call()})},showLoading:function(a){var b=this.options,c=this.loadingDiv,d=b.loading;if(!c)this.loadingDiv=c=T(ga,{className:"highcharts-loading"}, +x(d.style,{left:this.plotLeft+"px",top:this.plotTop+"px",width:this.plotWidth+"px",height:this.plotHeight+"px",zIndex:10,display:Q}),this.container),this.loadingSpan=T("span",null,d.labelStyle,c);this.loadingSpan.innerHTML=a||b.lang.loading;if(!this.loadingShown)I(c,{opacity:0,display:""}),xb(c,{opacity:d.style.opacity},{duration:d.showDuration||0}),this.loadingShown=!0},hideLoading:function(){var a=this.options,b=this.loadingDiv;b&&xb(b,{opacity:0},{duration:a.loading.hideDuration||100,complete:function(){I(b, +{display:Q})}});this.loadingShown=!1},get:function(a){var b=this.axes,c=this.series,d,e;for(d=0;dO(e.dataMin,e.min)&&c19?this.containerHeight:400))},cloneRenderTo:function(a){var b=this.renderToClone,c=this.container;a?b&&(this.renderTo.appendChild(c),Na(b),delete this.renderToClone):(c&&this.renderTo.removeChild(c),this.renderToClone=b=this.renderTo.cloneNode(0),I(b,{position:"absolute",top:"-9999px",display:"block"}),C.body.appendChild(b),c&&b.appendChild(c))},getContainer:function(){var a,b=this.options.chart,c,d,e;this.renderTo=a=b.renderTo;e="highcharts-"+tb++;if(ja(a))this.renderTo= +a=C.getElementById(a);a||Oa(13,!0);c=z(w(a,"data-highcharts-chart"));!isNaN(c)&&Ha[c]&&Ha[c].destroy();w(a,"data-highcharts-chart",this.index);a.innerHTML="";a.offsetWidth||this.cloneRenderTo();this.getChartSize();c=this.chartWidth;d=this.chartHeight;this.container=a=T(ga,{className:"highcharts-container"+(b.className?" "+b.className:""),id:e},x({position:"relative",overflow:"hidden",width:c+"px",height:d+"px",textAlign:"left",lineHeight:"normal",zIndex:0},b.style),this.renderToClone||a);this.renderer= +b.forExport?new sa(a,c,d,!0):new Sa(a,c,d);V&&this.renderer.create(this,a,c,d)},getMargins:function(){var a=this.options.chart,b=a.spacingTop,c=a.spacingRight,d=a.spacingBottom,a=a.spacingLeft,e,f=this.legend,g=this.optionsMarginTop,h=this.optionsMarginLeft,i=this.optionsMarginRight,j=this.optionsMarginBottom,k=this.chartTitleOptions,l=this.chartSubtitleOptions,m=this.options.legend,q=n(m.margin,10),p=m.x,y=m.y,t=m.align,u=m.verticalAlign;this.resetMargins();e=this.axisOffset;if((this.title||this.subtitle)&& +!r(this.optionsMarginTop))if(l=s(this.title&&!k.floating&&!k.verticalAlign&&k.y||0,this.subtitle&&!l.floating&&!l.verticalAlign&&l.y||0))this.plotTop=s(this.plotTop,l+n(k.margin,15)+b);if(f.display&&!m.floating)if(t==="right"){if(!r(i))this.marginRight=s(this.marginRight,f.legendWidth-p+q+c)}else if(t==="left"){if(!r(h))this.plotLeft=s(this.plotLeft,f.legendWidth+p+q+a)}else if(u==="top"){if(!r(g))this.plotTop=s(this.plotTop,f.legendHeight+y+q+b)}else if(u==="bottom"&&!r(j))this.marginBottom=s(this.marginBottom, +f.legendHeight-y+q+d);this.extraBottomMargin&&(this.marginBottom+=this.extraBottomMargin);this.extraTopMargin&&(this.plotTop+=this.extraTopMargin);this.hasCartesianSeries&&o(this.axes,function(a){a.getOffset()});r(h)||(this.plotLeft+=e[3]);r(g)||(this.plotTop+=e[0]);r(j)||(this.marginBottom+=e[2]);r(i)||(this.marginRight+=e[1]);this.setChartSize()},initReflow:function(){function a(a){var g=c.width||eb(d,"width"),h=c.height||eb(d,"height"),a=a?a.target:L;if(!b.hasUserSize&&g&&h&&(a===L||a===C)){if(g!== +b.containerWidth||h!==b.containerHeight)clearTimeout(e),b.reflowTimeout=e=setTimeout(function(){if(b.container)b.setSize(g,h,!1),b.hasUserSize=null},100);b.containerWidth=g;b.containerHeight=h}}var b=this,c=b.options.chart,d=b.renderTo,e;J(L,"resize",a);J(b,"destroy",function(){R(L,"resize",a)})},setSize:function(a,b,c){var d=this,e,f,g=d.resetZoomButton,h=d.title,i=d.subtitle,j;d.isResizing+=1;j=function(){d&&F(d,"endResize",null,function(){d.isResizing-=1})};xa(c,d);d.oldChartHeight=d.chartHeight; +d.oldChartWidth=d.chartWidth;if(r(a))d.chartWidth=e=s(0,u(a)),d.hasUserSize=!!e;if(r(b))d.chartHeight=f=s(0,u(b));I(d.container,{width:e+"px",height:f+"px"});d.renderer.setSize(e,f,c);d.plotWidth=e-d.plotLeft-d.marginRight;d.plotHeight=f-d.plotTop-d.marginBottom;d.maxTicks=null;o(d.axes,function(a){a.isDirty=!0;a.setScale()});o(d.series,function(a){a.isDirty=!0});d.isDirtyLegend=!0;d.isDirtyBox=!0;d.getMargins();a=d.spacingBox;h&&h.align(null,null,a);i&&i.align(null,null,a);g&&g.align&&g.align(null, +null,d[g.alignTo]);d.redraw(c);d.oldChartHeight=null;F(d,"resize");Pa===!1?j():setTimeout(j,Pa&&Pa.duration||500)},setChartSize:function(){var a=this.inverted,b=this.chartWidth,c=this.chartHeight,d=this.options.chart,e=d.spacingTop,f=d.spacingRight,g=d.spacingBottom,h=d.spacingLeft,i,j,k,l;this.plotLeft=i=u(this.plotLeft);this.plotTop=j=u(this.plotTop);this.plotWidth=k=s(0,u(b-i-this.marginRight));this.plotHeight=l=s(0,u(c-j-this.marginBottom));this.plotSizeX=a?l:k;this.plotSizeY=a?k:l;this.plotBorderWidth= +a=d.plotBorderWidth||0;this.spacingBox={x:h,y:e,width:b-h-f,height:c-e-g};this.plotBox={x:i,y:j,width:k,height:l};this.clipBox={x:a/2,y:a/2,width:this.plotSizeX-a,height:this.plotSizeY-a};o(this.axes,function(a){a.setAxisSize();a.setAxisTranslation()})},resetMargins:function(){var a=this.options.chart,b=a.spacingRight,c=a.spacingBottom,d=a.spacingLeft;this.plotTop=n(this.optionsMarginTop,a.spacingTop);this.marginRight=n(this.optionsMarginRight,b);this.marginBottom=n(this.optionsMarginBottom,c);this.plotLeft= +n(this.optionsMarginLeft,d);this.axisOffset=[0,0,0,0]},drawChartBox:function(){var a=this.options.chart,b=this.renderer,c=this.chartWidth,d=this.chartHeight,e=this.chartBackground,f=this.plotBackground,g=this.plotBorder,h=this.plotBGImage,i=a.borderWidth||0,j=a.backgroundColor,k=a.plotBackgroundColor,l=a.plotBackgroundImage,m=a.plotBorderWidth||0,n,p=this.plotLeft,o=this.plotTop,t=this.plotWidth,r=this.plotHeight,u=this.plotBox,v=this.clipRect,s=this.clipBox;n=i+(a.shadow?8:0);if(i||j)if(e)e.animate(e.crisp(null, +null,null,c-n,d-n));else{e={fill:j||Q};if(i)e.stroke=a.borderColor,e["stroke-width"]=i;this.chartBackground=b.rect(n/2,n/2,c-n,d-n,a.borderRadius,i).attr(e).add().shadow(a.shadow)}if(k)f?f.animate(u):this.plotBackground=b.rect(p,o,t,r,0).attr({fill:k}).add().shadow(a.plotShadow);if(l)h?h.animate(u):this.plotBGImage=b.image(l,p,o,t,r).add();v?v.animate({width:s.width,height:s.height}):this.clipRect=b.clipRect(s);if(m)g?g.animate(g.crisp(null,p,o,t,r)):this.plotBorder=b.rect(p,o,t,r,0,m).attr({stroke:a.plotBorderColor, +"stroke-width":m,zIndex:1}).add();this.isDirtyBox=!1},propFromSeries:function(){var a=this,b=a.options.chart,c,d=a.options.series,e,f;o(["inverted","angular","polar"],function(g){c=$[b.type||b.defaultSeriesType];f=a[g]||b[g]||c&&c.prototype[g];for(e=d&&d.length;!f&&e--;)(c=$[d[e].type])&&c.prototype[g]&&(f=!0);a[g]=f})},render:function(){var a=this,b=a.axes,c=a.renderer,d=a.options,e=d.labels,d=d.credits,f;a.setTitle();a.legend=new rb(a);o(b,function(a){a.setScale()});a.getMargins();a.maxTicks=null; +o(b,function(a){a.setTickPositions(!0);a.setMaxTicks()});a.adjustTickAmounts();a.getMargins();a.drawChartBox();a.hasCartesianSeries&&o(b,function(a){a.render()});if(!a.seriesGroup)a.seriesGroup=c.g("series-group").attr({zIndex:3}).add();o(a.series,function(a){a.translate();a.setTooltipPoints();a.render()});e.items&&o(e.items,function(b){var d=x(e.style,b.style),f=z(d.left)+a.plotLeft,j=z(d.top)+a.plotTop+12;delete d.left;delete d.top;c.text(b.html,f,j).attr({zIndex:2}).css(d).add()});if(d.enabled&& +!a.credits)f=d.href,a.credits=c.text(d.text,0,0).on("click",function(){if(f)location.href=f}).attr({align:d.position.align,zIndex:8}).css(d.style).add().align(d.position);a.hasRendered=!0},destroy:function(){var a=this,b=a.axes,c=a.series,d=a.container,e,f=d&&d.parentNode;F(a,"destroy");Ha[a.index]=A;a.renderTo.removeAttribute("data-highcharts-chart");R(a);for(e=b.length;e--;)b[e]=b[e].destroy();for(e=c.length;e--;)c[e]=c[e].destroy();o("title,subtitle,chartBackground,plotBackground,plotBGImage,plotBorder,seriesGroup,clipRect,credits,tracker,scroller,rangeSelector,legend,resetZoomButton,tooltip,renderer".split(","), +function(b){var c=a[b];c&&c.destroy&&(a[b]=c.destroy())});if(d)d.innerHTML="",R(d),f&&Na(d);for(e in a)delete a[e]},isReadyToRender:function(){var a=this;return!ca&&L==L.top&&C.readyState!=="complete"||V&&!L.canvg?(V?Rb.push(function(){a.firstRender()},a.options.global.canvasToolsURL):C.attachEvent("onreadystatechange",function(){C.detachEvent("onreadystatechange",a.firstRender);C.readyState==="complete"&&a.firstRender()}),!1):!0},firstRender:function(){var a=this,b=a.options,c=a.callback;if(a.isReadyToRender()){a.getContainer(); +F(a,"init");if(Highcharts.RangeSelector&&b.rangeSelector.enabled)a.rangeSelector=new Highcharts.RangeSelector(a);a.resetMargins();a.setChartSize();a.propFromSeries();a.getAxes();o(b.series||[],function(b){a.initSeries(b)});if(Highcharts.Scroller&&(b.navigator.enabled||b.scrollbar.enabled))a.scroller=new Highcharts.Scroller(a);a.tracker=new qb(a,b);a.render();a.renderer.draw();c&&c.apply(a,[a]);o(a.callbacks,function(b){b.apply(a,[a])});a.cloneRenderTo(!0);F(a,"load")}}};sb.prototype.callbacks=[]; +var Ua=function(){};Ua.prototype={init:function(a,b,c){var d=a.chart.counters;this.series=a;this.applyOptions(b,c);this.pointAttr={};if(a.options.colorByPoint)b=a.chart.options.colors,this.color=this.color||b[d.color++],d.wrapColor(b.length);a.chart.pointCount++;return this},applyOptions:function(a,b){var c=this.series,d=typeof a;this.config=a;if(d==="number"||a===null)this.y=a;else if(typeof a[0]==="number")this.x=a[0],this.y=a[1];else if(d==="object"&&typeof a.length!=="number"){x(this,a);this.options= +a;if(a.dataLabels)c._hasPointLabels=!0;if(a.marker)c._hasPointMarkers=!0}else if(typeof a[0]==="string")this.name=a[0],this.y=a[1];if(this.x===A)this.x=b===A?c.autoIncrement():b},destroy:function(){var a=this.series.chart,b=a.hoverPoints,c;a.pointCount--;if(b&&(this.setState(),ta(b,this),!b.length))a.hoverPoints=null;if(this===a.hoverPoint)this.onMouseOut();if(this.graphic||this.dataLabel)R(this),this.destroyElements();this.legendItem&&a.legend.destroyItem(this);for(c in this)this[c]=null},destroyElements:function(){for(var a= +"graphic,tracker,dataLabel,dataLabelUpper,group,connector,shadowGroup".split(","),b,c=6;c--;)b=a[c],this[b]&&(this[b]=this[b].destroy())},getLabelConfig:function(){return{x:this.category,y:this.y,key:this.name||this.category,series:this.series,point:this,percentage:this.percentage,total:this.total||this.stackTotal}},select:function(a,b){var c=this,d=c.series.chart,a=n(a,!c.selected);c.firePointEvent(a?"select":"unselect",{accumulate:b},function(){c.selected=a;c.setState(a&&"select");b||o(d.getSelectedPoints(), +function(a){if(a.selected&&a!==c)a.selected=!1,a.setState(""),a.firePointEvent("unselect")})})},onMouseOver:function(){var a=this.series,b=a.chart,c=b.tooltip,d=b.hoverPoint;if(d&&d!==this)d.onMouseOut();this.firePointEvent("mouseOver");c&&(!c.shared||a.noSharedTooltip)&&c.refresh(this);this.setState("hover");b.hoverPoint=this},onMouseOut:function(){var a=this.series.chart,b=a.hoverPoints;if(!b||Ub(this,b)===-1)this.firePointEvent("mouseOut"),this.setState(),a.hoverPoint=null},tooltipFormatter:function(a){var b= +this.series,c=b.tooltipOptions,d=a.match(/\{(series|point)\.[a-zA-Z]+\}/g),e=/[{\.}]/,f,g,h,i,j={y:0,open:0,high:0,low:0,close:0,percentage:1,total:1};c.valuePrefix=c.valuePrefix||c.yPrefix;c.valueDecimals=n(c.valueDecimals,c.yDecimals);c.valueSuffix=c.valueSuffix||c.ySuffix;for(i in d)g=d[i],ja(g)&&g!==a&&(h=(" "+g).split(e),f={point:this,series:b}[h[1]],h=h[2],f===this&&j.hasOwnProperty(h)?(f=j[h]?h:"value",f=(c[f+"Prefix"]||"")+Ja(this[h],n(c[f+"Decimals"],-1))+(c[f+"Suffix"]||"")):f=f[h],a=a.replace(g, +f));return a},update:function(a,b,c){var d=this,e=d.series,f=d.graphic,g,h=e.data,i=h.length,j=e.chart,b=n(b,!0);d.firePointEvent("update",{options:a},function(){d.applyOptions(a);Y(a)&&(e.getAttribs(),f&&f.attr(d.pointAttr[e.state]));for(g=0;ga+1&&b.push(d.slice(a+1,g)),a=g):g===e-1&&b.push(d.slice(a+1,g+1))});this.segments=b},setOptions:function(a){var b=this.chart.options,c=b.plotOptions,d=c[this.type],e=a.data;a.data=null;c=B(d,c.series,a);c.data=a.data=e;this.tooltipOptions=B(b.tooltip,c.tooltip);d.marker===null&&delete c.marker;return c},getColor:function(){var a=this.options, +b=this.chart.options.colors,c=this.chart.counters;this.color=a.color||!a.colorByPoint&&b[c.color++]||"gray";c.wrapColor(b.length)},getSymbol:function(){var a=this.options.marker,b=this.chart,c=b.options.symbols,b=b.counters;this.symbol=a.symbol||c[b.symbol++];if(/^url/.test(this.symbol))a.radius=0;b.wrapSymbol(c.length)},drawLegendSymbol:function(a){var b=this.options,c=b.marker,d=a.options.symbolWidth,e=this.chart.renderer,f=this.legendGroup,a=a.baseline,g;if(b.lineWidth){g={"stroke-width":b.lineWidth}; +if(b.dashStyle)g.dashstyle=b.dashStyle;this.legendLine=e.path(["M",0,a-4,"L",d,a-4]).attr(g).add(f)}if(c&&c.enabled)b=c.radius,this.legendSymbol=e.symbol(this.symbol,d/2-b,a-4-b,2*b,2*b).add(f)},addPoint:function(a,b,c,d){var e=this.options,f=this.data,g=this.graph,h=this.area,i=this.chart,j=this.xData,k=this.yData,l=g&&g.shift||0,m=e.data,q=this.pointClass.prototype;xa(d,i);if(g&&c)g.shift=l+1;if(h){if(c)h.shift=l+1;h.isArea=!0}b=n(b,!0);d={series:this};q.applyOptions.apply(d,[a]);j.push(d.x);k.push(q.toYData? +q.toYData.call(d):d.y);m.push(a);e.legendType==="point"&&this.generatePoints();c&&(f[0]&&f[0].remove?f[0].remove(!1):(f.shift(),j.shift(),k.shift(),m.shift()));this.getAttribs();this.isDirtyData=this.isDirty=!0;b&&i.redraw()},setData:function(a,b){var c=this.points,d=this.options,e=this.initialColor,f=this.chart,g=null,h=this.xAxis,i,j=this.pointClass.prototype;this.xIncrement=null;this.pointRange=h&&h.categories?1:d.pointRange;if(r(e))f.counters.color=e;var e=[],k=[],l=a?a.length:[],m=(i=this.pointArrayMap)&& +i.length;if(l>(d.turboThreshold||1E3)){for(i=0;g===null&&i1&&e[1]k||this.forceCrop))if(a=i.getExtremes(),i=a.min,k=a.max,b[d-1]k)b=[],c=[];else if(b[0]k){for(a=0;a=i){e=s(0,a-1);break}for(;ak){f=a+1;break}b=b.slice(e,f);c=c.slice(e,f);g=!0}for(a=b.length-1;a>0;a--)if(d=b[a]-b[a-1],d>0&&(h===A||d=0&&c<=d;)i[c++]=g}this.tooltipPoints=i}},tooltipHeaderFormatter:function(a){var b=this.tooltipOptions,c=b.xDateFormat,d=this.xAxis,e=d&&d.options.type==="datetime", +f;if(e&&!c)for(f in D)if(D[f]>=d.closestPointRange){c=b.dateTimeLabelFormats[f];break}return b.headerFormat.replace("{point.key}",e&&Da(a)?db(c,a):a).replace("{series.name}",this.name).replace("{series.color}",this.color)},onMouseOver:function(){var a=this.chart,b=a.hoverSeries;if(b&&b!==this)b.onMouseOut();this.options.events.mouseOver&&F(this,"mouseOver");this.setState("hover");a.hoverSeries=this},onMouseOut:function(){var a=this.options,b=this.chart,c=b.tooltip,d=b.hoverPoint;if(d)d.onMouseOut(); +this&&a.events.mouseOut&&F(this,"mouseOut");c&&!a.stickyTracking&&!c.shared&&c.hide();this.setState();b.hoverSeries=null},animate:function(a){var b=this,c=b.chart,d=c.renderer,e;e=b.options.animation;var f=c.clipBox,g=c.inverted,h;if(e&&!Y(e))e=X[b.type].animation;h="_sharedClip"+e.duration+e.easing;if(a)a=c[h],e=c[h+"m"],a||(c[h]=a=d.clipRect(x(f,{width:0})),c[h+"m"]=e=d.clipRect(-99,g?-c.plotLeft:-c.plotTop,99,g?c.chartWidth:c.chartHeight)),b.group.clip(a),b.markerGroup.clip(e),b.sharedClipKey= +h;else{if(a=c[h])a.animate({width:c.plotSizeX},e),c[h+"m"].animate({width:c.plotSizeX+99},e);b.animate=null;b.animationTimeout=setTimeout(function(){b.afterAnimate()},e.duration)}},afterAnimate:function(){var a=this.chart,b=this.sharedClipKey,c=this.group,d=this.trackerGroup;c&&this.options.clip!==!1&&(c.clip(a.clipRect),d&&d.clip(a.clipRect),this.markerGroup.clip());setTimeout(function(){b&&a[b]&&(a[b]=a[b].destroy(),a[b+"m"]=a[b+"m"].destroy())},100)},drawPoints:function(){var a,b=this.points,c= +this.chart,d,e,f,g,h,i,j,k,l=this.options.marker,m,o=this.markerGroup;if(l.enabled||this._hasPointMarkers)for(f=b.length;f--;)if(g=b[f],d=g.plotX,e=g.plotY,k=g.graphic,i=g.marker||{},a=l.enabled&&i.enabled===A||i.enabled,m=c.isInsidePlot(d,e,c.inverted),a&&e!==A&&!isNaN(e))if(a=g.pointAttr[g.selected?"select":""],h=a.r,i=n(i.symbol,this.symbol),j=i.indexOf("url")===0,k)k.attr({visibility:m?ca?"inherit":"visible":"hidden"}).animate(x({x:d-h,y:e-h},k.symbolName?{width:2*h,height:2*h}:{}));else{if(m&& +(h>0||j))g.graphic=c.renderer.symbol(i,d-h,e-h,2*h,2*h).attr(a).add(o)}else if(k)g.graphic=k.destroy()},convertAttribs:function(a,b,c,d){var e=this.pointAttrToOptions,f,g,h={},a=a||{},b=b||{},c=c||{},d=d||{};for(f in e)g=e[f],h[f]=n(a[g],b[f],c[f],d[f]);return h},getAttribs:function(){var a=this,b=X[a.type].marker?a.options.marker:a.options,c=b.states,d=c.hover,e,f=a.color,g={stroke:f,fill:f},h=a.points||[],i=[],j,k=a.pointAttrToOptions,l;a.options.marker?(d.radius=d.radius||b.radius+2,d.lineWidth= +d.lineWidth||b.lineWidth+1):d.color=d.color||qa(d.color||f).brighten(d.brightness).get();i[""]=a.convertAttribs(b,g);o(["hover","select"],function(b){i[b]=a.convertAttribs(c[b],i[""])});a.pointAttr=i;for(f=h.length;f--;){g=h[f];if((b=g.options&&g.options.marker||g.options)&&b.enabled===!1)b.radius=0;e=a.options.colorByPoint;if(g.options)for(l in k)r(b[k[l]])&&(e=!0);if(e){b=b||{};j=[];c=b.states||{};e=c.hover=c.hover||{};if(!a.options.marker)e.color=qa(e.color||g.color).brighten(e.brightness||d.brightness).get(); +j[""]=a.convertAttribs(x({color:g.color},b),i[""]);j.hover=a.convertAttribs(c.hover,i.hover,j[""]);j.select=a.convertAttribs(c.select,i.select,j[""])}else j=i;g.pointAttr=j}},destroy:function(){var a=this,b=a.chart,c=/AppleWebKit\/533/.test(na),d,e,f=a.data||[],g,h,i;F(a,"destroy");R(a);o(["xAxis","yAxis"],function(b){if(i=a[b])ta(i.series,a),i.isDirty=!0});a.legendItem&&a.chart.legend.destroyItem(a);for(e=f.length;e--;)(g=f[e])&&g.destroy&&g.destroy();a.points=null;clearTimeout(a.animationTimeout); +o("area,graph,dataLabelsGroup,group,markerGroup,tracker,trackerGroup".split(","),function(b){a[b]&&(d=c&&b==="group"?"hide":"destroy",a[b][d]())});if(b.hoverSeries===a)b.hoverSeries=null;ta(b.series,a);for(h in a)delete a[h]},drawDataLabels:function(){var a=this,b=a.options.dataLabels,c=a.points,d,e,f,g;if(b.enabled||a._hasPointLabels)a.dlProcessOptions&&a.dlProcessOptions(b),g=a.plotGroup("dataLabelsGroup","data-labels",a.visible?"visible":"hidden",b.zIndex||6),e=b,o(c,function(c){var i,j=c.dataLabel, +k,l=!0;d=c.options&&c.options.dataLabels;i=e.enabled||d&&d.enabled;if(j&&!i)c.dataLabel=j.destroy();else if(i){i=b.rotation;b=B(e,d);f=b.formatter.call(c.getLabelConfig(),b);b.style.color=n(b.color,b.style.color,a.color,"black");if(j)j.attr({text:f}),l=!1;else if(r(f)){j={fill:b.backgroundColor,stroke:b.borderColor,"stroke-width":b.borderWidth,r:b.borderRadius||0,rotation:i,padding:b.padding,zIndex:1};for(k in j)j[k]===A&&delete j[k];j=c.dataLabel=a.chart.renderer[i?"text":"label"](f,0,-999,null, +null,null,b.useHTML).attr(j).css(b.style).add(g).shadow(b.shadow)}j&&a.alignDataLabel(c,j,b,null,l)}})},alignDataLabel:function(a,b,c,d,e){var f=this.chart,g=f.inverted,h=n(a.plotX,-999),a=n(a.plotY,-999),i=b.getBBox(),d=x({x:g?f.plotWidth-a:h,y:u(g?f.plotHeight-h:a),width:0,height:0},d);x(c,{width:i.width,height:i.height});c.rotation?(d={align:c.align,x:d.x+c.x+d.width/2,y:d.y+c.y+d.height/2},b[e?"attr":"animate"](d)):(b.align(c,null,d),d=b.alignAttr);b.attr({visibility:c.crop===!1||f.isInsidePlot(d.x, +d.y)||f.isInsidePlot(h,a,g)?f.renderer.isSVG?"inherit":"visible":"hidden"})},getSegmentPath:function(a){var b=this,c=[],d=b.options.step;o(a,function(e,f){var g=e.plotX,h=e.plotY,i;b.getPointSpline?c.push.apply(c,b.getPointSpline(a,e,f)):(c.push(f?"L":"M"),d&&f&&(i=a[f-1],d==="right"?c.push(i.plotX,h):d==="center"?c.push((i.plotX+g)/2,i.plotY,(i.plotX+g)/2,h):c.push(g,i.plotY)),c.push(e.plotX,e.plotY))});return c},getGraphPath:function(){var a=this,b=[],c,d=[];o(a.segments,function(e){c=a.getSegmentPath(e); +e.length>1?b=b.concat(c):d.push(e[0])});a.singlePoints=d;return a.graphPath=b},drawGraph:function(){var a=this.options,b=this.graph,c=this.group,d=a.lineColor||this.color,e=a.lineWidth,f=a.dashStyle,g=this.getGraphPath();if(b)fb(b),b.animate({d:g});else if(e){b={stroke:d,"stroke-width":e,zIndex:1};if(f)b.dashstyle=f;this.graph=this.chart.renderer.path(g).attr(b).add(c).shadow(a.shadow)}},invertGroups:function(){function a(){var a={width:b.yAxis.len,height:b.xAxis.len};o(["group","trackerGroup","markerGroup"], +function(c){b[c]&&b[c].attr(a).invert()})}var b=this,c=b.chart;J(c,"resize",a);J(b,"destroy",function(){R(c,"resize",a)});a();b.invertGroups=a},plotGroup:function(a,b,c,d,e){var f=this[a],g=this.chart,h=this.xAxis,i=this.yAxis;f||(this[a]=f=g.renderer.g(b).attr({visibility:c,zIndex:d||0.1}).add(e));f.translate(h?h.left:g.plotLeft,i?i.top:g.plotTop);return f},render:function(){var a=this.chart,b,c=this.options,d=c.animation&&!!this.animate,e=this.visible?"visible":"hidden",f=c.zIndex,g=this.hasRendered, +h=a.seriesGroup;b=this.plotGroup("group","series",e,f,h);this.markerGroup=this.plotGroup("markerGroup","markers",e,f,h);d&&this.animate(!0);this.getAttribs();b.inverted=a.inverted;this.drawGraph&&this.drawGraph();this.drawPoints();this.drawDataLabels();this.options.enableMouseTracking!==!1&&this.drawTracker();a.inverted&&this.invertGroups();c.clip!==!1&&!this.sharedClipKey&&!g&&(b.clip(a.clipRect),this.trackerGroup&&this.trackerGroup.clip(a.clipRect));d?this.animate():g||this.afterAnimate();this.isDirty= +this.isDirtyData=!1;this.hasRendered=!0},redraw:function(){var a=this.chart,b=this.isDirtyData,c=this.group;c&&(a.inverted&&c.attr({width:a.plotWidth,height:a.plotHeight}),c.animate({translateX:this.xAxis.left,translateY:this.yAxis.top}));this.translate();this.setTooltipPoints(!0);this.render();b&&F(this,"updatedData")},setState:function(a){var b=this.options,c=this.graph,d=b.states,b=b.lineWidth,a=a||"";if(this.state!==a)this.state=a,d[a]&&d[a].enabled===!1||(a&&(b=d[a].lineWidth||b+1),c&&!c.dashstyle&& +c.attr({"stroke-width":b},a?0:500))},setVisible:function(a,b){var c=this.chart,d=this.legendItem,e=this.group,f=this.tracker,g=this.dataLabelsGroup,h=this.markerGroup,i,j=this.points,k=c.options.chart.ignoreHiddenSeries;i=this.visible;i=(this.visible=a=a===A?!i:a)?"show":"hide";if(e)e[i]();if(h)h[i]();if(f)f[i]();else if(j)for(e=j.length;e--;)if(f=j[e],f.tracker)f.tracker[i]();if(c.hoverSeries===this)this.onMouseOut();if(g)g[i]();d&&c.legend.colorizeItem(this,a);this.isDirty=!0;this.options.stacking&& +o(c.series,function(a){if(a.options.stacking&&a.visible)a.isDirty=!0});if(k)c.isDirtyBox=!0;b!==!1&&c.redraw();F(this,i)},show:function(){this.setVisible(!0)},hide:function(){this.setVisible(!1)},select:function(a){this.selected=a=a===A?!this.selected:a;if(this.checkbox)this.checkbox.checked=a;F(this,a?"select":"unselect")},drawTracker:function(){var a=this,b=a.options,c=b.trackByArea,d=[].concat(c?a.areaPath:a.graphPath),e=d.length,f=a.chart,g=f.renderer,h=f.options.tooltip.snap,i=a.tracker,j=b.cursor, +j=j&&{cursor:j},k=a.singlePoints,l=this.isCartesian&&this.plotGroup("trackerGroup",null,"visible",b.zIndex||1,f.trackerGroup),m,n=function(){if(f.hoverSeries!==a)a.onMouseOver()},o=function(){if(!b.stickyTracking)a.onMouseOut()};if(e&&!c)for(m=e+1;m--;)d[m]==="M"&&d.splice(m+1,0,d[m+1]-h,d[m+2],"L"),(m&&d[m]==="M"||m===e)&&d.splice(m,0,"L",d[m-2]+h,d[m-1]);for(m=0;m=0;d--)da&&i>e?(i=s(a,e),k=2*e-i):ig&&k>e?(k=s(g,e),i=2*e-k):kw?g-w:z-(f<=z?w:0));c.barX=i;c.pointWidth=u;c.shapeType= +"rect";c.shapeArgs=f=b.renderer.Element.prototype.crisp.call(0,e,i,j,x,k);e%2&&(f.y-=1,f.height+=1);c.trackerArgs=M(k)<3&&B(c.shapeArgs,{height:6,y:j-3})})},getSymbol:pa,drawLegendSymbol:G.prototype.drawLegendSymbol,drawGraph:pa,drawPoints:function(){var a=this,b=a.options,c=a.chart.renderer,d;o(a.points,function(e){var f=e.plotY,g=e.graphic;if(f!==A&&!isNaN(f)&&e.y!==null)d=e.shapeArgs,g?(fb(g),g.animate(B(d))):e.graphic=c[e.shapeType](d).attr(e.pointAttr[e.selected?"select":""]).add(a.group).shadow(b.shadow, +null,b.stacking&&!b.borderRadius);else if(g)e.graphic=g.destroy()})},drawTracker:function(){for(var a=this,b=a.chart,c=b.renderer,d,e,f=+new Date,g=a.options,h=(d=g.cursor)&&{cursor:d},i=a.isCartesian&&a.plotGroup("trackerGroup",null,"visible",g.zIndex||1,b.trackerGroup),j,k,l=a.points,m,n=l.length,o=function(c){j=c.relatedTarget||c.fromElement;if(b.hoverSeries!==a&&w(j,"isTracker")!==f)a.onMouseOver();l[c.target._i].onMouseOver()},r=function(b){if(!g.stickyTracking&&(j=b.relatedTarget||b.toElement, +w(j,"isTracker")!==f))a.onMouseOut()};n--;)if(m=l[n],e=m.tracker,d=m.trackerArgs||m.shapeArgs,k=m.plotY,k=!a.isCartesian||k!==A&&!isNaN(k),delete d.strokeWidth,m.y!==null&&k){if(e)e.attr(d);else if(m.tracker=e=c[m.shapeType](d).attr({isTracker:f,fill:vb,visibility:a.visible?"visible":"hidden"}).on("mouseover",o).on("mouseout",r).css(h).add(m.group||i),Ba)e.on("touchstart",o);e.element._i=n}},alignDataLabel:function(a,b,c,d,e){var f=this.chart,g=f.inverted,h=a.below||a.plotY>n(this.translatedThreshold, +f.plotSizeY),i=this.options.stacking||c.inside;if(a.shapeArgs&&(d=B(a.shapeArgs),g&&(d={x:f.plotWidth-d.y-d.height,y:f.plotHeight-d.x-d.width,width:d.height,height:d.width}),!i))g?(d.x+=h?0:d.width,d.width=0):(d.y+=h?d.height:0,d.height=0);c.align=n(c.align,!g||i?"center":h?"right":"left");c.verticalAlign=n(c.verticalAlign,g||i?"middle":h?"top":"bottom");P.prototype.alignDataLabel.call(this,a,b,c,d,e)},animate:function(a){var b=this,c=b.points,d=b.options;if(!a)o(c,function(a){var c=a.graphic,a=a.shapeArgs, +g=b.yAxis,h=d.threshold;c&&(c.attr({height:0,y:r(h)?g.getThreshold(h):g.translate(g.getExtremes().min,0,1,0,1)}),c.animate({height:a.height,y:a.y},d.animation))}),b.animate=null},remove:function(){var a=this,b=a.chart;b.hasRendered&&o(b.series,function(b){if(b.type===a.type)b.isDirty=!0});P.prototype.remove.apply(a,arguments)}});$.column=fa;X.bar=B(X.column);Ca=ba(fa,{type:"bar",inverted:!0});$.bar=Ca;X.scatter=B(ea,{lineWidth:0,states:{hover:{lineWidth:0}},tooltip:{headerFormat:'{series.name}
', +pointFormat:"x: {point.x}
y: {point.y}
"}});Ca=ba(P,{type:"scatter",sorted:!1,requireSorting:!1,translate:function(){var a=this;P.prototype.translate.apply(a);o(a.points,function(b){b.shapeType="circle";b.shapeArgs={x:b.plotX,y:b.plotY,r:a.chart.options.tooltip.snap}})},drawTracker:function(){for(var a=this,b=a.options.cursor,b=b&&{cursor:b},c=a.points,d=c.length,e,f=a.markerGroup,g=function(b){a.onMouseOver();if(b.target._i!==A)c[b.target._i].onMouseOver()};d--;)if(e=c[d].graphic)e.element._i= +d;if(a._hasTracking)a._hasTracking=!0;else if(f.attr({isTracker:!0}).on("mouseover",g).on("mouseout",function(){if(!a.options.stickyTracking)a.onMouseOut()}).css(b),Ba)f.on("touchstart",g)},setTooltipPoints:pa});$.scatter=Ca;X.pie=B(ea,{borderColor:"#FFFFFF",borderWidth:1,center:["50%","50%"],colorByPoint:!0,dataLabels:{distance:30,enabled:!0,formatter:function(){return this.point.name}},legendType:"point",marker:null,size:"75%",showInLegend:!1,slicedOffset:10,states:{hover:{brightness:0.1,shadow:!1}}}); +pa={type:"pie",isCartesian:!1,pointClass:ba(Ua,{init:function(){Ua.prototype.init.apply(this,arguments);var a=this,b;x(a,{visible:a.visible!==!1,name:n(a.name,"Slice")});b=function(){a.slice()};J(a,"select",b);J(a,"unselect",b);return a},setVisible:function(a){var b=this.series,c=b.chart,d=this.tracker,e=this.dataLabel,f=this.connector,g=this.shadowGroup,h;h=(this.visible=a=a===A?!this.visible:a)?"show":"hide";this.group[h]();if(d)d[h]();if(e)e[h]();if(f)f[h]();if(g)g[h]();this.legendItem&&c.legend.colorizeItem(this, +a);if(!b.isDirty&&b.options.ignoreHiddenPoint)b.isDirty=!0,c.redraw()},slice:function(a,b,c){var d=this.series.chart,e=this.slicedTranslation;xa(c,d);n(b,!0);a=this.sliced=r(a)?a:!this.sliced;a={translateX:a?e[0]:d.plotLeft,translateY:a?e[1]:d.plotTop};this.group.animate(a);this.shadowGroup&&this.shadowGroup.animate(a)}}),requireSorting:!1,pointAttrToOptions:{stroke:"borderColor","stroke-width":"borderWidth",fill:"color"},getColor:function(){this.initialColor=this.chart.counters.color},animate:function(){var a= +this,b=a.startAngleRad;o(a.points,function(c){var d=c.graphic,c=c.shapeArgs;d&&(d.attr({r:a.center[3]/2,start:b,end:b}),d.animate({r:c.r,start:c.start,end:c.end},a.options.animation))});a.animate=null},setData:function(a,b){P.prototype.setData.call(this,a,!1);this.processData();this.generatePoints();n(b,!0)&&this.chart.redraw()},getCenter:function(){var a=this.options,b=this.chart,c=b.plotWidth,d=b.plotHeight,a=a.center.concat([a.size,a.innerSize||0]),e=O(c,d),f;return Ta(a,function(a,b){return(f= +/%$/.test(a))?[c,d,e,e][b]*z(a)/100:a})},translate:function(){this.generatePoints();var a=0,b=0,c=this.options,d=c.slicedOffset,e=d+c.borderWidth,f,g=this.chart,h,i,j,k=this.startAngleRad=Aa/180*((c.startAngle||0)%360-90),l=this.points,m=2*Aa,n=c.dataLabels.distance,o=c.ignoreHiddenPoint,r,t=l.length,s;this.center=f=this.getCenter();this.getX=function(a,b){j=K.asin((a-f[1])/(f[2]/2+n));return f[0]+(b?-1:1)*W(j)*(f[2]/2+n)};for(r=0;r0.75*m&&(j-=2*Aa);s.slicedTranslation=Ta([W(j)*d+g.plotLeft,Z(j)*d+g.plotTop],u);h=W(j)*f[2]/2;i=Z(j)*f[2]/2;s.tooltipPos=[f[0]+h*0.7,f[1]+i*0.7];s.half=j0,p=[[],[]],r,t,s,u=2,v,x=function(a,b){return b.y- +a.y},z=function(a,b){a.sort(function(a,c){return(c.angle-a.angle)*b})};if(d.enabled||this._hasPointLabels){P.prototype.drawDataLabels.apply(this);o(a,function(a){a.dataLabel&&p[a.half].push(a)});for(a=p[0][0]&&p[0][0].dataLabel&&(p[0][0].dataLabel.getBBox().height||21);u--;){var w=[],A=[],B=p[u],C=B.length,D;z(B,u-0.5);if(j>0){for(v=m-l-j;v<=m+l+j;v+=a)w.push(v);s=w.length;if(C>s){h=[].concat(B);h.sort(x);for(v=C;v--;)h[v].rank=v;for(v=C;v--;)B[v].rank>=s&&B.splice(v,1);C=B.length}for(v=0;v0){if(t=A.pop(),D=t.i,t=t.y,r>t&&w[D+1]!==null||r type pairs + class2type = {}, + + // List of deleted data cache ids, so we can reuse them + core_deletedIds = [], + + core_version = "2.0.0pre", + + // Save a reference to some core methods + core_concat = core_deletedIds.concat, + core_push = core_deletedIds.push, + core_slice = core_deletedIds.slice, + core_indexOf = core_deletedIds.indexOf, + core_toString = class2type.toString, + core_hasOwn = class2type.hasOwnProperty, + core_trim = core_version.trim, + + // Define a local copy of jQuery + jQuery = function( selector, context ) { + // The jQuery object is actually just the init constructor 'enhanced' + return new jQuery.fn.init( selector, context, rootjQuery ); + }, + + // Used for matching numbers + core_pnum = /[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/.source, + + // Used for splitting on whitespace + core_rnotwhite = /\S+/g, + + // A simple way to check for HTML strings + // Prioritize #id over to avoid XSS via location.hash (#9521) + // Strict HTML recognition (#11290: must start with <) + rquickExpr = /^(?:(<[\w\W]+>)[^>]*|#([\w-]*))$/, + + // Match a standalone tag + rsingleTag = /^<(\w+)\s*\/?>(?:<\/\1>|)$/, + + // Matches dashed string for camelizing + rmsPrefix = /^-ms-/, + rdashAlpha = /-([\da-z])/gi, + + // Used by jQuery.camelCase as callback to replace() + fcamelCase = function( all, letter ) { + return letter.toUpperCase(); + }, + + // The ready event handler and self cleanup method + DOMContentLoaded = function() { + document.removeEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + jQuery.ready(); + }; + +jQuery.fn = jQuery.prototype = { + // The current version of jQuery being used + jquery: core_version, + + constructor: jQuery, + init: function( selector, context, rootjQuery ) { + var match, elem; + + // HANDLE: $(""), $(null), $(undefined), $(false) + if ( !selector ) { + return this; + } + + // Handle HTML strings + if ( typeof selector === "string" ) { + if ( selector.charAt(0) === "<" && selector.charAt( selector.length - 1 ) === ">" && selector.length >= 3 ) { + // Assume that strings that start and end with <> are HTML and skip the regex check + match = [ null, selector, null ]; + + } else { + match = rquickExpr.exec( selector ); + } + + // Match html or make sure no context is specified for #id + if ( match && (match[1] || !context) ) { + + // HANDLE: $(html) -> $(array) + if ( match[1] ) { + context = context instanceof jQuery ? context[0] : context; + + // scripts is true for back-compat + jQuery.merge( this, jQuery.parseHTML( + match[1], + context && context.nodeType ? context.ownerDocument || context : document, + true + ) ); + + // HANDLE: $(html, props) + if ( rsingleTag.test( match[1] ) && jQuery.isPlainObject( context ) ) { + for ( match in context ) { + // Properties of context are called as methods if possible + if ( jQuery.isFunction( this[ match ] ) ) { + this[ match ]( context[ match ] ); + + // ...and otherwise set as attributes + } else { + this.attr( match, context[ match ] ); + } + } + } + + return this; + + // HANDLE: $(#id) + } else { + elem = document.getElementById( match[2] ); + + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + if ( elem && elem.parentNode ) { + // Handle the case where IE and Opera return items + // by name instead of ID + if ( elem.id !== match[2] ) { + return rootjQuery.find( selector ); + } + + // Otherwise, we inject the element directly into the jQuery object + this.length = 1; + this[0] = elem; + } + + this.context = document; + this.selector = selector; + return this; + } + + // HANDLE: $(expr, $(...)) + } else if ( !context || context.jquery ) { + return ( context || rootjQuery ).find( selector ); + + // HANDLE: $(expr, context) + // (which is just equivalent to: $(context).find(expr) + } else { + return this.constructor( context ).find( selector ); + } + + // HANDLE: $(DOMElement) + } else if ( selector.nodeType ) { + this.context = this[0] = selector; + this.length = 1; + return this; + + // HANDLE: $(function) + // Shortcut for document ready + } else if ( jQuery.isFunction( selector ) ) { + return rootjQuery.ready( selector ); + } + + if ( selector.selector !== undefined ) { + this.selector = selector.selector; + this.context = selector.context; + } + + return jQuery.makeArray( selector, this ); + }, + + // Start with an empty selector + selector: "", + + // The default length of a jQuery object is 0 + length: 0, + + // The number of elements contained in the matched element set + size: function() { + return this.length; + }, + + toArray: function() { + return core_slice.call( this ); + }, + + // Get the Nth element in the matched element set OR + // Get the whole matched element set as a clean array + get: function( num ) { + return num == null ? + + // Return a 'clean' array + this.toArray() : + + // Return just the object + ( num < 0 ? this[ this.length + num ] : this[ num ] ); + }, + + // Take an array of elements and push it onto the stack + // (returning the new matched element set) + pushStack: function( elems ) { + + // Build a new jQuery matched element set + var ret = jQuery.merge( this.constructor(), elems ); + + // Add the old object onto the stack (as a reference) + ret.prevObject = this; + ret.context = this.context; + + // Return the newly-formed element set + return ret; + }, + + // Execute a callback for every element in the matched set. + // (You can seed the arguments with an array of args, but this is + // only used internally.) + each: function( callback, args ) { + return jQuery.each( this, callback, args ); + }, + + ready: function( fn ) { + // Add the callback + jQuery.ready.promise().done( fn ); + + return this; + }, + + slice: function() { + return this.pushStack( core_slice.apply( this, arguments ) ); + }, + + first: function() { + return this.eq( 0 ); + }, + + last: function() { + return this.eq( -1 ); + }, + + eq: function( i ) { + var len = this.length, + j = +i + ( i < 0 ? len : 0 ); + return this.pushStack( j >= 0 && j < len ? [ this[j] ] : [] ); + }, + + map: function( callback ) { + return this.pushStack( jQuery.map(this, function( elem, i ) { + return callback.call( elem, i, elem ); + })); + }, + + end: function() { + return this.prevObject || this.constructor(null); + }, + + // For internal use only. + // Behaves like an Array's method, not like a jQuery method. + push: core_push, + sort: [].sort, + splice: [].splice +}; + +// Give the init function the jQuery prototype for later instantiation +jQuery.fn.init.prototype = jQuery.fn; + +jQuery.extend = jQuery.fn.extend = function() { + var options, name, src, copy, copyIsArray, clone, + target = arguments[0] || {}, + i = 1, + length = arguments.length, + deep = false; + + // Handle a deep copy situation + if ( typeof target === "boolean" ) { + deep = target; + target = arguments[1] || {}; + // skip the boolean and the target + i = 2; + } + + // Handle case when target is a string or something (possible in deep copy) + if ( typeof target !== "object" && !jQuery.isFunction(target) ) { + target = {}; + } + + // extend jQuery itself if only one argument is passed + if ( length === i ) { + target = this; + --i; + } + + for ( ; i < length; i++ ) { + // Only deal with non-null/undefined values + if ( (options = arguments[ i ]) != null ) { + // Extend the base object + for ( name in options ) { + src = target[ name ]; + copy = options[ name ]; + + // Prevent never-ending loop + if ( target === copy ) { + continue; + } + + // Recurse if we're merging plain objects or arrays + if ( deep && copy && ( jQuery.isPlainObject(copy) || (copyIsArray = jQuery.isArray(copy)) ) ) { + if ( copyIsArray ) { + copyIsArray = false; + clone = src && jQuery.isArray(src) ? src : []; + + } else { + clone = src && jQuery.isPlainObject(src) ? src : {}; + } + + // Never move original objects, clone them + target[ name ] = jQuery.extend( deep, clone, copy ); + + // Don't bring in undefined values + } else if ( copy !== undefined ) { + target[ name ] = copy; + } + } + } + } + + // Return the modified object + return target; +}; + +jQuery.extend({ + noConflict: function( deep ) { + if ( window.$ === jQuery ) { + window.$ = _$; + } + + if ( deep && window.jQuery === jQuery ) { + window.jQuery = _jQuery; + } + + return jQuery; + }, + + // Is the DOM ready to be used? Set to true once it occurs. + isReady: false, + + // A counter to track how many items to wait for before + // the ready event fires. See #6781 + readyWait: 1, + + // Hold (or release) the ready event + holdReady: function( hold ) { + if ( hold ) { + jQuery.readyWait++; + } else { + jQuery.ready( true ); + } + }, + + // Handle when the DOM is ready + ready: function( wait ) { + + // Abort if there are pending holds or we're already ready + if ( wait === true ? --jQuery.readyWait : jQuery.isReady ) { + return; + } + + // Remember that the DOM is ready + jQuery.isReady = true; + + // If a normal DOM Ready event fired, decrement, and wait if need be + if ( wait !== true && --jQuery.readyWait > 0 ) { + return; + } + + // If there are functions bound, to execute + readyList.resolveWith( document, [ jQuery ] ); + + // Trigger any bound ready events + if ( jQuery.fn.trigger ) { + jQuery( document ).trigger("ready").off("ready"); + } + }, + + // See test/unit/core.js for details concerning isFunction. + // Since version 1.3, DOM methods and functions like alert + // aren't supported. They return false on IE (#2968). + isFunction: function( obj ) { + return jQuery.type(obj) === "function"; + }, + + isArray: Array.isArray, + + isWindow: function( obj ) { + return obj != null && obj == obj.window; + }, + + isNumeric: function( obj ) { + return !isNaN( parseFloat(obj) ) && isFinite( obj ); + }, + + type: function( obj ) { + if ( obj == null ) { + return String( obj ); + } + return typeof obj === "object" || typeof obj === "function" ? + class2type[ core_toString.call(obj) ] || "object" : + typeof obj; + }, + + isPlainObject: function( obj ) { + // Not plain objects: + // - Any object or value whose internal [[Class]] property is not "[object Object]" + // - DOM nodes + // - window + if ( jQuery.type( obj ) !== "object" || obj.nodeType || jQuery.isWindow( obj ) ) { + return false; + } + + // Support: Firefox >16 + // The try/catch supresses exceptions thrown when attempting to access + // the "constructor" property of certain host objects, ie. |window.location| + try { + if ( obj.constructor && + !core_hasOwn.call( obj.constructor.prototype, "isPrototypeOf" ) ) { + return false; + } + } catch ( e ) { + return false; + } + + // If the function hasn't returned already, we're confident that + // |obj| is a plain object, created by {} or constructed with new Object + return true; + }, + + isEmptyObject: function( obj ) { + var name; + for ( name in obj ) { + return false; + } + return true; + }, + + error: function( msg ) { + throw new Error( msg ); + }, + + // data: string of html + // context (optional): If specified, the fragment will be created in this context, defaults to document + // keepScripts (optional): If true, will include scripts passed in the html string + parseHTML: function( data, context, keepScripts ) { + if ( !data || typeof data !== "string" ) { + return null; + } + if ( typeof context === "boolean" ) { + keepScripts = context; + context = false; + } + context = context || document; + + var parsed = rsingleTag.exec( data ), + scripts = !keepScripts && []; + + // Single tag + if ( parsed ) { + return [ context.createElement( parsed[1] ) ]; + } + + parsed = context.createDocumentFragment(); + jQuery.clean( [ data ], context, parsed, scripts ); + if ( scripts ) { + jQuery( scripts ).remove(); + } + return jQuery.merge( [], parsed.childNodes ); + }, + + parseJSON: JSON.parse, + + // Cross-browser xml parsing + parseXML: function( data ) { + var xml, tmp; + if ( !data || typeof data !== "string" ) { + return null; + } + + // Support: IE9 + try { + tmp = new DOMParser(); + xml = tmp.parseFromString( data , "text/xml" ); + } catch ( e ) { + xml = undefined; + } + + if ( !xml || xml.getElementsByTagName( "parsererror" ).length ) { + jQuery.error( "Invalid XML: " + data ); + } + return xml; + }, + + noop: function() {}, + + // Evaluates a script in a global context + globalEval: function( data ) { + var indirect = eval; + if ( jQuery.trim( data ) ) { + indirect( data + ";" ); + } + }, + + // Convert dashed to camelCase; used by the css and data modules + // Microsoft forgot to hump their vendor prefix (#9572) + camelCase: function( string ) { + return string.replace( rmsPrefix, "ms-" ).replace( rdashAlpha, fcamelCase ); + }, + + nodeName: function( elem, name ) { + return elem.nodeName && elem.nodeName.toLowerCase() === name.toLowerCase(); + }, + + // args is for internal usage only + each: function( obj, callback, args ) { + var value, + i = 0, + length = obj.length, + isArray = isArraylike( obj ); + + if ( args ) { + if ( isArray ) { + for ( ; i < length; i++ ) { + value = callback.apply( obj[ i ], args ); + + if ( value === false ) { + break; + } + } + } else { + for ( i in obj ) { + value = callback.apply( obj[ i ], args ); + + if ( value === false ) { + break; + } + } + } + + // A special, fast, case for the most common use of each + } else { + if ( isArray ) { + for ( ; i < length; i++ ) { + value = callback.call( obj[ i ], i, obj[ i ] ); + + if ( value === false ) { + break; + } + } + } else { + for ( i in obj ) { + value = callback.call( obj[ i ], i, obj[ i ] ); + + if ( value === false ) { + break; + } + } + } + } + + return obj; + }, + + trim: function( text ) { + return text == null ? "" : core_trim.call( text ); + }, + + // results is for internal usage only + makeArray: function( arr, results ) { + var ret = results || []; + + if ( arr != null ) { + if ( isArraylike( Object(arr) ) ) { + jQuery.merge( ret, + typeof arr === "string" ? + [ arr ] : arr + ); + } else { + core_push.call( ret, arr ); + } + } + + return ret; + }, + + inArray: function( elem, arr, i ) { + return arr == null ? -1 : core_indexOf.call( arr, elem, i ); + }, + + merge: function( first, second ) { + var l = second.length, + i = first.length, + j = 0; + + if ( typeof l === "number" ) { + for ( ; j < l; j++ ) { + first[ i++ ] = second[ j ]; + } + } else { + while ( second[j] !== undefined ) { + first[ i++ ] = second[ j++ ]; + } + } + + first.length = i; + + return first; + }, + + grep: function( elems, callback, inv ) { + var retVal, + ret = [], + i = 0, + length = elems.length; + inv = !!inv; + + // Go through the array, only saving the items + // that pass the validator function + for ( ; i < length; i++ ) { + retVal = !!callback( elems[ i ], i ); + if ( inv !== retVal ) { + ret.push( elems[ i ] ); + } + } + + return ret; + }, + + // arg is for internal usage only + map: function( elems, callback, arg ) { + var value, + i = 0, + length = elems.length, + isArray = isArraylike( elems ), + ret = []; + + // Go through the array, translating each of the items to their + if ( isArray ) { + for ( ; i < length; i++ ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret[ ret.length ] = value; + } + } + + // Go through every key on the object, + } else { + for ( i in elems ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret[ ret.length ] = value; + } + } + } + + // Flatten any nested arrays + return core_concat.apply( [], ret ); + }, + + // A global GUID counter for objects + guid: 1, + + // Bind a function to a context, optionally partially applying any + // arguments. + proxy: function( fn, context ) { + var tmp, args, proxy; + + if ( typeof context === "string" ) { + tmp = fn[ context ]; + context = fn; + fn = tmp; + } + + // Quick check to determine if target is callable, in the spec + // this throws a TypeError, but we will just return undefined. + if ( !jQuery.isFunction( fn ) ) { + return undefined; + } + + // Simulated bind + args = core_slice.call( arguments, 2 ); + proxy = function() { + return fn.apply( context || this, args.concat( core_slice.call( arguments ) ) ); + }; + + // Set the guid of unique handler to the same of original handler, so it can be removed + proxy.guid = fn.guid = fn.guid || jQuery.guid++; + + return proxy; + }, + + // Multifunctional method to get and set values of a collection + // The value/s can optionally be executed if it's a function + access: function( elems, fn, key, value, chainable, emptyGet, raw ) { + var i = 0, + length = elems.length, + bulk = key == null; + + // Sets many values + if ( jQuery.type( key ) === "object" ) { + chainable = true; + for ( i in key ) { + jQuery.access( elems, fn, i, key[i], true, emptyGet, raw ); + } + + // Sets one value + } else if ( value !== undefined ) { + chainable = true; + + if ( !jQuery.isFunction( value ) ) { + raw = true; + } + + if ( bulk ) { + // Bulk operations run against the entire set + if ( raw ) { + fn.call( elems, value ); + fn = null; + + // ...except when executing function values + } else { + bulk = fn; + fn = function( elem, key, value ) { + return bulk.call( jQuery( elem ), value ); + }; + } + } + + if ( fn ) { + for ( ; i < length; i++ ) { + fn( elems[i], key, raw ? value : value.call( elems[i], i, fn( elems[i], key ) ) ); + } + } + } + + return chainable ? + elems : + + // Gets + bulk ? + fn.call( elems ) : + length ? fn( elems[0], key ) : emptyGet; + }, + + now: Date.now +}); + +jQuery.ready.promise = function( obj ) { + if ( !readyList ) { + + readyList = jQuery.Deferred(); + + // Catch cases where $(document).ready() is called after the browser event has already occurred. + // we once tried to use readyState "interactive" here, but it caused issues like the one + // discovered by ChrisS here: http://bugs.jquery.com/ticket/12282#comment:15 + if ( document.readyState === "complete" ) { + // Handle it asynchronously to allow scripts the opportunity to delay ready + setTimeout( jQuery.ready ); + + // Standards-based browsers support DOMContentLoaded + } else { + // Use the handy event callback + document.addEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + + // A fallback to window.onload, that will always work + window.addEventListener( "load", jQuery.ready, false ); + } + } + return readyList.promise( obj ); +}; + +// Populate the class2type map +jQuery.each("Boolean Number String Function Array Date RegExp Object Error".split(" "), function(i, name) { + class2type[ "[object " + name + "]" ] = name.toLowerCase(); +}); + +function isArraylike( obj ) { + var length = obj.length, + type = jQuery.type( obj ); + + if ( jQuery.isWindow( obj ) ) { + return false; + } + + if ( obj.nodeType === 1 && length ) { + return true; + } + + return type === "array" || type !== "function" && + ( length === 0 || + typeof length === "number" && length > 0 && ( length - 1 ) in obj ); +} + +// All jQuery objects should point back to these +rootjQuery = jQuery(document); +// String to Object options format cache +var optionsCache = {}; + +// Convert String-formatted options into Object-formatted ones and store in cache +function createOptions( options ) { + var object = optionsCache[ options ] = {}; + jQuery.each( options.match( core_rnotwhite ) || [], function( _, flag ) { + object[ flag ] = true; + }); + return object; +} + +/* + * Create a callback list using the following parameters: + * + * options: an optional list of space-separated options that will change how + * the callback list behaves or a more traditional option object + * + * By default a callback list will act like an event callback list and can be + * "fired" multiple times. + * + * Possible options: + * + * once: will ensure the callback list can only be fired once (like a Deferred) + * + * memory: will keep track of previous values and will call any callback added + * after the list has been fired right away with the latest "memorized" + * values (like a Deferred) + * + * unique: will ensure a callback can only be added once (no duplicate in the list) + * + * stopOnFalse: interrupt callings when a callback returns false + * + */ +jQuery.Callbacks = function( options ) { + + // Convert options from String-formatted to Object-formatted if needed + // (we check in cache first) + options = typeof options === "string" ? + ( optionsCache[ options ] || createOptions( options ) ) : + jQuery.extend( {}, options ); + + var // Last fire value (for non-forgettable lists) + memory, + // Flag to know if list was already fired + fired, + // Flag to know if list is currently firing + firing, + // First callback to fire (used internally by add and fireWith) + firingStart, + // End of the loop when firing + firingLength, + // Index of currently firing callback (modified by remove if needed) + firingIndex, + // Actual callback list + list = [], + // Stack of fire calls for repeatable lists + stack = !options.once && [], + // Fire callbacks + fire = function( data ) { + memory = options.memory && data; + fired = true; + firingIndex = firingStart || 0; + firingStart = 0; + firingLength = list.length; + firing = true; + for ( ; list && firingIndex < firingLength; firingIndex++ ) { + if ( list[ firingIndex ].apply( data[ 0 ], data[ 1 ] ) === false && options.stopOnFalse ) { + memory = false; // To prevent further calls using add + break; + } + } + firing = false; + if ( list ) { + if ( stack ) { + if ( stack.length ) { + fire( stack.shift() ); + } + } else if ( memory ) { + list = []; + } else { + self.disable(); + } + } + }, + // Actual Callbacks object + self = { + // Add a callback or a collection of callbacks to the list + add: function() { + if ( list ) { + // First, we save the current length + var start = list.length; + (function add( args ) { + jQuery.each( args, function( _, arg ) { + var type = jQuery.type( arg ); + if ( type === "function" ) { + if ( !options.unique || !self.has( arg ) ) { + list.push( arg ); + } + } else if ( arg && arg.length && type !== "string" ) { + // Inspect recursively + add( arg ); + } + }); + })( arguments ); + // Do we need to add the callbacks to the + // current firing batch? + if ( firing ) { + firingLength = list.length; + // With memory, if we're not firing then + // we should call right away + } else if ( memory ) { + firingStart = start; + fire( memory ); + } + } + return this; + }, + // Remove a callback from the list + remove: function() { + if ( list ) { + jQuery.each( arguments, function( _, arg ) { + var index; + while( ( index = jQuery.inArray( arg, list, index ) ) > -1 ) { + list.splice( index, 1 ); + // Handle firing indexes + if ( firing ) { + if ( index <= firingLength ) { + firingLength--; + } + if ( index <= firingIndex ) { + firingIndex--; + } + } + } + }); + } + return this; + }, + // Control if a given callback is in the list + has: function( fn ) { + return jQuery.inArray( fn, list ) > -1; + }, + // Remove all callbacks from the list + empty: function() { + list = []; + return this; + }, + // Have the list do nothing anymore + disable: function() { + list = stack = memory = undefined; + return this; + }, + // Is it disabled? + disabled: function() { + return !list; + }, + // Lock the list in its current state + lock: function() { + stack = undefined; + if ( !memory ) { + self.disable(); + } + return this; + }, + // Is it locked? + locked: function() { + return !stack; + }, + // Call all callbacks with the given context and arguments + fireWith: function( context, args ) { + args = args || []; + args = [ context, args.slice ? args.slice() : args ]; + if ( list && ( !fired || stack ) ) { + if ( firing ) { + stack.push( args ); + } else { + fire( args ); + } + } + return this; + }, + // Call all the callbacks with the given arguments + fire: function() { + self.fireWith( this, arguments ); + return this; + }, + // To know if the callbacks have already been called at least once + fired: function() { + return !!fired; + } + }; + + return self; +}; +jQuery.extend({ + + Deferred: function( func ) { + var tuples = [ + // action, add listener, listener list, final state + [ "resolve", "done", jQuery.Callbacks("once memory"), "resolved" ], + [ "reject", "fail", jQuery.Callbacks("once memory"), "rejected" ], + [ "notify", "progress", jQuery.Callbacks("memory") ] + ], + state = "pending", + promise = { + state: function() { + return state; + }, + always: function() { + deferred.done( arguments ).fail( arguments ); + return this; + }, + then: function( /* fnDone, fnFail, fnProgress */ ) { + var fns = arguments; + return jQuery.Deferred(function( newDefer ) { + jQuery.each( tuples, function( i, tuple ) { + var action = tuple[ 0 ], + fn = fns[ i ]; + // deferred[ done | fail | progress ] for forwarding actions to newDefer + deferred[ tuple[1] ]( jQuery.isFunction( fn ) ? + function() { + var returned = fn.apply( this, arguments ); + if ( returned && jQuery.isFunction( returned.promise ) ) { + returned.promise() + .done( newDefer.resolve ) + .fail( newDefer.reject ) + .progress( newDefer.notify ); + } else { + newDefer[ action + "With" ]( this === promise ? newDefer.promise() : this, [ returned ] ); + } + } : + newDefer[ action ] + ); + }); + fns = null; + }).promise(); + }, + // Get a promise for this deferred + // If obj is provided, the promise aspect is added to the object + promise: function( obj ) { + return obj != null ? jQuery.extend( obj, promise ) : promise; + } + }, + deferred = {}; + + // Keep pipe for back-compat + promise.pipe = promise.then; + + // Add list-specific methods + jQuery.each( tuples, function( i, tuple ) { + var list = tuple[ 2 ], + stateString = tuple[ 3 ]; + + // promise[ done | fail | progress ] = list.add + promise[ tuple[1] ] = list.add; + + // Handle state + if ( stateString ) { + list.add(function() { + // state = [ resolved | rejected ] + state = stateString; + + // [ reject_list | resolve_list ].disable; progress_list.lock + }, tuples[ i ^ 1 ][ 2 ].disable, tuples[ 2 ][ 2 ].lock ); + } + + // deferred[ resolve | reject | notify ] + deferred[ tuple[0] ] = function() { + deferred[ tuple[0] + "With" ]( promise, arguments ); + return this; + }; + deferred[ tuple[0] + "With" ] = list.fireWith; + }); + + // Make the deferred a promise + promise.promise( deferred ); + + // Call given func if any + if ( func ) { + func.call( deferred, deferred ); + } + + // All done! + return deferred; + }, + + // Deferred helper + when: function( subordinate /* , ..., subordinateN */ ) { + var i = 0, + resolveValues = core_slice.call( arguments ), + length = resolveValues.length, + + // the count of uncompleted subordinates + remaining = length !== 1 || ( subordinate && jQuery.isFunction( subordinate.promise ) ) ? length : 0, + + // the master Deferred. If resolveValues consist of only a single Deferred, just use that. + deferred = remaining === 1 ? subordinate : jQuery.Deferred(), + + // Update function for both resolve and progress values + updateFunc = function( i, contexts, values ) { + return function( value ) { + contexts[ i ] = this; + values[ i ] = arguments.length > 1 ? core_slice.call( arguments ) : value; + if( values === progressValues ) { + deferred.notifyWith( contexts, values ); + } else if ( !( --remaining ) ) { + deferred.resolveWith( contexts, values ); + } + }; + }, + + progressValues, progressContexts, resolveContexts; + + // add listeners to Deferred subordinates; treat others as resolved + if ( length > 1 ) { + progressValues = new Array( length ); + progressContexts = new Array( length ); + resolveContexts = new Array( length ); + for ( ; i < length; i++ ) { + if ( resolveValues[ i ] && jQuery.isFunction( resolveValues[ i ].promise ) ) { + resolveValues[ i ].promise() + .done( updateFunc( i, resolveContexts, resolveValues ) ) + .fail( deferred.reject ) + .progress( updateFunc( i, progressContexts, progressValues ) ); + } else { + --remaining; + } + } + } + + // if we're not waiting on anything, resolve the master + if ( !remaining ) { + deferred.resolveWith( resolveContexts, resolveValues ); + } + + return deferred.promise(); + } +}); +jQuery.support = (function() { + + var support, all, a, select, opt, input, fragment, eventName, isSupported, i, + div = document.createElement("div"); + + // Setup + div.setAttribute( "className", "t" ); + div.innerHTML = "

a"; + + // Support tests won't run in some limited or non-browser environments + all = div.getElementsByTagName("*"); + a = div.getElementsByTagName("a")[ 0 ]; + if ( !all || !a || !all.length ) { + return {}; + } + + // First batch of tests + select = document.createElement("select"); + opt = select.appendChild( document.createElement("option") ); + input = div.getElementsByTagName("input")[ 0 ]; + + a.style.cssText = "float:left;opacity:.5"; + support = { + // Test setAttribute on camelCase class. If it works, we need attrFixes when doing get/setAttribute (ie6/7) + getSetAttribute: div.className !== "t", + + // IE strips leading whitespace when .innerHTML is used + leadingWhitespace: div.firstChild.nodeType === 3, + + // Make sure that tbody elements aren't automatically inserted + // IE will insert them into empty tables + tbody: !div.getElementsByTagName("tbody").length, + + // Make sure that link elements get serialized correctly by innerHTML + // This requires a wrapper element in IE + htmlSerialize: !!div.getElementsByTagName("link").length, + + // Make sure that element opacity exists + // (IE uses filter instead) + // Use a regex to work around a WebKit issue. See #5145 + opacity: /^0.5/.test( a.style.opacity ), + + // Verify style float existence + // (IE uses styleFloat instead of cssFloat) + cssFloat: !!a.style.cssFloat, + + // Check the default checkbox/radio value ("" on WebKit; "on" elsewhere) + checkOn: !!input.value, + + // Must access the parent to make an option select properly + // Support: IE9, IE10 + optSelected: opt.selected, + + // Makes sure cloning an html5 element does not cause problems + // Where outerHTML is undefined, this still works + html5Clone: document.createElement("nav").cloneNode( true ).outerHTML !== "<:nav>", + + // jQuery.support.boxModel DEPRECATED in 1.8 since we don't support Quirks Mode + boxModel: document.compatMode === "CSS1Compat", + + // Will be defined later + deleteExpando: true, + noCloneEvent: true, + inlineBlockNeedsLayout: false, + shrinkWrapBlocks: false, + reliableMarginRight: true, + boxSizingReliable: true, + pixelPosition: false + }; + + // Make sure checked status is properly cloned + input.checked = true; + support.noCloneChecked = input.cloneNode( true ).checked; + + // Make sure that the options inside disabled selects aren't marked as disabled + // (WebKit marks them as disabled) + select.disabled = true; + support.optDisabled = !opt.disabled; + + // Support: IE<9 + try { + delete div.test; + } catch( e ) { + support.deleteExpando = false; + } + + // Check if an input maintains its value after becoming a radio + input = document.createElement("input"); + input.value = "t"; + input.setAttribute( "type", "radio" ); + support.radioValue = input.value === "t"; + + // #11217 - WebKit loses check when the name is after the checked attribute + input.setAttribute( "checked", "t" ); + input.setAttribute( "name", "t" ); + + fragment = document.createDocumentFragment(); + fragment.appendChild( input ); + + // Check if a disconnected checkbox will retain its checked + // value of true after appended to the DOM (IE6/7) + support.appendChecked = input.checked; + + // WebKit doesn't clone checked state correctly in fragments + support.checkClone = fragment.cloneNode( true ).cloneNode( true ).lastChild.checked; + + // Support: IE<9 + // Opera does not clone events (and typeof div.attachEvent === undefined). + // IE9-10 clones events bound via attachEvent, but they don't trigger with .click() + if ( div.attachEvent ) { + div.attachEvent( "onclick", function() { + support.noCloneEvent = false; + }); + + div.cloneNode( true ).click(); + } + + // Support: IE<9 (lack submit/change bubble), Firefox 17+ (lack focusin event) + // Beware of CSP restrictions (https://developer.mozilla.org/en/Security/CSP), test/csp.php + for ( i in { submit: true, change: true, focusin: true }) { + div.setAttribute( eventName = "on" + i, "t" ); + + support[ i + "Bubbles" ] = eventName in window || div.attributes[ eventName ].expando === false; + } + + // Run tests that need a body at doc ready + jQuery(function() { + var container, marginDiv, tds, + divReset = "padding:0;margin:0;border:0;display:block;box-sizing:content-box;-moz-box-sizing:content-box;-webkit-box-sizing:content-box;", + body = document.getElementsByTagName("body")[0]; + + if ( !body ) { + // Return for frameset docs that don't have a body + return; + } + + container = document.createElement("div"); + container.style.cssText = "border:0;width:0;height:0;position:absolute;top:0;left:-9999px;margin-top:1px"; + + body.appendChild( container ).appendChild( div ); + + // Support: IE8 + // Check if table cells still have offsetWidth/Height when they are set + // to display:none and there are still other visible table cells in a + // table row; if so, offsetWidth/Height are not reliable for use when + // determining if an element has been hidden directly using + // display:none (it is still safe to use offsets if a parent element is + // hidden; don safety goggles and see bug #4512 for more information). + div.innerHTML = "

"; + tds = div.getElementsByTagName("td"); + tds[ 0 ].style.cssText = "padding:0;margin:0;border:0;display:none"; + isSupported = ( tds[ 0 ].offsetHeight === 0 ); + + tds[ 0 ].style.display = ""; + tds[ 1 ].style.display = "none"; + + // Support: IE8 + // Check if empty table cells still have offsetWidth/Height + support.reliableHiddenOffsets = isSupported && ( tds[ 0 ].offsetHeight === 0 ); + + // Check box-sizing and margin behavior + div.innerHTML = ""; + div.style.cssText = "box-sizing:border-box;-moz-box-sizing:border-box;-webkit-box-sizing:border-box;padding:1px;border:1px;display:block;width:4px;margin-top:1%;position:absolute;top:1%;"; + support.boxSizing = ( div.offsetWidth === 4 ); + support.doesNotIncludeMarginInBodyOffset = ( body.offsetTop !== 1 ); + + // Use window.getComputedStyle because jsdom on node.js will break without it. + if ( window.getComputedStyle ) { + support.pixelPosition = ( window.getComputedStyle( div, null ) || {} ).top !== "1%"; + support.boxSizingReliable = ( window.getComputedStyle( div, null ) || { width: "4px" } ).width === "4px"; + + // Check if div with explicit width and no margin-right incorrectly + // gets computed margin-right based on width of container. (#3333) + // Fails in WebKit before Feb 2011 nightlies + // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right + marginDiv = div.appendChild( document.createElement("div") ); + marginDiv.style.cssText = div.style.cssText = divReset; + marginDiv.style.marginRight = marginDiv.style.width = "0"; + div.style.width = "1px"; + + support.reliableMarginRight = + !parseFloat( ( window.getComputedStyle( marginDiv, null ) || {} ).marginRight ); + } + + if ( typeof div.style.zoom !== "undefined" ) { + // Support: IE<8 + // Check if natively block-level elements act like inline-block + // elements when setting their display to 'inline' and giving + // them layout + div.innerHTML = ""; + div.style.cssText = divReset + "width:1px;padding:1px;display:inline;zoom:1"; + support.inlineBlockNeedsLayout = ( div.offsetWidth === 3 ); + + // Support: IE6 + // Check if elements with layout shrink-wrap their children + div.style.display = "block"; + div.innerHTML = "

"; + div.firstChild.style.width = "5px"; + support.shrinkWrapBlocks = ( div.offsetWidth !== 3 ); + + // Prevent IE 6 from affecting layout for positioned elements #11048 + // Prevent IE from shrinking the body in IE 7 mode #12869 + body.style.zoom = 1; + } + + body.removeChild( container ); + + // Null elements to avoid leaks in IE + container = div = tds = marginDiv = null; + }); + + // Null elements to avoid leaks in IE + all = select = fragment = opt = a = input = null; + + return support; +})(); + +var user, priv, data_user, data_priv, + rbrace = /(?:\{[\s\S]*\}|\[[\s\S]*\])$/, + rmultiDash = /([A-Z])/g; + +function Data() { + // Nodes|Objects + this.owners = []; + // Data objects + this.cache = []; +} + +Data.prototype = { + add: function( owner ) { + this.owners.push( owner ); + return (this.cache[ this.owners.length - 1 ] = {}); + }, + set: function( owner, data, value ) { + var prop, + index = this.owners.indexOf( owner ); + + if ( index === -1 ) { + this.add( owner ); + index = this.owners.length - 1; + } + if ( typeof data === "string" ) { + this.cache[ index ][ data ] = value; + } else { + + if ( jQuery.isEmptyObject( this.cache[ index ] ) ) { + this.cache[ index ] = data; + } else { + for ( prop in data ) { + this.cache[ index ][ prop ] = data[ prop ]; + } + } + } + return this; + }, + get: function( owner, key ) { + var cache, + index = this.owners.indexOf( owner ); + + // A valid cache is found, or needs to be created. + // New entries will be added and return the current + // empty data object to be used as a return reference + // return this.add( owner ); + cache = index === -1 ? + this.add( owner ) : this.cache[ index ]; + + return key === undefined ? + cache : cache[ key ]; + }, + access: function( owner, key, value ) { + if ( value === undefined && (key && typeof key !== "object") ) { + // Assume this is a request to read the cached data + return this.get( owner, key ); + } else { + + // If only an owner was specified, return the entire + // cache object. + if ( key === undefined ) { + return this.get( owner ); + } + + // Allow setting or extending (existing objects) with an + // object of properties, or a key and val + this.set( owner, key, value ); + return value !== undefined ? value : key; + } + // Otherwise, this is a read request. + return this.get( owner, key ); + }, + remove: function( owner, key ) { + var i, l, name, + camel = jQuery.camelCase, + index = this.owners.indexOf( owner ), + cache = this.cache[ index ]; + + if ( key === undefined ) { + cache = {}; + } else { + if ( cache ) { + // Support array or space separated string of keys + if ( !Array.isArray( key ) ) { + // Try the string as a key before any manipulation + // + + if ( key in cache ) { + name = [ key ]; + } else { + // split the camel cased version by spaces unless a key with the spaces exists + name = camel( key ); + name = name in cache ? + [ name ] : name.split(" "); + } + } else { + // If "name" is an array of keys... + // When data is initially created, via ("key", "val") signature, + // keys will be converted to camelCase. + // Since there is no way to tell _how_ a key was added, remove + // both plain key and camelCase key. #12786 + // This will only penalize the array argument path. + name = key.concat( key.map( camel ) ); + } + i = 0; + l = name.length; + + for ( ; i < l; i++ ) { + delete cache[ name[i] ]; + } + } + } + this.cache[ index ] = cache; + }, + hasData: function( owner ) { + var index = this.owners.indexOf( owner ); + + if ( index > -1 ) { + return !jQuery.isEmptyObject( this.cache[ index ] ); + } + return false; + }, + discard: function( owner ) { + var index = this.owners.indexOf( owner ); + + if ( index >= 0 ) { + this.owners.splice( index, 1 ); + this.cache.splice( index, 1 ); + } + return this; + } +}; + +// This will be used by remove() in manipulation to sever +// remaining references to node objects. One day we'll replace the dual +// arrays with a WeakMap and this won't be an issue. +function data_discard( owner ) { + user.discard( owner ); + priv.discard( owner ); +} + +// These may used throughout the jQuery core codebase +user = data_user = new Data(); +priv = data_priv = new Data(); + + +jQuery.extend({ + acceptData: function() { + return true; + }, + // Unique for each copy of jQuery on the page + // Non-digits removed to match rinlinejQuery + expando: "jQuery" + ( core_version + Math.random() ).replace( /\D/g, "" ), + + hasData: function( elem ) { + return user.hasData( elem ) || priv.hasData( elem ); + }, + + data: function( elem, name, data ) { + return user.access( elem, name, data ); + }, + + removeData: function( elem, name ) { + return user.remove( elem, name ); + }, + + // TODO: Replace all calls to _data and _removeData with direct + // calls to + // + // priv.access( elem, name, data ); + // + // priv.remove( elem, name ); + // + _data: function( elem, name, data ) { + return priv.access( elem, name, data ); + }, + + _removeData: function( elem, name ) { + return priv.remove( elem, name ); + } +}); + +jQuery.fn.extend({ + data: function( key, value ) { + var attrs, name, + elem = this[0], + i = 0, + data = null; + + // Gets all values + if ( key === undefined ) { + if ( this.length ) { + data = user.get( elem ); + + if ( elem.nodeType === 1 && !priv.get( elem, "hasDataAttrs" ) ) { + attrs = elem.attributes; + for ( ; i < attrs.length; i++ ) { + name = attrs[i].name; + + if ( name.indexOf( "data-" ) === 0 ) { + name = jQuery.camelCase( name.substring(5) ); + dataAttr( elem, name, data[ name ] ); + } + } + priv.set( elem, "hasDataAttrs", true ); + } + } + + return data; + } + + // Sets multiple values + if ( typeof key === "object" ) { + return this.each(function() { + user.set( this, key ); + }); + } + + return jQuery.access( this, function( value ) { + var data, + camelKey = jQuery.camelCase( key ); + + // Get the Data... + if ( value === undefined ) { + + // Attempt to get data from the cache + // with the key as-is + data = user.get( elem, key ); + if ( data !== undefined ) { + return data; + } + + // Attempt to "discover" the data in + // HTML5 custom data-* attrs + data = dataAttr( elem, key, undefined ); + if ( data !== undefined ) { + return data; + } + + // As a last resort, attempt to find + // the data by checking AGAIN, but with + // a camelCased key. + data = user.get( elem, camelKey ); + if ( data !== undefined ) { + return data; + } + + // We tried really hard, but the data doesn't exist. + return undefined; + } + + // Set the data... + this.each(function() { + // First, attempt to store a copy or reference of any + // data that might've been store with a camelCased key. + var data = user.get( this, camelKey ); + + // For HTML5 data-* attribute interop, we have to + // store property names with dashes in a camelCase form. + // This might not apply to all properties...* + user.set( this, camelKey, value ); + + // *... In the case of properties that might ACTUALLY + // have dashes, we need to also store a copy of that + // unchanged property. + if ( /-/.test( key ) && data !== undefined ) { + user.set( this, key, value ); + } + }); + }, null, value, arguments.length > 1, null, true ); + }, + + removeData: function( key ) { + return this.each(function() { + user.remove( this, key ); + }); + } +}); + +function dataAttr( elem, key, data ) { + var name; + + // If nothing was found internally, try to fetch any + // data from the HTML5 data-* attribute + if ( data === undefined && elem.nodeType === 1 ) { + + name = "data-" + key.replace( rmultiDash, "-$1" ).toLowerCase(); + data = elem.getAttribute( name ); + + if ( typeof data === "string" ) { + try { + data = data === "true" ? true : + data === "false" ? false : + data === "null" ? null : + // Only convert to a number if it doesn't change the string + +data + "" === data ? +data : + rbrace.test( data ) ? + JSON.parse( data ) : data; + } catch( e ) {} + + // Make sure we set the data so it isn't changed later + user.set( elem, key, data ); + } else { + data = undefined; + } + } + + return data; +} +jQuery.extend({ + queue: function( elem, type, data ) { + var queue; + + if ( elem ) { + type = ( type || "fx" ) + "queue"; + queue = jQuery._data( elem, type ); + + // Speed up dequeue by getting out quickly if this is just a lookup + if ( data ) { + if ( !queue || jQuery.isArray(data) ) { + queue = jQuery._data( elem, type, jQuery.makeArray(data) ); + } else { + queue.push( data ); + } + } + return queue || []; + } + }, + + dequeue: function( elem, type ) { + type = type || "fx"; + + var queue = jQuery.queue( elem, type ), + startLength = queue.length, + fn = queue.shift(), + hooks = jQuery._queueHooks( elem, type ), + next = function() { + jQuery.dequeue( elem, type ); + }; + + // If the fx queue is dequeued, always remove the progress sentinel + if ( fn === "inprogress" ) { + fn = queue.shift(); + startLength--; + } + + if ( fn ) { + + // Add a progress sentinel to prevent the fx queue from being + // automatically dequeued + if ( type === "fx" ) { + queue.unshift( "inprogress" ); + } + + // clear up the last queue stop function + delete hooks.stop; + fn.call( elem, next, hooks ); + } + + if ( !startLength && hooks ) { + hooks.empty.fire(); + } + }, + + // not intended for public consumption - generates a queueHooks object, or returns the current one + _queueHooks: function( elem, type ) { + var key = type + "queueHooks"; + return jQuery._data( elem, key ) || jQuery._data( elem, key, { + empty: jQuery.Callbacks("once memory").add(function() { + jQuery._removeData( elem, type + "queue" ); + jQuery._removeData( elem, key ); + }) + }); + } +}); + +jQuery.fn.extend({ + queue: function( type, data ) { + var setter = 2; + + if ( typeof type !== "string" ) { + data = type; + type = "fx"; + setter--; + } + + if ( arguments.length < setter ) { + return jQuery.queue( this[0], type ); + } + + return data === undefined ? + this : + this.each(function() { + var queue = jQuery.queue( this, type, data ); + + // ensure a hooks for this queue + jQuery._queueHooks( this, type ); + + if ( type === "fx" && queue[0] !== "inprogress" ) { + jQuery.dequeue( this, type ); + } + }); + }, + dequeue: function( type ) { + return this.each(function() { + jQuery.dequeue( this, type ); + }); + }, + // Based off of the plugin by Clint Helfers, with permission. + // http://blindsignals.com/index.php/2009/07/jquery-delay/ + delay: function( time, type ) { + time = jQuery.fx ? jQuery.fx.speeds[ time ] || time : time; + type = type || "fx"; + + return this.queue( type, function( next, hooks ) { + var timeout = setTimeout( next, time ); + hooks.stop = function() { + clearTimeout( timeout ); + }; + }); + }, + clearQueue: function( type ) { + return this.queue( type || "fx", [] ); + }, + // Get a promise resolved when queues of a certain type + // are emptied (fx is the type by default) + promise: function( type, obj ) { + var tmp, + count = 1, + defer = jQuery.Deferred(), + elements = this, + i = this.length, + resolve = function() { + if ( !( --count ) ) { + defer.resolveWith( elements, [ elements ] ); + } + }; + + if ( typeof type !== "string" ) { + obj = type; + type = undefined; + } + type = type || "fx"; + + while( i-- ) { + tmp = jQuery._data( elements[ i ], type + "queueHooks" ); + if ( tmp && tmp.empty ) { + count++; + tmp.empty.add( resolve ); + } + } + resolve(); + return defer.promise( obj ); + } +}); +var nodeHook, boolHook, + rclass = /[\t\r\n]/g, + rreturn = /\r/g, + rfocusable = /^(?:input|select|textarea|button|object)$/i, + rclickable = /^(?:a|area)$/i, + rboolean = /^(?:checked|selected|autofocus|autoplay|async|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped)$/i; + +jQuery.fn.extend({ + attr: function( name, value ) { + return jQuery.access( this, jQuery.attr, name, value, arguments.length > 1 ); + }, + + removeAttr: function( name ) { + return this.each(function() { + jQuery.removeAttr( this, name ); + }); + }, + + prop: function( name, value ) { + return jQuery.access( this, jQuery.prop, name, value, arguments.length > 1 ); + }, + + removeProp: function( name ) { + name = jQuery.propFix[ name ] || name; + return this.each(function() { + // try/catch handles cases where IE balks (such as removing a property on window) + try { + this[ name ] = undefined; + delete this[ name ]; + } catch( e ) {} + }); + }, + + addClass: function( value ) { + var classes, elem, cur, clazz, j, + i = 0, + len = this.length, + proceed = typeof value === "string" && value; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( j ) { + jQuery( this ).addClass( value.call( this, j, this.className ) ); + }); + } + + if ( proceed ) { + // The disjunction here is for better compressibility (see removeClass) + classes = ( value || "" ).match( core_rnotwhite ) || []; + + for ( ; i < len; i++ ) { + elem = this[ i ]; + cur = elem.nodeType === 1 && ( elem.className ? + ( " " + elem.className + " " ).replace( rclass, " " ) : + " " + ); + + if ( cur ) { + j = 0; + while ( (clazz = classes[j++]) ) { + if ( cur.indexOf( " " + clazz + " " ) < 0 ) { + cur += clazz + " "; + } + } + elem.className = jQuery.trim( cur ); + + } + } + } + + return this; + }, + + removeClass: function( value ) { + var classes, elem, cur, clazz, j, + i = 0, + len = this.length, + proceed = arguments.length === 0 || typeof value === "string" && value; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( j ) { + jQuery( this ).removeClass( value.call( this, j, this.className ) ); + }); + } + if ( proceed ) { + classes = ( value || "" ).match( core_rnotwhite ) || []; + + for ( ; i < len; i++ ) { + elem = this[ i ]; + // This expression is here for better compressibility (see addClass) + cur = elem.nodeType === 1 && ( elem.className ? + ( " " + elem.className + " " ).replace( rclass, " " ) : + "" + ); + + if ( cur ) { + j = 0; + while ( (clazz = classes[j++]) ) { + // Remove *all* instances + while ( cur.indexOf( " " + clazz + " " ) >= 0 ) { + cur = cur.replace( " " + clazz + " ", " " ); + } + } + elem.className = value ? jQuery.trim( cur ) : ""; + } + } + } + + return this; + }, + + toggleClass: function( value, stateVal ) { + var type = typeof value, + isBool = typeof stateVal === "boolean"; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( i ) { + jQuery( this ).toggleClass( value.call(this, i, this.className, stateVal), stateVal ); + }); + } + + return this.each(function() { + if ( type === "string" ) { + // toggle individual class names + var className, + i = 0, + self = jQuery( this ), + state = stateVal, + classNames = value.match( core_rnotwhite ) || []; + + while ( (className = classNames[ i++ ]) ) { + // check each className given, space separated list + state = isBool ? state : !self.hasClass( className ); + self[ state ? "addClass" : "removeClass" ]( className ); + } + + // Toggle whole class name + } else if ( type === "undefined" || type === "boolean" ) { + if ( this.className ) { + // store className if set + jQuery._data( this, "__className__", this.className ); + } + + // If the element has a class name or if we're passed "false", + // then remove the whole classname (if there was one, the above saved it). + // Otherwise bring back whatever was previously saved (if anything), + // falling back to the empty string if nothing was stored. + this.className = this.className || value === false ? "" : jQuery._data( this, "__className__" ) || ""; + } + }); + }, + + hasClass: function( selector ) { + var className = " " + selector + " ", + i = 0, + l = this.length; + for ( ; i < l; i++ ) { + if ( this[i].nodeType === 1 && (" " + this[i].className + " ").replace(rclass, " ").indexOf( className ) >= 0 ) { + return true; + } + } + + return false; + }, + + val: function( value ) { + var hooks, ret, isFunction, + elem = this[0]; + + if ( !arguments.length ) { + if ( elem ) { + hooks = jQuery.valHooks[ elem.type ] || jQuery.valHooks[ elem.nodeName.toLowerCase() ]; + + if ( hooks && "get" in hooks && (ret = hooks.get( elem, "value" )) !== undefined ) { + return ret; + } + + ret = elem.value; + + return typeof ret === "string" ? + // handle most common string cases + ret.replace(rreturn, "") : + // handle cases where value is null/undef or number + ret == null ? "" : ret; + } + + return; + } + + isFunction = jQuery.isFunction( value ); + + return this.each(function( i ) { + var val, + self = jQuery(this); + + if ( this.nodeType !== 1 ) { + return; + } + + if ( isFunction ) { + val = value.call( this, i, self.val() ); + } else { + val = value; + } + + // Treat null/undefined as ""; convert numbers to string + if ( val == null ) { + val = ""; + } else if ( typeof val === "number" ) { + val += ""; + } else if ( jQuery.isArray( val ) ) { + val = jQuery.map(val, function ( value ) { + return value == null ? "" : value + ""; + }); + } + + hooks = jQuery.valHooks[ this.type ] || jQuery.valHooks[ this.nodeName.toLowerCase() ]; + + // If set returns undefined, fall back to normal setting + if ( !hooks || !("set" in hooks) || hooks.set( this, val, "value" ) === undefined ) { + this.value = val; + } + }); + } +}); + +jQuery.extend({ + valHooks: { + option: { + get: function( elem ) { + // attributes.value is undefined in Blackberry 4.7 but + // uses .value. See #6932 + var val = elem.attributes.value; + return !val || val.specified ? elem.value : elem.text; + } + }, + select: { + get: function( elem ) { + var value, option, + options = elem.options, + index = elem.selectedIndex, + one = elem.type === "select-one" || index < 0, + values = one ? null : [], + max = one ? index + 1 : options.length, + i = index < 0 ? + max : + one ? index : 0; + + // Loop through all the selected options + for ( ; i < max; i++ ) { + option = options[ i ]; + + // oldIE doesn't update selected after form reset (#2551) + if ( ( option.selected || i === index ) && + // Don't return options that are disabled or in a disabled optgroup + ( jQuery.support.optDisabled ? !option.disabled : option.getAttribute("disabled") === null ) && + ( !option.parentNode.disabled || !jQuery.nodeName( option.parentNode, "optgroup" ) ) ) { + + // Get the specific value for the option + value = jQuery( option ).val(); + + // We don't need an array for one selects + if ( one ) { + return value; + } + + // Multi-Selects return an array + values.push( value ); + } + } + + return values; + }, + + set: function( elem, value ) { + var values = jQuery.makeArray( value ); + + jQuery(elem).find("option").each(function() { + this.selected = jQuery.inArray( jQuery(this).val(), values ) >= 0; + }); + + if ( !values.length ) { + elem.selectedIndex = -1; + } + return values; + } + } + }, + + attr: function( elem, name, value ) { + var ret, hooks, notxml, + nType = elem.nodeType; + + // don't get/set attributes on text, comment and attribute nodes + if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + // Fallback to prop when attributes are not supported + if ( typeof elem.getAttribute === "undefined" ) { + return jQuery.prop( elem, name, value ); + } + + notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); + + // All attributes are lowercase + // Grab necessary hook if one is defined + if ( notxml ) { + name = name.toLowerCase(); + hooks = jQuery.attrHooks[ name ] || ( rboolean.test( name ) ? boolHook : nodeHook ); + } + + if ( value !== undefined ) { + + if ( value === null ) { + jQuery.removeAttr( elem, name ); + + } else if ( hooks && notxml && "set" in hooks && (ret = hooks.set( elem, value, name )) !== undefined ) { + return ret; + + } else { + elem.setAttribute( name, value + "" ); + return value; + } + + } else if ( hooks && notxml && "get" in hooks && (ret = hooks.get( elem, name )) !== null ) { + return ret; + + } else { + + ret = elem.getAttribute( name ); + + // Non-existent attributes return null, we normalize to undefined + return ret == null ? + undefined : + ret; + } + }, + + removeAttr: function( elem, value ) { + var name, propName, + i = 0, + attrNames = value && value.match( core_rnotwhite ); + + if ( attrNames && elem.nodeType === 1 ) { + while ( (name = attrNames[i++]) ) { + propName = jQuery.propFix[ name ] || name; + + // Boolean attributes get special treatment (#10870) + // Set corresponding property to false for boolean attributes + if ( rboolean.test( name ) ) { + elem[ propName ] = false; + } + + elem.removeAttribute( name ); + } + } + }, + + attrHooks: { + type: { + set: function( elem, value ) { + if ( !jQuery.support.radioValue && value === "radio" && jQuery.nodeName(elem, "input") ) { + // Setting the type on a radio button after the value resets the value in IE6-9 + // Reset value to default in case type is set after value during creation + var val = elem.value; + elem.setAttribute( "type", value ); + if ( val ) { + elem.value = val; + } + return value; + } + } + } + }, + + propFix: { + tabindex: "tabIndex", + readonly: "readOnly", + "for": "htmlFor", + "class": "className", + maxlength: "maxLength", + cellspacing: "cellSpacing", + cellpadding: "cellPadding", + rowspan: "rowSpan", + colspan: "colSpan", + usemap: "useMap", + frameborder: "frameBorder", + contenteditable: "contentEditable" + }, + + prop: function( elem, name, value ) { + var ret, hooks, notxml, + nType = elem.nodeType; + + // don't get/set properties on text, comment and attribute nodes + if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); + + if ( notxml ) { + // Fix name and attach hooks + name = jQuery.propFix[ name ] || name; + hooks = jQuery.propHooks[ name ]; + } + + if ( value !== undefined ) { + if ( hooks && "set" in hooks && (ret = hooks.set( elem, value, name )) !== undefined ) { + return ret; + + } else { + return ( elem[ name ] = value ); + } + + } else { + if ( hooks && "get" in hooks && (ret = hooks.get( elem, name )) !== null ) { + return ret; + + } else { + return elem[ name ]; + } + } + }, + + propHooks: { + tabIndex: { + get: function( elem ) { + // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set + // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ + var attributeNode = elem.getAttributeNode("tabindex"); + + return attributeNode && attributeNode.specified ? + parseInt( attributeNode.value, 10 ) : + rfocusable.test( elem.nodeName ) || rclickable.test( elem.nodeName ) && elem.href ? + 0 : + undefined; + } + } + } +}); + +// Hook for boolean attributes +boolHook = { + get: function( elem, name ) { + return elem.getAttribute( name ) !== null ? + name.toLowerCase() : + undefined; + }, + set: function( elem, value, name ) { + if ( value === false ) { + // Remove boolean attributes when set to false + jQuery.removeAttr( elem, name ); + } else { + elem.setAttribute( name, name ); + } + return name; + } +}; + +// Radios and checkboxes getter/setter +if ( !jQuery.support.checkOn ) { + jQuery.each([ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = { + get: function( elem ) { + // Handle the case where in Webkit "" is returned instead of "on" if a value isn't specified + return elem.getAttribute("value") === null ? "on" : elem.value; + } + }; + }); +} +jQuery.each([ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = jQuery.extend( jQuery.valHooks[ this ], { + set: function( elem, value ) { + if ( jQuery.isArray( value ) ) { + return ( elem.checked = jQuery.inArray( jQuery(elem).val(), value ) >= 0 ); + } + } + }); +}); + +// IE9/10 do not see a selected option inside an optgroup unless you access it +// Support: IE9, IE10 +if ( !jQuery.support.optSelected ) { + jQuery.propHooks.selected = jQuery.extend( jQuery.propHooks.selected, { + get: function( elem ) { + var parent = elem.parentNode; + if ( parent && parent.parentNode ) { + parent.parentNode.selectedIndex; + } + return null; + } + }); +} +var rkeyEvent = /^key/, + rmouseEvent = /^(?:mouse|contextmenu)|click/, + rfocusMorph = /^(?:focusinfocus|focusoutblur)$/, + rtypenamespace = /^([^.]*)(?:\.(.+)|)$/; + +/* + * Helper functions for managing events -- not part of the public interface. + * Props to Dean Edwards' addEvent library for many of the ideas. + */ +jQuery.event = { + + add: function( elem, types, handler, data, selector ) { + var elemData, eventHandle, events, + tns, type, namespaces, handleObj, + handleObjIn, handlers, special, + t = 0; + + // Don't attach events to noData or text/comment nodes (allow plain objects tho) + if ( elem.nodeType === 3 || elem.nodeType === 8 || !types || !handler || !(elemData = data_priv.get( elem )) ) { + return; + } + + // Caller can pass in an object of custom data in lieu of the handler + if ( handler.handler ) { + handleObjIn = handler; + handler = handleObjIn.handler; + selector = handleObjIn.selector; + } + + // Make sure that the handler has a unique ID, used to find/remove it later + if ( !handler.guid ) { + handler.guid = jQuery.guid++; + } + + // Init the element's event structure and main handler, if this is the first + events = elemData.events; + if ( !events ) { + elemData.events = events = {}; + } + eventHandle = elemData.handle; + if ( !eventHandle ) { + elemData.handle = eventHandle = function( e ) { + // Discard the second event of a jQuery.event.trigger() and + // when an event is called after a page has unloaded + return typeof jQuery !== "undefined" && (!e || jQuery.event.triggered !== e.type) ? + jQuery.event.dispatch.apply( eventHandle.elem, arguments ) : + undefined; + }; + // Add elem as a property of the handle fn to prevent a memory leak with IE non-native events + eventHandle.elem = elem; + } + + // Handle multiple events separated by a space + types = ( types || "" ).match( core_rnotwhite ) || [""]; + for ( ; t < types.length; t++ ) { + + tns = rtypenamespace.exec( types[t] ) || []; + type = tns[1]; + namespaces = ( tns[2] || "" ).split( "." ).sort(); + + // If event changes its type, use the special event handlers for the changed type + special = jQuery.event.special[ type ] || {}; + + // If selector defined, determine special event api type, otherwise given type + type = ( selector ? special.delegateType : special.bindType ) || type; + + // Update special based on newly reset type + special = jQuery.event.special[ type ] || {}; + + // handleObj is passed to all event handlers + handleObj = jQuery.extend({ + type: type, + origType: tns[1], + data: data, + handler: handler, + guid: handler.guid, + selector: selector, + needsContext: selector && jQuery.expr.match.needsContext.test( selector ), + namespace: namespaces.join(".") + }, handleObjIn ); + + // Init the event handler queue if we're the first + handlers = events[ type ]; + if ( !handlers ) { + handlers = events[ type ] = []; + handlers.delegateCount = 0; + + // Only use addEventListener if the special events handler returns false + if ( !special.setup || special.setup.call( elem, data, namespaces, eventHandle ) === false ) { + if ( elem.addEventListener ) { + elem.addEventListener( type, eventHandle, false ); + } + } + } + + if ( special.add ) { + special.add.call( elem, handleObj ); + + if ( !handleObj.handler.guid ) { + handleObj.handler.guid = handler.guid; + } + } + + // Add to the element's handler list, delegates in front + if ( selector ) { + handlers.splice( handlers.delegateCount++, 0, handleObj ); + } else { + handlers.push( handleObj ); + } + + // Keep track of which events have ever been used, for event optimization + jQuery.event.global[ type ] = true; + } + + // Nullify elem to prevent memory leaks in IE + elem = null; + }, + + global: {}, + + // Detach an event or set of events from an element + remove: function( elem, types, handler, selector, mappedTypes ) { + + var tns, type, origType, namespaces, origCount, + j, events, special, eventType, handleObj, + t = 0, + elemData = data_priv.hasData( elem ) && data_priv.get( elem ); + + if ( !elemData || !(events = elemData.events) ) { + return; + } + + // Once for each type.namespace in types; type may be omitted + types = ( types || "" ).match( core_rnotwhite ) || [""]; + for ( ; t < types.length; t++ ) { + tns = rtypenamespace.exec( types[t] ) || []; + type = origType = tns[1]; + namespaces = tns[2]; + + // Unbind all events (on this namespace, if provided) for the element + if ( !type ) { + for ( type in events ) { + jQuery.event.remove( elem, type + types[ t ], handler, selector, true ); + } + continue; + } + + special = jQuery.event.special[ type ] || {}; + type = ( selector? special.delegateType : special.bindType ) || type; + eventType = events[ type ] || []; + origCount = eventType.length; + namespaces = namespaces ? new RegExp("(^|\\.)" + namespaces.split(".").sort().join("\\.(?:.*\\.|)") + "(\\.|$)") : null; + + // Remove matching events + for ( j = 0; j < eventType.length; j++ ) { + handleObj = eventType[ j ]; + + if ( ( mappedTypes || origType === handleObj.origType ) && + ( !handler || handler.guid === handleObj.guid ) && + ( !namespaces || namespaces.test( handleObj.namespace ) ) && + ( !selector || selector === handleObj.selector || selector === "**" && handleObj.selector ) ) { + eventType.splice( j--, 1 ); + + if ( handleObj.selector ) { + eventType.delegateCount--; + } + if ( special.remove ) { + special.remove.call( elem, handleObj ); + } + } + } + + // Remove generic event handler if we removed something and no more handlers exist + // (avoids potential for endless recursion during removal of special event handlers) + if ( eventType.length === 0 && origCount !== eventType.length ) { + if ( !special.teardown || special.teardown.call( elem, namespaces, elemData.handle ) === false ) { + jQuery.removeEvent( elem, type, elemData.handle ); + } + + delete events[ type ]; + } + } + + // Remove the expando if it's no longer used + if ( jQuery.isEmptyObject( events ) ) { + delete elemData.handle; + + // removeData also checks for emptiness and clears the expando if empty + // so use it instead of delete + jQuery._removeData( elem, "events" ); + } + }, + + trigger: function( event, data, elem, onlyHandlers ) { + + var i, cur, old, ontype, special, handle, eventPath, bubbleType, + type = event.type || event, + namespaces = event.namespace ? event.namespace.split(".") : []; + + elem = elem || document; + + // Don't do events on text and comment nodes + if ( elem.nodeType === 3 || elem.nodeType === 8 ) { + return; + } + + // focus/blur morphs to focusin/out; ensure we're not firing them right now + if ( rfocusMorph.test( type + jQuery.event.triggered ) ) { + return; + } + + if ( type.indexOf(".") >= 0 ) { + // Namespaced trigger; create a regexp to match event type in handle() + namespaces = type.split("."); + type = namespaces.shift(); + namespaces.sort(); + } + + // Caller can pass in an Event, Object, or just an event type string + event = typeof event === "object" ? + // jQuery.Event object + event[ jQuery.expando ] ? event : + // Object literal + new jQuery.Event( type, event ) : + // Just the event type (string) + new jQuery.Event( type ); + + event.type = type; + event.isTrigger = true; + event.namespace = namespaces.join("."); + event.namespace_re = event.namespace? new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.|)") + "(\\.|$)") : null; + ontype = type.indexOf(":") < 0 ? "on" + type : ""; + + // Clean up the event in case it is being reused + event.result = undefined; + if ( !event.target ) { + event.target = elem; + } + + // Clone any incoming data and prepend the event, creating the handler arg list + data = data != null ? jQuery.makeArray( data ) : []; + data.unshift( event ); + + // Allow special events to draw outside the lines + special = jQuery.event.special[ type ] || {}; + if ( !onlyHandlers && special.trigger && special.trigger.apply( elem, data ) === false ) { + return; + } + + // Determine event propagation path in advance, per W3C events spec (#9951) + // Bubble up to document, then to window; watch for a global ownerDocument var (#9724) + eventPath = [[ elem, special.bindType || type ]]; + if ( !onlyHandlers && !special.noBubble && !jQuery.isWindow( elem ) ) { + + bubbleType = special.delegateType || type; + cur = rfocusMorph.test( bubbleType + type ) ? elem : elem.parentNode; + for ( old = elem; cur; cur = cur.parentNode ) { + eventPath.push([ cur, bubbleType ]); + old = cur; + } + + // Only add window if we got to document (e.g., not plain obj or detached DOM) + if ( old === (elem.ownerDocument || document) ) { + eventPath.push([ old.defaultView || old.parentWindow || window, bubbleType ]); + } + } + + // Fire handlers on the event path + for ( i = 0; i < eventPath.length && !event.isPropagationStopped(); i++ ) { + + cur = eventPath[i][0]; + event.type = eventPath[i][1]; + + handle = ( jQuery._data( cur, "events" ) || {} )[ event.type ] && jQuery._data( cur, "handle" ); + if ( handle ) { + handle.apply( cur, data ); + } + // Note that this is a bare JS function and not a jQuery handler + handle = ontype && cur[ ontype ]; + if ( handle && jQuery.acceptData( cur ) && handle.apply && handle.apply( cur, data ) === false ) { + event.preventDefault(); + } + } + event.type = type; + + // If nobody prevented the default action, do it now + if ( !onlyHandlers && !event.isDefaultPrevented() ) { + + if ( (!special._default || special._default.apply( elem.ownerDocument, data ) === false) && + !(type === "click" && jQuery.nodeName( elem, "a" )) && jQuery.acceptData( elem ) ) { + + // Call a native DOM method on the target with the same name name as the event. + // Don't do default actions on window, that's where global variables be (#6170) + if ( ontype && jQuery.isFunction( elem[ type ] ) && !jQuery.isWindow( elem ) ) { + + // Don't re-trigger an onFOO event when we call its FOO() method + old = elem[ ontype ]; + + if ( old ) { + elem[ ontype ] = null; + } + + // Prevent re-triggering of the same event, since we already bubbled it above + jQuery.event.triggered = type; + elem[ type ](); + jQuery.event.triggered = undefined; + + if ( old ) { + elem[ ontype ] = old; + } + } + } + } + + return event.result; + }, + + dispatch: function( event ) { + + // Make a writable jQuery.Event from the native event object + event = jQuery.event.fix( event ); + + var i, j, cur, ret, selMatch, matched, matches, handleObj, sel, + handlers = ( (jQuery._data( this, "events" ) || {} )[ event.type ] || []), + delegateCount = handlers.delegateCount, + args = core_slice.call( arguments ), + special = jQuery.event.special[ event.type ] || {}, + handlerQueue = []; + + // Use the fix-ed jQuery.Event rather than the (read-only) native event + args[0] = event; + event.delegateTarget = this; + + // Call the preDispatch hook for the mapped type, and let it bail if desired + if ( special.preDispatch && special.preDispatch.call( this, event ) === false ) { + return; + } + + // Determine handlers that should run if there are delegated events + // Avoid non-left-click bubbling in Firefox (#3861) + if ( delegateCount && !(event.button && event.type === "click") ) { + + for ( cur = event.target; cur != this; cur = cur.parentNode || this ) { + + // Ignore clicks (ONLY) on disabled elements (#6911, #8165, #11382, #11764) + if ( cur.disabled !== true || event.type !== "click" ) { + selMatch = {}; + matches = []; + for ( i = 0; i < delegateCount; i++ ) { + handleObj = handlers[ i ]; + sel = handleObj.selector; + + if ( selMatch[ sel ] === undefined ) { + selMatch[ sel ] = handleObj.needsContext ? + jQuery( sel, this ).index( cur ) >= 0 : + jQuery.find( sel, this, null, [ cur ] ).length; + } + if ( selMatch[ sel ] ) { + matches.push( handleObj ); + } + } + if ( matches.length ) { + handlerQueue.push({ elem: cur, matches: matches }); + } + } + } + } + + // Add the remaining (directly-bound) handlers + if ( handlers.length > delegateCount ) { + handlerQueue.push({ elem: this, matches: handlers.slice( delegateCount ) }); + } + + // Run delegates first; they may want to stop propagation beneath us + for ( i = 0; i < handlerQueue.length && !event.isPropagationStopped(); i++ ) { + matched = handlerQueue[ i ]; + event.currentTarget = matched.elem; + + for ( j = 0; j < matched.matches.length && !event.isImmediatePropagationStopped(); j++ ) { + handleObj = matched.matches[ j ]; + + // Triggered event must either 1) have no namespace, or + // 2) have namespace(s) a subset or equal to those in the bound event (both can have no namespace). + if ( !event.namespace || event.namespace_re && event.namespace_re.test( handleObj.namespace ) ) { + + event.data = handleObj.data; + event.handleObj = handleObj; + + ret = ( (jQuery.event.special[ handleObj.origType ] || {}).handle || handleObj.handler ) + .apply( matched.elem, args ); + + if ( ret !== undefined ) { + event.result = ret; + if ( ret === false ) { + event.preventDefault(); + event.stopPropagation(); + } + } + } + } + } + + // Call the postDispatch hook for the mapped type + if ( special.postDispatch ) { + special.postDispatch.call( this, event ); + } + + return event.result; + }, + + // Includes some event props shared by KeyEvent and MouseEvent + props: "altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "), + + fixHooks: {}, + + keyHooks: { + props: "char charCode key keyCode".split(" "), + filter: function( event, original ) { + + // Add which for key events + if ( event.which == null ) { + event.which = original.charCode != null ? original.charCode : original.keyCode; + } + + return event; + } + }, + + mouseHooks: { + props: "button buttons clientX clientY offsetX offsetY pageX pageY screenX screenY toElement".split(" "), + filter: function( event, original ) { + var eventDoc, doc, body, + button = original.button; + + // Calculate pageX/Y if missing and clientX/Y available + if ( event.pageX == null && original.clientX != null ) { + eventDoc = event.target.ownerDocument || document; + doc = eventDoc.documentElement; + body = eventDoc.body; + + event.pageX = original.clientX + ( doc && doc.scrollLeft || body && body.scrollLeft || 0 ) - ( doc && doc.clientLeft || body && body.clientLeft || 0 ); + event.pageY = original.clientY + ( doc && doc.scrollTop || body && body.scrollTop || 0 ) - ( doc && doc.clientTop || body && body.clientTop || 0 ); + } + + // Add which for click: 1 === left; 2 === middle; 3 === right + // Note: button is not normalized, so don't use it + if ( !event.which && button !== undefined ) { + event.which = ( button & 1 ? 1 : ( button & 2 ? 3 : ( button & 4 ? 2 : 0 ) ) ); + } + + return event; + } + }, + + fix: function( event ) { + if ( event[ jQuery.expando ] ) { + return event; + } + + // Create a writable copy of the event object and normalize some properties + var i, prop, + originalEvent = event, + fixHook = jQuery.event.fixHooks[ event.type ] || {}, + copy = fixHook.props ? this.props.concat( fixHook.props ) : this.props; + + event = jQuery.Event( originalEvent ); + + for ( i = copy.length; i; ) { + prop = copy[ --i ]; + event[ prop ] = originalEvent[ prop ]; + } + + return fixHook.filter? fixHook.filter( event, originalEvent ) : event; + }, + + special: { + load: { + // Prevent triggered image.load events from bubbling to window.load + noBubble: true + }, + click: { + // For checkbox, fire native event so checked state will be right + trigger: function() { + if ( jQuery.nodeName( this, "input" ) && this.type === "checkbox" && this.click ) { + this.click(); + return false; + } + } + }, + focus: { + // Fire native event if possible so blur/focus sequence is correct + trigger: function() { + if ( this !== document.activeElement && this.focus ) { + this.focus(); + return false; + } + }, + delegateType: "focusin" + }, + blur: { + trigger: function() { + if ( this === document.activeElement && this.blur ) { + this.blur(); + return false; + } + }, + delegateType: "focusout" + }, + + beforeunload: { + postDispatch: function( event ) { + + // Support: Firefox 10+ + if ( event.result !== undefined ) { + event.originalEvent.returnValue = event.result; + } + } + } + }, + + simulate: function( type, elem, event, bubble ) { + // Piggyback on a donor event to simulate a different one. + // Fake originalEvent to avoid donor's stopPropagation, but if the + // simulated event prevents default then we do the same on the donor. + var e = jQuery.extend( + new jQuery.Event(), + event, + { type: type, + isSimulated: true, + originalEvent: {} + } + ); + if ( bubble ) { + jQuery.event.trigger( e, null, elem ); + } else { + jQuery.event.dispatch.call( elem, e ); + } + if ( e.isDefaultPrevented() ) { + event.preventDefault(); + } + } +}; + +// Some plugins are using, but it's undocumented/deprecated and will be removed. +// The 1.7 special event interface should provide all the hooks needed now. +jQuery.event.handle = jQuery.event.dispatch; + +jQuery.removeEvent = function( elem, type, handle ) { + if ( elem.removeEventListener ) { + elem.removeEventListener( type, handle, false ); + } +}; + +jQuery.Event = function( src, props ) { + // Allow instantiation without the 'new' keyword + if ( !(this instanceof jQuery.Event) ) { + return new jQuery.Event( src, props ); + } + + // Event object + if ( src && src.type ) { + this.originalEvent = src; + this.type = src.type; + + // Events bubbling up the document may have been marked as prevented + // by a handler lower down the tree; reflect the correct value. + this.isDefaultPrevented = ( src.defaultPrevented || + src.getPreventDefault && src.getPreventDefault() ) ? returnTrue : returnFalse; + + // Event type + } else { + this.type = src; + } + + // Put explicitly provided properties onto the event object + if ( props ) { + jQuery.extend( this, props ); + } + + // Create a timestamp if incoming event doesn't have one + this.timeStamp = src && src.timeStamp || jQuery.now(); + + // Mark it as fixed + this[ jQuery.expando ] = true; +}; + +function returnFalse() { + return false; +} +function returnTrue() { + return true; +} + +// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding +// http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html +jQuery.Event.prototype = { + preventDefault: function() { + this.isDefaultPrevented = returnTrue; + + var e = this.originalEvent; + if ( e && e.preventDefault ) { + e.preventDefault(); + } + }, + stopPropagation: function() { + this.isPropagationStopped = returnTrue; + + var e = this.originalEvent; + if ( e && e.stopPropagation ) { + e.stopPropagation(); + } + }, + stopImmediatePropagation: function() { + this.isImmediatePropagationStopped = returnTrue; + this.stopPropagation(); + }, + isDefaultPrevented: returnFalse, + isPropagationStopped: returnFalse, + isImmediatePropagationStopped: returnFalse +}; + +// Create mouseenter/leave events using mouseover/out and event-time checks +// Support: Chrome 15+ +jQuery.each({ + mouseenter: "mouseover", + mouseleave: "mouseout" +}, function( orig, fix ) { + jQuery.event.special[ orig ] = { + delegateType: fix, + bindType: fix, + + handle: function( event ) { + var ret, + target = this, + related = event.relatedTarget, + handleObj = event.handleObj; + + // For mousenter/leave call the handler if related is outside the target. + // NB: No relatedTarget if the mouse left/entered the browser window + if ( !related || (related !== target && !jQuery.contains( target, related )) ) { + event.type = handleObj.origType; + ret = handleObj.handler.apply( this, arguments ); + event.type = fix; + } + return ret; + } + }; +}); + +// Create "bubbling" focus and blur events +// Support: Firefox 10+ +if ( !jQuery.support.focusinBubbles ) { + jQuery.each({ focus: "focusin", blur: "focusout" }, function( orig, fix ) { + + // Attach a single capturing handler while someone wants focusin/focusout + var attaches = 0, + handler = function( event ) { + jQuery.event.simulate( fix, event.target, jQuery.event.fix( event ), true ); + }; + + jQuery.event.special[ fix ] = { + setup: function() { + if ( attaches++ === 0 ) { + document.addEventListener( orig, handler, true ); + } + }, + teardown: function() { + if ( --attaches === 0 ) { + document.removeEventListener( orig, handler, true ); + } + } + }; + }); +} + +jQuery.fn.extend({ + + on: function( types, selector, data, fn, /*INTERNAL*/ one ) { + var origFn, type; + + // Types can be a map of types/handlers + if ( typeof types === "object" ) { + // ( types-Object, selector, data ) + if ( typeof selector !== "string" ) { // && selector != null + // ( types-Object, data ) + data = data || selector; + selector = undefined; + } + for ( type in types ) { + this.on( type, selector, data, types[ type ], one ); + } + return this; + } + + if ( data == null && fn == null ) { + // ( types, fn ) + fn = selector; + data = selector = undefined; + } else if ( fn == null ) { + if ( typeof selector === "string" ) { + // ( types, selector, fn ) + fn = data; + data = undefined; + } else { + // ( types, data, fn ) + fn = data; + data = selector; + selector = undefined; + } + } + if ( fn === false ) { + fn = returnFalse; + } else if ( !fn ) { + return this; + } + + if ( one === 1 ) { + origFn = fn; + fn = function( event ) { + // Can use an empty set, since event contains the info + jQuery().off( event ); + return origFn.apply( this, arguments ); + }; + // Use same guid so caller can remove using origFn + fn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ ); + } + return this.each( function() { + jQuery.event.add( this, types, fn, data, selector ); + }); + }, + one: function( types, selector, data, fn ) { + return this.on( types, selector, data, fn, 1 ); + }, + off: function( types, selector, fn ) { + var handleObj, type; + if ( types && types.preventDefault && types.handleObj ) { + // ( event ) dispatched jQuery.Event + handleObj = types.handleObj; + jQuery( types.delegateTarget ).off( + handleObj.namespace ? handleObj.origType + "." + handleObj.namespace : handleObj.origType, + handleObj.selector, + handleObj.handler + ); + return this; + } + if ( typeof types === "object" ) { + // ( types-object [, selector] ) + for ( type in types ) { + this.off( type, selector, types[ type ] ); + } + return this; + } + if ( selector === false || typeof selector === "function" ) { + // ( types [, fn] ) + fn = selector; + selector = undefined; + } + if ( fn === false ) { + fn = returnFalse; + } + return this.each(function() { + jQuery.event.remove( this, types, fn, selector ); + }); + }, + + bind: function( types, data, fn ) { + return this.on( types, null, data, fn ); + }, + unbind: function( types, fn ) { + return this.off( types, null, fn ); + }, + + delegate: function( selector, types, data, fn ) { + return this.on( types, selector, data, fn ); + }, + undelegate: function( selector, types, fn ) { + // ( namespace ) or ( selector, types [, fn] ) + return arguments.length === 1 ? this.off( selector, "**" ) : this.off( types, selector || "**", fn ); + }, + + trigger: function( type, data ) { + return this.each(function() { + jQuery.event.trigger( type, data, this ); + }); + }, + triggerHandler: function( type, data ) { + if ( this[0] ) { + return jQuery.event.trigger( type, data, this[0], true ); + } + }, + + hover: function( fnOver, fnOut ) { + return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver ); + } +}); + +jQuery.each( ("blur focus focusin focusout load resize scroll unload click dblclick " + + "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " + + "change select submit keydown keypress keyup error contextmenu").split(" "), function( i, name ) { + + // Handle event binding + jQuery.fn[ name ] = function( data, fn ) { + return arguments.length > 0 ? + this.on( name, null, data, fn ) : + this.trigger( name ); + }; + + if ( rkeyEvent.test( name ) ) { + jQuery.event.fixHooks[ name ] = jQuery.event.keyHooks; + } + + if ( rmouseEvent.test( name ) ) { + jQuery.event.fixHooks[ name ] = jQuery.event.mouseHooks; + } +}); +/*! + * Sizzle CSS Selector Engine + * Copyright 2012 jQuery Foundation and other contributors + * Released under the MIT license + * http://sizzlejs.com/ + */ +(function( window, undefined ) { + +var i, + cachedruns, + Expr, + getText, + isXML, + compile, + hasDuplicate, + outermostContext, + + // Local document vars + setDocument, + document, + docElem, + documentIsXML, + rbuggyQSA, + rbuggyMatches, + matches, + contains, + sortOrder, + + // Instance-specific data + expando = "sizzle" + -(new Date()), + preferredDoc = window.document, + support = {}, + dirruns = 0, + done = 0, + classCache = createCache(), + tokenCache = createCache(), + compilerCache = createCache(), + + // General-purpose constants + Token = String, + strundefined = typeof undefined, + MAX_NEGATIVE = 1 << 31, + + // Array methods + arr = [], + pop = arr.pop, + push = arr.push, + slice = arr.slice, + // Use a stripped-down indexOf if we can't use a native one + indexOf = arr.indexOf || function( elem ) { + var i = 0, + len = this.length; + for ( ; i < len; i++ ) { + if ( this[i] === elem ) { + return i; + } + } + return -1; + }, + + + // Regular expressions + + // Whitespace characters http://www.w3.org/TR/css3-selectors/#whitespace + whitespace = "[\\x20\\t\\r\\n\\f]", + // http://www.w3.org/TR/css3-syntax/#characters + characterEncoding = "(?:\\\\.|[\\w-]|[^\\x00-\\xa0])+", + + // Loosely modeled on CSS identifier characters + // An unquoted value should be a CSS identifier http://www.w3.org/TR/css3-selectors/#attribute-selectors + // Proper syntax: http://www.w3.org/TR/CSS21/syndata.html#value-def-identifier + identifier = characterEncoding.replace( "w", "w#" ), + + // Acceptable operators http://www.w3.org/TR/selectors/#attribute-selectors + operators = "([*^$|!~]?=)", + attributes = "\\[" + whitespace + "*(" + characterEncoding + ")" + whitespace + + "*(?:" + operators + whitespace + "*(?:(['\"])((?:\\\\.|[^\\\\])*?)\\3|(" + identifier + ")|)|)" + whitespace + "*\\]", + + // Prefer arguments quoted, + // then not containing pseudos/brackets, + // then attribute selectors/non-parenthetical expressions, + // then anything else + // These preferences are here to reduce the number of selectors + // needing tokenize in the PSEUDO preFilter + pseudos = ":(" + characterEncoding + ")(?:\$((['\"])((?:\\\\.|[^\\\\])*?)\\3|((?:\\\\.|[^\\\\()[\\]]|" + attributes.replace( 3, 8 ) + ")*)|.*)\$|)", + + // Leading and non-escaped trailing whitespace, capturing some non-whitespace characters preceding the latter + rtrim = new RegExp( "^" + whitespace + "+|((?:^|[^\\\\])(?:\\\\.)*)" + whitespace + "+$", "g" ), + + rcomma = new RegExp( "^" + whitespace + "*," + whitespace + "*" ), + rcombinators = new RegExp( "^" + whitespace + "*([\\x20\\t\\r\\n\\f>+~])" + whitespace + "*" ), + rpseudo = new RegExp( pseudos ), + ridentifier = new RegExp( "^" + identifier + "$" ), + + matchExpr = { + "ID": new RegExp( "^#(" + characterEncoding + ")" ), + "CLASS": new RegExp( "^\\.(" + characterEncoding + ")" ), + "NAME": new RegExp( "^\\[name=['\"]?(" + characterEncoding + ")['\"]?\\]" ), + "TAG": new RegExp( "^(" + characterEncoding.replace( "w", "w*" ) + ")" ), + "ATTR": new RegExp( "^" + attributes ), + "PSEUDO": new RegExp( "^" + pseudos ), + "CHILD": new RegExp( "^:(only|first|last|nth|nth-last)-(child|of-type)(?:\$" + whitespace + + "*(even|odd|(([+-]|)(\\d*)n|)" + whitespace + "*(?:([+-]|)" + whitespace + + "*(\\d+)|))" + whitespace + "*\$|)", "i" ), + // For use in libraries implementing .is() + // We use this for POS matching in `select` + "needsContext": new RegExp( "^" + whitespace + "*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\$" + + whitespace + "*((?:-\\d)?\\d*)" + whitespace + "*\$|)(?=[^-]|$)", "i" ) + }, + + rsibling = /[\x20\t\r\n\f]*[+~]/, + + rnative = /\{\s*\[native code\]\s*\}/, + + // Easily-parseable/retrievable ID or TAG or CLASS selectors + rquickExpr = /^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/, + + rinputs = /^(?:input|select|textarea|button)$/i, + rheader = /^h\d$/i, + + rescape = /'|\\/g, + rattributeQuotes = /\=[\x20\t\r\n\f]*([^'"\]]*)[\x20\t\r\n\f]*\]/g, + + // CSS escapes http://www.w3.org/TR/CSS21/syndata.html#escaped-characters + runescape = /\\([\da-fA-F]{1,6}[\x20\t\r\n\f]?|.)/g, + funescape = function( _, escaped ) { + var high = "0x" + escaped - 0x10000; + // NaN means non-codepoint + return high !== high ? + escaped : + // BMP codepoint + high < 0 ? + String.fromCharCode( high + 0x10000 ) : + // Supplemental Plane codepoint (surrogate pair) + String.fromCharCode( high >> 10 | 0xD800, high & 0x3FF | 0xDC00 ); + }; + +// Use a stripped-down slice if we can't use a native one +try { + slice.call( docElem.childNodes, 0 )[0].nodeType; +} catch ( e ) { + slice = function( i ) { + var elem, + results = []; + for ( ; (elem = this[i]); i++ ) { + results.push( elem ); + } + return results; + }; +} + +/** + * For feature detection + * @param {Function} fn The function to test for native support + */ +function isNative( fn ) { + return rnative.test( fn + "" ); +} + +/** + * Create key-value caches of limited size + * @returns {Function(string, Object)} Returns the Object data after storing it on itself with + * property name the (space-suffixed) string and (if the cache is larger than Expr.cacheLength) + * deleting the oldest entry + */ +function createCache() { + var cache, + keys = []; + + return (cache = function( key, value ) { + // Use (key + " ") to avoid collision with native prototype properties (see Issue #157) + if ( keys.push( key += " " ) > Expr.cacheLength ) { + // Only keep the most recent entries + delete cache[ keys.shift() ]; + } + return (cache[ key ] = value); + }); +} + +/** + * Mark a function for special use by Sizzle + * @param {Function} fn The function to mark + */ +function markFunction( fn ) { + fn[ expando ] = true; + return fn; +} + +/** + * Support testing using an element + * @param {Function} fn Passed the created div and expects a boolean result + */ +function assert( fn ) { + var div = document.createElement("div"); + + try { + return fn( div ); + } catch (e) { + return false; + } finally { + // release memory in IE + div = null; + } +} + +function Sizzle( selector, context, results, seed ) { + var match, elem, m, nodeType, + // QSA vars + i, groups, old, nid, newContext, newSelector; + + if ( ( context ? context.ownerDocument || context : preferredDoc ) !== document ) { + setDocument( context ); + } + + context = context || document; + results = results || []; + + if ( !selector || typeof selector !== "string" ) { + return results; + } + + if ( (nodeType = context.nodeType) !== 1 && nodeType !== 9 ) { + return []; + } + + if ( !documentIsXML && !seed ) { + + // Shortcuts + if ( (match = rquickExpr.exec( selector )) ) { + // Speed-up: Sizzle("#ID") + if ( (m = match[1]) ) { + if ( nodeType === 9 ) { + elem = context.getElementById( m ); + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + if ( elem && elem.parentNode ) { + // Handle the case where IE, Opera, and Webkit return items + // by name instead of ID + if ( elem.id === m ) { + results.push( elem ); + return results; + } + } else { + return results; + } + } else { + // Context is not a document + if ( context.ownerDocument && (elem = context.ownerDocument.getElementById( m )) && + contains( context, elem ) && elem.id === m ) { + results.push( elem ); + return results; + } + } + + // Speed-up: Sizzle("TAG") + } else if ( match[2] ) { + push.apply( results, slice.call(context.getElementsByTagName( selector ), 0) ); + return results; + + // Speed-up: Sizzle(".CLASS") + } else if ( (m = match[3]) && support.getByClassName && context.getElementsByClassName ) { + push.apply( results, slice.call(context.getElementsByClassName( m ), 0) ); + return results; + } + } + + // QSA path + if ( support.qsa && !rbuggyQSA.test(selector) ) { + old = true; + nid = expando; + newContext = context; + newSelector = nodeType === 9 && selector; + + // qSA works strangely on Element-rooted queries + // We can work around this by specifying an extra ID on the root + // and working up from there (Thanks to Andrew Dupont for the technique) + // IE 8 doesn't work on object elements + if ( nodeType === 1 && context.nodeName.toLowerCase() !== "object" ) { + groups = tokenize( selector ); + + if ( (old = context.getAttribute("id")) ) { + nid = old.replace( rescape, "\\$&" ); + } else { + context.setAttribute( "id", nid ); + } + nid = "[id='" + nid + "'] "; + + i = groups.length; + while ( i-- ) { + groups[i] = nid + groups[i].join(""); + } + newContext = rsibling.test( selector ) && context.parentNode || context; + newSelector = groups.join(","); + } + + if ( newSelector ) { + try { + push.apply( results, slice.call( newContext.querySelectorAll( + newSelector + ), 0 ) ); + return results; + } catch(qsaError) { + } finally { + if ( !old ) { + context.removeAttribute("id"); + } + } + } + } + } + + // All others + return select( selector.replace( rtrim, "$1" ), context, results, seed ); +} + +/** + * Detect xml + * @param {Element|Object} elem An element or a document + */ +isXML = Sizzle.isXML = function( elem ) { + // documentElement is verified for cases where it doesn't yet exist + // (such as loading iframes in IE - #4833) + var documentElement = elem && (elem.ownerDocument || elem).documentElement; + return documentElement ? documentElement.nodeName !== "HTML" : false; +}; + +/** + * Sets document-related variables once based on the current document + * @param {Element|Object} [doc] An element or document object to use to set the document + * @returns {Object} Returns the current document + */ +setDocument = Sizzle.setDocument = function( node ) { + var doc = node ? node.ownerDocument || node : preferredDoc; + + // If no document and documentElement is available, return + if ( doc === document || doc.nodeType !== 9 || !doc.documentElement ) { + return document; + } + + // Set our document + document = doc; + docElem = doc.documentElement; + + // Support tests + documentIsXML = isXML( doc ); + + // Check if getElementsByTagName("*") returns only elements + support.tagNameNoComments = assert(function( div ) { + div.appendChild( doc.createComment("") ); + return !div.getElementsByTagName("*").length; + }); + + // Check if attributes should be retrieved by attribute nodes + support.attributes = assert(function( div ) { + div.innerHTML = ""; + var type = typeof div.lastChild.getAttribute("multiple"); + // IE8 returns a string for some attributes even when not present + return type !== "boolean" && type !== "string"; + }); + + // Check if getElementsByClassName can be trusted + support.getByClassName = assert(function( div ) { + // Opera can't find a second classname (in 9.6) + div.innerHTML = ""; + if ( !div.getElementsByClassName || !div.getElementsByClassName("e").length ) { + return false; + } + + // Safari 3.2 caches class attributes and doesn't catch changes + div.lastChild.className = "e"; + return div.getElementsByClassName("e").length === 2; + }); + + // Check if getElementById returns elements by name + // Check if getElementsByName privileges form controls or returns elements by ID + support.getByName = assert(function( div ) { + // Inject content + div.id = expando + 0; + div.innerHTML = "

"; + docElem.insertBefore( div, docElem.firstChild ); + + // Test + var pass = doc.getElementsByName && + // buggy browsers will return fewer than the correct 2 + doc.getElementsByName( expando ).length === 2 + + // buggy browsers will return more than the correct 0 + doc.getElementsByName( expando + 0 ).length; + support.getIdNotName = !doc.getElementById( expando ); + + // Cleanup + docElem.removeChild( div ); + + return pass; + }); + + // IE6/7 return modified attributes + Expr.attrHandle = assert(function( div ) { + div.innerHTML = ""; + return div.firstChild && typeof div.firstChild.getAttribute !== strundefined && + div.firstChild.getAttribute("href") === "#"; + }) ? + {} : + { + "href": function( elem ) { + return elem.getAttribute( "href", 2 ); + }, + "type": function( elem ) { + return elem.getAttribute("type"); + } + }; + + // ID find and filter + if ( support.getIdNotName ) { + Expr.find["ID"] = function( id, context ) { + if ( typeof context.getElementById !== strundefined && !documentIsXML ) { + var m = context.getElementById( id ); + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + return m && m.parentNode ? [m] : []; + } + }; + Expr.filter["ID"] = function( id ) { + var attrId = id.replace( runescape, funescape ); + return function( elem ) { + return elem.getAttribute("id") === attrId; + }; + }; + } else { + Expr.find["ID"] = function( id, context ) { + if ( typeof context.getElementById !== strundefined && !documentIsXML ) { + var m = context.getElementById( id ); + + return m ? + m.id === id || typeof m.getAttributeNode !== strundefined && m.getAttributeNode("id").value === id ? + [m] : + undefined : + []; + } + }; + Expr.filter["ID"] = function( id ) { + var attrId = id.replace( runescape, funescape ); + return function( elem ) { + var node = typeof elem.getAttributeNode !== strundefined && elem.getAttributeNode("id"); + return node && node.value === attrId; + }; + }; + } + + // Tag + Expr.find["TAG"] = support.tagNameNoComments ? + function( tag, context ) { + if ( typeof context.getElementsByTagName !== strundefined ) { + return context.getElementsByTagName( tag ); + } + } : + function( tag, context ) { + var elem, + tmp = [], + i = 0, + results = context.getElementsByTagName( tag ); + + // Filter out possible comments + if ( tag === "*" ) { + for ( ; (elem = results[i]); i++ ) { + if ( elem.nodeType === 1 ) { + tmp.push( elem ); + } + } + + return tmp; + } + return results; + }; + + // Name + Expr.find["NAME"] = support.getByName && function( tag, context ) { + if ( typeof context.getElementsByName !== strundefined ) { + return context.getElementsByName( name ); + } + }; + + // Class + Expr.find["CLASS"] = support.getByClassName && function( className, context ) { + if ( typeof context.getElementsByClassName !== strundefined && !documentIsXML ) { + return context.getElementsByClassName( className ); + } + }; + + // QSA and matchesSelector support + + // matchesSelector(:active) reports false when true (IE9/Opera 11.5) + rbuggyMatches = []; + + // qSa(:focus) reports false when true (Chrome 21), + // no need to also add to buggyMatches since matches checks buggyQSA + // A support test would require too much code (would include document ready) + rbuggyQSA = [ ":focus" ]; + + if ( (support.qsa = isNative(doc.querySelectorAll)) ) { + // Build QSA regex + // Regex strategy adopted from Diego Perini + assert(function( div ) { + // Select is set to empty string on purpose + // This is to test IE's treatment of not explictly + // setting a boolean content attribute, + // since its presence should be enough + // http://bugs.jquery.com/ticket/12359 + div.innerHTML = ""; + + // IE8 - Some boolean attributes are not treated correctly + if ( !div.querySelectorAll("[selected]").length ) { + rbuggyQSA.push( "\\[" + whitespace + "*(?:checked|disabled|ismap|multiple|readonly|selected|value)" ); + } + + // Webkit/Opera - :checked should return selected option elements + // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked + // IE8 throws error here and will not see later tests + if ( !div.querySelectorAll(":checked").length ) { + rbuggyQSA.push(":checked"); + } + }); + + assert(function( div ) { + + // Opera 10-12/IE8 - ^= $= *= and empty values + // Should not select anything + div.innerHTML = ""; + if ( div.querySelectorAll("[i^='']").length ) { + rbuggyQSA.push( "[*^$]=" + whitespace + "*(?:\"\"|'')" ); + } + + // FF 3.5 - :enabled/:disabled and hidden elements (hidden elements are still enabled) + // IE8 throws error here and will not see later tests + if ( !div.querySelectorAll(":enabled").length ) { + rbuggyQSA.push( ":enabled", ":disabled" ); + } + + // Opera 10-11 does not throw on post-comma invalid pseudos + div.querySelectorAll("*,:x"); + rbuggyQSA.push(",.*:"); + }); + } + + if ( (support.matchesSelector = isNative( (matches = docElem.matchesSelector || + docElem.mozMatchesSelector || + docElem.webkitMatchesSelector || + docElem.oMatchesSelector || + docElem.msMatchesSelector) )) ) { + + assert(function( div ) { + // Check to see if it's possible to do matchesSelector + // on a disconnected node (IE 9) + support.disconnectedMatch = matches.call( div, "div" ); + + // This should fail with an exception + // Gecko does not error, returns false instead + matches.call( div, "[s!='']:x" ); + rbuggyMatches.push( "!=", pseudos ); + }); + } + + rbuggyQSA = new RegExp( rbuggyQSA.join("|") ); + rbuggyMatches = new RegExp( rbuggyMatches.join("|") ); + + // Element contains another + // Purposefully does not implement inclusive descendent + // As in, an element does not contain itself + contains = isNative(docElem.contains) || docElem.compareDocumentPosition ? + function( a, b ) { + var adown = a.nodeType === 9 ? a.documentElement : a, + bup = b && b.parentNode; + return a === bup || !!( bup && bup.nodeType === 1 && ( + adown.contains ? + adown.contains( bup ) : + a.compareDocumentPosition && a.compareDocumentPosition( bup ) & 16 + )); + } : + function( a, b ) { + if ( b ) { + while ( (b = b.parentNode) ) { + if ( b === a ) { + return true; + } + } + } + return false; + }; + + // Document order sorting + sortOrder = docElem.compareDocumentPosition ? + function( a, b ) { + var compare; + + if ( a === b ) { + hasDuplicate = true; + return 0; + } + + if ( (compare = b.compareDocumentPosition && a.compareDocumentPosition && a.compareDocumentPosition( b )) ) { + if ( compare & 1 || a.parentNode && a.parentNode.nodeType === 11 ) { + if ( a === doc || contains( preferredDoc, a ) ) { + return -1; + } + if ( b === doc || contains( preferredDoc, b ) ) { + return 1; + } + return 0; + } + return compare & 4 ? -1 : 1; + } + + return a.compareDocumentPosition ? -1 : 1; + } : + function( a, b ) { + var cur, + i = 0, + aup = a.parentNode, + bup = b.parentNode, + ap = [ a ], + bp = [ b ]; + + // The nodes are identical, we can exit early + if ( a === b ) { + hasDuplicate = true; + return 0; + + // Fallback to using sourceIndex (in IE) if it's available on both nodes + } else if ( a.sourceIndex && b.sourceIndex ) { + return ( ~b.sourceIndex || MAX_NEGATIVE ) - ( contains( preferredDoc, a ) && ~a.sourceIndex || MAX_NEGATIVE ); + + // Parentless nodes are either documents or disconnected + } else if ( !aup || !bup ) { + return a === doc ? -1 : + b === doc ? 1 : + aup ? -1 : + bup ? 1 : + 0; + + // If the nodes are siblings, we can do a quick check + } else if ( aup === bup ) { + return siblingCheck( a, b ); + } + + // Otherwise we need full lists of their ancestors for comparison + cur = a; + while ( (cur = cur.parentNode) ) { + ap.unshift( cur ); + } + cur = b; + while ( (cur = cur.parentNode) ) { + bp.unshift( cur ); + } + + // Walk down the tree looking for a discrepancy + while ( ap[i] === bp[i] ) { + i++; + } + + return i ? + // Do a sibling check if the nodes have a common ancestor + siblingCheck( ap[i], bp[i] ) : + + // Otherwise nodes in our document sort first + ap[i] === preferredDoc ? -1 : + bp[i] === preferredDoc ? 1 : + 0; + }; + + // Always assume the presence of duplicates if sort doesn't + // pass them to our comparison function (as in Google Chrome). + hasDuplicate = false; + [0, 0].sort( sortOrder ); + support.detectDuplicates = hasDuplicate; + + return document; +}; + +Sizzle.matches = function( expr, elements ) { + return Sizzle( expr, null, null, elements ); +}; + +Sizzle.matchesSelector = function( elem, expr ) { + // Set document vars if needed + if ( ( elem.ownerDocument || elem ) !== document ) { + setDocument( elem ); + } + + // Make sure that attribute selectors are quoted + expr = expr.replace( rattributeQuotes, "='$1']" ); + + // rbuggyQSA always contains :focus, so no need for an existence check + if ( support.matchesSelector && !documentIsXML && (!rbuggyMatches || !rbuggyMatches.test(expr)) && !rbuggyQSA.test(expr) ) { + try { + var ret = matches.call( elem, expr ); + + // IE 9's matchesSelector returns false on disconnected nodes + if ( ret || support.disconnectedMatch || + // As well, disconnected nodes are said to be in a document + // fragment in IE 9 + elem.document && elem.document.nodeType !== 11 ) { + return ret; + } + } catch(e) {} + } + + return Sizzle( expr, document, null, [elem] ).length > 0; +}; + +Sizzle.contains = function( context, elem ) { + // Set document vars if needed + if ( ( context.ownerDocument || context ) !== document ) { + setDocument( context ); + } + return contains( context, elem ); +}; + +Sizzle.attr = function( elem, name ) { + var val; + + // Set document vars if needed + if ( ( elem.ownerDocument || elem ) !== document ) { + setDocument( elem ); + } + + if ( !documentIsXML ) { + name = name.toLowerCase(); + } + if ( (val = Expr.attrHandle[ name ]) ) { + return val( elem ); + } + if ( documentIsXML || support.attributes ) { + return elem.getAttribute( name ); + } + return ( (val = elem.getAttributeNode( name )) || elem.getAttribute( name ) ) && elem[ name ] === true ? + name : + val && val.specified ? val.value : null; +}; + +Sizzle.error = function( msg ) { + throw new Error( "Syntax error, unrecognized expression: " + msg ); +}; + +// Document sorting and removing duplicates +Sizzle.uniqueSort = function( results ) { + var elem, + duplicates = [], + i = 1, + j = 0; + + // Unless we *know* we can detect duplicates, assume their presence + hasDuplicate = !support.detectDuplicates; + results.sort( sortOrder ); + + if ( hasDuplicate ) { + for ( ; (elem = results[i]); i++ ) { + if ( elem === results[ i - 1 ] ) { + j = duplicates.push( i ); + } + } + while ( j-- ) { + results.splice( duplicates[ j ], 1 ); + } + } + + return results; +}; + +function siblingCheck( a, b ) { + var cur = a && b && a.nextSibling; + + for ( ; cur; cur = cur.nextSibling ) { + if ( cur === b ) { + return -1; + } + } + + return a ? 1 : -1; +} + +// Returns a function to use in pseudos for input types +function createInputPseudo( type ) { + return function( elem ) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && elem.type === type; + }; +} + +// Returns a function to use in pseudos for buttons +function createButtonPseudo( type ) { + return function( elem ) { + var name = elem.nodeName.toLowerCase(); + return (name === "input" || name === "button") && elem.type === type; + }; +} + +// Returns a function to use in pseudos for positionals +function createPositionalPseudo( fn ) { + return markFunction(function( argument ) { + argument = +argument; + return markFunction(function( seed, matches ) { + var j, + matchIndexes = fn( [], seed.length, argument ), + i = matchIndexes.length; + + // Match elements found at the specified indexes + while ( i-- ) { + if ( seed[ (j = matchIndexes[i]) ] ) { + seed[j] = !(matches[j] = seed[j]); + } + } + }); + }); +} + +/** + * Utility function for retrieving the text value of an array of DOM nodes + * @param {Array|Element} elem + */ +getText = Sizzle.getText = function( elem ) { + var node, + ret = "", + i = 0, + nodeType = elem.nodeType; + + if ( !nodeType ) { + // If no nodeType, this is expected to be an array + for ( ; (node = elem[i]); i++ ) { + // Do not traverse comment nodes + ret += getText( node ); + } + } else if ( nodeType === 1 || nodeType === 9 || nodeType === 11 ) { + // Use textContent for elements + // innerText usage removed for consistency of new lines (see #11153) + if ( typeof elem.textContent === "string" ) { + return elem.textContent; + } else { + // Traverse its children + for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) { + ret += getText( elem ); + } + } + } else if ( nodeType === 3 || nodeType === 4 ) { + return elem.nodeValue; + } + // Do not include comment or processing instruction nodes + + return ret; +}; + +Expr = Sizzle.selectors = { + + // Can be adjusted by the user + cacheLength: 50, + + createPseudo: markFunction, + + match: matchExpr, + + find: {}, + + relative: { + ">": { dir: "parentNode", first: true }, + " ": { dir: "parentNode" }, + "+": { dir: "previousSibling", first: true }, + "~": { dir: "previousSibling" } + }, + + preFilter: { + "ATTR": function( match ) { + match[1] = match[1].replace( runescape, funescape ); + + // Move the given value to match[3] whether quoted or unquoted + match[3] = ( match[4] || match[5] || "" ).replace( runescape, funescape ); + + if ( match[2] === "~=" ) { + match[3] = " " + match[3] + " "; + } + + return match.slice( 0, 4 ); + }, + + "CHILD": function( match ) { + /* matches from matchExpr["CHILD"] + 1 type (only|nth|...) + 2 what (child|of-type) + 3 argument (even|odd|\d*|\d*n([+-]\d+)?|...) + 4 xn-component of xn+y argument ([+-]?\d*n|) + 5 sign of xn-component + 6 x of xn-component + 7 sign of y-component + 8 y of y-component + */ + match[1] = match[1].toLowerCase(); + + if ( match[1].slice( 0, 3 ) === "nth" ) { + // nth-* requires argument + if ( !match[3] ) { + Sizzle.error( match[0] ); + } + + // numeric x and y parameters for Expr.filter.CHILD + // remember that false/true cast respectively to 0/1 + match[4] = +( match[4] ? match[5] + (match[6] || 1) : 2 * ( match[3] === "even" || match[3] === "odd" ) ); + match[5] = +( ( match[7] + match[8] ) || match[3] === "odd" ); + + // other types prohibit arguments + } else if ( match[3] ) { + Sizzle.error( match[0] ); + } + + return match; + }, + + "PSEUDO": function( match ) { + var excess, + unquoted = !match[5] && match[2]; + + if ( matchExpr["CHILD"].test( match[0] ) ) { + return null; + } + + // Accept quoted arguments as-is + if ( match[4] ) { + match[2] = match[4]; + + // Strip excess characters from unquoted arguments + } else if ( unquoted && rpseudo.test( unquoted ) && + // Get excess from tokenize (recursively) + (excess = tokenize( unquoted, true )) && + // advance to the next closing parenthesis + (excess = unquoted.indexOf( ")", unquoted.length - excess ) - unquoted.length) ) { + + // excess is a negative index + match[0] = match[0].slice( 0, excess ); + match[2] = unquoted.slice( 0, excess ); + } + + // Return only captures needed by the pseudo filter method (type and argument) + return match.slice( 0, 3 ); + } + }, + + filter: { + + "TAG": function( nodeName ) { + if ( nodeName === "*" ) { + return function() { return true; }; + } + + nodeName = nodeName.replace( runescape, funescape ).toLowerCase(); + return function( elem ) { + return elem.nodeName && elem.nodeName.toLowerCase() === nodeName; + }; + }, + + "CLASS": function( className ) { + var pattern = classCache[ className + " " ]; + + return pattern || + (pattern = new RegExp( "(^|" + whitespace + ")" + className + "(" + whitespace + "|$)" )) && + classCache( className, function( elem ) { + return pattern.test( elem.className || (typeof elem.getAttribute !== strundefined && elem.getAttribute("class")) || "" ); + }); + }, + + "ATTR": function( name, operator, check ) { + return function( elem ) { + var result = Sizzle.attr( elem, name ); + + if ( result == null ) { + return operator === "!="; + } + if ( !operator ) { + return true; + } + + result += ""; + + return operator === "=" ? result === check : + operator === "!=" ? result !== check : + operator === "^=" ? check && result.indexOf( check ) === 0 : + operator === "*=" ? check && result.indexOf( check ) > -1 : + operator === "$=" ? check && result.substr( result.length - check.length ) === check : + operator === "~=" ? ( " " + result + " " ).indexOf( check ) > -1 : + operator === "|=" ? result === check || result.substr( 0, check.length + 1 ) === check + "-" : + false; + }; + }, + + "CHILD": function( type, what, argument, first, last ) { + var simple = type.slice( 0, 3 ) !== "nth", + forward = type.slice( -4 ) !== "last", + ofType = what === "of-type"; + + return first === 1 && last === 0 ? + + // Shortcut for :nth-*(n) + function( elem ) { + return !!elem.parentNode; + } : + + function( elem, context, xml ) { + var cache, outerCache, node, diff, nodeIndex, start, + dir = simple !== forward ? "nextSibling" : "previousSibling", + parent = elem.parentNode, + name = ofType && elem.nodeName.toLowerCase(), + useCache = !xml && !ofType; + + if ( parent ) { + + // :(first|last|only)-(child|of-type) + if ( simple ) { + while ( dir ) { + node = elem; + while ( (node = node[ dir ]) ) { + if ( ofType ? node.nodeName.toLowerCase() === name : node.nodeType === 1 ) { + return false; + } + } + // Reverse direction for :only-* (if we haven't yet done so) + start = dir = type === "only" && !start && "nextSibling"; + } + return true; + } + + start = [ forward ? parent.firstChild : parent.lastChild ]; + + // non-xml :nth-child(...) stores cache data on `parent` + if ( forward && useCache ) { + // Seek `elem` from a previously-cached index + outerCache = parent[ expando ] || (parent[ expando ] = {}); + cache = outerCache[ type ] || []; + nodeIndex = cache[0] === dirruns && cache[1]; + diff = cache[0] === dirruns && cache[2]; + node = nodeIndex && parent.childNodes[ nodeIndex ]; + + while ( (node = ++nodeIndex && node && node[ dir ] || + + // Fallback to seeking `elem` from the start + (diff = nodeIndex = 0) || start.pop()) ) { + + // When found, cache indexes on `parent` and break + if ( node.nodeType === 1 && ++diff && node === elem ) { + outerCache[ type ] = [ dirruns, nodeIndex, diff ]; + break; + } + } + + // Use previously-cached element index if available + } else if ( useCache && (cache = (elem[ expando ] || (elem[ expando ] = {}))[ type ]) && cache[0] === dirruns ) { + diff = cache[1]; + + // xml :nth-child(...) or :nth-last-child(...) or :nth(-last)?-of-type(...) + } else { + // Use the same loop as above to seek `elem` from the start + while ( (node = ++nodeIndex && node && node[ dir ] || + (diff = nodeIndex = 0) || start.pop()) ) { + + if ( ( ofType ? node.nodeName.toLowerCase() === name : node.nodeType === 1 ) && ++diff ) { + // Cache the index of each encountered element + if ( useCache ) { + (node[ expando ] || (node[ expando ] = {}))[ type ] = [ dirruns, diff ]; + } + + if ( node === elem ) { + break; + } + } + } + } + + // Incorporate the offset, then check against cycle size + diff -= last; + return diff === first || ( diff % first === 0 && diff / first >= 0 ); + } + }; + }, + + "PSEUDO": function( pseudo, argument ) { + // pseudo-class names are case-insensitive + // http://www.w3.org/TR/selectors/#pseudo-classes + // Prioritize by case sensitivity in case custom pseudos are added with uppercase letters + // Remember that setFilters inherits from pseudos + var args, + fn = Expr.pseudos[ pseudo ] || Expr.setFilters[ pseudo.toLowerCase() ] || + Sizzle.error( "unsupported pseudo: " + pseudo ); + + // The user may use createPseudo to indicate that + // arguments are needed to create the filter function + // just as Sizzle does + if ( fn[ expando ] ) { + return fn( argument ); + } + + // But maintain support for old signatures + if ( fn.length > 1 ) { + args = [ pseudo, pseudo, "", argument ]; + return Expr.setFilters.hasOwnProperty( pseudo.toLowerCase() ) ? + markFunction(function( seed, matches ) { + var idx, + matched = fn( seed, argument ), + i = matched.length; + while ( i-- ) { + idx = indexOf.call( seed, matched[i] ); + seed[ idx ] = !( matches[ idx ] = matched[i] ); + } + }) : + function( elem ) { + return fn( elem, 0, args ); + }; + } + + return fn; + } + }, + + pseudos: { + // Potentially complex pseudos + "not": markFunction(function( selector ) { + // Trim the selector passed to compile + // to avoid treating leading and trailing + // spaces as combinators + var input = [], + results = [], + matcher = compile( selector.replace( rtrim, "$1" ) ); + + return matcher[ expando ] ? + markFunction(function( seed, matches, context, xml ) { + var elem, + unmatched = matcher( seed, null, xml, [] ), + i = seed.length; + + // Match elements unmatched by `matcher` + while ( i-- ) { + if ( (elem = unmatched[i]) ) { + seed[i] = !(matches[i] = elem); + } + } + }) : + function( elem, context, xml ) { + input[0] = elem; + matcher( input, null, xml, results ); + return !results.pop(); + }; + }), + + "has": markFunction(function( selector ) { + return function( elem ) { + return Sizzle( selector, elem ).length > 0; + }; + }), + + "contains": markFunction(function( text ) { + return function( elem ) { + return ( elem.textContent || elem.innerText || getText( elem ) ).indexOf( text ) > -1; + }; + }), + + // "Whether an element is represented by a :lang() selector + // is based solely on the element's language value + // being equal to the identifier C, + // or beginning with the identifier C immediately followed by "-". + // The matching of C against the element's language value is performed case-insensitively. + // The identifier C does not have to be a valid language name." + // http://www.w3.org/TR/selectors/#lang-pseudo + "lang": markFunction( function( lang ) { + // lang value must be a valid identifider + if ( !ridentifier.test(lang || "") ) { + Sizzle.error( "unsupported lang: " + lang ); + } + lang = lang.replace( runescape, funescape ).toLowerCase(); + return function( elem ) { + var elemLang; + do { + if ( (elemLang = documentIsXML ? + elem.getAttribute("xml:lang") || elem.getAttribute("lang") : + elem.lang) ) { + + elemLang = elemLang.toLowerCase(); + return elemLang === lang || elemLang.indexOf( lang + "-" ) === 0; + } + } while ( (elem = elem.parentNode) && elem.nodeType === 1 ); + return false; + }; + }), + + // Miscellaneous + "target": function( elem ) { + var hash = window.location && window.location.hash; + return hash && hash.slice( 1 ) === elem.id; + }, + + "root": function( elem ) { + return elem === docElem; + }, + + "focus": function( elem ) { + return elem === document.activeElement && (!document.hasFocus || document.hasFocus()) && !!(elem.type || elem.href || ~elem.tabIndex); + }, + + // Boolean properties + "enabled": function( elem ) { + return elem.disabled === false; + }, + + "disabled": function( elem ) { + return elem.disabled === true; + }, + + "checked": function( elem ) { + // In CSS3, :checked should return both checked and selected elements + // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked + var nodeName = elem.nodeName.toLowerCase(); + return (nodeName === "input" && !!elem.checked) || (nodeName === "option" && !!elem.selected); + }, + + "selected": function( elem ) { + // Accessing this property makes selected-by-default + // options in Safari work properly + if ( elem.parentNode ) { + elem.parentNode.selectedIndex; + } + + return elem.selected === true; + }, + + // Contents + "empty": function( elem ) { + // http://www.w3.org/TR/selectors/#empty-pseudo + // :empty is only affected by element nodes and content nodes(including text(3), cdata(4)), + // not comment, processing instructions, or others + // Thanks to Diego Perini for the nodeName shortcut + // Greater than "@" means alpha characters (specifically not starting with "#" or "?") + for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) { + if ( elem.nodeName > "@" || elem.nodeType === 3 || elem.nodeType === 4 ) { + return false; + } + } + return true; + }, + + "parent": function( elem ) { + return !Expr.pseudos["empty"]( elem ); + }, + + // Element/input types + "header": function( elem ) { + return rheader.test( elem.nodeName ); + }, + + "input": function( elem ) { + return rinputs.test( elem.nodeName ); + }, + + "button": function( elem ) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && elem.type === "button" || name === "button"; + }, + + "text": function( elem ) { + var attr; + // IE6 and 7 will map elem.type to 'text' for new HTML5 types (search, etc) + // use getAttribute instead to test this case + return elem.nodeName.toLowerCase() === "input" && + elem.type === "text" && + ( (attr = elem.getAttribute("type")) == null || attr.toLowerCase() === elem.type ); + }, + + // Position-in-collection + "first": createPositionalPseudo(function() { + return [ 0 ]; + }), + + "last": createPositionalPseudo(function( matchIndexes, length ) { + return [ length - 1 ]; + }), + + "eq": createPositionalPseudo(function( matchIndexes, length, argument ) { + return [ argument < 0 ? argument + length : argument ]; + }), + + "even": createPositionalPseudo(function( matchIndexes, length ) { + var i = 0; + for ( ; i < length; i += 2 ) { + matchIndexes.push( i ); + } + return matchIndexes; + }), + + "odd": createPositionalPseudo(function( matchIndexes, length ) { + var i = 1; + for ( ; i < length; i += 2 ) { + matchIndexes.push( i ); + } + return matchIndexes; + }), + + "lt": createPositionalPseudo(function( matchIndexes, length, argument ) { + var i = argument < 0 ? argument + length : argument; + for ( ; --i >= 0; ) { + matchIndexes.push( i ); + } + return matchIndexes; + }), + + "gt": createPositionalPseudo(function( matchIndexes, length, argument ) { + var i = argument < 0 ? argument + length : argument; + for ( ; ++i < length; ) { + matchIndexes.push( i ); + } + return matchIndexes; + }) + } +}; + +// Add button/input type pseudos +for ( i in { radio: true, checkbox: true, file: true, password: true, image: true } ) { + Expr.pseudos[ i ] = createInputPseudo( i ); +} +for ( i in { submit: true, reset: true } ) { + Expr.pseudos[ i ] = createButtonPseudo( i ); +} + +function tokenize( selector, parseOnly ) { + var matched, match, tokens, type, + soFar, groups, preFilters, + cached = tokenCache[ selector + " " ]; + + if ( cached ) { + return parseOnly ? 0 : cached.slice( 0 ); + } + + soFar = selector; + groups = []; + preFilters = Expr.preFilter; + + while ( soFar ) { + + // Comma and first run + if ( !matched || (match = rcomma.exec( soFar )) ) { + if ( match ) { + // Don't consume trailing commas as valid + soFar = soFar.slice( match[0].length ) || soFar; + } + groups.push( tokens = [] ); + } + + matched = false; + + // Combinators + if ( (match = rcombinators.exec( soFar )) ) { + tokens.push( matched = new Token( match.shift() ) ); + soFar = soFar.slice( matched.length ); + + // Cast descendant combinators to space + matched.type = match[0].replace( rtrim, " " ); + } + + // Filters + for ( type in Expr.filter ) { + if ( (match = matchExpr[ type ].exec( soFar )) && (!preFilters[ type ] || + (match = preFilters[ type ]( match ))) ) { + + tokens.push( matched = new Token( match.shift() ) ); + soFar = soFar.slice( matched.length ); + matched.type = type; + matched.matches = match; + } + } + + if ( !matched ) { + break; + } + } + + // Return the length of the invalid excess + // if we're just parsing + // Otherwise, throw an error or return tokens + return parseOnly ? + soFar.length : + soFar ? + Sizzle.error( selector ) : + // Cache the tokens + tokenCache( selector, groups ).slice( 0 ); +} + +function addCombinator( matcher, combinator, base ) { + var dir = combinator.dir, + checkNonElements = base && combinator.dir === "parentNode", + doneName = done++; + + return combinator.first ? + // Check against closest ancestor/preceding element + function( elem, context, xml ) { + while ( (elem = elem[ dir ]) ) { + if ( elem.nodeType === 1 || checkNonElements ) { + return matcher( elem, context, xml ); + } + } + } : + + // Check against all ancestor/preceding elements + function( elem, context, xml ) { + var data, cache, outerCache, + dirkey = dirruns + " " + doneName; + + // We can't set arbitrary data on XML nodes, so they don't benefit from dir caching + if ( xml ) { + while ( (elem = elem[ dir ]) ) { + if ( elem.nodeType === 1 || checkNonElements ) { + if ( matcher( elem, context, xml ) ) { + return true; + } + } + } + } else { + while ( (elem = elem[ dir ]) ) { + if ( elem.nodeType === 1 || checkNonElements ) { + outerCache = elem[ expando ] || (elem[ expando ] = {}); + if ( (cache = outerCache[ dir ]) && cache[0] === dirkey ) { + if ( (data = cache[1]) === true || data === cachedruns ) { + return data === true; + } + } else { + cache = outerCache[ dir ] = [ dirkey ]; + cache[1] = matcher( elem, context, xml ) || cachedruns; + if ( cache[1] === true ) { + return true; + } + } + } + } + } + }; +} + +function elementMatcher( matchers ) { + return matchers.length > 1 ? + function( elem, context, xml ) { + var i = matchers.length; + while ( i-- ) { + if ( !matchers[i]( elem, context, xml ) ) { + return false; + } + } + return true; + } : + matchers[0]; +} + +function condense( unmatched, map, filter, context, xml ) { + var elem, + newUnmatched = [], + i = 0, + len = unmatched.length, + mapped = map != null; + + for ( ; i < len; i++ ) { + if ( (elem = unmatched[i]) ) { + if ( !filter || filter( elem, context, xml ) ) { + newUnmatched.push( elem ); + if ( mapped ) { + map.push( i ); + } + } + } + } + + return newUnmatched; +} + +function setMatcher( preFilter, selector, matcher, postFilter, postFinder, postSelector ) { + if ( postFilter && !postFilter[ expando ] ) { + postFilter = setMatcher( postFilter ); + } + if ( postFinder && !postFinder[ expando ] ) { + postFinder = setMatcher( postFinder, postSelector ); + } + return markFunction(function( seed, results, context, xml ) { + var temp, i, elem, + preMap = [], + postMap = [], + preexisting = results.length, + + // Get initial elements from seed or context + elems = seed || multipleContexts( selector || "*", context.nodeType ? [ context ] : context, [] ), + + // Prefilter to get matcher input, preserving a map for seed-results synchronization + matcherIn = preFilter && ( seed || !selector ) ? + condense( elems, preMap, preFilter, context, xml ) : + elems, + + matcherOut = matcher ? + // If we have a postFinder, or filtered seed, or non-seed postFilter or preexisting results, + postFinder || ( seed ? preFilter : preexisting || postFilter ) ? + + // ...intermediate processing is necessary + [] : + + // ...otherwise use results directly + results : + matcherIn; + + // Find primary matches + if ( matcher ) { + matcher( matcherIn, matcherOut, context, xml ); + } + + // Apply postFilter + if ( postFilter ) { + temp = condense( matcherOut, postMap ); + postFilter( temp, [], context, xml ); + + // Un-match failing elements by moving them back to matcherIn + i = temp.length; + while ( i-- ) { + if ( (elem = temp[i]) ) { + matcherOut[ postMap[i] ] = !(matcherIn[ postMap[i] ] = elem); + } + } + } + + if ( seed ) { + if ( postFinder || preFilter ) { + if ( postFinder ) { + // Get the final matcherOut by condensing this intermediate into postFinder contexts + temp = []; + i = matcherOut.length; + while ( i-- ) { + if ( (elem = matcherOut[i]) ) { + // Restore matcherIn since elem is not yet a final match + temp.push( (matcherIn[i] = elem) ); + } + } + postFinder( null, (matcherOut = []), temp, xml ); + } + + // Move matched elements from seed to results to keep them synchronized + i = matcherOut.length; + while ( i-- ) { + if ( (elem = matcherOut[i]) && + (temp = postFinder ? indexOf.call( seed, elem ) : preMap[i]) > -1 ) { + + seed[temp] = !(results[temp] = elem); + } + } + } + + // Add elements to results, through postFinder if defined + } else { + matcherOut = condense( + matcherOut === results ? + matcherOut.splice( preexisting, matcherOut.length ) : + matcherOut + ); + if ( postFinder ) { + postFinder( null, results, matcherOut, xml ); + } else { + push.apply( results, matcherOut ); + } + } + }); +} + +function matcherFromTokens( tokens ) { + var checkContext, matcher, j, + len = tokens.length, + leadingRelative = Expr.relative[ tokens[0].type ], + implicitRelative = leadingRelative || Expr.relative[" "], + i = leadingRelative ? 1 : 0, + + // The foundational matcher ensures that elements are reachable from top-level context(s) + matchContext = addCombinator( function( elem ) { + return elem === checkContext; + }, implicitRelative, true ), + matchAnyContext = addCombinator( function( elem ) { + return indexOf.call( checkContext, elem ) > -1; + }, implicitRelative, true ), + matchers = [ function( elem, context, xml ) { + return ( !leadingRelative && ( xml || context !== outermostContext ) ) || ( + (checkContext = context).nodeType ? + matchContext( elem, context, xml ) : + matchAnyContext( elem, context, xml ) ); + } ]; + + for ( ; i < len; i++ ) { + if ( (matcher = Expr.relative[ tokens[i].type ]) ) { + matchers = [ addCombinator(elementMatcher( matchers ), matcher) ]; + } else { + matcher = Expr.filter[ tokens[i].type ].apply( null, tokens[i].matches ); + + // Return special upon seeing a positional matcher + if ( matcher[ expando ] ) { + // Find the next relative operator (if any) for proper handling + j = ++i; + for ( ; j < len; j++ ) { + if ( Expr.relative[ tokens[j].type ] ) { + break; + } + } + return setMatcher( + i > 1 && elementMatcher( matchers ), + i > 1 && tokens.slice( 0, i - 1 ).join("").replace( rtrim, "$1" ), + matcher, + i < j && matcherFromTokens( tokens.slice( i, j ) ), + j < len && matcherFromTokens( (tokens = tokens.slice( j )) ), + j < len && tokens.join("") + ); + } + matchers.push( matcher ); + } + } + + return elementMatcher( matchers ); +} + +function matcherFromGroupMatchers( elementMatchers, setMatchers ) { + // A counter to specify which element is currently being matched + var matcherCachedRuns = 0, + bySet = setMatchers.length > 0, + byElement = elementMatchers.length > 0, + superMatcher = function( seed, context, xml, results, expandContext ) { + var elem, j, matcher, + setMatched = [], + matchedCount = 0, + i = "0", + unmatched = seed && [], + outermost = expandContext != null, + contextBackup = outermostContext, + // We must always have either seed elements or context + elems = seed || byElement && Expr.find["TAG"]( "*", expandContext && context.parentNode || context ), + // Nested matchers should use non-integer dirruns + dirrunsUnique = (dirruns += contextBackup == null ? 1 : Math.E); + + if ( outermost ) { + outermostContext = context !== document && context; + cachedruns = matcherCachedRuns; + } + + // Add elements passing elementMatchers directly to results + for ( ; (elem = elems[i]) != null; i++ ) { + if ( byElement && elem ) { + for ( j = 0; (matcher = elementMatchers[j]); j++ ) { + if ( matcher( elem, context, xml ) ) { + results.push( elem ); + break; + } + } + if ( outermost ) { + dirruns = dirrunsUnique; + cachedruns = ++matcherCachedRuns; + } + } + + // Track unmatched elements for set filters + if ( bySet ) { + // They will have gone through all possible matchers + if ( (elem = !matcher && elem) ) { + matchedCount--; + } + + // Lengthen the array for every element, matched or not + if ( seed ) { + unmatched.push( elem ); + } + } + } + + // Apply set filters to unmatched elements + // `i` starts as a string, so matchedCount would equal "00" if there are no elements + matchedCount += i; + if ( bySet && i !== matchedCount ) { + for ( j = 0; (matcher = setMatchers[j]); j++ ) { + matcher( unmatched, setMatched, context, xml ); + } + + if ( seed ) { + // Reintegrate element matches to eliminate the need for sorting + if ( matchedCount > 0 ) { + while ( i-- ) { + if ( !(unmatched[i] || setMatched[i]) ) { + setMatched[i] = pop.call( results ); + } + } + } + + // Discard index placeholder values to get only actual matches + setMatched = condense( setMatched ); + } + + // Add matches to results + push.apply( results, setMatched ); + + // Seedless set matches succeeding multiple successful matchers stipulate sorting + if ( outermost && !seed && setMatched.length > 0 && + ( matchedCount + setMatchers.length ) > 1 ) { + + Sizzle.uniqueSort( results ); + } + } + + // Override manipulation of globals by nested matchers + if ( outermost ) { + dirruns = dirrunsUnique; + outermostContext = contextBackup; + } + + return unmatched; + }; + + return bySet ? + markFunction( superMatcher ) : + superMatcher; +} + +compile = Sizzle.compile = function( selector, group /* Internal Use Only */ ) { + var i, + setMatchers = [], + elementMatchers = [], + cached = compilerCache[ selector + " " ]; + + if ( !cached ) { + // Generate a function of recursive functions that can be used to check each element + if ( !group ) { + group = tokenize( selector ); + } + i = group.length; + while ( i-- ) { + cached = matcherFromTokens( group[i] ); + if ( cached[ expando ] ) { + setMatchers.push( cached ); + } else { + elementMatchers.push( cached ); + } + } + + // Cache the compiled function + cached = compilerCache( selector, matcherFromGroupMatchers( elementMatchers, setMatchers ) ); + } + return cached; +}; + +function multipleContexts( selector, contexts, results ) { + var i = 0, + len = contexts.length; + for ( ; i < len; i++ ) { + Sizzle( selector, contexts[i], results ); + } + return results; +} + +function select( selector, context, results, seed ) { + var i, tokens, token, type, find, + match = tokenize( selector ); + + if ( !seed ) { + // Try to minimize operations if there is only one group + if ( match.length === 1 ) { + + // Take a shortcut and set the context if the root selector is an ID + tokens = match[0] = match[0].slice( 0 ); + if ( tokens.length > 2 && (token = tokens[0]).type === "ID" && + context.nodeType === 9 && !documentIsXML && + Expr.relative[ tokens[1].type ] ) { + + context = Expr.find["ID"]( token.matches[0].replace( runescape, funescape ), context )[0]; + if ( !context ) { + return results; + } + + selector = selector.slice( tokens.shift().length ); + } + + // Fetch a seed set for right-to-left matching + for ( i = matchExpr["needsContext"].test( selector ) ? -1 : tokens.length - 1; i >= 0; i-- ) { + token = tokens[i]; + + // Abort if we hit a combinator + if ( Expr.relative[ (type = token.type) ] ) { + break; + } + if ( (find = Expr.find[ type ]) ) { + // Search, expanding context for leading sibling combinators + if ( (seed = find( + token.matches[0].replace( runescape, funescape ), + rsibling.test( tokens[0].type ) && context.parentNode || context + )) ) { + + // If seed is empty or no tokens remain, we can return early + tokens.splice( i, 1 ); + selector = seed.length && tokens.join(""); + if ( !selector ) { + push.apply( results, slice.call( seed, 0 ) ); + return results; + } + + break; + } + } + } + } + } + + // Compile and execute a filtering function + // Provide `match` to avoid retokenization if we modified the selector above + compile( selector, match )( + seed, + context, + documentIsXML, + results, + rsibling.test( selector ) + ); + return results; +} + +// Deprecated +Expr.pseudos["nth"] = Expr.pseudos["eq"]; + +// Easy API for creating new setFilters +function setFilters() {} +Expr.filters = setFilters.prototype = Expr.pseudos; +Expr.setFilters = new setFilters(); + +// Initialize with the default document +setDocument(); + +// Override sizzle attribute retrieval +Sizzle.attr = jQuery.attr; +jQuery.find = Sizzle; +jQuery.expr = Sizzle.selectors; +jQuery.expr[":"] = jQuery.expr.pseudos; +jQuery.unique = Sizzle.uniqueSort; +jQuery.text = Sizzle.getText; +jQuery.isXMLDoc = Sizzle.isXML; +jQuery.contains = Sizzle.contains; + + +})( window ); +var runtil = /Until$/, + rparentsprev = /^(?:parents|prev(?:Until|All))/, + isSimple = /^.[^:#\[\.,]*$/, + rneedsContext = jQuery.expr.match.needsContext, + // methods guaranteed to produce a unique set when starting from a unique set + guaranteedUnique = { + children: true, + contents: true, + next: true, + prev: true + }; + +jQuery.fn.extend({ + find: function( selector ) { + var self, matched, i, + l = this.length; + + if ( typeof selector !== "string" ) { + self = this; + return this.pushStack( jQuery( selector ).filter(function() { + for ( i = 0; i < l; i++ ) { + if ( jQuery.contains( self[ i ], this ) ) { + return true; + } + } + }) ); + } + + matched = []; + for ( i = 0; i < l; i++ ) { + jQuery.find( selector, this[ i ], matched ); + } + + // Needed because $( selector, context ) becomes $( context ).find( selector ) + matched = this.pushStack( jQuery.unique( matched ) ); + matched.selector = ( this.selector ? this.selector + " " : "" ) + selector; + return matched; + }, + + has: function( target ) { + var targets = jQuery( target, this ), + l = targets.length; + + return this.filter(function() { + var i = 0; + for ( ; i < l; i++ ) { + if ( jQuery.contains( this, targets[i] ) ) { + return true; + } + } + }); + }, + + not: function( selector ) { + return this.pushStack( winnow(this, selector, false) ); + }, + + filter: function( selector ) { + return this.pushStack( winnow(this, selector, true) ); + }, + + is: function( selector ) { + return !!selector && ( + typeof selector === "string" ? + // If this is a positional/relative selector, check membership in the returned set + // so $("p:first").is("p:last") won't return true for a doc with two "p". + rneedsContext.test( selector ) ? + jQuery( selector, this.context ).index( this[ 0 ] ) >= 0 : + jQuery.filter( selector, this ).length > 0 : + this.filter( selector ).length > 0 ); + }, + + closest: function( selectors, context ) { + var cur, + i = 0, + l = this.length, + matched = [], + pos = ( rneedsContext.test( selectors ) || typeof selectors !== "string" ) ? + jQuery( selectors, context || this.context ) : + 0; + + for ( ; i < l; i++ ) { + cur = this[ i ]; + + while ( cur && cur.ownerDocument && cur !== context ) { + if ( pos ? pos.index( cur ) > -1 : jQuery.find.matchesSelector( cur, selectors ) ) { + matched.push( cur ); + break; + } + cur = cur.parentElement; + } + } + + return this.pushStack( matched.length > 1 ? jQuery.unique( matched ) : matched ); + }, + + // Determine the position of an element within + // the matched set of elements + index: function( elem ) { + + // No argument, return index in parent + if ( !elem ) { + return ( this[ 0 ] && this[ 0 ].parentNode ) ? this.first().prevAll().length : -1; + } + + // index in selector + if ( typeof elem === "string" ) { + return core_indexOf.call( jQuery( elem ), this[ 0 ] ); + } + + // Locate the position of the desired element + return core_indexOf.call( this, + + // If it receives a jQuery object, the first element is used + elem.jquery ? elem[ 0 ] : elem + ); + }, + + add: function( selector, context ) { + var set = typeof selector === "string" ? + jQuery( selector, context ) : + jQuery.makeArray( selector && selector.nodeType ? [ selector ] : selector ), + all = jQuery.merge( this.get(), set ); + + return this.pushStack( jQuery.unique(all) ); + }, + + addBack: function( selector ) { + return this.add( selector == null ? + this.prevObject : this.prevObject.filter(selector) + ); + } +}); + +jQuery.fn.andSelf = jQuery.fn.addBack; + +jQuery.each({ + parent: function( elem ) { + return elem.parentElement; + }, + parents: function( elem ) { + return jQuery.dir( elem, "parentElement" ); + }, + parentsUntil: function( elem, i, until ) { + return jQuery.dir( elem, "parentElement", until ); + }, + next: function( elem ) { + return elem.nextElementSibling; + }, + prev: function( elem ) { + return elem.previousElementSibling; + }, + nextAll: function( elem ) { + return jQuery.dir( elem, "nextElementSibling" ); + }, + prevAll: function( elem ) { + return jQuery.dir( elem, "previousElementSibling" ); + }, + nextUntil: function( elem, i, until ) { + return jQuery.dir( elem, "nextElementSibling", until ); + }, + prevUntil: function( elem, i, until ) { + return jQuery.dir( elem, "previousElementSibling", until ); + }, + siblings: function( elem ) { + return jQuery.sibling( ( elem.parentNode || {} ).firstChild, elem ); + }, + children: function( elem ) { + var children = elem.children; + + // documentFragment or document does not have children property + return children ? jQuery.merge( [], children ) : jQuery.sibling( elem.firstChild ); + }, + contents: function( elem ) { + return jQuery.nodeName( elem, "iframe" ) ? + elem.contentDocument || elem.contentWindow.document : + jQuery.merge( [], elem.childNodes ); + } +}, function( name, fn ) { + jQuery.fn[ name ] = function( until, selector ) { + var matched = jQuery.map( this, fn, until ); + + if ( !runtil.test( name ) ) { + selector = until; + } + + if ( selector && typeof selector === "string" ) { + matched = jQuery.filter( selector, matched ); + } + + if ( this.length > 1 ) { + if ( !guaranteedUnique[ name ] ) { + jQuery.unique( matched ); + } + + if ( rparentsprev.test( name ) ) { + matched.reverse(); + } + } + + return this.pushStack( matched ); + }; +}); + +jQuery.extend({ + filter: function( expr, elems, not ) { + if ( not ) { + expr = ":not(" + expr + ")"; + } + + return elems.length === 1 ? + jQuery.find.matchesSelector( elems[ 0 ], expr ) ? [ elems[ 0 ] ] : [] : + jQuery.find.matches( expr, elems ); + }, + + dir: function( elem, dir, until ) { + var cur = elem[ dir ], + matched = []; + + while ( cur && ( !until || !jQuery( cur ).is( until ) ) ) { + matched.push( cur ); + cur = cur[ dir ]; + } + + return matched; + }, + + sibling: function( n, elem ) { + var matched = []; + + for ( ; n; n = n.nextSibling ) { + if ( n.nodeType === 1 && n !== elem ) { + matched.push( n ); + } + } + + return matched; + } +}); + +// Implement the identical functionality for filter and not +function winnow( elements, qualifier, keep ) { + + // Can't pass null or undefined to indexOf in Firefox 4 + // Set to 0 to skip string check + qualifier = qualifier || 0; + + var filtered; + + if ( jQuery.isFunction( qualifier ) ) { + return jQuery.grep(elements, function( elem, i ) { + var retVal = !!qualifier.call( elem, i, elem ); + return retVal === keep; + }); + } + + if ( qualifier.nodeType ) { + return jQuery.grep(elements, function( elem ) { + return ( elem === qualifier ) === keep; + }); + } + + if ( typeof qualifier === "string" ) { + filtered = jQuery.grep(elements, function( elem ) { + return elem.nodeType === 1; + }); + + if ( isSimple.test( qualifier ) ) { + return jQuery.filter( qualifier, filtered, !keep ); + } + + qualifier = jQuery.filter( qualifier, filtered ); + } + + return jQuery.grep(elements, function( elem ) { + return ( core_indexOf.call( qualifier, elem ) >= 0 ) === keep; + }); +} +var rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/gi, + rtagName = /<([\w:]+)/, + rhtml = /<|&#?\w+;/, + rnoInnerhtml = /<(?:script|style|link)/i, + manipulation_rcheckableType = /^(?:checkbox|radio)$/i, + // checked="checked" or checked + rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i, + rscriptType = /^$|\/(?:java|ecma)script/i, + rscriptTypeMasked = /^true\/(.*)/, + rcleanScript = /^\s*\s*$/g, + wrapMap = { + + // Support: IE 9 + option: [ 1, "'); + this._dialogInput.keydown(this._doKeyDown); + $('body').append(this._dialogInput); + inst = this._dialogInst = this._newInst(this._dialogInput, false); + inst.settings = {}; + $.data(this._dialogInput[0], PROP_NAME, inst); + } + extendRemove(inst.settings, settings || {}); + date = (date && date.constructor == Date ? this._formatDate(inst, date) : date); + this._dialogInput.val(date); + + this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null); + if (!this._pos) { + var browserWidth = document.documentElement.clientWidth; + var browserHeight = document.documentElement.clientHeight; + var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft; + var scrollY = document.documentElement.scrollTop || document.body.scrollTop; + this._pos = // should use actual width/height below + [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY]; + } + + // move input on screen for focus, but hidden behind dialog + this._dialogInput.css('left', (this._pos[0] + 20) + 'px').css('top', this._pos[1] + 'px'); + inst.settings.onSelect = onSelect; + this._inDialog = true; + this.dpDiv.addClass(this._dialogClass); + this._showDatepicker(this._dialogInput[0]); + if ($.blockUI) + $.blockUI(this.dpDiv); + $.data(this._dialogInput[0], PROP_NAME, inst); + return this; + }, + + /* Detach a datepicker from its control. + @param target element - the target input field or division or span */ + _destroyDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + $.removeData(target, PROP_NAME); + if (nodeName == 'input') { + inst.append.remove(); + inst.trigger.remove(); + $target.removeClass(this.markerClassName). + unbind('focus', this._showDatepicker). + unbind('keydown', this._doKeyDown). + unbind('keypress', this._doKeyPress). + unbind('keyup', this._doKeyUp); + } else if (nodeName == 'div' || nodeName == 'span') + $target.removeClass(this.markerClassName).empty(); + }, + + /* Enable the date picker to a jQuery selection. + @param target element - the target input field or division or span */ + _enableDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + if (nodeName == 'input') { + target.disabled = false; + inst.trigger.filter('button'). + each(function() { this.disabled = false; }).end(). + filter('img').css({opacity: '1.0', cursor: ''}); + } + else if (nodeName == 'div' || nodeName == 'span') { + var inline = $target.children('.' + this._inlineClass); + inline.children().removeClass('ui-state-disabled'); + inline.find("select.ui-datepicker-month, select.ui-datepicker-year"). + removeAttr("disabled"); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value == target ? null : value); }); // delete entry + }, + + /* Disable the date picker to a jQuery selection. + @param target element - the target input field or division or span */ + _disableDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + if (nodeName == 'input') { + target.disabled = true; + inst.trigger.filter('button'). + each(function() { this.disabled = true; }).end(). + filter('img').css({opacity: '0.5', cursor: 'default'}); + } + else if (nodeName == 'div' || nodeName == 'span') { + var inline = $target.children('.' + this._inlineClass); + inline.children().addClass('ui-state-disabled'); + inline.find("select.ui-datepicker-month, select.ui-datepicker-year"). + attr("disabled", "disabled"); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value == target ? null : value); }); // delete entry + this._disabledInputs[this._disabledInputs.length] = target; + }, + + /* Is the first field in a jQuery collection disabled as a datepicker? + @param target element - the target input field or division or span + @return boolean - true if disabled, false if enabled */ + _isDisabledDatepicker: function(target) { + if (!target) { + return false; + } + for (var i = 0; i < this._disabledInputs.length; i++) { + if (this._disabledInputs[i] == target) + return true; + } + return false; + }, + + /* Retrieve the instance data for the target control. + @param target element - the target input field or division or span + @return object - the associated instance data + @throws error if a jQuery problem getting data */ + _getInst: function(target) { + try { + return $.data(target, PROP_NAME); + } + catch (err) { + throw 'Missing instance data for this datepicker'; + } + }, + + /* Update or retrieve the settings for a date picker attached to an input field or division. + @param target element - the target input field or division or span + @param name object - the new settings to update or + string - the name of the setting to change or retrieve, + when retrieving also 'all' for all instance settings or + 'defaults' for all global defaults + @param value any - the new value for the setting + (omit if above is an object or to retrieve a value) */ + _optionDatepicker: function(target, name, value) { + var inst = this._getInst(target); + if (arguments.length == 2 && typeof name == 'string') { + return (name == 'defaults' ? $.extend({}, $.datepicker._defaults) : + (inst ? (name == 'all' ? $.extend({}, inst.settings) : + this._get(inst, name)) : null)); + } + var settings = name || {}; + if (typeof name == 'string') { + settings = {}; + settings[name] = value; + } + if (inst) { + if (this._curInst == inst) { + this._hideDatepicker(); + } + var date = this._getDateDatepicker(target, true); + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + extendRemove(inst.settings, settings); + // reformat the old minDate/maxDate values if dateFormat changes and a new minDate/maxDate isn't provided + if (minDate !== null && settings['dateFormat'] !== undefined && settings['minDate'] === undefined) + inst.settings.minDate = this._formatDate(inst, minDate); + if (maxDate !== null && settings['dateFormat'] !== undefined && settings['maxDate'] === undefined) + inst.settings.maxDate = this._formatDate(inst, maxDate); + this._attachments($(target), inst); + this._autoSize(inst); + this._setDate(inst, date); + this._updateAlternate(inst); + this._updateDatepicker(inst); + } + }, + + // change method deprecated + _changeDatepicker: function(target, name, value) { + this._optionDatepicker(target, name, value); + }, + + /* Redraw the date picker attached to an input field or division. + @param target element - the target input field or division or span */ + _refreshDatepicker: function(target) { + var inst = this._getInst(target); + if (inst) { + this._updateDatepicker(inst); + } + }, + + /* Set the dates for a jQuery selection. + @param target element - the target input field or division or span + @param date Date - the new date */ + _setDateDatepicker: function(target, date) { + var inst = this._getInst(target); + if (inst) { + this._setDate(inst, date); + this._updateDatepicker(inst); + this._updateAlternate(inst); + } + }, + + /* Get the date(s) for the first entry in a jQuery selection. + @param target element - the target input field or division or span + @param noDefault boolean - true if no default date is to be used + @return Date - the current date */ + _getDateDatepicker: function(target, noDefault) { + var inst = this._getInst(target); + if (inst && !inst.inline) + this._setDateFromField(inst, noDefault); + return (inst ? this._getDate(inst) : null); + }, + + /* Handle keystrokes. */ + _doKeyDown: function(event) { + var inst = $.datepicker._getInst(event.target); + var handled = true; + var isRTL = inst.dpDiv.is('.ui-datepicker-rtl'); + inst._keyEvent = true; + if ($.datepicker._datepickerShowing) + switch (event.keyCode) { + case 9: $.datepicker._hideDatepicker(); + handled = false; + break; // hide on tab out + case 13: var sel = $('td.' + $.datepicker._dayOverClass + ':not(.' + + $.datepicker._currentClass + ')', inst.dpDiv); + if (sel[0]) + $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]); + var onSelect = $.datepicker._get(inst, 'onSelect'); + if (onSelect) { + var dateStr = $.datepicker._formatDate(inst); + + // trigger custom callback + onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); + } + else + $.datepicker._hideDatepicker(); + return false; // don't submit the form + break; // select the value on enter + case 27: $.datepicker._hideDatepicker(); + break; // hide on escape + case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, 'stepBigMonths') : + -$.datepicker._get(inst, 'stepMonths')), 'M'); + break; // previous month/year on page up/+ ctrl + case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, 'stepBigMonths') : + +$.datepicker._get(inst, 'stepMonths')), 'M'); + break; // next month/year on page down/+ ctrl + case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target); + handled = event.ctrlKey || event.metaKey; + break; // clear on ctrl or command +end + case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target); + handled = event.ctrlKey || event.metaKey; + break; // current on ctrl or command +home + case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D'); + handled = event.ctrlKey || event.metaKey; + // -1 day on ctrl or command +left + if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, 'stepBigMonths') : + -$.datepicker._get(inst, 'stepMonths')), 'M'); + // next month/year on alt +left on Mac + break; + case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D'); + handled = event.ctrlKey || event.metaKey; + break; // -1 week on ctrl or command +up + case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D'); + handled = event.ctrlKey || event.metaKey; + // +1 day on ctrl or command +right + if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, 'stepBigMonths') : + +$.datepicker._get(inst, 'stepMonths')), 'M'); + // next month/year on alt +right + break; + case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D'); + handled = event.ctrlKey || event.metaKey; + break; // +1 week on ctrl or command +down + default: handled = false; + } + else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home + $.datepicker._showDatepicker(this); + else { + handled = false; + } + if (handled) { + event.preventDefault(); + event.stopPropagation(); + } + }, + + /* Filter entered characters - based on date format. */ + _doKeyPress: function(event) { + var inst = $.datepicker._getInst(event.target); + if ($.datepicker._get(inst, 'constrainInput')) { + var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat')); + var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode); + return event.ctrlKey || event.metaKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1); + } + }, + + /* Synchronise manual entry and field/alternate field. */ + _doKeyUp: function(event) { + var inst = $.datepicker._getInst(event.target); + if (inst.input.val() != inst.lastVal) { + try { + var date = $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), + (inst.input ? inst.input.val() : null), + $.datepicker._getFormatConfig(inst)); + if (date) { // only if valid + $.datepicker._setDateFromField(inst); + $.datepicker._updateAlternate(inst); + $.datepicker._updateDatepicker(inst); + } + } + catch (err) { + $.datepicker.log(err); + } + } + return true; + }, + + /* Pop-up the date picker for a given input field. + If false returned from beforeShow event handler do not show. + @param input element - the input field attached to the date picker or + event - if triggered by focus */ + _showDatepicker: function(input) { + input = input.target || input; + if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger + input = $('input', input.parentNode)[0]; + if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here + return; + var inst = $.datepicker._getInst(input); + if ($.datepicker._curInst && $.datepicker._curInst != inst) { + $.datepicker._curInst.dpDiv.stop(true, true); + if ( inst && $.datepicker._datepickerShowing ) { + $.datepicker._hideDatepicker( $.datepicker._curInst.input[0] ); + } + } + var beforeShow = $.datepicker._get(inst, 'beforeShow'); + var beforeShowSettings = beforeShow ? beforeShow.apply(input, [input, inst]) : {}; + if(beforeShowSettings === false){ + //false + return; + } + extendRemove(inst.settings, beforeShowSettings); + inst.lastVal = null; + $.datepicker._lastInput = input; + $.datepicker._setDateFromField(inst); + if ($.datepicker._inDialog) // hide cursor + input.value = ''; + if (!$.datepicker._pos) { // position below input + $.datepicker._pos = $.datepicker._findPos(input); + $.datepicker._pos[1] += input.offsetHeight; // add the height + } + var isFixed = false; + $(input).parents().each(function() { + isFixed |= $(this).css('position') == 'fixed'; + return !isFixed; + }); + if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled + $.datepicker._pos[0] -= document.documentElement.scrollLeft; + $.datepicker._pos[1] -= document.documentElement.scrollTop; + } + var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]}; + $.datepicker._pos = null; + //to avoid flashes on Firefox + inst.dpDiv.empty(); + // determine sizing offscreen + inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'}); + $.datepicker._updateDatepicker(inst); + // fix width for dynamic number of date pickers + // and adjust position before showing + offset = $.datepicker._checkOffset(inst, offset, isFixed); + inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ? + 'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none', + left: offset.left + 'px', top: offset.top + 'px'}); + if (!inst.inline) { + var showAnim = $.datepicker._get(inst, 'showAnim'); + var duration = $.datepicker._get(inst, 'duration'); + var postProcess = function() { + var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only + if( !! cover.length ){ + var borders = $.datepicker._getBorders(inst.dpDiv); + cover.css({left: -borders[0], top: -borders[1], + width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}); + } + }; + inst.dpDiv.zIndex($(input).zIndex()+1); + $.datepicker._datepickerShowing = true; + if ($.effects && $.effects[showAnim]) + inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); + else + inst.dpDiv[showAnim || 'show']((showAnim ? duration : null), postProcess); + if (!showAnim || !duration) + postProcess(); + if (inst.input.is(':visible') && !inst.input.is(':disabled')) + inst.input.focus(); + $.datepicker._curInst = inst; + } + }, + + /* Generate the date picker content. */ + _updateDatepicker: function(inst) { + var self = this; + self.maxRows = 4; //Reset the max number of rows being displayed (see #7043) + var borders = $.datepicker._getBorders(inst.dpDiv); + instActive = inst; // for delegate hover events + inst.dpDiv.empty().append(this._generateHTML(inst)); + this._attachHandlers(inst); + var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only + if( !!cover.length ){ //avoid call to outerXXXX() when not in IE6 + cover.css({left: -borders[0], top: -borders[1], width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}) + } + inst.dpDiv.find('.' + this._dayOverClass + ' a').mouseover(); + var numMonths = this._getNumberOfMonths(inst); + var cols = numMonths[1]; + var width = 17; + inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width(''); + if (cols > 1) + inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em'); + inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') + + 'Class']('ui-datepicker-multi'); + inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') + + 'Class']('ui-datepicker-rtl'); + if (inst == $.datepicker._curInst && $.datepicker._datepickerShowing && inst.input && + // #6694 - don't focus the input if it's already focused + // this breaks the change event in IE + inst.input.is(':visible') && !inst.input.is(':disabled') && inst.input[0] != document.activeElement) + inst.input.focus(); + // deffered render of the years select (to avoid flashes on Firefox) + if( inst.yearshtml ){ + var origyearshtml = inst.yearshtml; + setTimeout(function(){ + //assure that inst.yearshtml didn't change. + if( origyearshtml === inst.yearshtml && inst.yearshtml ){ + inst.dpDiv.find('select.ui-datepicker-year:first').replaceWith(inst.yearshtml); + } + origyearshtml = inst.yearshtml = null; + }, 0); + } + }, + + /* Retrieve the size of left and top borders for an element. + @param elem (jQuery object) the element of interest + @return (number[2]) the left and top borders */ + _getBorders: function(elem) { + var convert = function(value) { + return {thin: 1, medium: 2, thick: 3}[value] || value; + }; + return [parseFloat(convert(elem.css('border-left-width'))), + parseFloat(convert(elem.css('border-top-width')))]; + }, + + /* Check positioning to remain on screen. */ + _checkOffset: function(inst, offset, isFixed) { + var dpWidth = inst.dpDiv.outerWidth(); + var dpHeight = inst.dpDiv.outerHeight(); + var inputWidth = inst.input ? inst.input.outerWidth() : 0; + var inputHeight = inst.input ? inst.input.outerHeight() : 0; + var viewWidth = document.documentElement.clientWidth + (isFixed ? 0 : $(document).scrollLeft()); + var viewHeight = document.documentElement.clientHeight + (isFixed ? 0 : $(document).scrollTop()); + + offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0); + offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0; + offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0; + + // now check if datepicker is showing outside window viewport - move to a better place if so. + offset.left -= Math.min(offset.left, (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ? + Math.abs(offset.left + dpWidth - viewWidth) : 0); + offset.top -= Math.min(offset.top, (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ? + Math.abs(dpHeight + inputHeight) : 0); + + return offset; + }, + + /* Find an object's position on the screen. */ + _findPos: function(obj) { + var inst = this._getInst(obj); + var isRTL = this._get(inst, 'isRTL'); + while (obj && (obj.type == 'hidden' || obj.nodeType != 1 || $.expr.filters.hidden(obj))) { + obj = obj[isRTL ? 'previousSibling' : 'nextSibling']; + } + var position = $(obj).offset(); + return [position.left, position.top]; + }, + + /* Hide the date picker from view. + @param input element - the input field attached to the date picker */ + _hideDatepicker: function(input) { + var inst = this._curInst; + if (!inst || (input && inst != $.data(input, PROP_NAME))) + return; + if (this._datepickerShowing) { + var showAnim = this._get(inst, 'showAnim'); + var duration = this._get(inst, 'duration'); + var postProcess = function() { + $.datepicker._tidyDialog(inst); + }; + if ($.effects && $.effects[showAnim]) + inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); + else + inst.dpDiv[(showAnim == 'slideDown' ? 'slideUp' : + (showAnim == 'fadeIn' ? 'fadeOut' : 'hide'))]((showAnim ? duration : null), postProcess); + if (!showAnim) + postProcess(); + this._datepickerShowing = false; + var onClose = this._get(inst, 'onClose'); + if (onClose) + onClose.apply((inst.input ? inst.input[0] : null), + [(inst.input ? inst.input.val() : ''), inst]); + this._lastInput = null; + if (this._inDialog) { + this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' }); + if ($.blockUI) { + $.unblockUI(); + $('body').append(this.dpDiv); + } + } + this._inDialog = false; + } + }, + + /* Tidy up after a dialog display. */ + _tidyDialog: function(inst) { + inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar'); + }, + + /* Close date picker if clicked elsewhere. */ + _checkExternalClick: function(event) { + if (!$.datepicker._curInst) + return; + + var $target = $(event.target), + inst = $.datepicker._getInst($target[0]); + + if ( ( ( $target[0].id != $.datepicker._mainDivId && + $target.parents('#' + $.datepicker._mainDivId).length == 0 && + !$target.hasClass($.datepicker.markerClassName) && + !$target.closest("." + $.datepicker._triggerClass).length && + $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI) ) ) || + ( $target.hasClass($.datepicker.markerClassName) && $.datepicker._curInst != inst ) ) + $.datepicker._hideDatepicker(); + }, + + /* Adjust one of the date sub-fields. */ + _adjustDate: function(id, offset, period) { + var target = $(id); + var inst = this._getInst(target[0]); + if (this._isDisabledDatepicker(target[0])) { + return; + } + this._adjustInstDate(inst, offset + + (period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning + period); + this._updateDatepicker(inst); + }, + + /* Action for current link. */ + _gotoToday: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + if (this._get(inst, 'gotoCurrent') && inst.currentDay) { + inst.selectedDay = inst.currentDay; + inst.drawMonth = inst.selectedMonth = inst.currentMonth; + inst.drawYear = inst.selectedYear = inst.currentYear; + } + else { + var date = new Date(); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + } + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Action for selecting a new month/year. */ + _selectMonthYear: function(id, select, period) { + var target = $(id); + var inst = this._getInst(target[0]); + inst['selected' + (period == 'M' ? 'Month' : 'Year')] = + inst['draw' + (period == 'M' ? 'Month' : 'Year')] = + parseInt(select.options[select.selectedIndex].value,10); + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Action for selecting a day. */ + _selectDay: function(id, month, year, td) { + var target = $(id); + if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) { + return; + } + var inst = this._getInst(target[0]); + inst.selectedDay = inst.currentDay = $('a', td).html(); + inst.selectedMonth = inst.currentMonth = month; + inst.selectedYear = inst.currentYear = year; + this._selectDate(id, this._formatDate(inst, + inst.currentDay, inst.currentMonth, inst.currentYear)); + }, + + /* Erase the input field and hide the date picker. */ + _clearDate: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + this._selectDate(target, ''); + }, + + /* Update the input field with the selected date. */ + _selectDate: function(id, dateStr) { + var target = $(id); + var inst = this._getInst(target[0]); + dateStr = (dateStr != null ? dateStr : this._formatDate(inst)); + if (inst.input) + inst.input.val(dateStr); + this._updateAlternate(inst); + var onSelect = this._get(inst, 'onSelect'); + if (onSelect) + onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback + else if (inst.input) + inst.input.trigger('change'); // fire the change event + if (inst.inline) + this._updateDatepicker(inst); + else { + this._hideDatepicker(); + this._lastInput = inst.input[0]; + if (typeof(inst.input[0]) != 'object') + inst.input.focus(); // restore focus + this._lastInput = null; + } + }, + + /* Update any alternate field to synchronise with the main field. */ + _updateAlternate: function(inst) { + var altField = this._get(inst, 'altField'); + if (altField) { // update alternate field too + var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat'); + var date = this._getDate(inst); + var dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst)); + $(altField).each(function() { $(this).val(dateStr); }); + } + }, + + /* Set as beforeShowDay function to prevent selection of weekends. + @param date Date - the date to customise + @return [boolean, string] - is this date selectable?, what is its CSS class? */ + noWeekends: function(date) { + var day = date.getDay(); + return [(day > 0 && day < 6), '']; + }, + + /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition. + @param date Date - the date to get the week for + @return number - the number of the week within the year that contains this date */ + iso8601Week: function(date) { + var checkDate = new Date(date.getTime()); + // Find Thursday of this week starting on Monday + checkDate.setDate(checkDate.getDate() + 4 - (checkDate.getDay() || 7)); + var time = checkDate.getTime(); + checkDate.setMonth(0); // Compare with Jan 1 + checkDate.setDate(1); + return Math.floor(Math.round((time - checkDate) / 86400000) / 7) + 1; + }, + + /* Parse a string value into a date object. + See formatDate below for the possible formats. + + @param format string - the expected format of the date + @param value string - the date in the above format + @param settings Object - attributes include: + shortYearCutoff number - the cutoff year for determining the century (optional) + dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + dayNames string[7] - names of the days from Sunday (optional) + monthNamesShort string[12] - abbreviated names of the months (optional) + monthNames string[12] - names of the months (optional) + @return Date - the extracted date value or null if value is blank */ + parseDate: function (format, value, settings) { + if (format == null || value == null) + throw 'Invalid arguments'; + value = (typeof value == 'object' ? value.toString() : value + ''); + if (value == '') + return null; + var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff; + shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : + new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); + var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; + var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; + var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; + var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; + var year = -1; + var month = -1; + var day = -1; + var doy = -1; + var literal = false; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + // Extract a number from the string value + var getNumber = function(match) { + var isDoubled = lookAhead(match); + var size = (match == '@' ? 14 : (match == '!' ? 20 : + (match == 'y' && isDoubled ? 4 : (match == 'o' ? 3 : 2)))); + var digits = new RegExp('^\\d{1,' + size + '}'); + var num = value.substring(iValue).match(digits); + if (!num) + throw 'Missing number at position ' + iValue; + iValue += num[0].length; + return parseInt(num[0], 10); + }; + // Extract a name from the string value and convert to an index + var getName = function(match, shortNames, longNames) { + var names = $.map(lookAhead(match) ? longNames : shortNames, function (v, k) { + return [ [k, v] ]; + }).sort(function (a, b) { + return -(a[1].length - b[1].length); + }); + var index = -1; + $.each(names, function (i, pair) { + var name = pair[1]; + if (value.substr(iValue, name.length).toLowerCase() == name.toLowerCase()) { + index = pair[0]; + iValue += name.length; + return false; + } + }); + if (index != -1) + return index + 1; + else + throw 'Unknown name at position ' + iValue; + }; + // Confirm that a literal character matches the string value + var checkLiteral = function() { + if (value.charAt(iValue) != format.charAt(iFormat)) + throw 'Unexpected literal at position ' + iValue; + iValue++; + }; + var iValue = 0; + for (var iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + checkLiteral(); + else + switch (format.charAt(iFormat)) { + case 'd': + day = getNumber('d'); + break; + case 'D': + getName('D', dayNamesShort, dayNames); + break; + case 'o': + doy = getNumber('o'); + break; + case 'm': + month = getNumber('m'); + break; + case 'M': + month = getName('M', monthNamesShort, monthNames); + break; + case 'y': + year = getNumber('y'); + break; + case '@': + var date = new Date(getNumber('@')); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case '!': + var date = new Date((getNumber('!') - this._ticksTo1970) / 10000); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case "'": + if (lookAhead("'")) + checkLiteral(); + else + literal = true; + break; + default: + checkLiteral(); + } + } + if (iValue < value.length){ + throw "Extra/unparsed characters found in date: " + value.substring(iValue); + } + if (year == -1) + year = new Date().getFullYear(); + else if (year < 100) + year += new Date().getFullYear() - new Date().getFullYear() % 100 + + (year <= shortYearCutoff ? 0 : -100); + if (doy > -1) { + month = 1; + day = doy; + do { + var dim = this._getDaysInMonth(year, month - 1); + if (day <= dim) + break; + month++; + day -= dim; + } while (true); + } + var date = this._daylightSavingAdjust(new Date(year, month - 1, day)); + if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day) + throw 'Invalid date'; // E.g. 31/02/00 + return date; + }, + + /* Standard date formats. */ + ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601) + COOKIE: 'D, dd M yy', + ISO_8601: 'yy-mm-dd', + RFC_822: 'D, d M y', + RFC_850: 'DD, dd-M-y', + RFC_1036: 'D, d M y', + RFC_1123: 'D, d M yy', + RFC_2822: 'D, d M yy', + RSS: 'D, d M y', // RFC 822 + TICKS: '!', + TIMESTAMP: '@', + W3C: 'yy-mm-dd', // ISO 8601 + + _ticksTo1970: (((1970 - 1) * 365 + Math.floor(1970 / 4) - Math.floor(1970 / 100) + + Math.floor(1970 / 400)) * 24 * 60 * 60 * 10000000), + + /* Format a date object into a string value. + The format can be combinations of the following: + d - day of month (no leading zero) + dd - day of month (two digit) + o - day of year (no leading zeros) + oo - day of year (three digit) + D - day name short + DD - day name long + m - month of year (no leading zero) + mm - month of year (two digit) + M - month name short + MM - month name long + y - year (two digit) + yy - year (four digit) + @ - Unix timestamp (ms since 01/01/1970) + ! - Windows ticks (100ns since 01/01/0001) + '...' - literal text + '' - single quote + + @param format string - the desired format of the date + @param date Date - the date value to format + @param settings Object - attributes include: + dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + dayNames string[7] - names of the days from Sunday (optional) + monthNamesShort string[12] - abbreviated names of the months (optional) + monthNames string[12] - names of the months (optional) + @return string - the date in the above format */ + formatDate: function (format, date, settings) { + if (!date) + return ''; + var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; + var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; + var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; + var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + // Format a number, with leading zero if necessary + var formatNumber = function(match, value, len) { + var num = '' + value; + if (lookAhead(match)) + while (num.length < len) + num = '0' + num; + return num; + }; + // Format a name, short or long as requested + var formatName = function(match, value, shortNames, longNames) { + return (lookAhead(match) ? longNames[value] : shortNames[value]); + }; + var output = ''; + var literal = false; + if (date) + for (var iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + output += format.charAt(iFormat); + else + switch (format.charAt(iFormat)) { + case 'd': + output += formatNumber('d', date.getDate(), 2); + break; + case 'D': + output += formatName('D', date.getDay(), dayNamesShort, dayNames); + break; + case 'o': + output += formatNumber('o', + Math.round((new Date(date.getFullYear(), date.getMonth(), date.getDate()).getTime() - new Date(date.getFullYear(), 0, 0).getTime()) / 86400000), 3); + break; + case 'm': + output += formatNumber('m', date.getMonth() + 1, 2); + break; + case 'M': + output += formatName('M', date.getMonth(), monthNamesShort, monthNames); + break; + case 'y': + output += (lookAhead('y') ? date.getFullYear() : + (date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100); + break; + case '@': + output += date.getTime(); + break; + case '!': + output += date.getTime() * 10000 + this._ticksTo1970; + break; + case "'": + if (lookAhead("'")) + output += "'"; + else + literal = true; + break; + default: + output += format.charAt(iFormat); + } + } + return output; + }, + + /* Extract all possible characters from the date format. */ + _possibleChars: function (format) { + var chars = ''; + var literal = false; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + for (var iFormat = 0; iFormat < format.length; iFormat++) + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + chars += format.charAt(iFormat); + else + switch (format.charAt(iFormat)) { + case 'd': case 'm': case 'y': case '@': + chars += '0123456789'; + break; + case 'D': case 'M': + return null; // Accept anything + case "'": + if (lookAhead("'")) + chars += "'"; + else + literal = true; + break; + default: + chars += format.charAt(iFormat); + } + return chars; + }, + + /* Get a setting value, defaulting if necessary. */ + _get: function(inst, name) { + return inst.settings[name] !== undefined ? + inst.settings[name] : this._defaults[name]; + }, + + /* Parse existing date and initialise date picker. */ + _setDateFromField: function(inst, noDefault) { + if (inst.input.val() == inst.lastVal) { + return; + } + var dateFormat = this._get(inst, 'dateFormat'); + var dates = inst.lastVal = inst.input ? inst.input.val() : null; + var date, defaultDate; + date = defaultDate = this._getDefaultDate(inst); + var settings = this._getFormatConfig(inst); + try { + date = this.parseDate(dateFormat, dates, settings) || defaultDate; + } catch (event) { + this.log(event); + dates = (noDefault ? '' : dates); + } + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + inst.currentDay = (dates ? date.getDate() : 0); + inst.currentMonth = (dates ? date.getMonth() : 0); + inst.currentYear = (dates ? date.getFullYear() : 0); + this._adjustInstDate(inst); + }, + + /* Retrieve the default date shown on opening. */ + _getDefaultDate: function(inst) { + return this._restrictMinMax(inst, + this._determineDate(inst, this._get(inst, 'defaultDate'), new Date())); + }, + + /* A date may be specified as an exact value or a relative one. */ + _determineDate: function(inst, date, defaultDate) { + var offsetNumeric = function(offset) { + var date = new Date(); + date.setDate(date.getDate() + offset); + return date; + }; + var offsetString = function(offset) { + try { + return $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), + offset, $.datepicker._getFormatConfig(inst)); + } + catch (e) { + // Ignore + } + var date = (offset.toLowerCase().match(/^c/) ? + $.datepicker._getDate(inst) : null) || new Date(); + var year = date.getFullYear(); + var month = date.getMonth(); + var day = date.getDate(); + var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g; + var matches = pattern.exec(offset); + while (matches) { + switch (matches[2] || 'd') { + case 'd' : case 'D' : + day += parseInt(matches[1],10); break; + case 'w' : case 'W' : + day += parseInt(matches[1],10) * 7; break; + case 'm' : case 'M' : + month += parseInt(matches[1],10); + day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); + break; + case 'y': case 'Y' : + year += parseInt(matches[1],10); + day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); + break; + } + matches = pattern.exec(offset); + } + return new Date(year, month, day); + }; + var newDate = (date == null || date === '' ? defaultDate : (typeof date == 'string' ? offsetString(date) : + (typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : new Date(date.getTime())))); + newDate = (newDate && newDate.toString() == 'Invalid Date' ? defaultDate : newDate); + if (newDate) { + newDate.setHours(0); + newDate.setMinutes(0); + newDate.setSeconds(0); + newDate.setMilliseconds(0); + } + return this._daylightSavingAdjust(newDate); + }, + + /* Handle switch to/from daylight saving. + Hours may be non-zero on daylight saving cut-over: + > 12 when midnight changeover, but then cannot generate + midnight datetime, so jump to 1AM, otherwise reset. + @param date (Date) the date to check + @return (Date) the corrected date */ + _daylightSavingAdjust: function(date) { + if (!date) return null; + date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0); + return date; + }, + + /* Set the date(s) directly. */ + _setDate: function(inst, date, noChange) { + var clear = !date; + var origMonth = inst.selectedMonth; + var origYear = inst.selectedYear; + var newDate = this._restrictMinMax(inst, this._determineDate(inst, date, new Date())); + inst.selectedDay = inst.currentDay = newDate.getDate(); + inst.drawMonth = inst.selectedMonth = inst.currentMonth = newDate.getMonth(); + inst.drawYear = inst.selectedYear = inst.currentYear = newDate.getFullYear(); + if ((origMonth != inst.selectedMonth || origYear != inst.selectedYear) && !noChange) + this._notifyChange(inst); + this._adjustInstDate(inst); + if (inst.input) { + inst.input.val(clear ? '' : this._formatDate(inst)); + } + }, + + /* Retrieve the date(s) directly. */ + _getDate: function(inst) { + var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null : + this._daylightSavingAdjust(new Date( + inst.currentYear, inst.currentMonth, inst.currentDay))); + return startDate; + }, + + /* Attach the onxxx handlers. These are declared statically so + * they work with static code transformers like Caja. + */ + _attachHandlers: function(inst) { + var stepMonths = this._get(inst, 'stepMonths'); + var id = '#' + inst.id.replace( /\\\\/g, "\\" ); + inst.dpDiv.find('[data-handler]').map(function () { + var handler = { + prev: function () { + window['DP_jQuery_' + dpuuid].datepicker._adjustDate(id, -stepMonths, 'M'); + }, + next: function () { + window['DP_jQuery_' + dpuuid].datepicker._adjustDate(id, +stepMonths, 'M'); + }, + hide: function () { + window['DP_jQuery_' + dpuuid].datepicker._hideDatepicker(); + }, + today: function () { + window['DP_jQuery_' + dpuuid].datepicker._gotoToday(id); + }, + selectDay: function () { + window['DP_jQuery_' + dpuuid].datepicker._selectDay(id, +this.getAttribute('data-month'), +this.getAttribute('data-year'), this); + return false; + }, + selectMonth: function () { + window['DP_jQuery_' + dpuuid].datepicker._selectMonthYear(id, this, 'M'); + return false; + }, + selectYear: function () { + window['DP_jQuery_' + dpuuid].datepicker._selectMonthYear(id, this, 'Y'); + return false; + } + }; + $(this).bind(this.getAttribute('data-event'), handler[this.getAttribute('data-handler')]); + }); + }, + + /* Generate the HTML for the current state of the date picker. */ + _generateHTML: function(inst) { + var today = new Date(); + today = this._daylightSavingAdjust( + new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time + var isRTL = this._get(inst, 'isRTL'); + var showButtonPanel = this._get(inst, 'showButtonPanel'); + var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext'); + var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat'); + var numMonths = this._getNumberOfMonths(inst); + var showCurrentAtPos = this._get(inst, 'showCurrentAtPos'); + var stepMonths = this._get(inst, 'stepMonths'); + var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1); + var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) : + new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + var drawMonth = inst.drawMonth - showCurrentAtPos; + var drawYear = inst.drawYear; + if (drawMonth < 0) { + drawMonth += 12; + drawYear--; + } + if (maxDate) { + var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(), + maxDate.getMonth() - (numMonths[0] * numMonths[1]) + 1, maxDate.getDate())); + maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw); + while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) { + drawMonth--; + if (drawMonth < 0) { + drawMonth = 11; + drawYear--; + } + } + } + inst.drawMonth = drawMonth; + inst.drawYear = drawYear; + var prevText = this._get(inst, 'prevText'); + prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)), + this._getFormatConfig(inst))); + var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ? + '' + prevText + '' : + (hideIfNoPrevNext ? '' : '' + prevText + '')); + var nextText = this._get(inst, 'nextText'); + nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)), + this._getFormatConfig(inst))); + var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ? + '' + nextText + '' : + (hideIfNoPrevNext ? '' : '' + nextText + '')); + var currentText = this._get(inst, 'currentText'); + var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today); + currentText = (!navigationAsDateFormat ? currentText : + this.formatDate(currentText, gotoDate, this._getFormatConfig(inst))); + var controls = (!inst.inline ? '' : ''); + var buttonPanel = (showButtonPanel) ? '

' + (isRTL ? controls : '') + + (this._isInRange(inst, gotoDate) ? '' : '') + (isRTL ? '' : controls) + '

' : ''; + var firstDay = parseInt(this._get(inst, 'firstDay'),10); + firstDay = (isNaN(firstDay) ? 0 : firstDay); + var showWeek = this._get(inst, 'showWeek'); + var dayNames = this._get(inst, 'dayNames'); + var dayNamesShort = this._get(inst, 'dayNamesShort'); + var dayNamesMin = this._get(inst, 'dayNamesMin'); + var monthNames = this._get(inst, 'monthNames'); + var monthNamesShort = this._get(inst, 'monthNamesShort'); + var beforeShowDay = this._get(inst, 'beforeShowDay'); + var showOtherMonths = this._get(inst, 'showOtherMonths'); + var selectOtherMonths = this._get(inst, 'selectOtherMonths'); + var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week; + var defaultDate = this._getDefaultDate(inst); + var html = ''; + for (var row = 0; row < numMonths[0]; row++) { + var group = ''; + this.maxRows = 4; + for (var col = 0; col < numMonths[1]; col++) { + var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay)); + var cornerClass = ' ui-corner-all'; + var calender = ''; + if (isMultiMonth) { + calender += '

'; + } + calender += '

' + + (/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') + + (/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') + + this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate, + row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers + '

' + + ''; + var thead = (showWeek ? '' : ''); + for (var dow = 0; dow < 7; dow++) { // days of the week + var day = (dow + firstDay) % 7; + thead += '= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' + + '' + dayNamesMin[day] + ''; + } + calender += thead + ''; + var daysInMonth = this._getDaysInMonth(drawYear, drawMonth); + if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth) + inst.selectedDay = Math.min(inst.selectedDay, daysInMonth); + var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7; + var curRows = Math.ceil((leadDays + daysInMonth) / 7); // calculate the number of rows to generate + var numRows = (isMultiMonth ? this.maxRows > curRows ? this.maxRows : curRows : curRows); //If multiple months, use the higher number of rows (see #7043) + this.maxRows = numRows; + var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays)); + for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows + calender += ''; + var tbody = (!showWeek ? '' : ''); + for (var dow = 0; dow < 7; dow++) { // create date picker days + var daySettings = (beforeShowDay ? + beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']); + var otherMonth = (printDate.getMonth() != drawMonth); + var unselectable = (otherMonth && !selectOtherMonths) || !daySettings[0] || + (minDate && printDate < minDate) || (maxDate && printDate > maxDate); + tbody += ''; // display selectable date + printDate.setDate(printDate.getDate() + 1); + printDate = this._daylightSavingAdjust(printDate); + } + calender += tbody + ''; + } + drawMonth++; + if (drawMonth > 11) { + drawMonth = 0; + drawYear++; + } + calender += '

' + (isMultiMonth ? '

' + this._get(inst, 'weekHeader') + '
' + + this._get(inst, 'calculateWeek')(printDate) + '	' + // actions + (otherMonth && !showOtherMonths ? ' ' : // display for other months + (unselectable ? '' + printDate.getDate() + '' : '' + printDate.getDate() + '')) + '

' + + ((numMonths[0] > 0 && col == numMonths[1]-1) ? '

' : '') : ''); + group += calender; + } + html += group; + } + html += buttonPanel + ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ? + '' : ''); + inst._keyEvent = false; + return html; + }, + + /* Generate the month and year header. */ + _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate, + secondary, monthNames, monthNamesShort) { + var changeMonth = this._get(inst, 'changeMonth'); + var changeYear = this._get(inst, 'changeYear'); + var showMonthAfterYear = this._get(inst, 'showMonthAfterYear'); + var html = '

'; + var monthHtml = ''; + // month selection + if (secondary || !changeMonth) + monthHtml += '' + monthNames[drawMonth] + ''; + else { + var inMinYear = (minDate && minDate.getFullYear() == drawYear); + var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear); + monthHtml += ''; + } + if (!showMonthAfterYear) + html += monthHtml + (secondary || !(changeMonth && changeYear) ? ' ' : ''); + // year selection + if ( !inst.yearshtml ) { + inst.yearshtml = ''; + if (secondary || !changeYear) + html += '' + drawYear + ''; + else { + // determine range of years to display + var years = this._get(inst, 'yearRange').split(':'); + var thisYear = new Date().getFullYear(); + var determineYear = function(value) { + var year = (value.match(/c[+-].*/) ? drawYear + parseInt(value.substring(1), 10) : + (value.match(/[+-].*/) ? thisYear + parseInt(value, 10) : + parseInt(value, 10))); + return (isNaN(year) ? thisYear : year); + }; + var year = determineYear(years[0]); + var endYear = Math.max(year, determineYear(years[1] || '')); + year = (minDate ? Math.max(year, minDate.getFullYear()) : year); + endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear); + inst.yearshtml += ''; + + html += inst.yearshtml; + inst.yearshtml = null; + } + } + html += this._get(inst, 'yearSuffix'); + if (showMonthAfterYear) + html += (secondary || !(changeMonth && changeYear) ? ' ' : '') + monthHtml; + html += '

'; // Close datepicker_header + return html; + }, + + /* Adjust one of the date sub-fields. */ + _adjustInstDate: function(inst, offset, period) { + var year = inst.drawYear + (period == 'Y' ? offset : 0); + var month = inst.drawMonth + (period == 'M' ? offset : 0); + var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) + + (period == 'D' ? offset : 0); + var date = this._restrictMinMax(inst, + this._daylightSavingAdjust(new Date(year, month, day))); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + if (period == 'M' || period == 'Y') + this._notifyChange(inst); + }, + + /* Ensure a date is within any min/max bounds. */ + _restrictMinMax: function(inst, date) { + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + var newDate = (minDate && date < minDate ? minDate : date); + newDate = (maxDate && newDate > maxDate ? maxDate : newDate); + return newDate; + }, + + /* Notify change of month/year. */ + _notifyChange: function(inst) { + var onChange = this._get(inst, 'onChangeMonthYear'); + if (onChange) + onChange.apply((inst.input ? inst.input[0] : null), + [inst.selectedYear, inst.selectedMonth + 1, inst]); + }, + + /* Determine the number of months to show. */ + _getNumberOfMonths: function(inst) { + var numMonths = this._get(inst, 'numberOfMonths'); + return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths)); + }, + + /* Determine the current maximum date - ensure no time components are set. */ + _getMinMaxDate: function(inst, minMax) { + return this._determineDate(inst, this._get(inst, minMax + 'Date'), null); + }, + + /* Find the number of days in a given month. */ + _getDaysInMonth: function(year, month) { + return 32 - this._daylightSavingAdjust(new Date(year, month, 32)).getDate(); + }, + + /* Find the day of the week of the first of a month. */ + _getFirstDayOfMonth: function(year, month) { + return new Date(year, month, 1).getDay(); + }, + + /* Determines if we should allow a "next/prev" month display change. */ + _canAdjustMonth: function(inst, offset, curYear, curMonth) { + var numMonths = this._getNumberOfMonths(inst); + var date = this._daylightSavingAdjust(new Date(curYear, + curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1)); + if (offset < 0) + date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth())); + return this._isInRange(inst, date); + }, + + /* Is the given date in the accepted range? */ + _isInRange: function(inst, date) { + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + return ((!minDate || date.getTime() >= minDate.getTime()) && + (!maxDate || date.getTime() <= maxDate.getTime())); + }, + + /* Provide the configuration settings for formatting/parsing. */ + _getFormatConfig: function(inst) { + var shortYearCutoff = this._get(inst, 'shortYearCutoff'); + shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : + new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); + return {shortYearCutoff: shortYearCutoff, + dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'), + monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')}; + }, + + /* Format the given date for display. */ + _formatDate: function(inst, day, month, year) { + if (!day) { + inst.currentDay = inst.selectedDay; + inst.currentMonth = inst.selectedMonth; + inst.currentYear = inst.selectedYear; + } + var date = (day ? (typeof day == 'object' ? day : + this._daylightSavingAdjust(new Date(year, month, day))) : + this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst)); + } +}); + +/* + * Bind hover events for datepicker elements. + * Done via delegate so the binding only occurs once in the lifetime of the parent div. + * Global instActive, set by _updateDatepicker allows the handlers to find their way back to the active picker. + */ +function bindHover(dpDiv) { + var selector = 'button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a'; + return dpDiv.bind('mouseout', function(event) { + var elem = $( event.target ).closest( selector ); + if ( !elem.length ) { + return; + } + elem.removeClass( "ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover" ); + }) + .bind('mouseover', function(event) { + var elem = $( event.target ).closest( selector ); + if ($.datepicker._isDisabledDatepicker( instActive.inline ? dpDiv.parent()[0] : instActive.input[0]) || + !elem.length ) { + return; + } + elem.parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover'); + elem.addClass('ui-state-hover'); + if (elem.hasClass('ui-datepicker-prev')) elem.addClass('ui-datepicker-prev-hover'); + if (elem.hasClass('ui-datepicker-next')) elem.addClass('ui-datepicker-next-hover'); + }); +} + +/* jQuery extend now ignores nulls! */ +function extendRemove(target, props) { + $.extend(target, props); + for (var name in props) + if (props[name] == null || props[name] == undefined) + target[name] = props[name]; + return target; +}; + +/* Determine whether an object is an array. */ +function isArray(a) { + return (a && (($.browser.safari && typeof a == 'object' && a.length) || + (a.constructor && a.constructor.toString().match(/\Array/)))); +}; + +/* Invoke the datepicker functionality. + @param options string - a command, optionally followed by additional parameters or + Object - settings for attaching new datepicker functionality + @return jQuery object */ +$.fn.datepicker = function(options){ + + /* Verify an empty collection wasn't passed - Fixes #6976 */ + if ( !this.length ) { + return this; + } + + /* Initialise the date picker. */ + if (!$.datepicker.initialized) { + $(document).mousedown($.datepicker._checkExternalClick). + find('body').append($.datepicker.dpDiv); + $.datepicker.initialized = true; + } + + var otherArgs = Array.prototype.slice.call(arguments, 1); + if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate' || options == 'widget')) + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + if (options == 'option' && arguments.length == 2 && typeof arguments[1] == 'string') + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + return this.each(function() { + typeof options == 'string' ? + $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this].concat(otherArgs)) : + $.datepicker._attachDatepicker(this, options); + }); +}; + +$.datepicker = new Datepicker(); // singleton instance +$.datepicker.initialized = false; +$.datepicker.uuid = new Date().getTime(); +$.datepicker.version = "1.8.24"; + +// Workaround for #4055 +// Add another global to avoid noConflict issues with inline event handlers +window['DP_jQuery_' + dpuuid] = $; + +})(jQuery); + +(function( $, undefined ) { + +var uiDialogClasses = + 'ui-dialog ' + + 'ui-widget ' + + 'ui-widget-content ' + + 'ui-corner-all ', + sizeRelatedOptions = { + buttons: true, + height: true, + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true, + width: true + }, + resizableRelatedOptions = { + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true + }; + +$.widget("ui.dialog", { + options: { + autoOpen: true, + buttons: {}, + closeOnEscape: true, + closeText: 'close', + dialogClass: '', + draggable: true, + hide: null, + height: 'auto', + maxHeight: false, + maxWidth: false, + minHeight: 150, + minWidth: 150, + modal: false, + position: { + my: 'center', + at: 'center', + collision: 'fit', + // ensure that the titlebar is never outside the document + using: function(pos) { + var topOffset = $(this).css(pos).offset().top; + if (topOffset < 0) { + $(this).css('top', pos.top - topOffset); + } + } + }, + resizable: true, + show: null, + stack: true, + title: '', + width: 300, + zIndex: 1000 + }, + + _create: function() { + this.originalTitle = this.element.attr('title'); + // #5742 - .attr() might return a DOMElement + if ( typeof this.originalTitle !== "string" ) { + this.originalTitle = ""; + } + + this.options.title = this.options.title || this.originalTitle; + var self = this, + options = self.options, + + title = options.title || ' ', + titleId = $.ui.dialog.getTitleId(self.element), + + uiDialog = (self.uiDialog = $('

')) + .appendTo(document.body) + .hide() + .addClass(uiDialogClasses + options.dialogClass) + .css({ + zIndex: options.zIndex + }) + // setting tabIndex makes the div focusable + // setting outline to 0 prevents a border on focus in Mozilla + .attr('tabIndex', -1).css('outline', 0).keydown(function(event) { + if (options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + self.close(event); + event.preventDefault(); + } + }) + .attr({ + role: 'dialog', + 'aria-labelledby': titleId + }) + .mousedown(function(event) { + self.moveToTop(false, event); + }), + + uiDialogContent = self.element + .show() + .removeAttr('title') + .addClass( + 'ui-dialog-content ' + + 'ui-widget-content') + .appendTo(uiDialog), + + uiDialogTitlebar = (self.uiDialogTitlebar = $('

')) + .addClass( + 'ui-dialog-titlebar ' + + 'ui-widget-header ' + + 'ui-corner-all ' + + 'ui-helper-clearfix' + ) + .prependTo(uiDialog), + + uiDialogTitlebarClose = $('') + .addClass( + 'ui-dialog-titlebar-close ' + + 'ui-corner-all' + ) + .attr('role', 'button') + .hover( + function() { + uiDialogTitlebarClose.addClass('ui-state-hover'); + }, + function() { + uiDialogTitlebarClose.removeClass('ui-state-hover'); + } + ) + .focus(function() { + uiDialogTitlebarClose.addClass('ui-state-focus'); + }) + .blur(function() { + uiDialogTitlebarClose.removeClass('ui-state-focus'); + }) + .click(function(event) { + self.close(event); + return false; + }) + .appendTo(uiDialogTitlebar), + + uiDialogTitlebarCloseText = (self.uiDialogTitlebarCloseText = $('')) + .addClass( + 'ui-icon ' + + 'ui-icon-closethick' + ) + .text(options.closeText) + .appendTo(uiDialogTitlebarClose), + + uiDialogTitle = $('') + .addClass('ui-dialog-title') + .attr('id', titleId) + .html(title) + .prependTo(uiDialogTitlebar); + + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + if ($.isFunction(options.beforeclose) && !$.isFunction(options.beforeClose)) { + options.beforeClose = options.beforeclose; + } + + uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection(); + + if (options.draggable && $.fn.draggable) { + self._makeDraggable(); + } + if (options.resizable && $.fn.resizable) { + self._makeResizable(); + } + + self._createButtons(options.buttons); + self._isOpen = false; + + if ($.fn.bgiframe) { + uiDialog.bgiframe(); + } + }, + + _init: function() { + if ( this.options.autoOpen ) { + this.open(); + } + }, + + destroy: function() { + var self = this; + + if (self.overlay) { + self.overlay.destroy(); + } + self.uiDialog.hide(); + self.element + .unbind('.dialog') + .removeData('dialog') + .removeClass('ui-dialog-content ui-widget-content') + .hide().appendTo('body'); + self.uiDialog.remove(); + + if (self.originalTitle) { + self.element.attr('title', self.originalTitle); + } + + return self; + }, + + widget: function() { + return this.uiDialog; + }, + + close: function(event) { + var self = this, + maxZ, thisZ; + + if (false === self._trigger('beforeClose', event)) { + return; + } + + if (self.overlay) { + self.overlay.destroy(); + } + self.uiDialog.unbind('keypress.ui-dialog'); + + self._isOpen = false; + + if (self.options.hide) { + self.uiDialog.hide(self.options.hide, function() { + self._trigger('close', event); + }); + } else { + self.uiDialog.hide(); + self._trigger('close', event); + } + + $.ui.dialog.overlay.resize(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + if (self.options.modal) { + maxZ = 0; + $('.ui-dialog').each(function() { + if (this !== self.uiDialog[0]) { + thisZ = $(this).css('z-index'); + if(!isNaN(thisZ)) { + maxZ = Math.max(maxZ, thisZ); + } + } + }); + $.ui.dialog.maxZ = maxZ; + } + + return self; + }, + + isOpen: function() { + return this._isOpen; + }, + + // the force parameter allows us to move modal dialogs to their correct + // position on open + moveToTop: function(force, event) { + var self = this, + options = self.options, + saveScroll; + + if ((options.modal && !force) || + (!options.stack && !options.modal)) { + return self._trigger('focus', event); + } + + if (options.zIndex > $.ui.dialog.maxZ) { + $.ui.dialog.maxZ = options.zIndex; + } + if (self.overlay) { + $.ui.dialog.maxZ += 1; + self.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = $.ui.dialog.maxZ); + } + + //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed. + // http://ui.jquery.com/bugs/ticket/3193 + saveScroll = { scrollTop: self.element.scrollTop(), scrollLeft: self.element.scrollLeft() }; + $.ui.dialog.maxZ += 1; + self.uiDialog.css('z-index', $.ui.dialog.maxZ); + self.element.attr(saveScroll); + self._trigger('focus', event); + + return self; + }, + + open: function() { + if (this._isOpen) { return; } + + var self = this, + options = self.options, + uiDialog = self.uiDialog; + + self.overlay = options.modal ? new $.ui.dialog.overlay(self) : null; + self._size(); + self._position(options.position); + uiDialog.show(options.show); + self.moveToTop(true); + + // prevent tabbing out of modal dialogs + if ( options.modal ) { + uiDialog.bind( "keydown.ui-dialog", function( event ) { + if ( event.keyCode !== $.ui.keyCode.TAB ) { + return; + } + + var tabbables = $(':tabbable', this), + first = tabbables.filter(':first'), + last = tabbables.filter(':last'); + + if (event.target === last[0] && !event.shiftKey) { + first.focus(1); + return false; + } else if (event.target === first[0] && event.shiftKey) { + last.focus(1); + return false; + } + }); + } + + // set focus to the first tabbable element in the content area or the first button + // if there are no tabbable elements, set focus on the dialog itself + $(self.element.find(':tabbable').get().concat( + uiDialog.find('.ui-dialog-buttonpane :tabbable').get().concat( + uiDialog.get()))).eq(0).focus(); + + self._isOpen = true; + self._trigger('open'); + + return self; + }, + + _createButtons: function(buttons) { + var self = this, + hasButtons = false, + uiDialogButtonPane = $('

') + .addClass( + 'ui-dialog-buttonpane ' + + 'ui-widget-content ' + + 'ui-helper-clearfix' + ), + uiButtonSet = $( "

" ) + .addClass( "ui-dialog-buttonset" ) + .appendTo( uiDialogButtonPane ); + + // if we already have a button pane, remove it + self.uiDialog.find('.ui-dialog-buttonpane').remove(); + + if (typeof buttons === 'object' && buttons !== null) { + $.each(buttons, function() { + return !(hasButtons = true); + }); + } + if (hasButtons) { + $.each(buttons, function(name, props) { + props = $.isFunction( props ) ? + { click: props, text: name } : + props; + var button = $('') + .click(function() { + props.click.apply(self.element[0], arguments); + }) + .appendTo(uiButtonSet); + // can't use .attr( props, true ) with jQuery 1.3.2. + $.each( props, function( key, value ) { + if ( key === "click" ) { + return; + } + if ( key in button ) { + button[ key ]( value ); + } else { + button.attr( key, value ); + } + }); + if ($.fn.button) { + button.button(); + } + }); + uiDialogButtonPane.appendTo(self.uiDialog); + } + }, + + _makeDraggable: function() { + var self = this, + options = self.options, + doc = $(document), + heightBeforeDrag; + + function filteredUi(ui) { + return { + position: ui.position, + offset: ui.offset + }; + } + + self.uiDialog.draggable({ + cancel: '.ui-dialog-content, .ui-dialog-titlebar-close', + handle: '.ui-dialog-titlebar', + containment: 'document', + start: function(event, ui) { + heightBeforeDrag = options.height === "auto" ? "auto" : $(this).height(); + $(this).height($(this).height()).addClass("ui-dialog-dragging"); + self._trigger('dragStart', event, filteredUi(ui)); + }, + drag: function(event, ui) { + self._trigger('drag', event, filteredUi(ui)); + }, + stop: function(event, ui) { + options.position = [ui.position.left - doc.scrollLeft(), + ui.position.top - doc.scrollTop()]; + $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag); + self._trigger('dragStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }); + }, + + _makeResizable: function(handles) { + handles = (handles === undefined ? this.options.resizable : handles); + var self = this, + options = self.options, + // .ui-resizable has position: relative defined in the stylesheet + // but dialogs have to use absolute or fixed positioning + position = self.uiDialog.css('position'), + resizeHandles = (typeof handles === 'string' ? + handles : + 'n,e,s,w,se,sw,ne,nw' + ); + + function filteredUi(ui) { + return { + originalPosition: ui.originalPosition, + originalSize: ui.originalSize, + position: ui.position, + size: ui.size + }; + } + + self.uiDialog.resizable({ + cancel: '.ui-dialog-content', + containment: 'document', + alsoResize: self.element, + maxWidth: options.maxWidth, + maxHeight: options.maxHeight, + minWidth: options.minWidth, + minHeight: self._minHeight(), + handles: resizeHandles, + start: function(event, ui) { + $(this).addClass("ui-dialog-resizing"); + self._trigger('resizeStart', event, filteredUi(ui)); + }, + resize: function(event, ui) { + self._trigger('resize', event, filteredUi(ui)); + }, + stop: function(event, ui) { + $(this).removeClass("ui-dialog-resizing"); + options.height = $(this).height(); + options.width = $(this).width(); + self._trigger('resizeStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }) + .css('position', position) + .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se'); + }, + + _minHeight: function() { + var options = this.options; + + if (options.height === 'auto') { + return options.minHeight; + } else { + return Math.min(options.minHeight, options.height); + } + }, + + _position: function(position) { + var myAt = [], + offset = [0, 0], + isVisible; + + if (position) { + // deep extending converts arrays to objects in jQuery <= 1.3.2 :-( + // if (typeof position == 'string' || $.isArray(position)) { + // myAt = $.isArray(position) ? position : position.split(' '); + + if (typeof position === 'string' || (typeof position === 'object' && '0' in position)) { + myAt = position.split ? position.split(' ') : [position[0], position[1]]; + if (myAt.length === 1) { + myAt[1] = myAt[0]; + } + + $.each(['left', 'top'], function(i, offsetPosition) { + if (+myAt[i] === myAt[i]) { + offset[i] = myAt[i]; + myAt[i] = offsetPosition; + } + }); + + position = { + my: myAt.join(" "), + at: myAt.join(" "), + offset: offset.join(" ") + }; + } + + position = $.extend({}, $.ui.dialog.prototype.options.position, position); + } else { + position = $.ui.dialog.prototype.options.position; + } + + // need to show the dialog to get the actual offset in the position plugin + isVisible = this.uiDialog.is(':visible'); + if (!isVisible) { + this.uiDialog.show(); + } + this.uiDialog + // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781 + .css({ top: 0, left: 0 }) + .position($.extend({ of: window }, position)); + if (!isVisible) { + this.uiDialog.hide(); + } + }, + + _setOptions: function( options ) { + var self = this, + resizableOptions = {}, + resize = false; + + $.each( options, function( key, value ) { + self._setOption( key, value ); + + if ( key in sizeRelatedOptions ) { + resize = true; + } + if ( key in resizableRelatedOptions ) { + resizableOptions[ key ] = value; + } + }); + + if ( resize ) { + this._size(); + } + if ( this.uiDialog.is( ":data(resizable)" ) ) { + this.uiDialog.resizable( "option", resizableOptions ); + } + }, + + _setOption: function(key, value){ + var self = this, + uiDialog = self.uiDialog; + + switch (key) { + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + case "beforeclose": + key = "beforeClose"; + break; + case "buttons": + self._createButtons(value); + break; + case "closeText": + // ensure that we always pass a string + self.uiDialogTitlebarCloseText.text("" + value); + break; + case "dialogClass": + uiDialog + .removeClass(self.options.dialogClass) + .addClass(uiDialogClasses + value); + break; + case "disabled": + if (value) { + uiDialog.addClass('ui-dialog-disabled'); + } else { + uiDialog.removeClass('ui-dialog-disabled'); + } + break; + case "draggable": + var isDraggable = uiDialog.is( ":data(draggable)" ); + if ( isDraggable && !value ) { + uiDialog.draggable( "destroy" ); + } + + if ( !isDraggable && value ) { + self._makeDraggable(); + } + break; + case "position": + self._position(value); + break; + case "resizable": + // currently resizable, becoming non-resizable + var isResizable = uiDialog.is( ":data(resizable)" ); + if (isResizable && !value) { + uiDialog.resizable('destroy'); + } + + // currently resizable, changing handles + if (isResizable && typeof value === 'string') { + uiDialog.resizable('option', 'handles', value); + } + + // currently non-resizable, becoming resizable + if (!isResizable && value !== false) { + self._makeResizable(value); + } + break; + case "title": + // convert whatever was passed in o a string, for html() to not throw up + $(".ui-dialog-title", self.uiDialogTitlebar).html("" + (value || ' ')); + break; + } + + $.Widget.prototype._setOption.apply(self, arguments); + }, + + _size: function() { + /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content + * divs will both have width and height set, so we need to reset them + */ + var options = this.options, + nonContentHeight, + minContentHeight, + isVisible = this.uiDialog.is( ":visible" ); + + // reset content sizing + this.element.show().css({ + width: 'auto', + minHeight: 0, + height: 0 + }); + + if (options.minWidth > options.width) { + options.width = options.minWidth; + } + + // reset wrapper sizing + // determine the height of all the non-content elements + nonContentHeight = this.uiDialog.css({ + height: 'auto', + width: options.width + }) + .height(); + minContentHeight = Math.max( 0, options.minHeight - nonContentHeight ); + + if ( options.height === "auto" ) { + // only needed for IE6 support + if ( $.support.minHeight ) { + this.element.css({ + minHeight: minContentHeight, + height: "auto" + }); + } else { + this.uiDialog.show(); + var autoHeight = this.element.css( "height", "auto" ).height(); + if ( !isVisible ) { + this.uiDialog.hide(); + } + this.element.height( Math.max( autoHeight, minContentHeight ) ); + } + } else { + this.element.height( Math.max( options.height - nonContentHeight, 0 ) ); + } + + if (this.uiDialog.is(':data(resizable)')) { + this.uiDialog.resizable('option', 'minHeight', this._minHeight()); + } + } +}); + +$.extend($.ui.dialog, { + version: "1.8.24", + + uuid: 0, + maxZ: 0, + + getTitleId: function($el) { + var id = $el.attr('id'); + if (!id) { + this.uuid += 1; + id = this.uuid; + } + return 'ui-dialog-title-' + id; + }, + + overlay: function(dialog) { + this.$el = $.ui.dialog.overlay.create(dialog); + } +}); + +$.extend($.ui.dialog.overlay, { + instances: [], + // reuse old instances due to IE memory leak with alpha transparency (see #5185) + oldInstances: [], + maxZ: 0, + events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','), + function(event) { return event + '.dialog-overlay'; }).join(' '), + create: function(dialog) { + if (this.instances.length === 0) { + // prevent use of anchors and inputs + // we use a setTimeout in case the overlay is created from an + // event that we're going to be cancelling (see #2804) + setTimeout(function() { + // handle $(el).dialog().dialog('close') (see #4065) + if ($.ui.dialog.overlay.instances.length) { + $(document).bind($.ui.dialog.overlay.events, function(event) { + // stop events if the z-index of the target is < the z-index of the overlay + // we cannot return true when we don't want to cancel the event (#3523) + if ($(event.target).zIndex() < $.ui.dialog.overlay.maxZ) { + return false; + } + }); + } + }, 1); + + // allow closing by pressing the escape key + $(document).bind('keydown.dialog-overlay', function(event) { + if (dialog.options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + dialog.close(event); + event.preventDefault(); + } + }); + + // handle window resize + $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize); + } + + var $el = (this.oldInstances.pop() || $('

').addClass('ui-widget-overlay')) + .appendTo(document.body) + .css({ + width: this.width(), + height: this.height() + }); + + if ($.fn.bgiframe) { + $el.bgiframe(); + } + + this.instances.push($el); + return $el; + }, + + destroy: function($el) { + var indexOf = $.inArray($el, this.instances); + if (indexOf != -1){ + this.oldInstances.push(this.instances.splice(indexOf, 1)[0]); + } + + if (this.instances.length === 0) { + $([document, window]).unbind('.dialog-overlay'); + } + + $el.remove(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + var maxZ = 0; + $.each(this.instances, function() { + maxZ = Math.max(maxZ, this.css('z-index')); + }); + this.maxZ = maxZ; + }, + + height: function() { + var scrollHeight, + offsetHeight; + // handle IE 6 + if ($.browser.msie && $.browser.version < 7) { + scrollHeight = Math.max( + document.documentElement.scrollHeight, + document.body.scrollHeight + ); + offsetHeight = Math.max( + document.documentElement.offsetHeight, + document.body.offsetHeight + ); + + if (scrollHeight < offsetHeight) { + return $(window).height() + 'px'; + } else { + return scrollHeight + 'px'; + } + // handle "good" browsers + } else { + return $(document).height() + 'px'; + } + }, + + width: function() { + var scrollWidth, + offsetWidth; + // handle IE + if ( $.browser.msie ) { + scrollWidth = Math.max( + document.documentElement.scrollWidth, + document.body.scrollWidth + ); + offsetWidth = Math.max( + document.documentElement.offsetWidth, + document.body.offsetWidth + ); + + if (scrollWidth < offsetWidth) { + return $(window).width() + 'px'; + } else { + return scrollWidth + 'px'; + } + // handle "good" browsers + } else { + return $(document).width() + 'px'; + } + }, + + resize: function() { + /* If the dialog is draggable and the user drags it past the + * right edge of the window, the document becomes wider so we + * need to stretch the overlay. If the user then drags the + * dialog back to the left, the document will become narrower, + * so we need to shrink the overlay to the appropriate size. + * This is handled by shrinking the overlay before setting it + * to the full document size. + */ + var $overlays = $([]); + $.each($.ui.dialog.overlay.instances, function() { + $overlays = $overlays.add(this); + }); + + $overlays.css({ + width: 0, + height: 0 + }).css({ + width: $.ui.dialog.overlay.width(), + height: $.ui.dialog.overlay.height() + }); + } +}); + +$.extend($.ui.dialog.overlay.prototype, { + destroy: function() { + $.ui.dialog.overlay.destroy(this.$el); + } +}); + +}(jQuery)); + +(function( $, undefined ) { + +$.ui = $.ui || {}; + +var horizontalPositions = /left|center|right/, + verticalPositions = /top|center|bottom/, + center = "center", + support = {}, + _position = $.fn.position, + _offset = $.fn.offset; + +$.fn.position = function( options ) { + if ( !options || !options.of ) { + return _position.apply( this, arguments ); + } + + // make a copy, we don't want to modify arguments + options = $.extend( {}, options ); + + var target = $( options.of ), + targetElem = target[0], + collision = ( options.collision || "flip" ).split( " " ), + offset = options.offset ? options.offset.split( " " ) : [ 0, 0 ], + targetWidth, + targetHeight, + basePosition; + + if ( targetElem.nodeType === 9 ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: 0, left: 0 }; + // TODO: use $.isWindow() in 1.9 + } else if ( targetElem.setTimeout ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: target.scrollTop(), left: target.scrollLeft() }; + } else if ( targetElem.preventDefault ) { + // force left top to allow flipping + options.at = "left top"; + targetWidth = targetHeight = 0; + basePosition = { top: options.of.pageY, left: options.of.pageX }; + } else { + targetWidth = target.outerWidth(); + targetHeight = target.outerHeight(); + basePosition = target.offset(); + } + + // force my and at to have valid horizontal and veritcal positions + // if a value is missing or invalid, it will be converted to center + $.each( [ "my", "at" ], function() { + var pos = ( options[this] || "" ).split( " " ); + if ( pos.length === 1) { + pos = horizontalPositions.test( pos[0] ) ? + pos.concat( [center] ) : + verticalPositions.test( pos[0] ) ? + [ center ].concat( pos ) : + [ center, center ]; + } + pos[ 0 ] = horizontalPositions.test( pos[0] ) ? pos[ 0 ] : center; + pos[ 1 ] = verticalPositions.test( pos[1] ) ? pos[ 1 ] : center; + options[ this ] = pos; + }); + + // normalize collision option + if ( collision.length === 1 ) { + collision[ 1 ] = collision[ 0 ]; + } + + // normalize offset option + offset[ 0 ] = parseInt( offset[0], 10 ) || 0; + if ( offset.length === 1 ) { + offset[ 1 ] = offset[ 0 ]; + } + offset[ 1 ] = parseInt( offset[1], 10 ) || 0; + + if ( options.at[0] === "right" ) { + basePosition.left += targetWidth; + } else if ( options.at[0] === center ) { + basePosition.left += targetWidth / 2; + } + + if ( options.at[1] === "bottom" ) { + basePosition.top += targetHeight; + } else if ( options.at[1] === center ) { + basePosition.top += targetHeight / 2; + } + + basePosition.left += offset[ 0 ]; + basePosition.top += offset[ 1 ]; + + return this.each(function() { + var elem = $( this ), + elemWidth = elem.outerWidth(), + elemHeight = elem.outerHeight(), + marginLeft = parseInt( $.curCSS( this, "marginLeft", true ) ) || 0, + marginTop = parseInt( $.curCSS( this, "marginTop", true ) ) || 0, + collisionWidth = elemWidth + marginLeft + + ( parseInt( $.curCSS( this, "marginRight", true ) ) || 0 ), + collisionHeight = elemHeight + marginTop + + ( parseInt( $.curCSS( this, "marginBottom", true ) ) || 0 ), + position = $.extend( {}, basePosition ), + collisionPosition; + + if ( options.my[0] === "right" ) { + position.left -= elemWidth; + } else if ( options.my[0] === center ) { + position.left -= elemWidth / 2; + } + + if ( options.my[1] === "bottom" ) { + position.top -= elemHeight; + } else if ( options.my[1] === center ) { + position.top -= elemHeight / 2; + } + + // prevent fractions if jQuery version doesn't support them (see #5280) + if ( !support.fractions ) { + position.left = Math.round( position.left ); + position.top = Math.round( position.top ); + } + + collisionPosition = { + left: position.left - marginLeft, + top: position.top - marginTop + }; + + $.each( [ "left", "top" ], function( i, dir ) { + if ( $.ui.position[ collision[i] ] ) { + $.ui.position[ collision[i] ][ dir ]( position, { + targetWidth: targetWidth, + targetHeight: targetHeight, + elemWidth: elemWidth, + elemHeight: elemHeight, + collisionPosition: collisionPosition, + collisionWidth: collisionWidth, + collisionHeight: collisionHeight, + offset: offset, + my: options.my, + at: options.at + }); + } + }); + + if ( $.fn.bgiframe ) { + elem.bgiframe(); + } + elem.offset( $.extend( position, { using: options.using } ) ); + }); +}; + +$.ui.position = { + fit: { + left: function( position, data ) { + var win = $( window ), + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(); + position.left = over > 0 ? position.left - over : Math.max( position.left - data.collisionPosition.left, position.left ); + }, + top: function( position, data ) { + var win = $( window ), + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(); + position.top = over > 0 ? position.top - over : Math.max( position.top - data.collisionPosition.top, position.top ); + } + }, + + flip: { + left: function( position, data ) { + if ( data.at[0] === center ) { + return; + } + var win = $( window ), + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(), + myOffset = data.my[ 0 ] === "left" ? + -data.elemWidth : + data.my[ 0 ] === "right" ? + data.elemWidth : + 0, + atOffset = data.at[ 0 ] === "left" ? + data.targetWidth : + -data.targetWidth, + offset = -2 * data.offset[ 0 ]; + position.left += data.collisionPosition.left < 0 ? + myOffset + atOffset + offset : + over > 0 ? + myOffset + atOffset + offset : + 0; + }, + top: function( position, data ) { + if ( data.at[1] === center ) { + return; + } + var win = $( window ), + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(), + myOffset = data.my[ 1 ] === "top" ? + -data.elemHeight : + data.my[ 1 ] === "bottom" ? + data.elemHeight : + 0, + atOffset = data.at[ 1 ] === "top" ? + data.targetHeight : + -data.targetHeight, + offset = -2 * data.offset[ 1 ]; + position.top += data.collisionPosition.top < 0 ? + myOffset + atOffset + offset : + over > 0 ? + myOffset + atOffset + offset : + 0; + } + } +}; + +// offset setter from jQuery 1.4 +if ( !$.offset.setOffset ) { + $.offset.setOffset = function( elem, options ) { + // set position first, in-case top/left are set even on static elem + if ( /static/.test( $.curCSS( elem, "position" ) ) ) { + elem.style.position = "relative"; + } + var curElem = $( elem ), + curOffset = curElem.offset(), + curTop = parseInt( $.curCSS( elem, "top", true ), 10 ) || 0, + curLeft = parseInt( $.curCSS( elem, "left", true ), 10) || 0, + props = { + top: (options.top - curOffset.top) + curTop, + left: (options.left - curOffset.left) + curLeft + }; + + if ( 'using' in options ) { + options.using.call( elem, props ); + } else { + curElem.css( props ); + } + }; + + $.fn.offset = function( options ) { + var elem = this[ 0 ]; + if ( !elem || !elem.ownerDocument ) { return null; } + if ( options ) { + if ( $.isFunction( options ) ) { + return this.each(function( i ) { + $( this ).offset( options.call( this, i, $( this ).offset() ) ); + }); + } + return this.each(function() { + $.offset.setOffset( this, options ); + }); + } + return _offset.call( this ); + }; +} + +// jQuery <1.4.3 uses curCSS, in 1.4.3 - 1.7.2 curCSS = css, 1.8+ only has css +if ( !$.curCSS ) { + $.curCSS = $.css; +} + +// fraction support test (older versions of jQuery don't support fractions) +(function () { + var body = document.getElementsByTagName( "body" )[ 0 ], + div = document.createElement( "div" ), + testElement, testElementParent, testElementStyle, offset, offsetTotal; + + //Create a "fake body" for testing based on method used in jQuery.support + testElement = document.createElement( body ? "div" : "body" ); + testElementStyle = { + visibility: "hidden", + width: 0, + height: 0, + border: 0, + margin: 0, + background: "none" + }; + if ( body ) { + $.extend( testElementStyle, { + position: "absolute", + left: "-1000px", + top: "-1000px" + }); + } + for ( var i in testElementStyle ) { + testElement.style[ i ] = testElementStyle[ i ]; + } + testElement.appendChild( div ); + testElementParent = body || document.documentElement; + testElementParent.insertBefore( testElement, testElementParent.firstChild ); + + div.style.cssText = "position: absolute; left: 10.7432222px; top: 10.432325px; height: 30px; width: 201px;"; + + offset = $( div ).offset( function( _, offset ) { + return offset; + }).offset(); + + testElement.innerHTML = ""; + testElementParent.removeChild( testElement ); + + offsetTotal = offset.top + offset.left + ( body ? 2000 : 0 ); + support.fractions = offsetTotal > 21 && offsetTotal < 22; +})(); + +}( jQuery )); + +(function( $, undefined ) { + +$.widget( "ui.progressbar", { + options: { + value: 0, + max: 100 + }, + + min: 0, + + _create: function() { + this.element + .addClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) + .attr({ + role: "progressbar", + "aria-valuemin": this.min, + "aria-valuemax": this.options.max, + "aria-valuenow": this._value() + }); + + this.valueDiv = $( "

" ) + .appendTo( this.element ); + + this.oldValue = this._value(); + this._refreshValue(); + }, + + destroy: function() { + this.element + .removeClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) + .removeAttr( "role" ) + .removeAttr( "aria-valuemin" ) + .removeAttr( "aria-valuemax" ) + .removeAttr( "aria-valuenow" ); + + this.valueDiv.remove(); + + $.Widget.prototype.destroy.apply( this, arguments ); + }, + + value: function( newValue ) { + if ( newValue === undefined ) { + return this._value(); + } + + this._setOption( "value", newValue ); + return this; + }, + + _setOption: function( key, value ) { + if ( key === "value" ) { + this.options.value = value; + this._refreshValue(); + if ( this._value() === this.options.max ) { + this._trigger( "complete" ); + } + } + + $.Widget.prototype._setOption.apply( this, arguments ); + }, + + _value: function() { + var val = this.options.value; + // normalize invalid value + if ( typeof val !== "number" ) { + val = 0; + } + return Math.min( this.options.max, Math.max( this.min, val ) ); + }, + + _percentage: function() { + return 100 * this._value() / this.options.max; + }, + + _refreshValue: function() { + var value = this.value(); + var percentage = this._percentage(); + + if ( this.oldValue !== value ) { + this.oldValue = value; + this._trigger( "change" ); + } + + this.valueDiv + .toggle( value > this.min ) + .toggleClass( "ui-corner-right", value === this.options.max ) + .width( percentage.toFixed(0) + "%" ); + this.element.attr( "aria-valuenow", value ); + } +}); + +$.extend( $.ui.progressbar, { + version: "1.8.24" +}); + +})( jQuery ); + +(function( $, undefined ) { + +// number of pages in a slider +// (how many times can you page up/down to go through the whole range) +var numPages = 5; + +$.widget( "ui.slider", $.ui.mouse, { + + widgetEventPrefix: "slide", + + options: { + animate: false, + distance: 0, + max: 100, + min: 0, + orientation: "horizontal", + range: false, + step: 1, + value: 0, + values: null + }, + + _create: function() { + var self = this, + o = this.options, + existingHandles = this.element.find( ".ui-slider-handle" ).addClass( "ui-state-default ui-corner-all" ), + handle = "", + handleCount = ( o.values && o.values.length ) || 1, + handles = []; + + this._keySliding = false; + this._mouseSliding = false; + this._animateOff = true; + this._handleIndex = null; + this._detectOrientation(); + this._mouseInit(); + + this.element + .addClass( "ui-slider" + + " ui-slider-" + this.orientation + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" + + ( o.disabled ? " ui-slider-disabled ui-disabled" : "" ) ); + + this.range = $([]); + + if ( o.range ) { + if ( o.range === true ) { + if ( !o.values ) { + o.values = [ this._valueMin(), this._valueMin() ]; + } + if ( o.values.length && o.values.length !== 2 ) { + o.values = [ o.values[0], o.values[0] ]; + } + } + + this.range = $( "

" ) + .appendTo( this.element ) + .addClass( "ui-slider-range" + + // note: this isn't the most fittingly semantic framework class for this element, + // but worked best visually with a variety of themes + " ui-widget-header" + + ( ( o.range === "min" || o.range === "max" ) ? " ui-slider-range-" + o.range : "" ) ); + } + + for ( var i = existingHandles.length; i < handleCount; i += 1 ) { + handles.push( handle ); + } + + this.handles = existingHandles.add( $( handles.join( "" ) ).appendTo( self.element ) ); + + this.handle = this.handles.eq( 0 ); + + this.handles.add( this.range ).filter( "a" ) + .click(function( event ) { + event.preventDefault(); + }) + .hover(function() { + if ( !o.disabled ) { + $( this ).addClass( "ui-state-hover" ); + } + }, function() { + $( this ).removeClass( "ui-state-hover" ); + }) + .focus(function() { + if ( !o.disabled ) { + $( ".ui-slider .ui-state-focus" ).removeClass( "ui-state-focus" ); + $( this ).addClass( "ui-state-focus" ); + } else { + $( this ).blur(); + } + }) + .blur(function() { + $( this ).removeClass( "ui-state-focus" ); + }); + + this.handles.each(function( i ) { + $( this ).data( "index.ui-slider-handle", i ); + }); + + this.handles + .keydown(function( event ) { + var index = $( this ).data( "index.ui-slider-handle" ), + allowed, + curVal, + newVal, + step; + + if ( self.options.disabled ) { + return; + } + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + case $.ui.keyCode.END: + case $.ui.keyCode.PAGE_UP: + case $.ui.keyCode.PAGE_DOWN: + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + event.preventDefault(); + if ( !self._keySliding ) { + self._keySliding = true; + $( this ).addClass( "ui-state-active" ); + allowed = self._start( event, index ); + if ( allowed === false ) { + return; + } + } + break; + } + + step = self.options.step; + if ( self.options.values && self.options.values.length ) { + curVal = newVal = self.values( index ); + } else { + curVal = newVal = self.value(); + } + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + newVal = self._valueMin(); + break; + case $.ui.keyCode.END: + newVal = self._valueMax(); + break; + case $.ui.keyCode.PAGE_UP: + newVal = self._trimAlignValue( curVal + ( (self._valueMax() - self._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.PAGE_DOWN: + newVal = self._trimAlignValue( curVal - ( (self._valueMax() - self._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + if ( curVal === self._valueMax() ) { + return; + } + newVal = self._trimAlignValue( curVal + step ); + break; + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + if ( curVal === self._valueMin() ) { + return; + } + newVal = self._trimAlignValue( curVal - step ); + break; + } + + self._slide( event, index, newVal ); + }) + .keyup(function( event ) { + var index = $( this ).data( "index.ui-slider-handle" ); + + if ( self._keySliding ) { + self._keySliding = false; + self._stop( event, index ); + self._change( event, index ); + $( this ).removeClass( "ui-state-active" ); + } + + }); + + this._refreshValue(); + + this._animateOff = false; + }, + + destroy: function() { + this.handles.remove(); + this.range.remove(); + + this.element + .removeClass( "ui-slider" + + " ui-slider-horizontal" + + " ui-slider-vertical" + + " ui-slider-disabled" + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" ) + .removeData( "slider" ) + .unbind( ".slider" ); + + this._mouseDestroy(); + + return this; + }, + + _mouseCapture: function( event ) { + var o = this.options, + position, + normValue, + distance, + closestHandle, + self, + index, + allowed, + offset, + mouseOverHandle; + + if ( o.disabled ) { + return false; + } + + this.elementSize = { + width: this.element.outerWidth(), + height: this.element.outerHeight() + }; + this.elementOffset = this.element.offset(); + + position = { x: event.pageX, y: event.pageY }; + normValue = this._normValueFromMouse( position ); + distance = this._valueMax() - this._valueMin() + 1; + self = this; + this.handles.each(function( i ) { + var thisDistance = Math.abs( normValue - self.values(i) ); + if ( distance > thisDistance ) { + distance = thisDistance; + closestHandle = $( this ); + index = i; + } + }); + + // workaround for bug #3736 (if both handles of a range are at 0, + // the first is always used as the one with least distance, + // and moving it is obviously prevented by preventing negative ranges) + if( o.range === true && this.values(1) === o.min ) { + index += 1; + closestHandle = $( this.handles[index] ); + } + + allowed = this._start( event, index ); + if ( allowed === false ) { + return false; + } + this._mouseSliding = true; + + self._handleIndex = index; + + closestHandle + .addClass( "ui-state-active" ) + .focus(); + + offset = closestHandle.offset(); + mouseOverHandle = !$( event.target ).parents().andSelf().is( ".ui-slider-handle" ); + this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : { + left: event.pageX - offset.left - ( closestHandle.width() / 2 ), + top: event.pageY - offset.top - + ( closestHandle.height() / 2 ) - + ( parseInt( closestHandle.css("borderTopWidth"), 10 ) || 0 ) - + ( parseInt( closestHandle.css("borderBottomWidth"), 10 ) || 0) + + ( parseInt( closestHandle.css("marginTop"), 10 ) || 0) + }; + + if ( !this.handles.hasClass( "ui-state-hover" ) ) { + this._slide( event, index, normValue ); + } + this._animateOff = true; + return true; + }, + + _mouseStart: function( event ) { + return true; + }, + + _mouseDrag: function( event ) { + var position = { x: event.pageX, y: event.pageY }, + normValue = this._normValueFromMouse( position ); + + this._slide( event, this._handleIndex, normValue ); + + return false; + }, + + _mouseStop: function( event ) { + this.handles.removeClass( "ui-state-active" ); + this._mouseSliding = false; + + this._stop( event, this._handleIndex ); + this._change( event, this._handleIndex ); + + this._handleIndex = null; + this._clickOffset = null; + this._animateOff = false; + + return false; + }, + + _detectOrientation: function() { + this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal"; + }, + + _normValueFromMouse: function( position ) { + var pixelTotal, + pixelMouse, + percentMouse, + valueTotal, + valueMouse; + + if ( this.orientation === "horizontal" ) { + pixelTotal = this.elementSize.width; + pixelMouse = position.x - this.elementOffset.left - ( this._clickOffset ? this._clickOffset.left : 0 ); + } else { + pixelTotal = this.elementSize.height; + pixelMouse = position.y - this.elementOffset.top - ( this._clickOffset ? this._clickOffset.top : 0 ); + } + + percentMouse = ( pixelMouse / pixelTotal ); + if ( percentMouse > 1 ) { + percentMouse = 1; + } + if ( percentMouse < 0 ) { + percentMouse = 0; + } + if ( this.orientation === "vertical" ) { + percentMouse = 1 - percentMouse; + } + + valueTotal = this._valueMax() - this._valueMin(); + valueMouse = this._valueMin() + percentMouse * valueTotal; + + return this._trimAlignValue( valueMouse ); + }, + + _start: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + return this._trigger( "start", event, uiHash ); + }, + + _slide: function( event, index, newVal ) { + var otherVal, + newValues, + allowed; + + if ( this.options.values && this.options.values.length ) { + otherVal = this.values( index ? 0 : 1 ); + + if ( ( this.options.values.length === 2 && this.options.range === true ) && + ( ( index === 0 && newVal > otherVal) || ( index === 1 && newVal < otherVal ) ) + ) { + newVal = otherVal; + } + + if ( newVal !== this.values( index ) ) { + newValues = this.values(); + newValues[ index ] = newVal; + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal, + values: newValues + } ); + otherVal = this.values( index ? 0 : 1 ); + if ( allowed !== false ) { + this.values( index, newVal, true ); + } + } + } else { + if ( newVal !== this.value() ) { + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal + } ); + if ( allowed !== false ) { + this.value( newVal ); + } + } + } + }, + + _stop: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + + this._trigger( "stop", event, uiHash ); + }, + + _change: function( event, index ) { + if ( !this._keySliding && !this._mouseSliding ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + + this._trigger( "change", event, uiHash ); + } + }, + + value: function( newValue ) { + if ( arguments.length ) { + this.options.value = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, 0 ); + return; + } + + return this._value(); + }, + + values: function( index, newValue ) { + var vals, + newValues, + i; + + if ( arguments.length > 1 ) { + this.options.values[ index ] = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, index ); + return; + } + + if ( arguments.length ) { + if ( $.isArray( arguments[ 0 ] ) ) { + vals = this.options.values; + newValues = arguments[ 0 ]; + for ( i = 0; i < vals.length; i += 1 ) { + vals[ i ] = this._trimAlignValue( newValues[ i ] ); + this._change( null, i ); + } + this._refreshValue(); + } else { + if ( this.options.values && this.options.values.length ) { + return this._values( index ); + } else { + return this.value(); + } + } + } else { + return this._values(); + } + }, + + _setOption: function( key, value ) { + var i, + valsLength = 0; + + if ( $.isArray( this.options.values ) ) { + valsLength = this.options.values.length; + } + + $.Widget.prototype._setOption.apply( this, arguments ); + + switch ( key ) { + case "disabled": + if ( value ) { + this.handles.filter( ".ui-state-focus" ).blur(); + this.handles.removeClass( "ui-state-hover" ); + this.handles.propAttr( "disabled", true ); + this.element.addClass( "ui-disabled" ); + } else { + this.handles.propAttr( "disabled", false ); + this.element.removeClass( "ui-disabled" ); + } + break; + case "orientation": + this._detectOrientation(); + this.element + .removeClass( "ui-slider-horizontal ui-slider-vertical" ) + .addClass( "ui-slider-" + this.orientation ); + this._refreshValue(); + break; + case "value": + this._animateOff = true; + this._refreshValue(); + this._change( null, 0 ); + this._animateOff = false; + break; + case "values": + this._animateOff = true; + this._refreshValue(); + for ( i = 0; i < valsLength; i += 1 ) { + this._change( null, i ); + } + this._animateOff = false; + break; + } + }, + + //internal value getter + // _value() returns value trimmed by min and max, aligned by step + _value: function() { + var val = this.options.value; + val = this._trimAlignValue( val ); + + return val; + }, + + //internal values getter + // _values() returns array of values trimmed by min and max, aligned by step + // _values( index ) returns single value trimmed by min and max, aligned by step + _values: function( index ) { + var val, + vals, + i; + + if ( arguments.length ) { + val = this.options.values[ index ]; + val = this._trimAlignValue( val ); + + return val; + } else { + // .slice() creates a copy of the array + // this copy gets trimmed by min and max and then returned + vals = this.options.values.slice(); + for ( i = 0; i < vals.length; i+= 1) { + vals[ i ] = this._trimAlignValue( vals[ i ] ); + } + + return vals; + } + }, + + // returns the step-aligned value that val is closest to, between (inclusive) min and max + _trimAlignValue: function( val ) { + if ( val <= this._valueMin() ) { + return this._valueMin(); + } + if ( val >= this._valueMax() ) { + return this._valueMax(); + } + var step = ( this.options.step > 0 ) ? this.options.step : 1, + valModStep = (val - this._valueMin()) % step, + alignValue = val - valModStep; + + if ( Math.abs(valModStep) * 2 >= step ) { + alignValue += ( valModStep > 0 ) ? step : ( -step ); + } + + // Since JavaScript has problems with large floats, round + // the final value to 5 digits after the decimal point (see #4124) + return parseFloat( alignValue.toFixed(5) ); + }, + + _valueMin: function() { + return this.options.min; + }, + + _valueMax: function() { + return this.options.max; + }, + + _refreshValue: function() { + var oRange = this.options.range, + o = this.options, + self = this, + animate = ( !this._animateOff ) ? o.animate : false, + valPercent, + _set = {}, + lastValPercent, + value, + valueMin, + valueMax; + + if ( this.options.values && this.options.values.length ) { + this.handles.each(function( i, j ) { + valPercent = ( self.values(i) - self._valueMin() ) / ( self._valueMax() - self._valueMin() ) * 100; + _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + $( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + if ( self.options.range === true ) { + if ( self.orientation === "horizontal" ) { + if ( i === 0 ) { + self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { left: valPercent + "%" }, o.animate ); + } + if ( i === 1 ) { + self.range[ animate ? "animate" : "css" ]( { width: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } else { + if ( i === 0 ) { + self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { bottom: ( valPercent ) + "%" }, o.animate ); + } + if ( i === 1 ) { + self.range[ animate ? "animate" : "css" ]( { height: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } + } + lastValPercent = valPercent; + }); + } else { + value = this.value(); + valueMin = this._valueMin(); + valueMax = this._valueMax(); + valPercent = ( valueMax !== valueMin ) ? + ( value - valueMin ) / ( valueMax - valueMin ) * 100 : + 0; + _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + + if ( oRange === "min" && this.orientation === "horizontal" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { width: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "horizontal" ) { + this.range[ animate ? "animate" : "css" ]( { width: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + if ( oRange === "min" && this.orientation === "vertical" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { height: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "vertical" ) { + this.range[ animate ? "animate" : "css" ]( { height: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } + } + +}); + +$.extend( $.ui.slider, { + version: "1.8.24" +}); + +}(jQuery)); + +(function( $, undefined ) { + +var tabId = 0, + listId = 0; + +function getNextTabId() { + return ++tabId; +} + +function getNextListId() { + return ++listId; +} + +$.widget( "ui.tabs", { + options: { + add: null, + ajaxOptions: null, + cache: false, + cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true } + collapsible: false, + disable: null, + disabled: [], + enable: null, + event: "click", + fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 } + idPrefix: "ui-tabs-", + load: null, + panelTemplate: "

", + remove: null, + select: null, + show: null, + spinner: "Loading…", + tabTemplate: "

#{label}

" + }, + + _create: function() { + this._tabify( true ); + }, + + _setOption: function( key, value ) { + if ( key == "selected" ) { + if (this.options.collapsible && value == this.options.selected ) { + return; + } + this.select( value ); + } else { + this.options[ key ] = value; + this._tabify(); + } + }, + + _tabId: function( a ) { + return a.title && a.title.replace( /\s/g, "_" ).replace( /[^\w\u00c0-\uFFFF-]/g, "" ) || + this.options.idPrefix + getNextTabId(); + }, + + _sanitizeSelector: function( hash ) { + // we need this because an id may contain a ":" + return hash.replace( /:/g, "\\:" ); + }, + + _cookie: function() { + var cookie = this.cookie || + ( this.cookie = this.options.cookie.name || "ui-tabs-" + getNextListId() ); + return $.cookie.apply( null, [ cookie ].concat( $.makeArray( arguments ) ) ); + }, + + _ui: function( tab, panel ) { + return { + tab: tab, + panel: panel, + index: this.anchors.index( tab ) + }; + }, + + _cleanup: function() { + // restore all former loading tabs labels + this.lis.filter( ".ui-state-processing" ) + .removeClass( "ui-state-processing" ) + .find( "span:data(label.tabs)" ) + .each(function() { + var el = $( this ); + el.html( el.data( "label.tabs" ) ).removeData( "label.tabs" ); + }); + }, + + _tabify: function( init ) { + var self = this, + o = this.options, + fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash + + this.list = this.element.find( "ol,ul" ).eq( 0 ); + this.lis = $( " > li:has(a[href])", this.list ); + this.anchors = this.lis.map(function() { + return $( "a", this )[ 0 ]; + }); + this.panels = $( [] ); + + this.anchors.each(function( i, a ) { + var href = $( a ).attr( "href" ); + // For dynamically created HTML that contains a hash as href IE < 8 expands + // such href to the full page url with hash and then misinterprets tab as ajax. + // Same consideration applies for an added tab with a fragment identifier + // since a[href=#fragment-identifier] does unexpectedly not match. + // Thus normalize href attribute... + var hrefBase = href.split( "#" )[ 0 ], + baseEl; + if ( hrefBase && ( hrefBase === location.toString().split( "#" )[ 0 ] || + ( baseEl = $( "base" )[ 0 ]) && hrefBase === baseEl.href ) ) { + href = a.hash; + a.href = href; + } + + // inline tab + if ( fragmentId.test( href ) ) { + self.panels = self.panels.add( self.element.find( self._sanitizeSelector( href ) ) ); + // remote tab + // prevent loading the page itself if href is just "#" + } else if ( href && href !== "#" ) { + // required for restore on destroy + $.data( a, "href.tabs", href ); + + // TODO until #3808 is fixed strip fragment identifier from url + // (IE fails to load from such url) + $.data( a, "load.tabs", href.replace( /#.*$/, "" ) ); + + var id = self._tabId( a ); + a.href = "#" + id; + var $panel = self.element.find( "#" + id ); + if ( !$panel.length ) { + $panel = $( o.panelTemplate ) + .attr( "id", id ) + .addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ) + .insertAfter( self.panels[ i - 1 ] || self.list ); + $panel.data( "destroy.tabs", true ); + } + self.panels = self.panels.add( $panel ); + // invalid tab href + } else { + o.disabled.push( i ); + } + }); + + // initialization from scratch + if ( init ) { + // attach necessary classes for styling + this.element.addClass( "ui-tabs ui-widget ui-widget-content ui-corner-all" ); + this.list.addClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ); + this.lis.addClass( "ui-state-default ui-corner-top" ); + this.panels.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ); + + // Selected tab + // use "selected" option or try to retrieve: + // 1. from fragment identifier in url + // 2. from cookie + // 3. from selected class attribute on

+ if ( o.selected === undefined ) { + if ( location.hash ) { + this.anchors.each(function( i, a ) { + if ( a.hash == location.hash ) { + o.selected = i; + return false; + } + }); + } + if ( typeof o.selected !== "number" && o.cookie ) { + o.selected = parseInt( self._cookie(), 10 ); + } + if ( typeof o.selected !== "number" && this.lis.filter( ".ui-tabs-selected" ).length ) { + o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) ); + } + o.selected = o.selected || ( this.lis.length ? 0 : -1 ); + } else if ( o.selected === null ) { // usage of null is deprecated, TODO remove in next release + o.selected = -1; + } + + // sanity check - default to first tab... + o.selected = ( ( o.selected >= 0 && this.anchors[ o.selected ] ) || o.selected < 0 ) + ? o.selected + : 0; + + // Take disabling tabs via class attribute from HTML + // into account and update option properly. + // A selected tab cannot become disabled. + o.disabled = $.unique( o.disabled.concat( + $.map( this.lis.filter( ".ui-state-disabled" ), function( n, i ) { + return self.lis.index( n ); + }) + ) ).sort(); + + if ( $.inArray( o.selected, o.disabled ) != -1 ) { + o.disabled.splice( $.inArray( o.selected, o.disabled ), 1 ); + } + + // highlight selected tab + this.panels.addClass( "ui-tabs-hide" ); + this.lis.removeClass( "ui-tabs-selected ui-state-active" ); + // check for length avoids error when initializing empty list + if ( o.selected >= 0 && this.anchors.length ) { + self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) ).removeClass( "ui-tabs-hide" ); + this.lis.eq( o.selected ).addClass( "ui-tabs-selected ui-state-active" ); + + // seems to be expected behavior that the show callback is fired + self.element.queue( "tabs", function() { + self._trigger( "show", null, + self._ui( self.anchors[ o.selected ], self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) )[ 0 ] ) ); + }); + + this.load( o.selected ); + } + + // clean up to avoid memory leaks in certain versions of IE 6 + // TODO: namespace this event + $( window ).bind( "unload", function() { + self.lis.add( self.anchors ).unbind( ".tabs" ); + self.lis = self.anchors = self.panels = null; + }); + // update selected after add/remove + } else { + o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) ); + } + + // update collapsible + // TODO: use .toggleClass() + this.element[ o.collapsible ? "addClass" : "removeClass" ]( "ui-tabs-collapsible" ); + + // set or update cookie after init and add/remove respectively + if ( o.cookie ) { + this._cookie( o.selected, o.cookie ); + } + + // disable tabs + for ( var i = 0, li; ( li = this.lis[ i ] ); i++ ) { + $( li )[ $.inArray( i, o.disabled ) != -1 && + // TODO: use .toggleClass() + !$( li ).hasClass( "ui-tabs-selected" ) ? "addClass" : "removeClass" ]( "ui-state-disabled" ); + } + + // reset cache if switching from cached to not cached + if ( o.cache === false ) { + this.anchors.removeData( "cache.tabs" ); + } + + // remove all handlers before, tabify may run on existing tabs after add or option change + this.lis.add( this.anchors ).unbind( ".tabs" ); + + if ( o.event !== "mouseover" ) { + var addState = function( state, el ) { + if ( el.is( ":not(.ui-state-disabled)" ) ) { + el.addClass( "ui-state-" + state ); + } + }; + var removeState = function( state, el ) { + el.removeClass( "ui-state-" + state ); + }; + this.lis.bind( "mouseover.tabs" , function() { + addState( "hover", $( this ) ); + }); + this.lis.bind( "mouseout.tabs", function() { + removeState( "hover", $( this ) ); + }); + this.anchors.bind( "focus.tabs", function() { + addState( "focus", $( this ).closest( "li" ) ); + }); + this.anchors.bind( "blur.tabs", function() { + removeState( "focus", $( this ).closest( "li" ) ); + }); + } + + // set up animations + var hideFx, showFx; + if ( o.fx ) { + if ( $.isArray( o.fx ) ) { + hideFx = o.fx[ 0 ]; + showFx = o.fx[ 1 ]; + } else { + hideFx = showFx = o.fx; + } + } + + // Reset certain styles left over from animation + // and prevent IE's ClearType bug... + function resetStyle( $el, fx ) { + $el.css( "display", "" ); + if ( !$.support.opacity && fx.opacity ) { + $el[ 0 ].style.removeAttribute( "filter" ); + } + } + + // Show a tab... + var showTab = showFx + ? function( clicked, $show ) { + $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" ); + $show.hide().removeClass( "ui-tabs-hide" ) // avoid flicker that way + .animate( showFx, showFx.duration || "normal", function() { + resetStyle( $show, showFx ); + self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) ); + }); + } + : function( clicked, $show ) { + $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" ); + $show.removeClass( "ui-tabs-hide" ); + self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) ); + }; + + // Hide a tab, $show is optional... + var hideTab = hideFx + ? function( clicked, $hide ) { + $hide.animate( hideFx, hideFx.duration || "normal", function() { + self.lis.removeClass( "ui-tabs-selected ui-state-active" ); + $hide.addClass( "ui-tabs-hide" ); + resetStyle( $hide, hideFx ); + self.element.dequeue( "tabs" ); + }); + } + : function( clicked, $hide, $show ) { + self.lis.removeClass( "ui-tabs-selected ui-state-active" ); + $hide.addClass( "ui-tabs-hide" ); + self.element.dequeue( "tabs" ); + }; + + // attach tab event handler, unbind to avoid duplicates from former tabifying... + this.anchors.bind( o.event + ".tabs", function() { + var el = this, + $li = $(el).closest( "li" ), + $hide = self.panels.filter( ":not(.ui-tabs-hide)" ), + $show = self.element.find( self._sanitizeSelector( el.hash ) ); + + // If tab is already selected and not collapsible or tab disabled or + // or is already loading or click callback returns false stop here. + // Check if click handler returns false last so that it is not executed + // for a disabled or loading tab! + if ( ( $li.hasClass( "ui-tabs-selected" ) && !o.collapsible) || + $li.hasClass( "ui-state-disabled" ) || + $li.hasClass( "ui-state-processing" ) || + self.panels.filter( ":animated" ).length || + self._trigger( "select", null, self._ui( this, $show[ 0 ] ) ) === false ) { + this.blur(); + return false; + } + + o.selected = self.anchors.index( this ); + + self.abort(); + + // if tab may be closed + if ( o.collapsible ) { + if ( $li.hasClass( "ui-tabs-selected" ) ) { + o.selected = -1; + + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + self.element.queue( "tabs", function() { + hideTab( el, $hide ); + }).dequeue( "tabs" ); + + this.blur(); + return false; + } else if ( !$hide.length ) { + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + self.element.queue( "tabs", function() { + showTab( el, $show ); + }); + + // TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171 + self.load( self.anchors.index( this ) ); + + this.blur(); + return false; + } + } + + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + // show new tab + if ( $show.length ) { + if ( $hide.length ) { + self.element.queue( "tabs", function() { + hideTab( el, $hide ); + }); + } + self.element.queue( "tabs", function() { + showTab( el, $show ); + }); + + self.load( self.anchors.index( this ) ); + } else { + throw "jQuery UI Tabs: Mismatching fragment identifier."; + } + + // Prevent IE from keeping other link focussed when using the back button + // and remove dotted border from clicked link. This is controlled via CSS + // in modern browsers; blur() removes focus from address bar in Firefox + // which can become a usability and annoying problem with tabs('rotate'). + if ( $.browser.msie ) { + this.blur(); + } + }); + + // disable click in any case + this.anchors.bind( "click.tabs", function(){ + return false; + }); + }, + + _getIndex: function( index ) { + // meta-function to give users option to provide a href string instead of a numerical index. + // also sanitizes numerical indexes to valid values. + if ( typeof index == "string" ) { + index = this.anchors.index( this.anchors.filter( "[href$='" + index + "']" ) ); + } + + return index; + }, + + destroy: function() { + var o = this.options; + + this.abort(); + + this.element + .unbind( ".tabs" ) + .removeClass( "ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible" ) + .removeData( "tabs" ); + + this.list.removeClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ); + + this.anchors.each(function() { + var href = $.data( this, "href.tabs" ); + if ( href ) { + this.href = href; + } + var $this = $( this ).unbind( ".tabs" ); + $.each( [ "href", "load", "cache" ], function( i, prefix ) { + $this.removeData( prefix + ".tabs" ); + }); + }); + + this.lis.unbind( ".tabs" ).add( this.panels ).each(function() { + if ( $.data( this, "destroy.tabs" ) ) { + $( this ).remove(); + } else { + $( this ).removeClass([ + "ui-state-default", + "ui-corner-top", + "ui-tabs-selected", + "ui-state-active", + "ui-state-hover", + "ui-state-focus", + "ui-state-disabled", + "ui-tabs-panel", + "ui-widget-content", + "ui-corner-bottom", + "ui-tabs-hide" + ].join( " " ) ); + } + }); + + if ( o.cookie ) { + this._cookie( null, o.cookie ); + } + + return this; + }, + + add: function( url, label, index ) { + if ( index === undefined ) { + index = this.anchors.length; + } + + var self = this, + o = this.options, + $li = $( o.tabTemplate.replace( /#\{href\}/g, url ).replace( /#\{label\}/g, label ) ), + id = !url.indexOf( "#" ) ? url.replace( "#", "" ) : this._tabId( $( "a", $li )[ 0 ] ); + + $li.addClass( "ui-state-default ui-corner-top" ).data( "destroy.tabs", true ); + + // try to find an existing element before creating a new one + var $panel = self.element.find( "#" + id ); + if ( !$panel.length ) { + $panel = $( o.panelTemplate ) + .attr( "id", id ) + .data( "destroy.tabs", true ); + } + $panel.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide" ); + + if ( index >= this.lis.length ) { + $li.appendTo( this.list ); + $panel.appendTo( this.list[ 0 ].parentNode ); + } else { + $li.insertBefore( this.lis[ index ] ); + $panel.insertBefore( this.panels[ index ] ); + } + + o.disabled = $.map( o.disabled, function( n, i ) { + return n >= index ? ++n : n; + }); + + this._tabify(); + + if ( this.anchors.length == 1 ) { + o.selected = 0; + $li.addClass( "ui-tabs-selected ui-state-active" ); + $panel.removeClass( "ui-tabs-hide" ); + this.element.queue( "tabs", function() { + self._trigger( "show", null, self._ui( self.anchors[ 0 ], self.panels[ 0 ] ) ); + }); + + this.load( 0 ); + } + + this._trigger( "add", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + return this; + }, + + remove: function( index ) { + index = this._getIndex( index ); + var o = this.options, + $li = this.lis.eq( index ).remove(), + $panel = this.panels.eq( index ).remove(); + + // If selected tab was removed focus tab to the right or + // in case the last tab was removed the tab to the left. + if ( $li.hasClass( "ui-tabs-selected" ) && this.anchors.length > 1) { + this.select( index + ( index + 1 < this.anchors.length ? 1 : -1 ) ); + } + + o.disabled = $.map( + $.grep( o.disabled, function(n, i) { + return n != index; + }), + function( n, i ) { + return n >= index ? --n : n; + }); + + this._tabify(); + + this._trigger( "remove", null, this._ui( $li.find( "a" )[ 0 ], $panel[ 0 ] ) ); + return this; + }, + + enable: function( index ) { + index = this._getIndex( index ); + var o = this.options; + if ( $.inArray( index, o.disabled ) == -1 ) { + return; + } + + this.lis.eq( index ).removeClass( "ui-state-disabled" ); + o.disabled = $.grep( o.disabled, function( n, i ) { + return n != index; + }); + + this._trigger( "enable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + return this; + }, + + disable: function( index ) { + index = this._getIndex( index ); + var self = this, o = this.options; + // cannot disable already selected tab + if ( index != o.selected ) { + this.lis.eq( index ).addClass( "ui-state-disabled" ); + + o.disabled.push( index ); + o.disabled.sort(); + + this._trigger( "disable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + } + + return this; + }, + + select: function( index ) { + index = this._getIndex( index ); + if ( index == -1 ) { + if ( this.options.collapsible && this.options.selected != -1 ) { + index = this.options.selected; + } else { + return this; + } + } + this.anchors.eq( index ).trigger( this.options.event + ".tabs" ); + return this; + }, + + load: function( index ) { + index = this._getIndex( index ); + var self = this, + o = this.options, + a = this.anchors.eq( index )[ 0 ], + url = $.data( a, "load.tabs" ); + + this.abort(); + + // not remote or from cache + if ( !url || this.element.queue( "tabs" ).length !== 0 && $.data( a, "cache.tabs" ) ) { + this.element.dequeue( "tabs" ); + return; + } + + // load remote from here on + this.lis.eq( index ).addClass( "ui-state-processing" ); + + if ( o.spinner ) { + var span = $( "span", a ); + span.data( "label.tabs", span.html() ).html( o.spinner ); + } + + this.xhr = $.ajax( $.extend( {}, o.ajaxOptions, { + url: url, + success: function( r, s ) { + self.element.find( self._sanitizeSelector( a.hash ) ).html( r ); + + // take care of tab labels + self._cleanup(); + + if ( o.cache ) { + $.data( a, "cache.tabs", true ); + } + + self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) ); + try { + o.ajaxOptions.success( r, s ); + } + catch ( e ) {} + }, + error: function( xhr, s, e ) { + // take care of tab labels + self._cleanup(); + + self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) ); + try { + // Passing index avoid a race condition when this method is + // called after the user has selected another tab. + // Pass the anchor that initiated this request allows + // loadError to manipulate the tab content panel via $(a.hash) + o.ajaxOptions.error( xhr, s, index, a ); + } + catch ( e ) {} + } + } ) ); + + // last, so that load event is fired before show... + self.element.dequeue( "tabs" ); + + return this; + }, + + abort: function() { + // stop possibly running animations + this.element.queue( [] ); + this.panels.stop( false, true ); + + // "tabs" queue must not contain more than two elements, + // which are the callbacks for the latest clicked tab... + this.element.queue( "tabs", this.element.queue( "tabs" ).splice( -2, 2 ) ); + + // terminate pending requests from other tabs + if ( this.xhr ) { + this.xhr.abort(); + delete this.xhr; + } + + // take care of tab labels + this._cleanup(); + return this; + }, + + url: function( index, url ) { + this.anchors.eq( index ).removeData( "cache.tabs" ).data( "load.tabs", url ); + return this; + }, + + length: function() { + return this.anchors.length; + } +}); + +$.extend( $.ui.tabs, { + version: "1.8.24" +}); + +/* + * Tabs Extensions + */ + +/* + * Rotate + */ +$.extend( $.ui.tabs.prototype, { + rotation: null, + rotate: function( ms, continuing ) { + var self = this, + o = this.options; + + var rotate = self._rotate || ( self._rotate = function( e ) { + clearTimeout( self.rotation ); + self.rotation = setTimeout(function() { + var t = o.selected; + self.select( ++t < self.anchors.length ? t : 0 ); + }, ms ); + + if ( e ) { + e.stopPropagation(); + } + }); + + var stop = self._unrotate || ( self._unrotate = !continuing + ? function(e) { + if (e.clientX) { // in case of a true click + self.rotate(null); + } + } + : function( e ) { + rotate(); + }); + + // start rotation + if ( ms ) { + this.element.bind( "tabsshow", rotate ); + this.anchors.bind( o.event + ".tabs", stop ); + rotate(); + // stop rotation + } else { + clearTimeout( self.rotation ); + this.element.unbind( "tabsshow", rotate ); + this.anchors.unbind( o.event + ".tabs", stop ); + delete this._rotate; + delete this._unrotate; + } + + return this; + } +}); + +})( jQuery );