diff --git a/Modules/QmitkExt/QmitkHistogramJSWidget.cpp b/Modules/QmitkExt/QmitkHistogramJSWidget.cpp new file mode 100644 index 0000000000..c0a2e33188 --- /dev/null +++ b/Modules/QmitkExt/QmitkHistogramJSWidget.cpp @@ -0,0 +1,293 @@ +/*=================================================================== + +The Medical Imaging Interaction Toolkit (MITK) + +Copyright (c) German Cancer Research Center, +Division of Medical and Biological Informatics. +All rights reserved. + +This software is distributed WITHOUT ANY WARRANTY; without +even the implied warranty of MERCHANTABILITY or FITNESS FOR +A PARTICULAR PURPOSE. + +See LICENSE.txt or http://www.mitk.org for details. + +===================================================================*/ + + +#include "QmitkHistogramJSWidget.h" +#include "mitkPixelTypeMultiplex.h" +#include +#include "mitkRenderingManager.h" +#include "mitkBaseRenderer.h" +#include "mitkImageTimeSelector.h" +#include "mitkExtractSliceFilter.h" + +QmitkHistogramJSWidget::QmitkHistogramJSWidget(QWidget *parent) : + QWebView(parent) +{ + // set histogram type to barchart in first instance + m_UseLineGraph = false; + + // set html from source + connect(page()->mainFrame(), SIGNAL(javaScriptWindowObjectCleared()), this, SLOT(AddJSObject())); + QUrl myUrl = QUrl("qrc:/qmitk/Histogram.html"); + setUrl(myUrl); + + // set Scrollbars to be always disabled + page()->mainFrame()->setScrollBarPolicy(Qt::Horizontal, Qt::ScrollBarAlwaysOff); + page()->mainFrame()->setScrollBarPolicy(Qt::Vertical, Qt::ScrollBarAlwaysOff); + + m_ParametricPath = ParametricPathType::New(); +} + +QmitkHistogramJSWidget::~QmitkHistogramJSWidget() +{ + +} + +// adds an Object of Type QmitkHistogramJSWidget to the JavaScript, using QtWebkitBridge +void QmitkHistogramJSWidget::AddJSObject() +{ + page()->mainFrame()->addToJavaScriptWindowObject(QString("histogramData"), this); +} + + +// reloads WebView, everytime its size has been changed, so the size of the Histogram fits to the size of the widget +void QmitkHistogramJSWidget::resizeEvent(QResizeEvent* resizeEvent) +{ + QWebView::resizeEvent(resizeEvent); + this->reload(); +} + +// method to expose data to JavaScript by using properties +void QmitkHistogramJSWidget::ComputeHistogram(HistogramType* histogram) +{ + m_Histogram = histogram; + HistogramConstIteratorType startIt = m_Histogram->End(); + HistogramConstIteratorType endIt = m_Histogram->End(); + HistogramConstIteratorType it; + ClearData(); + unsigned int i = 0; + bool firstValue = false; + // removes frequencies of 0, which are outside the first and last bin + for (it = m_Histogram->Begin() ; it != m_Histogram->End(); ++it) + { + if (it.GetFrequency() > 0.0) + { + endIt = it; + if (!firstValue) + { + firstValue = true; + startIt = it; + } + } + } + ++endIt; + // generating Lists of measurement and frequencies + for (it = startIt ; it != endIt; ++it, ++i) + { + QVariant frequency = it.GetFrequency(); + QVariant measurement = it.GetMeasurementVector()[0]; + m_Frequency.insert(i, frequency); + m_Measurement.insert(i, measurement); + } + m_IntensityProfile = false; + this->SignalDataChanged(); +} + +void QmitkHistogramJSWidget::ClearData() +{ + m_Frequency.clear(); + m_Measurement.clear(); +} + +void QmitkHistogramJSWidget::ClearHistogram() +{ + this->ClearData(); + this->SignalDataChanged(); +} + +QList QmitkHistogramJSWidget::GetFrequency() +{ + return m_Frequency; +} + +QList QmitkHistogramJSWidget::GetMeasurement() +{ + return m_Measurement; +} + +bool QmitkHistogramJSWidget::GetUseLineGraph() +{ + return m_UseLineGraph; +} + +void QmitkHistogramJSWidget::OnBarRadioButtonSelected() +{ + m_UseLineGraph = false; + this->SignalGraphChanged(); +} + +void QmitkHistogramJSWidget::OnLineRadioButtonSelected() +{ + m_UseLineGraph = true; + this->SignalGraphChanged(); +} + +void QmitkHistogramJSWidget::SetImage(mitk::Image* image) +{ + m_Image = image; +} + +void QmitkHistogramJSWidget::SetPlanarFigure(const mitk::PlanarFigure* planarFigure) +{ + m_PlanarFigure = planarFigure; +} + +template +void ReadPixel(mitk::PixelType ptype, mitk::Image::Pointer image, mitk::Index3D indexPoint, double& value) +{ + if (image->GetDimension() == 2) + { + mitk::ImagePixelReadAccessor readAccess(image, image->GetSliceData(0)); + itk::Index<2> idx; + idx[0] = indexPoint[0]; + idx[1] = indexPoint[1]; + value = readAccess.GetPixelByIndex(idx); + } + else if (image->GetDimension() == 3) + { + mitk::ImagePixelReadAccessor readAccess(image, image->GetVolumeData(0)); + itk::Index<3> idx; + idx[0] = indexPoint[0]; + idx[1] = indexPoint[1]; + idx[2] = indexPoint[2]; + value = readAccess.GetPixelByIndex(idx); + } + else + { + //unhandled + } +} + +void QmitkHistogramJSWidget::ComputeIntensityProfile(unsigned int timeStep) +{ + this->ClearData(); + m_ParametricPath->Initialize(); + + if (m_PlanarFigure.IsNull()) + { + mitkThrow() << "PlanarFigure not set!"; + } + + if (m_Image.IsNull()) + { + mitkThrow() << "Image not set!"; + } + + // Get 2D geometry frame of PlanarFigure + mitk::Geometry2D* planarFigureGeometry2D = dynamic_cast(m_PlanarFigure->GetGeometry(0)); + if (planarFigureGeometry2D == NULL) + { + mitkThrow() << "PlanarFigure has no valid geometry!"; + } + + // Get 3D geometry from Image (needed for conversion of point to index) + mitk::Geometry3D* imageGeometry = m_Image->GetGeometry(0); + if (imageGeometry == NULL) + { + mitkThrow() << "Image has no valid geometry!"; + } + + // Get first poly-line of PlanarFigure (other possible poly-lines in PlanarFigure + // are not supported) + const VertexContainerType vertexContainer = m_PlanarFigure->GetPolyLine(0); + + VertexContainerType::const_iterator it; + for (it = vertexContainer.begin(); it != vertexContainer.end(); ++it) + { + // Map PlanarFigure 2D point to 3D point + mitk::Point3D point3D; + planarFigureGeometry2D->Map(it->Point, point3D); + + // Convert world to index coordinates + mitk::Point3D indexPoint3D; + imageGeometry->WorldToIndex(point3D, indexPoint3D); + + ParametricPathType::OutputType index; + index[0] = indexPoint3D[0]; + index[1] = indexPoint3D[1]; + index[2] = indexPoint3D[2]; + + // Add index to parametric path + m_ParametricPath->AddVertex(index); + } + + m_DerivedPath = m_ParametricPath; + + if (m_DerivedPath.IsNull()) + { + mitkThrow() << "No path set!"; + } + + // Fill item model with line profile data + double distance = 0.0; + mitk::Point3D currentWorldPoint; + + double t; + unsigned int i = 0; + for (i = 0, t = m_DerivedPath->StartOfInput(); ;++i) + { + const PathType::OutputType &continousIndex = m_DerivedPath->Evaluate(t); + + mitk::Point3D worldPoint; + imageGeometry->IndexToWorld(continousIndex, worldPoint); + + if (i == 0) + { + currentWorldPoint = worldPoint; + } + + + distance += currentWorldPoint.EuclideanDistanceTo(worldPoint); + mitk::Index3D indexPoint; + imageGeometry->WorldToIndex(worldPoint, indexPoint); + const mitk::PixelType ptype = m_Image->GetPixelType(); + double intensity = 0.0; + if (m_Image->GetDimension() == 4) + { + mitk::ImageTimeSelector::Pointer timeSelector = mitk::ImageTimeSelector::New(); + timeSelector->SetInput(m_Image); + timeSelector->SetTimeNr(timeStep); + timeSelector->Update(); + mitk::Image::Pointer image = timeSelector->GetOutput(); + mitkPixelTypeMultiplex3( ReadPixel, ptype, image, indexPoint, intensity); + } + else + { + mitkPixelTypeMultiplex3( ReadPixel, ptype, m_Image, indexPoint, intensity); + } + + m_Measurement.insert(i, distance); + m_Frequency.insert(i, intensity); + + // Go to next index; when iteration offset reaches zero, iteration is finished + PathType::OffsetType offset = m_DerivedPath->IncrementInput(t); + if (!(offset[0] || offset[1] || offset[2])) + { + break; + } + + currentWorldPoint = worldPoint; + } + + m_IntensityProfile = true; + m_UseLineGraph = true; + this->SignalDataChanged(); +} + +bool QmitkHistogramJSWidget::GetIntensityProfile() +{ + return m_IntensityProfile; +} diff --git a/Modules/QmitkExt/QmitkHistogramJSWidget.h b/Modules/QmitkExt/QmitkHistogramJSWidget.h new file mode 100644 index 0000000000..7d59f82199 --- /dev/null +++ b/Modules/QmitkExt/QmitkHistogramJSWidget.h @@ -0,0 +1,275 @@ +/*=================================================================== + +The Medical Imaging Interaction Toolkit (MITK) + +Copyright (c) German Cancer Research Center, +Division of Medical and Biological Informatics. +All rights reserved. + +This software is distributed WITHOUT ANY WARRANTY; without +even the implied warranty of MERCHANTABILITY or FITNESS FOR +A PARTICULAR PURPOSE. + +See LICENSE.txt or http://www.mitk.org for details. + +===================================================================*/ + + +#ifndef QMITKHISTOGRAMJSWIDGET_H +#define QMITKHISTOGRAMJSWIDGET_H + +#include +#include +#include +#include "QmitkExtExports.h" +#include +#include "mitkImage.h" +#include "mitkPlanarFigure.h" +#include + +/** +* \brief Widget which shows a histogram using JavaScript. +* +* This class is a QWebView. It shows the histogram for a selected image +* or segmentation. It also can display an intesity profile for +* path elements, which lais over an image. +*/ +class QmitkExt_EXPORT QmitkHistogramJSWidget : public QWebView +{ + Q_OBJECT + + /** + * \brief Measurement property. + * + * This property is used in JavaScript as member of the current object. + * It holds a QList, containing the measurements of the current histogram. + * @see GetMeasurement() + */ + Q_PROPERTY(QList measurement + READ GetMeasurement) + + /** + * \brief Frequency property. + * + * This property is used in JavaScript as member of the current object. + * It holds a QList, containing the frequencies of the current histogram. + * @see GetFrequency() + */ + Q_PROPERTY(QList frequency + READ GetFrequency) + + /** + * \brief Line graph property. + * + * This property is used in JavaScript as member of the current object. + * It holds a boolean, which sais wether to use a line or not. + * @see GetUseLineGraph() + */ + Q_PROPERTY(bool useLineGraph + READ GetUseLineGraph) + + /** + * @brief Intesity profile property. + * + * This property is used in JavaScript as member of the current object. + * It holds a boolean, which sais wether to use an intesity profile or not. + * @see GetIntensityProfile() + */ + Q_PROPERTY(bool intensityProfile + READ GetIntensityProfile) + +public: + typedef mitk::Image::HistogramType HistogramType; + typedef mitk::Image::HistogramType::ConstIterator HistogramConstIteratorType; + typedef itk::PolyLineParametricPath< 3 > ParametricPathType; + typedef itk::ParametricPath< 3 >::Superclass PathType; + typedef mitk::PlanarFigure::PolyLineType VertexContainerType; + + explicit QmitkHistogramJSWidget(QWidget *parent = 0); + + + ~QmitkHistogramJSWidget(); + + /** + * \brief Event which notifies a change of the widget size. + * + * Reimplemented from QWebView::resizeEvent(), + * reloads the webframe + */ + void resizeEvent(QResizeEvent* resizeEvent); + + /** + * \brief Calculates the histogram. + * + * This function removes all frequencies of 0 until the first bin and behind the last bin. + * It writes the measurement and frequency, which are given from the HistogramType, into + * m_Measurement and m_Frequency. + * The SignalDataChanged is called, to update the information, which is displayed in the webframe. + */ + void ComputeHistogram(HistogramType* histogram); + + /** + * \brief Calculates the intesityprofile. + * + * If an image and a pathelement are set, this function + * calculates an intensity profile for a pathelement which lies over an image. + * Sets m_IntensityProfile and m_UseLineGraph to true. + * The SignalDataChanged is called, to update the information, which is displayed in the webframe. + */ + void ComputeIntensityProfile(unsigned int timeStep = 0); + + /** + * \brief Clears the Histogram. + * + * This function clears the data and calls SignalDataChanged to update + * the displayed information in the webframe. + */ + void ClearHistogram(); + + /** + * \brief Getter for measurement. + * + * @return List of measurements. + */ + QList GetMeasurement(); + + /** + * \brief Getter for frequency. + * + * @return List of frequencies. + */ + QList GetFrequency(); + + /** + * \brief Getter for uselineGraph. + * + * @return True if a linegraph should be used. + */ + bool GetUseLineGraph(); + + /** + * \brief Getter for intensity profile. + * + * @return True if current histogram is an intesityprofile + */ + bool GetIntensityProfile(); + + /** + * \brief Setter for reference image. + * + * @param image The corresponding image for an intensity profile. + */ + void SetImage(mitk::Image* image); + + /** + * \brief Setter for planarFigure. + * + * @param planarFigure The pathelement for an intensity profile. + */ + void SetPlanarFigure(const mitk::PlanarFigure* planarFigure); + +private: + + /** + * \brief List of frequencies. + * + * A QList which holds the frequencies of the current histogram + * or holds the intesities of current intensity profile. + */ + QList m_Frequency; + + /** + * \brief List of measurements. + * + * A QList which holds the measurements of the current histogram + * or holds the distances of current intensity profile. + */ + QList m_Measurement; + + /** + * \brief Reference image. + * + * Holds the image to calculate an intesity profile. + */ + mitk::Image::Pointer m_Image; + + /** + * \brief Pathelement. + * + * Holds a not closed planar figure to calculate an intesity profile. + */ + mitk::PlanarFigure::ConstPointer m_PlanarFigure; + + bool m_UseLineGraph; + bool m_IntensityProfile; + + /** + * Holds the current histogram + */ + HistogramType::ConstPointer m_Histogram; + + /** + * Path derived either form user-specified path or from PlanarFigure-generated + * path + */ + PathType::ConstPointer m_DerivedPath; + + /** + * Parametric path as generated from PlanarFigure + */ + ParametricPathType::Pointer m_ParametricPath; + + /** + * \brief Clears data. + * + * Clears the QLists m_Measurement and m_Frequency + */ + void ClearData(); + +private slots: + + /** + * \brief Adds an object to JavaScript. + * + * Adds an object of the widget to JavaScript. + * By using this object JavaScript can react to the signals of the widget + * and can access the QProperties as members of the object. + */ + void AddJSObject(); + +public slots: + + /** + * \brief Slot for radiobutton m_barRadioButton. + * + * Sets m_UseLineGraph to false. + * Calls signal GraphChanged to update the graph in the webframe. + */ + void OnBarRadioButtonSelected(); + + /** + * \brief Slot for radiobutton m_lineRadioButton. + * + * Sets m_UseLineGraph to true. + * Calls signal GraphChanged to update the graph in the webframe. + */ + void OnLineRadioButtonSelected(); + +signals: + + /** + * \brief Signal data has changed. + * + * It has to be called when the data of the histogram or intesity profile has changed. + */ + void SignalDataChanged(); + + /** + * \brief Signal graph has changed. + * + * It has to be called when the graph changed from barchart to linegraph. Vice versa. + */ + void SignalGraphChanged(); +}; + +#endif // QMITKHISTOGRAMJSWIDGET_H diff --git a/Modules/QmitkExt/files.cmake b/Modules/QmitkExt/files.cmake index 0bd4443159..48eefa8b88 100644 --- a/Modules/QmitkExt/files.cmake +++ b/Modules/QmitkExt/files.cmake @@ -1,263 +1,267 @@ set(CPP_FILES QmitkApplicationBase/QmitkCommonFunctionality.cpp QmitkApplicationBase/QmitkIOUtil.cpp #QmitkModels/QmitkDataStorageListModel.cpp #QmitkModels/QmitkPropertiesTableModel.cpp #QmitkModels/QmitkDataStorageTreeModel.cpp #QmitkModels/QmitkDataStorageTableModel.cpp #QmitkModels/QmitkPropertyDelegate.cpp #QmitkModels/QmitkPointListModel.cpp #QmitkAlgorithmFunctionalityComponent.cpp #QmitkBaseAlgorithmComponent.cpp QmitkAboutDialog/QmitkAboutDialog.cpp #QmitkFunctionalityComponents/QmitkSurfaceCreatorComponent.cpp #QmitkFunctionalityComponents/QmitkPixelGreyValueManipulatorComponent.cpp #QmitkFunctionalityComponents/QmitkConnectivityFilterComponent.cpp #QmitkFunctionalityComponents/QmitkImageCropperComponent.cpp #QmitkFunctionalityComponents/QmitkSeedPointSetComponent.cpp #QmitkFunctionalityComponents/QmitkSurfaceTransformerComponent.cpp QmitkPropertyObservers/QmitkBasePropertyView.cpp QmitkPropertyObservers/QmitkBoolPropertyWidget.cpp QmitkPropertyObservers/QmitkColorPropertyEditor.cpp QmitkPropertyObservers/QmitkColorPropertyView.cpp QmitkPropertyObservers/QmitkEnumerationPropertyWidget.cpp QmitkPropertyObservers/QmitkNumberPropertyEditor.cpp QmitkPropertyObservers/QmitkNumberPropertyView.cpp QmitkPropertyObservers/QmitkPropertyViewFactory.cpp QmitkPropertyObservers/QmitkStringPropertyEditor.cpp QmitkPropertyObservers/QmitkStringPropertyOnDemandEdit.cpp QmitkPropertyObservers/QmitkStringPropertyView.cpp QmitkPropertyObservers/QmitkNumberPropertySlider.cpp QmitkPropertyObservers/QmitkUGCombinedRepresentationPropertyWidget.cpp qclickablelabel.cpp #QmitkAbortEventFilter.cpp # QmitkApplicationCursor.cpp QmitkCallbackFromGUIThread.cpp QmitkEditPointDialog.cpp QmitkExtRegisterClasses.cpp QmitkFileChooser.cpp # QmitkRenderingManager.cpp # QmitkRenderingManagerFactory.cpp # QmitkRenderWindow.cpp # QmitkEventAdapter.cpp QmitkFloatingPointSpanSlider.cpp QmitkColorTransferFunctionCanvas.cpp QmitkSlicesInterpolator.cpp QmitkStandardViews.cpp QmitkStepperAdapter.cpp # QmitkLineEditLevelWindowWidget.cpp # mitkSliderLevelWindowWidget.cpp # QmitkLevelWindowWidget.cpp # QmitkPointListWidget.cpp # QmitkPointListView.cpp QmitkPiecewiseFunctionCanvas.cpp QmitkSliderNavigatorWidget.cpp QmitkTransferFunctionCanvas.cpp QmitkCrossWidget.cpp #QmitkLevelWindowRangeChangeDialog.cpp #QmitkLevelWindowPresetDefinitionDialog.cpp # QmitkLevelWindowWidgetContextMenu.cpp QmitkSliceWidget.cpp # QmitkStdMultiWidget.cpp QmitkTransferFunctionWidget.cpp QmitkTransferFunctionGeneratorWidget.cpp QmitkSelectableGLWidget.cpp QmitkToolReferenceDataSelectionBox.cpp QmitkToolWorkingDataSelectionBox.cpp QmitkToolGUIArea.cpp QmitkToolSelectionBox.cpp # QmitkPropertyListPopup.cpp QmitkToolGUI.cpp QmitkNewSegmentationDialog.cpp QmitkPaintbrushToolGUI.cpp QmitkDrawPaintbrushToolGUI.cpp QmitkErasePaintbrushToolGUI.cpp QmitkBinaryThresholdToolGUI.cpp QmitkCalculateGrayValueStatisticsToolGUI.cpp QmitkCopyToClipBoardDialog.cpp # QmitkMaterialEditor.cpp # QmitkMaterialShowcase.cpp # QmitkPropertiesTableEditor.cpp QmitkPrimitiveMovieNavigatorWidget.cpp # QmitkDataStorageComboBox.cpp QmitkHistogram.cpp QmitkHistogramWidget.cpp QmitkPlotWidget.cpp QmitkPlotDialog.cpp QmitkPointListModel.cpp QmitkPointListView.cpp QmitkPointListWidget.cpp QmitkPointListViewWidget.cpp QmitkCorrespondingPointSetsView.cpp QmitkCorrespondingPointSetsModel.cpp QmitkCorrespondingPointSetsWidget.cpp QmitkVideoBackground.cpp QmitkHotkeyLineEdit.cpp QmitkErodeToolGUI.cpp QmitkDilateToolGUI.cpp QmitkMorphologicToolGUI.cpp QmitkOpeningToolGUI.cpp QmitkClosingToolGUI.cpp QmitkBinaryThresholdULToolGUI.cpp QmitkPixelManipulationToolGUI.cpp QmitkRegionGrow3DToolGUI.cpp QmitkToolRoiDataSelectionBox.cpp QmitkBoundingObjectWidget.cpp QmitkAdaptiveRegionGrowingWidget.cpp QmitkModuleTableModel.cpp QmitkModulesDialog.cpp + + QmitkHistogramJSWidget.cpp ) if( NOT ${VTK_MAJOR_VERSION}.${VTK_MINOR_VERSION}.${VTK_BUILD_VERSION} VERSION_LESS 5.4.0 ) set(CPP_FILES ${CPP_FILES} QmitkVtkHistogramWidget.cpp QmitkVtkLineProfileWidget.cpp ) endif() if(NOT APPLE) set(CPP_FILES ${CPP_FILES} QmitkBaseComponent.cpp QmitkBaseFunctionalityComponent.cpp QmitkFunctionalityComponentContainer.cpp QmitkFunctionalityComponents/QmitkThresholdComponent.cpp ) endif() QT4_ADD_RESOURCES(CPP_FILES resources/QmitkResources.qrc) set(MOC_H_FILES QmitkPropertyObservers/QmitkBasePropertyView.h QmitkPropertyObservers/QmitkBoolPropertyWidget.h QmitkPropertyObservers/QmitkColorPropertyEditor.h QmitkPropertyObservers/QmitkColorPropertyView.h QmitkPropertyObservers/QmitkEnumerationPropertyWidget.h QmitkPropertyObservers/QmitkNumberPropertyEditor.h QmitkPropertyObservers/QmitkNumberPropertyView.h QmitkPropertyObservers/QmitkStringPropertyEditor.h QmitkPropertyObservers/QmitkStringPropertyOnDemandEdit.h QmitkPropertyObservers/QmitkStringPropertyView.h QmitkPropertyObservers/QmitkNumberPropertySlider.h QmitkPropertyObservers/QmitkUGCombinedRepresentationPropertyWidget.h # QmitkFunctionalityComponents/QmitkSurfaceCreatorComponent.h #QmitkFunctionalityComponents/QmitkPixelGreyValueManipulatorComponent.h # QmitkFunctionalityComponents/QmitkConnectivityFilterComponent.h # QmitkFunctionalityComponents/QmitkImageCropperComponent.h # QmitkFunctionalityComponents/QmitkSeedPointSetComponent.h # QmitkFunctionalityComponents/QmitkSurfaceTransformerComponent.h qclickablelabel.h QmitkCallbackFromGUIThread.h QmitkEditPointDialog.h #QmitkAlgorithmFunctionalityComponent.h #QmitkBaseAlgorithmComponent.h QmitkStandardViews.h QmitkStepperAdapter.h QmitkSliderNavigatorWidget.h QmitkSliceWidget.h QmitkSlicesInterpolator.h QmitkColorTransferFunctionCanvas.h QmitkPiecewiseFunctionCanvas.h QmitkTransferFunctionCanvas.h QmitkFloatingPointSpanSlider.h QmitkCrossWidget.h QmitkTransferFunctionWidget.h QmitkTransferFunctionGeneratorWidget.h QmitkToolGUIArea.h QmitkToolGUI.h QmitkToolReferenceDataSelectionBox.h QmitkToolWorkingDataSelectionBox.h QmitkToolSelectionBox.h # QmitkPropertyListPopup.h #QmitkSelectableGLWidget.h QmitkNewSegmentationDialog.h QmitkPaintbrushToolGUI.h QmitkDrawPaintbrushToolGUI.h QmitkErasePaintbrushToolGUI.h QmitkBinaryThresholdToolGUI.h QmitkCalculateGrayValueStatisticsToolGUI.h QmitkCopyToClipBoardDialog.h QmitkPrimitiveMovieNavigatorWidget.h QmitkPlotWidget.h QmitkPointListModel.h QmitkPointListView.h QmitkPointListWidget.h QmitkPointListViewWidget.h QmitkCorrespondingPointSetsView.h QmitkCorrespondingPointSetsModel.h QmitkCorrespondingPointSetsWidget.h QmitkHistogramWidget.h QmitkVideoBackground.h QmitkFileChooser.h QmitkHotkeyLineEdit.h QmitkAboutDialog/QmitkAboutDialog.h QmitkErodeToolGUI.h QmitkDilateToolGUI.h QmitkMorphologicToolGUI.h QmitkOpeningToolGUI.h QmitkClosingToolGUI.h QmitkBinaryThresholdULToolGUI.h QmitkPixelManipulationToolGUI.h QmitkRegionGrow3DToolGUI.h QmitkToolRoiDataSelectionBox.h QmitkBoundingObjectWidget.h QmitkPlotWidget.h QmitkAdaptiveRegionGrowingWidget.h + + QmitkHistogramJSWidget.h ) if( NOT ${VTK_MAJOR_VERSION}.${VTK_MINOR_VERSION}.${VTK_BUILD_VERSION} VERSION_LESS 5.4.0 ) set(MOC_H_FILES ${MOC_H_FILES} QmitkVtkHistogramWidget.h QmitkVtkLineProfileWidget.h ) endif() if(NOT APPLE) set(MOC_H_FILES ${MOC_H_FILES} QmitkBaseComponent.h QmitkBaseFunctionalityComponent.h QmitkFunctionalityComponentContainer.h QmitkFunctionalityComponents/QmitkThresholdComponent.h ) endif() set(UI_FILES QmitkSliderNavigator.ui # QmitkLevelWindowRangeChange.ui # QmitkLevelWindowPresetDefinition.ui # QmitkLevelWindowWidget.ui QmitkSliceWidget.ui QmitkTransferFunctionWidget.ui QmitkTransferFunctionGeneratorWidget.ui QmitkSelectableGLWidget.ui QmitkPrimitiveMovieNavigatorWidget.ui QmitkFunctionalityComponentContainerControls.ui QmitkFunctionalityComponents/QmitkThresholdComponentControls.ui QmitkAboutDialog/QmitkAboutDialogGUI.ui QmitkAdaptiveRegionGrowingWidgetControls.ui ) set(QRC_FILES QmitkExt.qrc ) diff --git a/Modules/QmitkExt/resources/HighChartsHistogram.js b/Modules/QmitkExt/resources/HighChartsHistogram.js new file mode 100644 index 0000000000..8b23f75969 --- /dev/null +++ b/Modules/QmitkExt/resources/HighChartsHistogram.js @@ -0,0 +1,150 @@ +/*=================================================================== + +The Medical Imaging Interaction Toolkit (MITK) + +Copyright (c) German Cancer Research Center, +Division of Medical and Biological Informatics. +All rights reserved. + +This software is distributed WITHOUT ANY WARRANTY; without +even the implied warranty of MERCHANTABILITY or FITNESS FOR +A PARTICULAR PURPOSE. + +See LICENSE.txt or http://www.mitk.org for details. + +===================================================================*/ + +var connected = false; +var chart; +var histData; + +if (!connected) +{ + connected = true; + histogramData.DataChanged.connect(updateHistogram); + histogramData.GraphChanged.connect(toggleGraph); +} + +$(function () { + chart = new Highcharts.Chart({ + chart: { + renderTo: 'container', + resetZoomButton: { + position: { + x:-10, + y:10 + }, + relativeTo: 'chart' + }, + animation: { + duration: 1500, + }, + zoomType: 'x' + }, + title: { + text: null + }, + plotOptions: { + column: { + borderWidth: 0.0, + shadow: false, + turboThreshold: 500.0, + enableMouseTracking: false + }, + line: { + shadow: false, + lineWidth: 1.0, + marker: { + enabled: false + }, + stickyTracking: false, + visible: false + } + }, + xAxis: { + title: { + text: null + }, + allowDecimals: false, + endOnTick: true + }, + yAxis: { + title: { + text: null + }, + allowDecimals: false, + endOnTick: true + }, + tooltip: { + shadow: false, + formatter: function() { + if (!histogramData.intensityProfile) + { + return 'Greyvalue: '+this.x+'
'+'Frequency: '+this.y; + } + else + { + return 'Distance: '+Math.round(this.x*100)/100+' mm
'+'Intensity: '+this.y; + } + } + }, + series: [{ + type: 'column', + data: histData, + name: 'Barchart' + }, { + type: 'line', + data: histData, + name: 'Lineplot' + }], + credits: { + enabled: false + }, + navigation: { + buttonOptions: { + enabled: false + } + }, + legend: { + enabled: false + } + }); +}); + +updateHistogram(); + +function updateHistogram() { + if (histogramData.useLineGraph) + { + chart.series[0].hide(); + chart.series[1].show(); + } + else + { + chart.series[0].show(); + chart.series[1].hide(); + } + histData = []; + for (var i = 0; i < histogramData.frequency.length; i++) + { + var tempArray = [histogramData.measurement[i], histogramData.frequency[i]] + histData[i] = tempArray; + } + chart.series[0].setData(histData); + chart.series[1].setData(histData); + chart.redraw(); +} + +function toggleGraph() +{ + if (histogramData.useLineGraph) + { + chart.series[0].hide(); + chart.series[1].show(); + } + else + { + chart.series[0].show(); + chart.series[1].hide(); + } +} diff --git a/Modules/QmitkExt/resources/Histogram.css b/Modules/QmitkExt/resources/Histogram.css new file mode 100644 index 0000000000..88eb703c20 --- /dev/null +++ b/Modules/QmitkExt/resources/Histogram.css @@ -0,0 +1,35 @@ +body { + font: 10px sans-serif; + background-color: rgb(240,240,240) +} + +.bar { + fill: rgb(0,71,185); + shape-rendering: crispEdges; +} + +.line { + fill: none; + stroke: rgb(0,71,185); + stroke-width: 1; +} + +.axis path, .axis line { + fill: none; + stroke: #000; + shape-rendering: crispEdges; +} + +.infobox { + background-color: rgba(255, 255, 255, 0.75); + padding: 10px; + position: absolute; + width: auto; + display: none; +} + +circle { + stroke: rgb(0,71,185); + stroke-width: 1; + fill-opacity: 0; +} diff --git a/Modules/QmitkExt/resources/Histogram.html b/Modules/QmitkExt/resources/Histogram.html new file mode 100644 index 0000000000..09eaf6a574 --- /dev/null +++ b/Modules/QmitkExt/resources/Histogram.html @@ -0,0 +1,15 @@ + + + + Histogram + + + + +
+

+

+
+ + + diff --git a/Modules/QmitkExt/resources/Histogram.js b/Modules/QmitkExt/resources/Histogram.js new file mode 100644 index 0000000000..2e73055140 --- /dev/null +++ b/Modules/QmitkExt/resources/Histogram.js @@ -0,0 +1,539 @@ +/*=================================================================== + +The Medical Imaging Interaction Toolkit (MITK) + +Copyright (c) German Cancer Research Center, +Division of Medical and Biological Informatics. +All rights reserved. + +This software is distributed WITHOUT ANY WARRANTY; without +even the implied warranty of MERCHANTABILITY or FITNESS FOR +A PARTICULAR PURPOSE. + +See LICENSE.txt or http://www.mitk.org for details. + +===================================================================*/ + +var margin = { + top : 10, + bottom : 50, + left : 45, + right : 20, + }; +var height = histogramData.height - margin.top - margin.bottom; +var width = histogramData.width - margin.left - margin.right; +var tension = 0.8; +var connected = false; +var dur = 1000; +var binSize = 10; +var min; +var max; + +/* + * Connecting signals from qt side with JavaScript methods. + */ +if (!connected) +{ + connected = true; + histogramData.SignalDataChanged.connect(updateHistogram); + histogramData.SignalGraphChanged.connect(updateHistogram); +} + +/* + * Predefinition of scales. + */ +var xScale = d3.scale.linear() + .domain([d3.min(histogramData.measurement)-binSize/2,d3.max(histogramData.measurement)+binSize/2]) + .range([0,width]); + +var yScale = d3.scale.linear() + .domain([d3.min(histogramData.frequency),d3.max(histogramData.frequency)]) + .range([height,margin.top]); + +/* + * Predefinition of axis elements. + */ +var xAxis = d3.svg.axis() + .scale(xScale) + .orient("bottom") + .tickFormat(d3.format("s")); + +var yAxis = d3.svg.axis() + .scale(yScale) + .orient("left") + .tickFormat(d3.format("s")); + +/* + * Predefinition of the zoom. + */ +var zoombie = d3.behavior.zoom().x(xScale).scaleExtent([1, 50]).on("zoom", zoom); + +/* + * Creation of the svg element, which holds the complete histogram. + */ +var svg = d3.select("body") + .append("svg") + .attr("class", "svg") + .attr("width", width + margin.right + margin.left) + .attr("height", height + margin.top + margin.bottom) + .append("g") + .attr("transform", "translate (" + margin.left + "," + margin.top + ")") + .call(zoombie) + .on("mousemove", myMouseMove); + +/* + * Appending a rectangle to the svg, to guarantee the possibility + * of zooming on the whole histogram. + */ +svg.append("rect") + .attr("width", width + margin.left + margin.right) + .attr("height", height + margin.top + margin.bottom) + .attr("opacity", 0); + +/* + * Appending a second svg to main svg, which holds only the graph. + */ +var vis = svg.append("svg") + .attr("width", width) + .attr("height", height); + +/* + * Predefinition of the lines. + */ +var line = d3.svg.line() + .interpolate("linear") + .x(function(d,i) { + return xScale(histogramData.measurement[i]-binSize/2); + }) + .y(function(d) { + return yScale(d); + }); + +var linenull = d3.svg.line() + .interpolate("linear") + .x(function(d,i) { + return xScale(histogramData.measurement[i]-binSize/2); + }) + .y(function(d) { + return yScale(0); + }); + +updateHistogram(); + +/* + * Method to update the histogram data + * and to change the displayed graph. + */ +function updateHistogram() +{ + calcBinSize(); + if (!histogramData.useLineGraph) + { + barChart(); + } + else if (histogramData.useLineGraph) + { + linePlot() + } +} + +/* + * Calculation of the bin size. + */ +function calcBinSize() +{ + min = d3.min(histogramData.measurement); + max = d3.max(histogramData.measurement); + binSize = ((max - min) / (histogramData.measurement.length)); +} + +/* + * Method to display histogram as a barchart. + */ +function barChart() +{ + definition(); + + /* + * Change zoom to a fixed y-axis. + */ + zoombie = d3.behavior.zoom().x(xScale).scaleExtent([1, 50]).on("zoom", zoom); + + svg.call(zoombie); + + /* + * Element to animate transition from linegraph to barchart. + */ + vis.selectAll("path.line").remove(); + vis.selectAll("circle").remove(); + + /* + * Definition of the bar elements. + */ + var bar = vis.selectAll("rect.bar").data(histogramData.frequency); + + /* + * Definition how to handle new bar elements. + */ + bar.enter().append("rect") + .attr("class", "bar") + .on("mouseover", myMouseOver) + .on("mouseout", myMouseOut) + .attr("x", function(d,i) { + return xScale(histogramData.measurement[i]-binSize/2); + }) + .attr("y", height) + .attr("height", 0) + .attr("width", barWidth) + + /* + * Definition how to handle changed bar elements. + */ + bar.transition() + .duration(dur) + .attr("x", function(d,i) { + return xScale(histogramData.measurement[i]-binSize/2); + }) + .attr("y", myYPostion) + .attr("height", barHeight) + .attr("width", barWidth); + + /* + * Definition how to handle bar elements which doesn't exist anymore.' + */ + bar.exit() + .transition() + .duration(dur) + .attr("y", height) + .attr("height", 0) + .remove(); + + /* + * Update of axis elements. + * First delete old ones, then generate new. + */ + svg.selectAll("g") + .remove(); + + svg.append("g") + .attr("class", "x axis") + .attr("transform", "translate(0," + height + ")") + .call(xAxis); + + svg.append("g") + .attr("class", "y axis") + .call(yAxis); +} + +/* + * Method to display histogram as a linegraph. + */ +function linePlot() +{ + definition(); + + /* + * Change zoom to a zoomable y-axis. + */ + zoombie = d3.behavior.zoom().x(xScale).y(yScale).scaleExtent([1, 50]).on("zoom", zoom); + + svg.call(zoombie); + /* + * Elements to animate transitions from barchart to linegraph. + * Different transition when an intesity profile is generated. + */ + if(!histogramData.intensityProfile) + { + vis.selectAll("rect.bar") + .transition() + .duration(dur) + .attr("height", 0) + .remove(); + } + else + { + vis.selectAll("rect.bar") + .transition() + .duration(dur) + .attr("y", height) // <-- + .attr("height", 0) + .remove(); + } + + /* + * Creating circle elements, when an intensity profile is generated to show tooltips. + * Due performance losses tooltips are not supported for line histograms. + */ + if(histogramData.intensityProfile) + { + var circles = vis.selectAll("circle").data(histogramData.frequency); + + /* + * Definition how to handle new circle elements. + */ + circles.enter() + .append("circle") + .on("mouseover", myMouseOverLine) + .on("mouseout", myMouseOutLine) + .attr("cx", function(d,i) { + return xScale(histogramData.measurement[i]-binSize/2); + }) + .attr("cy", function (d) { + return yScale(d) + }) + .attr("r", 5) + .attr("opacity", 0) + .style("stroke", "red") + .style("stroke-width", 1) + .style("fill-opacity", 0); + + /* + * Definition how to handle bar elements which doesn't exist anymore. + */ + circles.exit().remove(); + } + else + { + /* + * Removing of all circle elements if a line histogram is generated. + */ + vis.selectAll("circle").remove(); + } + + /* + * Creating a new path element. + */ + var graph = vis.selectAll("path.line") + .data([histogramData.frequency]); + +/* + * Definition how to handle a new path element, using predefined lines. + */ + graph.enter() + .append("path") + .attr("class", "line") + .transition() + .duration(dur) + .attr("d", line); + +/* + * Definition how to handle change points in an existing path element. + */ + graph.transition() + .duration(dur) + .attr("d", line); + + /* + * Update of axis elements. + * First delete old ones, then generate new. + */ + svg.selectAll("g") + .remove(); + + svg.append("g") + .attr("class", "x axis") + .attr("transform", "translate(0," + height + ")") + .call(xAxis); + + svg.append("g") + .attr("class", "y axis") + .call(yAxis); +} + +function definition() +{ +/* + * Match scale to current data. + */ + xScale = d3.scale.linear() + .domain([d3.min(histogramData.measurement)-binSize/2,d3.max(histogramData.measurement)+binSize/2]) + .range([0,width]); + + yScale = d3.scale.linear() + .domain([d3.min(histogramData.frequency),d3.max(histogramData.frequency)]) + .range([height,margin.top]); + +/* + * Match axes to current scale + */ + xAxis = d3.svg.axis() + .scale(xScale) + .orient("bottom") + .tickFormat(d3.format("s")); + + yAxis = d3.svg.axis() + .scale(yScale) + .orient("left") + .tickFormat(d3.format("s")); +} + +/* + * Method to calculate barwidth in px. + */ +function barWidth(d, i) +{ + var bw; + if (i != (histogramData.measurement.length-1)) + { + bw =(xScale(histogramData.measurement[i + 1]) - xScale(histogramData.measurement[i])) * (histogramData.frequency.length / (histogramData.frequency.length + 1)) - 1; + } + else + { + bw =(xScale(histogramData.measurement[i]) - xScale(histogramData.measurement[i - 1])) * (histogramData.frequency.length / (histogramData.frequency.length + 1)) - 1; + } + /* + * Ensure barwidth is not smaller than 1px. + */ + bw = bw > 1 ? bw : 1; + return bw; +} + +/* + * Method to calculate barheight in px. + * Ensure barheight is not smaller than 1px. + */ +function barHeight(d) +{ + var bh; + bh = height - yScale(d); + bh = bh >=2 ? bh : 2; + return bh; +} + +/* + * Method to calculate dynamical y positions. + */ +function myYPostion(d) +{ + var myy = yScale(d); + myy = (height-myy) > 2 ? myy : (height-2); + if (d == 0) + { + return height; + } + return myy; +} + +/* + * Method to fit parameters of bars/line when zoomed. + * Update axes elements. + * Resets the view if scale is 1. + */ +function zoom() +{ + if (zoombie.scale() == 1) + { + zoombie.translate([0,0]); + xScale.domain([d3.min(histogramData.measurement)-binSize/2,d3.max(histogramData.measurement)+binSize/2]); + yScale.domain([d3.min(histogramData.frequency),d3.max(histogramData.frequency)]); + } + if (!histogramData.useLineGraph) + { + svg.select(".x.axis").call(xAxis); + vis.selectAll(".bar") + .attr("width", barWidth) + .attr("x", function(d, i) { + return xScale(histogramData.measurement[i]-binSize/2); + }); + } + else + { + svg.select(".x.axis").call(xAxis); + svg.select(".y.axis").call(yAxis); + vis.selectAll("path.line") + .attr("transform", "translate(" + zoombie.translate() + ")scale(" + zoombie.scale() + ")") + .style("stroke-width", 1 / zoombie.scale()); + vis.selectAll("circle") + .attr("cx", function(d, i) { + return xScale(histogramData.measurement[i]-binSize/2); + }) + .attr("cy", function(d) { + return yScale(d); + }); + } +} + +/* + * Method to show infobox, while mouse is over a bin. + */ +function myMouseOver() +{ + var myBar = d3.select(this); + var reScale = d3.scale.linear() + .domain(xScale.range()) + .range(xScale.domain()); + var y = myBar.data(); + var x = reScale(myBar.attr("x")); + myBar.style("fill", "red"); + d3.select(".infobox").style("display", "block"); + if ((min >= 0) && (max <= 2)) //tooltip for float images + { + d3.select(".measurement").text("Greayvalue: " + (Math.round(x*1000)/1000)); + } + else + { + d3.select(".measurement").text("Greyvalue: " + (Math.round(x*10)/10) + " ... " + (Math.round((x+binSize)*10)/10)); + } + d3.select(".frequency").text("Frequency: " + y); +} + +/* + * Hide infobox, when mouse not over a bin. + */ +function myMouseOut() +{ + var myBar = d3.select(this); + myBar.style("fill", d3.rgb(0,71,185)); + d3.select(".infobox").style("display", "none"); +} + +/* + * Show tooltip, while mouse is over a circle in an intesity profile. + */ +function myMouseOverLine() +{ + var myCircle = d3.select(this) + var reScale = d3.scale.linear() + .domain(xScale.range()) + .range(xScale.domain()); + var y = myCircle.data(); + var x = reScale(myCircle.attr("cx")); + + x = x >= 0 ? x : 0; + + myCircle.attr("opacity", 1); + d3.select(".infobox").style("display", "block"); + d3.select(".measurement").text("Distance: " + (Math.round(x*100)/100) + " mm"); + d3.select(".frequency").text("Intesity: " + y); +} + +/* + * Hide infobox, when mouse not over a circle. + */ +function myMouseOutLine() +{ + var myCircle = d3.select(this); + myCircle.attr("opacity", 0); + d3.select(".infobox").style("display", "none"); +} + +/* + * Update mousecoordinates when mouse is moved. + * Tooltip is shown on the right side of the mouse until it reaches the right boundary, + * the it switches to the left side. + */ +function myMouseMove() +{ + var infobox = d3.select(".infobox"); + var coords = d3.mouse(this); + if ((coords[0]+120)<(width-margin.right)) + { + infobox.style("left", coords[0] + 75 + "px"); + infobox.style("top", coords[1] + "px"); + } + else + { + infobox.style("left", coords[0] - 90 + "px"); + infobox.style("top",coords[1] + "px"); + } +} diff --git a/Modules/QmitkExt/resources/QmitkResources.qrc b/Modules/QmitkExt/resources/QmitkResources.qrc index fbeade59c1..512b8e1678 100644 --- a/Modules/QmitkExt/resources/QmitkResources.qrc +++ b/Modules/QmitkExt/resources/QmitkResources.qrc @@ -1,18 +1,27 @@ Logo_mbiATdkfz_small.png cross.png QmitkStandardViewsDialogBar.xpm play.xpm stop.xpm logo_mint-medical.png Logo_mbiATdkfz_gross.png btnSetPoints.png btnAddPointSet.png btnMoveUp.png btnMoveDown.png btnRemovePoint.png btnSwapSets.png ModuleView.png + Histogram.html + Histogram.js + Histogram.css + d3.v2.js + exporting.js + highcharts.js + jquery-git.js + jquery-ui.js + HighChartsHistogram.js diff --git a/Modules/QmitkExt/resources/d3.v2.js b/Modules/QmitkExt/resources/d3.v2.js new file mode 100644 index 0000000000..fc0503c984 --- /dev/null +++ b/Modules/QmitkExt/resources/d3.v2.js @@ -0,0 +1,7033 @@ +(function() { + function d3_class(ctor, properties) { + try { + for (var key in properties) { + Object.defineProperty(ctor.prototype, key, { + value: properties[key], + enumerable: false + }); + } + } catch (e) { + ctor.prototype = properties; + } + } + function d3_arrayCopy(pseudoarray) { + var i = -1, n = pseudoarray.length, array = []; + while (++i < n) array.push(pseudoarray[i]); + return array; + } + function d3_arraySlice(pseudoarray) { + return Array.prototype.slice.call(pseudoarray); + } + function d3_Map() {} + function d3_identity(d) { + return d; + } + function d3_this() { + return this; + } + function d3_true() { + return true; + } + function d3_functor(v) { + return typeof v === "function" ? v : function() { + return v; + }; + } + function d3_rebind(target, source, method) { + return function() { + var value = method.apply(source, arguments); + return arguments.length ? target : value; + }; + } + function d3_number(x) { + return x != null && !isNaN(x); + } + function d3_zipLength(d) { + return d.length; + } + function d3_splitter(d) { + return d == null; + } + function d3_collapse(s) { + return s.trim().replace(/\s+/g, " "); + } + function d3_range_integerScale(x) { + var k = 1; + while (x * k % 1) k *= 10; + return k; + } + function d3_dispatch() {} + function d3_dispatch_event(dispatch) { + function event() { + var z = listeners, i = -1, n = z.length, l; + while (++i < n) if (l = z[i].on) l.apply(this, arguments); + return dispatch; + } + var listeners = [], listenerByName = new d3_Map; + event.on = function(name, listener) { + var l = listenerByName.get(name), i; + if (arguments.length < 2) return l && l.on; + if (l) { + l.on = null; + listeners = listeners.slice(0, i = listeners.indexOf(l)).concat(listeners.slice(i + 1)); + listenerByName.remove(name); + } + if (listener) listeners.push(listenerByName.set(name, { + on: listener + })); + return dispatch; + }; + return event; + } + function d3_format_precision(x, p) { + return p - (x ? 1 + Math.floor(Math.log(x + Math.pow(10, 1 + Math.floor(Math.log(x) / Math.LN10) - p)) / Math.LN10) : 1); + } + function d3_format_typeDefault(x) { + return x + ""; + } + function d3_format_group(value) { + var i = value.lastIndexOf("."), f = i >= 0 ? value.substring(i) : (i = value.length, ""), t = []; + while (i > 0) t.push(value.substring(i -= 3, i + 3)); + return t.reverse().join(",") + f; + } + function d3_formatPrefix(d, i) { + var k = Math.pow(10, Math.abs(8 - i) * 3); + return { + scale: i > 8 ? function(d) { + return d / k; + } : function(d) { + return d * k; + }, + symbol: d + }; + } + function d3_ease_clamp(f) { + return function(t) { + return t <= 0 ? 0 : t >= 1 ? 1 : f(t); + }; + } + function d3_ease_reverse(f) { + return function(t) { + return 1 - f(1 - t); + }; + } + function d3_ease_reflect(f) { + return function(t) { + return .5 * (t < .5 ? f(2 * t) : 2 - f(2 - 2 * t)); + }; + } + function d3_ease_identity(t) { + return t; + } + function d3_ease_poly(e) { + return function(t) { + return Math.pow(t, e); + }; + } + function d3_ease_sin(t) { + return 1 - Math.cos(t * Math.PI / 2); + } + function d3_ease_exp(t) { + return Math.pow(2, 10 * (t - 1)); + } + function d3_ease_circle(t) { + return 1 - Math.sqrt(1 - t * t); + } + function d3_ease_elastic(a, p) { + var s; + if (arguments.length < 2) p = .45; + if (arguments.length < 1) { + a = 1; + s = p / 4; + } else s = p / (2 * Math.PI) * Math.asin(1 / a); + return function(t) { + return 1 + a * Math.pow(2, 10 * -t) * Math.sin((t - s) * 2 * Math.PI / p); + }; + } + function d3_ease_back(s) { + if (!s) s = 1.70158; + return function(t) { + return t * t * ((s + 1) * t - s); + }; + } + function d3_ease_bounce(t) { + return t < 1 / 2.75 ? 7.5625 * t * t : t < 2 / 2.75 ? 7.5625 * (t -= 1.5 / 2.75) * t + .75 : t < 2.5 / 2.75 ? 7.5625 * (t -= 2.25 / 2.75) * t + .9375 : 7.5625 * (t -= 2.625 / 2.75) * t + .984375; + } + function d3_eventCancel() { + d3.event.stopPropagation(); + d3.event.preventDefault(); + } + function d3_eventSource() { + var e = d3.event, s; + while (s = e.sourceEvent) e = s; + return e; + } + function d3_eventDispatch(target) { + var dispatch = new d3_dispatch, i = 0, n = arguments.length; + while (++i < n) dispatch[arguments[i]] = d3_dispatch_event(dispatch); + dispatch.of = function(thiz, argumentz) { + return function(e1) { + try { + var e0 = e1.sourceEvent = d3.event; + e1.target = target; + d3.event = e1; + dispatch[e1.type].apply(thiz, argumentz); + } finally { + d3.event = e0; + } + }; + }; + return dispatch; + } + function d3_transform(m) { + var r0 = [ m.a, m.b ], r1 = [ m.c, m.d ], kx = d3_transformNormalize(r0), kz = d3_transformDot(r0, r1), ky = d3_transformNormalize(d3_transformCombine(r1, r0, -kz)) || 0; + if (r0[0] * r1[1] < r1[0] * r0[1]) { + r0[0] *= -1; + r0[1] *= -1; + kx *= -1; + kz *= -1; + } + this.rotate = (kx ? Math.atan2(r0[1], r0[0]) : Math.atan2(-r1[0], r1[1])) * d3_transformDegrees; + this.translate = [ m.e, m.f ]; + this.scale = [ kx, ky ]; + this.skew = ky ? Math.atan2(kz, ky) * d3_transformDegrees : 0; + } + function d3_transformDot(a, b) { + return a[0] * b[0] + a[1] * b[1]; + } + function d3_transformNormalize(a) { + var k = Math.sqrt(d3_transformDot(a, a)); + if (k) { + a[0] /= k; + a[1] /= k; + } + return k; + } + function d3_transformCombine(a, b, k) { + a[0] += k * b[0]; + a[1] += k * b[1]; + return a; + } + function d3_interpolateByName(name) { + return name == "transform" ? d3.interpolateTransform : d3.interpolate; + } + function d3_uninterpolateNumber(a, b) { + b = b - (a = +a) ? 1 / (b - a) : 0; + return function(x) { + return (x - a) * b; + }; + } + function d3_uninterpolateClamp(a, b) { + b = b - (a = +a) ? 1 / (b - a) : 0; + return function(x) { + return Math.max(0, Math.min(1, (x - a) * b)); + }; + } + function d3_rgb(r, g, b) { + return new d3_Rgb(r, g, b); + } + function d3_Rgb(r, g, b) { + this.r = r; + this.g = g; + this.b = b; + } + function d3_rgb_hex(v) { + return v < 16 ? "0" + Math.max(0, v).toString(16) : Math.min(255, v).toString(16); + } + function d3_rgb_parse(format, rgb, hsl) { + var r = 0, g = 0, b = 0, m1, m2, name; + m1 = /([a-z]+)\((.*)\)/i.exec(format); + if (m1) { + m2 = m1[2].split(","); + switch (m1[1]) { + case "hsl": + { + return hsl(parseFloat(m2[0]), parseFloat(m2[1]) / 100, parseFloat(m2[2]) / 100); + } + case "rgb": + { + return rgb(d3_rgb_parseNumber(m2[0]), d3_rgb_parseNumber(m2[1]), d3_rgb_parseNumber(m2[2])); + } + } + } + if (name = d3_rgb_names.get(format)) return rgb(name.r, name.g, name.b); + if (format != null && format.charAt(0) === "#") { + if (format.length === 4) { + r = format.charAt(1); + r += r; + g = format.charAt(2); + g += g; + b = format.charAt(3); + b += b; + } else if (format.length === 7) { + r = format.substring(1, 3); + g = format.substring(3, 5); + b = format.substring(5, 7); + } + r = parseInt(r, 16); + g = parseInt(g, 16); + b = parseInt(b, 16); + } + return rgb(r, g, b); + } + function d3_rgb_hsl(r, g, b) { + var min = Math.min(r /= 255, g /= 255, b /= 255), max = Math.max(r, g, b), d = max - min, h, s, l = (max + min) / 2; + if (d) { + s = l < .5 ? d / (max + min) : d / (2 - max - min); + if (r == max) h = (g - b) / d + (g < b ? 6 : 0); else if (g == max) h = (b - r) / d + 2; else h = (r - g) / d + 4; + h *= 60; + } else { + s = h = 0; + } + return d3_hsl(h, s, l); + } + function d3_rgb_lab(r, g, b) { + r = d3_rgb_xyz(r); + g = d3_rgb_xyz(g); + b = d3_rgb_xyz(b); + var x = d3_xyz_lab((.4124564 * r + .3575761 * g + .1804375 * b) / d3_lab_X), y = d3_xyz_lab((.2126729 * r + .7151522 * g + .072175 * b) / d3_lab_Y), z = d3_xyz_lab((.0193339 * r + .119192 * g + .9503041 * b) / d3_lab_Z); + return d3_lab(116 * y - 16, 500 * (x - y), 200 * (y - z)); + } + function d3_rgb_xyz(r) { + return (r /= 255) <= .04045 ? r / 12.92 : Math.pow((r + .055) / 1.055, 2.4); + } + function d3_rgb_parseNumber(c) { + var f = parseFloat(c); + return c.charAt(c.length - 1) === "%" ? Math.round(f * 2.55) : f; + } + function d3_hsl(h, s, l) { + return new d3_Hsl(h, s, l); + } + function d3_Hsl(h, s, l) { + this.h = h; + this.s = s; + this.l = l; + } + function d3_hsl_rgb(h, s, l) { + function v(h) { + if (h > 360) h -= 360; else if (h < 0) h += 360; + if (h < 60) return m1 + (m2 - m1) * h / 60; + if (h < 180) return m2; + if (h < 240) return m1 + (m2 - m1) * (240 - h) / 60; + return m1; + } + function vv(h) { + return Math.round(v(h) * 255); + } + var m1, m2; + h = h % 360; + if (h < 0) h += 360; + s = s < 0 ? 0 : s > 1 ? 1 : s; + l = l < 0 ? 0 : l > 1 ? 1 : l; + m2 = l <= .5 ? l * (1 + s) : l + s - l * s; + m1 = 2 * l - m2; + return d3_rgb(vv(h + 120), vv(h), vv(h - 120)); + } + function d3_hcl(h, c, l) { + return new d3_Hcl(h, c, l); + } + function d3_Hcl(h, c, l) { + this.h = h; + this.c = c; + this.l = l; + } + function d3_hcl_lab(h, c, l) { + return d3_lab(l, Math.cos(h *= Math.PI / 180) * c, Math.sin(h) * c); + } + function d3_lab(l, a, b) { + return new d3_Lab(l, a, b); + } + function d3_Lab(l, a, b) { + this.l = l; + this.a = a; + this.b = b; + } + function d3_lab_rgb(l, a, b) { + var y = (l + 16) / 116, x = y + a / 500, z = y - b / 200; + x = d3_lab_xyz(x) * d3_lab_X; + y = d3_lab_xyz(y) * d3_lab_Y; + z = d3_lab_xyz(z) * d3_lab_Z; + return d3_rgb(d3_xyz_rgb(3.2404542 * x - 1.5371385 * y - .4985314 * z), d3_xyz_rgb(-.969266 * x + 1.8760108 * y + .041556 * z), d3_xyz_rgb(.0556434 * x - .2040259 * y + 1.0572252 * z)); + } + function d3_lab_hcl(l, a, b) { + return d3_hcl(Math.atan2(b, a) / Math.PI * 180, Math.sqrt(a * a + b * b), l); + } + function d3_lab_xyz(x) { + return x > .206893034 ? x * x * x : (x - 4 / 29) / 7.787037; + } + function d3_xyz_lab(x) { + return x > .008856 ? Math.pow(x, 1 / 3) : 7.787037 * x + 4 / 29; + } + function d3_xyz_rgb(r) { + return Math.round(255 * (r <= .00304 ? 12.92 * r : 1.055 * Math.pow(r, 1 / 2.4) - .055)); + } + function d3_selection(groups) { + d3_arraySubclass(groups, d3_selectionPrototype); + return groups; + } + function d3_selection_selector(selector) { + return function() { + return d3_select(selector, this); + }; + } + function d3_selection_selectorAll(selector) { + return function() { + return d3_selectAll(selector, this); + }; + } + function d3_selection_attr(name, value) { + function attrNull() { + this.removeAttribute(name); + } + function attrNullNS() { + this.removeAttributeNS(name.space, name.local); + } + function attrConstant() { + this.setAttribute(name, value); + } + function attrConstantNS() { + this.setAttributeNS(name.space, name.local, value); + } + function attrFunction() { + var x = value.apply(this, arguments); + if (x == null) this.removeAttribute(name); else this.setAttribute(name, x); + } + function attrFunctionNS() { + var x = value.apply(this, arguments); + if (x == null) this.removeAttributeNS(name.space, name.local); else this.setAttributeNS(name.space, name.local, x); + } + name = d3.ns.qualify(name); + return value == null ? name.local ? attrNullNS : attrNull : typeof value === "function" ? name.local ? attrFunctionNS : attrFunction : name.local ? attrConstantNS : attrConstant; + } + function d3_selection_classedRe(name) { + return new RegExp("(?:^|\\s+)" + d3.requote(name) + "(?:\\s+|$)", "g"); + } + function d3_selection_classed(name, value) { + function classedConstant() { + var i = -1; + while (++i < n) name[i](this, value); + } + function classedFunction() { + var i = -1, x = value.apply(this, arguments); + while (++i < n) name[i](this, x); + } + name = name.trim().split(/\s+/).map(d3_selection_classedName); + var n = name.length; + return typeof value === "function" ? classedFunction : classedConstant; + } + function d3_selection_classedName(name) { + var re = d3_selection_classedRe(name); + return function(node, value) { + if (c = node.classList) return value ? c.add(name) : c.remove(name); + var c = node.className, cb = c.baseVal != null, cv = cb ? c.baseVal : c; + if (value) { + re.lastIndex = 0; + if (!re.test(cv)) { + cv = d3_collapse(cv + " " + name); + if (cb) c.baseVal = cv; else node.className = cv; + } + } else if (cv) { + cv = d3_collapse(cv.replace(re, " ")); + if (cb) c.baseVal = cv; else node.className = cv; + } + }; + } + function d3_selection_style(name, value, priority) { + function styleNull() { + this.style.removeProperty(name); + } + function styleConstant() { + this.style.setProperty(name, value, priority); + } + function styleFunction() { + var x = value.apply(this, arguments); + if (x == null) this.style.removeProperty(name); else this.style.setProperty(name, x, priority); + } + return value == null ? styleNull : typeof value === "function" ? styleFunction : styleConstant; + } + function d3_selection_property(name, value) { + function propertyNull() { + delete this[name]; + } + function propertyConstant() { + this[name] = value; + } + function propertyFunction() { + var x = value.apply(this, arguments); + if (x == null) delete this[name]; else this[name] = x; + } + return value == null ? propertyNull : typeof value === "function" ? propertyFunction : propertyConstant; + } + function d3_selection_dataNode(data) { + return { + __data__: data + }; + } + function d3_selection_filter(selector) { + return function() { + return d3_selectMatches(this, selector); + }; + } + function d3_selection_sortComparator(comparator) { + if (!arguments.length) comparator = d3.ascending; + return function(a, b) { + return comparator(a && a.__data__, b && b.__data__); + }; + } + function d3_selection_on(type, listener, capture) { + function onRemove() { + var wrapper = this[name]; + if (wrapper) { + this.removeEventListener(type, wrapper, wrapper.$); + delete this[name]; + } + } + function onAdd() { + function wrapper(e) { + var o = d3.event; + d3.event = e; + args[0] = node.__data__; + try { + listener.apply(node, args); + } finally { + d3.event = o; + } + } + var node = this, args = arguments; + onRemove.call(this); + this.addEventListener(type, this[name] = wrapper, wrapper.$ = capture); + wrapper._ = listener; + } + var name = "__on" + type, i = type.indexOf("."); + if (i > 0) type = type.substring(0, i); + return listener ? onAdd : onRemove; + } + function d3_selection_each(groups, callback) { + for (var j = 0, m = groups.length; j < m; j++) { + for (var group = groups[j], i = 0, n = group.length, node; i < n; i++) { + if (node = group[i]) callback(node, i, j); + } + } + return groups; + } + function d3_selection_enter(selection) { + d3_arraySubclass(selection, d3_selection_enterPrototype); + return selection; + } + function d3_transition(groups, id, time) { + d3_arraySubclass(groups, d3_transitionPrototype); + var tweens = new d3_Map, event = d3.dispatch("start", "end"), ease = d3_transitionEase; + groups.id = id; + groups.time = time; + groups.tween = function(name, tween) { + if (arguments.length < 2) return tweens.get(name); + if (tween == null) tweens.remove(name); else tweens.set(name, tween); + return groups; + }; + groups.ease = function(value) { + if (!arguments.length) return ease; + ease = typeof value === "function" ? value : d3.ease.apply(d3, arguments); + return groups; + }; + groups.each = function(type, listener) { + if (arguments.length < 2) return d3_transition_each.call(groups, type); + event.on(type, listener); + return groups; + }; + d3.timer(function(elapsed) { + return d3_selection_each(groups, function(node, i, j) { + function start(elapsed) { + if (lock.active > id) return stop(); + lock.active = id; + tweens.forEach(function(key, value) { + if (value = value.call(node, d, i)) { + tweened.push(value); + } + }); + event.start.call(node, d, i); + if (!tick(elapsed)) d3.timer(tick, 0, time); + return 1; + } + function tick(elapsed) { + if (lock.active !== id) return stop(); + var t = (elapsed - delay) / duration, e = ease(t), n = tweened.length; + while (n > 0) { + tweened[--n].call(node, e); + } + if (t >= 1) { + stop(); + d3_transitionId = id; + event.end.call(node, d, i); + d3_transitionId = 0; + return 1; + } + } + function stop() { + if (!--lock.count) delete node.__transition__; + return 1; + } + var tweened = [], delay = node.delay, duration = node.duration, lock = (node = node.node).__transition__ || (node.__transition__ = { + active: 0, + count: 0 + }), d = node.__data__; + ++lock.count; + delay <= elapsed ? start(elapsed) : d3.timer(start, delay, time); + }); + }, 0, time); + return groups; + } + function d3_transition_each(callback) { + var id = d3_transitionId, ease = d3_transitionEase, delay = d3_transitionDelay, duration = d3_transitionDuration; + d3_transitionId = this.id; + d3_transitionEase = this.ease(); + d3_selection_each(this, function(node, i, j) { + d3_transitionDelay = node.delay; + d3_transitionDuration = node.duration; + callback.call(node = node.node, node.__data__, i, j); + }); + d3_transitionId = id; + d3_transitionEase = ease; + d3_transitionDelay = delay; + d3_transitionDuration = duration; + return this; + } + function d3_tweenNull(d, i, a) { + return a != "" && d3_tweenRemove; + } + function d3_tweenByName(b, name) { + return d3.tween(b, d3_interpolateByName(name)); + } + function d3_timer_step() { + var elapsed, now = Date.now(), t1 = d3_timer_queue; + while (t1) { + elapsed = now - t1.then; + if (elapsed >= t1.delay) t1.flush = t1.callback(elapsed); + t1 = t1.next; + } + var delay = d3_timer_flush() - now; + if (delay > 24) { + if (isFinite(delay)) { + clearTimeout(d3_timer_timeout); + d3_timer_timeout = setTimeout(d3_timer_step, delay); + } + d3_timer_interval = 0; + } else { + d3_timer_interval = 1; + d3_timer_frame(d3_timer_step); + } + } + function d3_timer_flush() { + var t0 = null, t1 = d3_timer_queue, then = Infinity; + while (t1) { + if (t1.flush) { + t1 = t0 ? t0.next = t1.next : d3_timer_queue = t1.next; + } else { + then = Math.min(then, t1.then + t1.delay); + t1 = (t0 = t1).next; + } + } + return then; + } + function d3_mousePoint(container, e) { + var svg = container.ownerSVGElement || container; + if (svg.createSVGPoint) { + var point = svg.createSVGPoint(); + if (d3_mouse_bug44083 < 0 && (window.scrollX || window.scrollY)) { + svg = d3.select(document.body).append("svg").style("position", "absolute").style("top", 0).style("left", 0); + var ctm = svg[0][0].getScreenCTM(); + d3_mouse_bug44083 = !(ctm.f || ctm.e); + svg.remove(); + } + if (d3_mouse_bug44083) { + point.x = e.pageX; + point.y = e.pageY; + } else { + point.x = e.clientX; + point.y = e.clientY; + } + point = point.matrixTransform(container.getScreenCTM().inverse()); + return [ point.x, point.y ]; + } + var rect = container.getBoundingClientRect(); + return [ e.clientX - rect.left - container.clientLeft, e.clientY - rect.top - container.clientTop ]; + } + function d3_noop() {} + function d3_scaleExtent(domain) { + var start = domain[0], stop = domain[domain.length - 1]; + return start < stop ? [ start, stop ] : [ stop, start ]; + } + function d3_scaleRange(scale) { + return scale.rangeExtent ? scale.rangeExtent() : d3_scaleExtent(scale.range()); + } + function d3_scale_nice(domain, nice) { + var i0 = 0, i1 = domain.length - 1, x0 = domain[i0], x1 = domain[i1], dx; + if (x1 < x0) { + dx = i0, i0 = i1, i1 = dx; + dx = x0, x0 = x1, x1 = dx; + } + if (nice = nice(x1 - x0)) { + domain[i0] = nice.floor(x0); + domain[i1] = nice.ceil(x1); + } + return domain; + } + function d3_scale_niceDefault() { + return Math; + } + function d3_scale_linear(domain, range, interpolate, clamp) { + function rescale() { + var linear = Math.min(domain.length, range.length) > 2 ? d3_scale_polylinear : d3_scale_bilinear, uninterpolate = clamp ? d3_uninterpolateClamp : d3_uninterpolateNumber; + output = linear(domain, range, uninterpolate, interpolate); + input = linear(range, domain, uninterpolate, d3.interpolate); + return scale; + } + function scale(x) { + return output(x); + } + var output, input; + scale.invert = function(y) { + return input(y); + }; + scale.domain = function(x) { + if (!arguments.length) return domain; + domain = x.map(Number); + return rescale(); + }; + scale.range = function(x) { + if (!arguments.length) return range; + range = x; + return rescale(); + }; + scale.rangeRound = function(x) { + return scale.range(x).interpolate(d3.interpolateRound); + }; + scale.clamp = function(x) { + if (!arguments.length) return clamp; + clamp = x; + return rescale(); + }; + scale.interpolate = function(x) { + if (!arguments.length) return interpolate; + interpolate = x; + return rescale(); + }; + scale.ticks = function(m) { + return d3_scale_linearTicks(domain, m); + }; + scale.tickFormat = function(m) { + return d3_scale_linearTickFormat(domain, m); + }; + scale.nice = function() { + d3_scale_nice(domain, d3_scale_linearNice); + return rescale(); + }; + scale.copy = function() { + return d3_scale_linear(domain, range, interpolate, clamp); + }; + return rescale(); + } + function d3_scale_linearRebind(scale, linear) { + return d3.rebind(scale, linear, "range", "rangeRound", "interpolate", "clamp"); + } + function d3_scale_linearNice(dx) { + dx = Math.pow(10, Math.round(Math.log(dx) / Math.LN10) - 1); + return dx && { + floor: function(x) { + return Math.floor(x / dx) * dx; + }, + ceil: function(x) { + return Math.ceil(x / dx) * dx; + } + }; + } + function d3_scale_linearTickRange(domain, m) { + var extent = d3_scaleExtent(domain), span = extent[1] - extent[0], step = Math.pow(10, Math.floor(Math.log(span / m) / Math.LN10)), err = m / span * step; + if (err <= .15) step *= 10; else if (err <= .35) step *= 5; else if (err <= .75) step *= 2; + extent[0] = Math.ceil(extent[0] / step) * step; + extent[1] = Math.floor(extent[1] / step) * step + step * .5; + extent[2] = step; + return extent; + } + function d3_scale_linearTicks(domain, m) { + return d3.range.apply(d3, d3_scale_linearTickRange(domain, m)); + } + function d3_scale_linearTickFormat(domain, m) { + return d3.format(",." + Math.max(0, -Math.floor(Math.log(d3_scale_linearTickRange(domain, m)[2]) / Math.LN10 + .01)) + "f"); + } + function d3_scale_bilinear(domain, range, uninterpolate, interpolate) { + var u = uninterpolate(domain[0], domain[1]), i = interpolate(range[0], range[1]); + return function(x) { + return i(u(x)); + }; + } + function d3_scale_polylinear(domain, range, uninterpolate, interpolate) { + var u = [], i = [], j = 0, k = Math.min(domain.length, range.length) - 1; + if (domain[k] < domain[0]) { + domain = domain.slice().reverse(); + range = range.slice().reverse(); + } + while (++j <= k) { + u.push(uninterpolate(domain[j - 1], domain[j])); + i.push(interpolate(range[j - 1], range[j])); + } + return function(x) { + var j = d3.bisect(domain, x, 1, k) - 1; + return i[j](u[j](x)); + }; + } + function d3_scale_log(linear, log) { + function scale(x) { + return linear(log(x)); + } + var pow = log.pow; + scale.invert = function(x) { + return pow(linear.invert(x)); + }; + scale.domain = function(x) { + if (!arguments.length) return linear.domain().map(pow); + log = x[0] < 0 ? d3_scale_logn : d3_scale_logp; + pow = log.pow; + linear.domain(x.map(log)); + return scale; + }; + scale.nice = function() { + linear.domain(d3_scale_nice(linear.domain(), d3_scale_niceDefault)); + return scale; + }; + scale.ticks = function() { + var extent = d3_scaleExtent(linear.domain()), ticks = []; + if (extent.every(isFinite)) { + var i = Math.floor(extent[0]), j = Math.ceil(extent[1]), u = pow(extent[0]), v = pow(extent[1]); + if (log === d3_scale_logn) { + ticks.push(pow(i)); + for (; i++ < j; ) for (var k = 9; k > 0; k--) ticks.push(pow(i) * k); + } else { + for (; i < j; i++) for (var k = 1; k < 10; k++) ticks.push(pow(i) * k); + ticks.push(pow(i)); + } + for (i = 0; ticks[i] < u; i++) {} + for (j = ticks.length; ticks[j - 1] > v; j--) {} + ticks = ticks.slice(i, j); + } + return ticks; + }; + scale.tickFormat = function(n, format) { + if (arguments.length < 2) format = d3_scale_logFormat; + if (arguments.length < 1) return format; + var k = Math.max(.1, n / scale.ticks().length), f = log === d3_scale_logn ? (e = -1e-12, Math.floor) : (e = 1e-12, Math.ceil), e; + return function(d) { + return d / pow(f(log(d) + e)) <= k ? format(d) : ""; + }; + }; + scale.copy = function() { + return d3_scale_log(linear.copy(), log); + }; + return d3_scale_linearRebind(scale, linear); + } + function d3_scale_logp(x) { + return Math.log(x < 0 ? 0 : x) / Math.LN10; + } + function d3_scale_logn(x) { + return -Math.log(x > 0 ? 0 : -x) / Math.LN10; + } + function d3_scale_pow(linear, exponent) { + function scale(x) { + return linear(powp(x)); + } + var powp = d3_scale_powPow(exponent), powb = d3_scale_powPow(1 / exponent); + scale.invert = function(x) { + return powb(linear.invert(x)); + }; + scale.domain = function(x) { + if (!arguments.length) return linear.domain().map(powb); + linear.domain(x.map(powp)); + return scale; + }; + scale.ticks = function(m) { + return d3_scale_linearTicks(scale.domain(), m); + }; + scale.tickFormat = function(m) { + return d3_scale_linearTickFormat(scale.domain(), m); + }; + scale.nice = function() { + return scale.domain(d3_scale_nice(scale.domain(), d3_scale_linearNice)); + }; + scale.exponent = function(x) { + if (!arguments.length) return exponent; + var domain = scale.domain(); + powp = d3_scale_powPow(exponent = x); + powb = d3_scale_powPow(1 / exponent); + return scale.domain(domain); + }; + scale.copy = function() { + return d3_scale_pow(linear.copy(), exponent); + }; + return d3_scale_linearRebind(scale, linear); + } + function d3_scale_powPow(e) { + return function(x) { + return x < 0 ? -Math.pow(-x, e) : Math.pow(x, e); + }; + } + function d3_scale_ordinal(domain, ranger) { + function scale(x) { + return range[((index.get(x) || index.set(x, domain.push(x))) - 1) % range.length]; + } + function steps(start, step) { + return d3.range(domain.length).map(function(i) { + return start + step * i; + }); + } + var index, range, rangeBand; + scale.domain = function(x) { + if (!arguments.length) return domain; + domain = []; + index = new d3_Map; + var i = -1, n = x.length, xi; + while (++i < n) if (!index.has(xi = x[i])) index.set(xi, domain.push(xi)); + return scale[ranger.t].apply(scale, ranger.a); + }; + scale.range = function(x) { + if (!arguments.length) return range; + range = x; + rangeBand = 0; + ranger = { + t: "range", + a: arguments + }; + return scale; + }; + scale.rangePoints = function(x, padding) { + if (arguments.length < 2) padding = 0; + var start = x[0], stop = x[1], step = (stop - start) / (Math.max(1, domain.length - 1) + padding); + range = steps(domain.length < 2 ? (start + stop) / 2 : start + step * padding / 2, step); + rangeBand = 0; + ranger = { + t: "rangePoints", + a: arguments + }; + return scale; + }; + scale.rangeBands = function(x, padding, outerPadding) { + if (arguments.length < 2) padding = 0; + if (arguments.length < 3) outerPadding = padding; + var reverse = x[1] < x[0], start = x[reverse - 0], stop = x[1 - reverse], step = (stop - start) / (domain.length - padding + 2 * outerPadding); + range = steps(start + step * outerPadding, step); + if (reverse) range.reverse(); + rangeBand = step * (1 - padding); + ranger = { + t: "rangeBands", + a: arguments + }; + return scale; + }; + scale.rangeRoundBands = function(x, padding, outerPadding) { + if (arguments.length < 2) padding = 0; + if (arguments.length < 3) outerPadding = padding; + var reverse = x[1] < x[0], start = x[reverse - 0], stop = x[1 - reverse], step = Math.floor((stop - start) / (domain.length - padding + 2 * outerPadding)), error = stop - start - (domain.length - padding) * step; + range = steps(start + Math.round(error / 2), step); + if (reverse) range.reverse(); + rangeBand = Math.round(step * (1 - padding)); + ranger = { + t: "rangeRoundBands", + a: arguments + }; + return scale; + }; + scale.rangeBand = function() { + return rangeBand; + }; + scale.rangeExtent = function() { + return d3_scaleExtent(ranger.a[0]); + }; + scale.copy = function() { + return d3_scale_ordinal(domain, ranger); + }; + return scale.domain(domain); + } + function d3_scale_quantile(domain, range) { + function rescale() { + var k = 0, n = domain.length, q = range.length; + thresholds = []; + while (++k < q) thresholds[k - 1] = d3.quantile(domain, k / q); + return scale; + } + function scale(x) { + if (isNaN(x = +x)) return NaN; + return range[d3.bisect(thresholds, x)]; + } + var thresholds; + scale.domain = function(x) { + if (!arguments.length) return domain; + domain = x.filter(function(d) { + return !isNaN(d); + }).sort(d3.ascending); + return rescale(); + }; + scale.range = function(x) { + if (!arguments.length) return range; + range = x; + return rescale(); + }; + scale.quantiles = function() { + return thresholds; + }; + scale.copy = function() { + return d3_scale_quantile(domain, range); + }; + return rescale(); + } + function d3_scale_quantize(x0, x1, range) { + function scale(x) { + return range[Math.max(0, Math.min(i, Math.floor(kx * (x - x0))))]; + } + function rescale() { + kx = range.length / (x1 - x0); + i = range.length - 1; + return scale; + } + var kx, i; + scale.domain = function(x) { + if (!arguments.length) return [ x0, x1 ]; + x0 = +x[0]; + x1 = +x[x.length - 1]; + return rescale(); + }; + scale.range = function(x) { + if (!arguments.length) return range; + range = x; + return rescale(); + }; + scale.copy = function() { + return d3_scale_quantize(x0, x1, range); + }; + return rescale(); + } + function d3_scale_threshold(domain, range) { + function scale(x) { + return range[d3.bisect(domain, x)]; + } + scale.domain = function(_) { + if (!arguments.length) return domain; + domain = _; + return scale; + }; + scale.range = function(_) { + if (!arguments.length) return range; + range = _; + return scale; + }; + scale.copy = function() { + return d3_scale_threshold(domain, range); + }; + return scale; + } + function d3_scale_identity(domain) { + function identity(x) { + return +x; + } + identity.invert = identity; + identity.domain = identity.range = function(x) { + if (!arguments.length) return domain; + domain = x.map(identity); + return identity; + }; + identity.ticks = function(m) { + return d3_scale_linearTicks(domain, m); + }; + identity.tickFormat = function(m) { + return d3_scale_linearTickFormat(domain, m); + }; + identity.copy = function() { + return d3_scale_identity(domain); + }; + return identity; + } + function d3_svg_arcInnerRadius(d) { + return d.innerRadius; + } + function d3_svg_arcOuterRadius(d) { + return d.outerRadius; + } + function d3_svg_arcStartAngle(d) { + return d.startAngle; + } + function d3_svg_arcEndAngle(d) { + return d.endAngle; + } + function d3_svg_line(projection) { + function line(data) { + function segment() { + segments.push("M", interpolate(projection(points), tension)); + } + var segments = [], points = [], i = -1, n = data.length, d, fx = d3_functor(x), fy = d3_functor(y); + while (++i < n) { + if (defined.call(this, d = data[i], i)) { + points.push([ +fx.call(this, d, i), +fy.call(this, d, i) ]); + } else if (points.length) { + segment(); + points = []; + } + } + if (points.length) segment(); + return segments.length ? segments.join("") : null; + } + var x = d3_svg_lineX, y = d3_svg_lineY, defined = d3_true, interpolate = d3_svg_lineLinear, interpolateKey = interpolate.key, tension = .7; + line.x = function(_) { + if (!arguments.length) return x; + x = _; + return line; + }; + line.y = function(_) { + if (!arguments.length) return y; + y = _; + return line; + }; + line.defined = function(_) { + if (!arguments.length) return defined; + defined = _; + return line; + }; + line.interpolate = function(_) { + if (!arguments.length) return interpolateKey; + if (typeof _ === "function") interpolateKey = interpolate = _; else interpolateKey = (interpolate = d3_svg_lineInterpolators.get(_) || d3_svg_lineLinear).key; + return line; + }; + line.tension = function(_) { + if (!arguments.length) return tension; + tension = _; + return line; + }; + return line; + } + function d3_svg_lineX(d) { + return d[0]; + } + function d3_svg_lineY(d) { + return d[1]; + } + function d3_svg_lineLinear(points) { + return points.join("L"); + } + function d3_svg_lineLinearClosed(points) { + return d3_svg_lineLinear(points) + "Z"; + } + function d3_svg_lineStepBefore(points) { + var i = 0, n = points.length, p = points[0], path = [ p[0], ",", p[1] ]; + while (++i < n) path.push("V", (p = points[i])[1], "H", p[0]); + return path.join(""); + } + function d3_svg_lineStepAfter(points) { + var i = 0, n = points.length, p = points[0], path = [ p[0], ",", p[1] ]; + while (++i < n) path.push("H", (p = points[i])[0], "V", p[1]); + return path.join(""); + } + function d3_svg_lineCardinalOpen(points, tension) { + return points.length < 4 ? d3_svg_lineLinear(points) : points[1] + d3_svg_lineHermite(points.slice(1, points.length - 1), d3_svg_lineCardinalTangents(points, tension)); + } + function d3_svg_lineCardinalClosed(points, tension) { + return points.length < 3 ? d3_svg_lineLinear(points) : points[0] + d3_svg_lineHermite((points.push(points[0]), points), d3_svg_lineCardinalTangents([ points[points.length - 2] ].concat(points, [ points[1] ]), tension)); + } + function d3_svg_lineCardinal(points, tension, closed) { + return points.length < 3 ? d3_svg_lineLinear(points) : points[0] + d3_svg_lineHermite(points, d3_svg_lineCardinalTangents(points, tension)); + } + function d3_svg_lineHermite(points, tangents) { + if (tangents.length < 1 || points.length != tangents.length && points.length != tangents.length + 2) { + return d3_svg_lineLinear(points); + } + var quad = points.length != tangents.length, path = "", p0 = points[0], p = points[1], t0 = tangents[0], t = t0, pi = 1; + if (quad) { + path += "Q" + (p[0] - t0[0] * 2 / 3) + "," + (p[1] - t0[1] * 2 / 3) + "," + p[0] + "," + p[1]; + p0 = points[1]; + pi = 2; + } + if (tangents.length > 1) { + t = tangents[1]; + p = points[pi]; + pi++; + path += "C" + (p0[0] + t0[0]) + "," + (p0[1] + t0[1]) + "," + (p[0] - t[0]) + "," + (p[1] - t[1]) + "," + p[0] + "," + p[1]; + for (var i = 2; i < tangents.length; i++, pi++) { + p = points[pi]; + t = tangents[i]; + path += "S" + (p[0] - t[0]) + "," + (p[1] - t[1]) + "," + p[0] + "," + p[1]; + } + } + if (quad) { + var lp = points[pi]; + path += "Q" + (p[0] + t[0] * 2 / 3) + "," + (p[1] + t[1] * 2 / 3) + "," + lp[0] + "," + lp[1]; + } + return path; + } + function d3_svg_lineCardinalTangents(points, tension) { + var tangents = [], a = (1 - tension) / 2, p0, p1 = points[0], p2 = points[1], i = 1, n = points.length; + while (++i < n) { + p0 = p1; + p1 = p2; + p2 = points[i]; + tangents.push([ a * (p2[0] - p0[0]), a * (p2[1] - p0[1]) ]); + } + return tangents; + } + function d3_svg_lineBasis(points) { + if (points.length < 3) return d3_svg_lineLinear(points); + var i = 1, n = points.length, pi = points[0], x0 = pi[0], y0 = pi[1], px = [ x0, x0, x0, (pi = points[1])[0] ], py = [ y0, y0, y0, pi[1] ], path = [ x0, ",", y0 ]; + d3_svg_lineBasisBezier(path, px, py); + while (++i < n) { + pi = points[i]; + px.shift(); + px.push(pi[0]); + py.shift(); + py.push(pi[1]); + d3_svg_lineBasisBezier(path, px, py); + } + i = -1; + while (++i < 2) { + px.shift(); + px.push(pi[0]); + py.shift(); + py.push(pi[1]); + d3_svg_lineBasisBezier(path, px, py); + } + return path.join(""); + } + function d3_svg_lineBasisOpen(points) { + if (points.length < 4) return d3_svg_lineLinear(points); + var path = [], i = -1, n = points.length, pi, px = [ 0 ], py = [ 0 ]; + while (++i < 3) { + pi = points[i]; + px.push(pi[0]); + py.push(pi[1]); + } + path.push(d3_svg_lineDot4(d3_svg_lineBasisBezier3, px) + "," + d3_svg_lineDot4(d3_svg_lineBasisBezier3, py)); + --i; + while (++i < n) { + pi = points[i]; + px.shift(); + px.push(pi[0]); + py.shift(); + py.push(pi[1]); + d3_svg_lineBasisBezier(path, px, py); + } + return path.join(""); + } + function d3_svg_lineBasisClosed(points) { + var path, i = -1, n = points.length, m = n + 4, pi, px = [], py = []; + while (++i < 4) { + pi = points[i % n]; + px.push(pi[0]); + py.push(pi[1]); + } + path = [ d3_svg_lineDot4(d3_svg_lineBasisBezier3, px), ",", d3_svg_lineDot4(d3_svg_lineBasisBezier3, py) ]; + --i; + while (++i < m) { + pi = points[i % n]; + px.shift(); + px.push(pi[0]); + py.shift(); + py.push(pi[1]); + d3_svg_lineBasisBezier(path, px, py); + } + return path.join(""); + } + function d3_svg_lineBundle(points, tension) { + var n = points.length - 1; + if (n) { + var x0 = points[0][0], y0 = points[0][1], dx = points[n][0] - x0, dy = points[n][1] - y0, i = -1, p, t; + while (++i <= n) { + p = points[i]; + t = i / n; + p[0] = tension * p[0] + (1 - tension) * (x0 + t * dx); + p[1] = tension * p[1] + (1 - tension) * (y0 + t * dy); + } + } + return d3_svg_lineBasis(points); + } + function d3_svg_lineDot4(a, b) { + return a[0] * b[0] + a[1] * b[1] + a[2] * b[2] + a[3] * b[3]; + } + function d3_svg_lineBasisBezier(path, x, y) { + path.push("C", d3_svg_lineDot4(d3_svg_lineBasisBezier1, x), ",", d3_svg_lineDot4(d3_svg_lineBasisBezier1, y), ",", d3_svg_lineDot4(d3_svg_lineBasisBezier2, x), ",", d3_svg_lineDot4(d3_svg_lineBasisBezier2, y), ",", d3_svg_lineDot4(d3_svg_lineBasisBezier3, x), ",", d3_svg_lineDot4(d3_svg_lineBasisBezier3, y)); + } + function d3_svg_lineSlope(p0, p1) { + return (p1[1] - p0[1]) / (p1[0] - p0[0]); + } + function d3_svg_lineFiniteDifferences(points) { + var i = 0, j = points.length - 1, m = [], p0 = points[0], p1 = points[1], d = m[0] = d3_svg_lineSlope(p0, p1); + while (++i < j) { + m[i] = (d + (d = d3_svg_lineSlope(p0 = p1, p1 = points[i + 1]))) / 2; + } + m[i] = d; + return m; + } + function d3_svg_lineMonotoneTangents(points) { + var tangents = [], d, a, b, s, m = d3_svg_lineFiniteDifferences(points), i = -1, j = points.length - 1; + while (++i < j) { + d = d3_svg_lineSlope(points[i], points[i + 1]); + if (Math.abs(d) < 1e-6) { + m[i] = m[i + 1] = 0; + } else { + a = m[i] / d; + b = m[i + 1] / d; + s = a * a + b * b; + if (s > 9) { + s = d * 3 / Math.sqrt(s); + m[i] = s * a; + m[i + 1] = s * b; + } + } + } + i = -1; + while (++i <= j) { + s = (points[Math.min(j, i + 1)][0] - points[Math.max(0, i - 1)][0]) / (6 * (1 + m[i] * m[i])); + tangents.push([ s || 0, m[i] * s || 0 ]); + } + return tangents; + } + function d3_svg_lineMonotone(points) { + return points.length < 3 ? d3_svg_lineLinear(points) : points[0] + d3_svg_lineHermite(points, d3_svg_lineMonotoneTangents(points)); + } + function d3_svg_lineRadial(points) { + var point, i = -1, n = points.length, r, a; + while (++i < n) { + point = points[i]; + r = point[0]; + a = point[1] + d3_svg_arcOffset; + point[0] = r * Math.cos(a); + point[1] = r * Math.sin(a); + } + return points; + } + function d3_svg_area(projection) { + function area(data) { + function segment() { + segments.push("M", interpolate(projection(points1), tension), L, interpolateReverse(projection(points0.reverse()), tension), "Z"); + } + var segments = [], points0 = [], points1 = [], i = -1, n = data.length, d, fx0 = d3_functor(x0), fy0 = d3_functor(y0), fx1 = x0 === x1 ? function() { + return x; + } : d3_functor(x1), fy1 = y0 === y1 ? function() { + return y; + } : d3_functor(y1), x, y; + while (++i < n) { + if (defined.call(this, d = data[i], i)) { + points0.push([ x = +fx0.call(this, d, i), y = +fy0.call(this, d, i) ]); + points1.push([ +fx1.call(this, d, i), +fy1.call(this, d, i) ]); + } else if (points0.length) { + segment(); + points0 = []; + points1 = []; + } + } + if (points0.length) segment(); + return segments.length ? segments.join("") : null; + } + var x0 = d3_svg_lineX, x1 = d3_svg_lineX, y0 = 0, y1 = d3_svg_lineY, defined = d3_true, interpolate = d3_svg_lineLinear, interpolateKey = interpolate.key, interpolateReverse = interpolate, L = "L", tension = .7; + area.x = function(_) { + if (!arguments.length) return x1; + x0 = x1 = _; + return area; + }; + area.x0 = function(_) { + if (!arguments.length) return x0; + x0 = _; + return area; + }; + area.x1 = function(_) { + if (!arguments.length) return x1; + x1 = _; + return area; + }; + area.y = function(_) { + if (!arguments.length) return y1; + y0 = y1 = _; + return area; + }; + area.y0 = function(_) { + if (!arguments.length) return y0; + y0 = _; + return area; + }; + area.y1 = function(_) { + if (!arguments.length) return y1; + y1 = _; + return area; + }; + area.defined = function(_) { + if (!arguments.length) return defined; + defined = _; + return area; + }; + area.interpolate = function(_) { + if (!arguments.length) return interpolateKey; + if (typeof _ === "function") interpolateKey = interpolate = _; else interpolateKey = (interpolate = d3_svg_lineInterpolators.get(_) || d3_svg_lineLinear).key; + interpolateReverse = interpolate.reverse || interpolate; + L = interpolate.closed ? "M" : "L"; + return area; + }; + area.tension = function(_) { + if (!arguments.length) return tension; + tension = _; + return area; + }; + return area; + } + function d3_svg_chordSource(d) { + return d.source; + } + function d3_svg_chordTarget(d) { + return d.target; + } + function d3_svg_chordRadius(d) { + return d.radius; + } + function d3_svg_chordStartAngle(d) { + return d.startAngle; + } + function d3_svg_chordEndAngle(d) { + return d.endAngle; + } + function d3_svg_diagonalProjection(d) { + return [ d.x, d.y ]; + } + function d3_svg_diagonalRadialProjection(projection) { + return function() { + var d = projection.apply(this, arguments), r = d[0], a = d[1] + d3_svg_arcOffset; + return [ r * Math.cos(a), r * Math.sin(a) ]; + }; + } + function d3_svg_symbolSize() { + return 64; + } + function d3_svg_symbolType() { + return "circle"; + } + function d3_svg_symbolCircle(size) { + var r = Math.sqrt(size / Math.PI); + return "M0," + r + "A" + r + "," + r + " 0 1,1 0," + -r + "A" + r + "," + r + " 0 1,1 0," + r + "Z"; + } + function d3_svg_axisX(selection, x) { + selection.attr("transform", function(d) { + return "translate(" + x(d) + ",0)"; + }); + } + function d3_svg_axisY(selection, y) { + selection.attr("transform", function(d) { + return "translate(0," + y(d) + ")"; + }); + } + function d3_svg_axisSubdivide(scale, ticks, m) { + subticks = []; + if (m && ticks.length > 1) { + var extent = d3_scaleExtent(scale.domain()), subticks, i = -1, n = ticks.length, d = (ticks[1] - ticks[0]) / ++m, j, v; + while (++i < n) { + for (j = m; --j > 0; ) { + if ((v = +ticks[i] - j * d) >= extent[0]) { + subticks.push(v); + } + } + } + for (--i, j = 0; ++j < m && (v = +ticks[i] + j * d) < extent[1]; ) { + subticks.push(v); + } + } + return subticks; + } + function d3_behavior_zoomDelta() { + if (!d3_behavior_zoomDiv) { + d3_behavior_zoomDiv = d3.select("body").append("div").style("visibility", "hidden").style("top", 0).style("height", 0).style("width", 0).style("overflow-y", "scroll").append("div").style("height", "2000px").node().parentNode; + } + var e = d3.event, delta; + try { + d3_behavior_zoomDiv.scrollTop = 1e3; + d3_behavior_zoomDiv.dispatchEvent(e); + delta = 1e3 - d3_behavior_zoomDiv.scrollTop; + } catch (error) { + delta = e.wheelDelta || -e.detail * 5; + } + return delta; + } + function d3_layout_bundlePath(link) { + var start = link.source, end = link.target, lca = d3_layout_bundleLeastCommonAncestor(start, end), points = [ start ]; + while (start !== lca) { + start = start.parent; + points.push(start); + } + var k = points.length; + while (end !== lca) { + points.splice(k, 0, end); + end = end.parent; + } + return points; + } + function d3_layout_bundleAncestors(node) { + var ancestors = [], parent = node.parent; + while (parent != null) { + ancestors.push(node); + node = parent; + parent = parent.parent; + } + ancestors.push(node); + return ancestors; + } + function d3_layout_bundleLeastCommonAncestor(a, b) { + if (a === b) return a; + var aNodes = d3_layout_bundleAncestors(a), bNodes = d3_layout_bundleAncestors(b), aNode = aNodes.pop(), bNode = bNodes.pop(), sharedNode = null; + while (aNode === bNode) { + sharedNode = aNode; + aNode = aNodes.pop(); + bNode = bNodes.pop(); + } + return sharedNode; + } + function d3_layout_forceDragstart(d) { + d.fixed |= 2; + } + function d3_layout_forceDragend(d) { + d.fixed &= 1; + } + function d3_layout_forceMouseover(d) { + d.fixed |= 4; + } + function d3_layout_forceMouseout(d) { + d.fixed &= 3; + } + function d3_layout_forceAccumulate(quad, alpha, charges) { + var cx = 0, cy = 0; + quad.charge = 0; + if (!quad.leaf) { + var nodes = quad.nodes, n = nodes.length, i = -1, c; + while (++i < n) { + c = nodes[i]; + if (c == null) continue; + d3_layout_forceAccumulate(c, alpha, charges); + quad.charge += c.charge; + cx += c.charge * c.cx; + cy += c.charge * c.cy; + } + } + if (quad.point) { + if (!quad.leaf) { + quad.point.x += Math.random() - .5; + quad.point.y += Math.random() - .5; + } + var k = alpha * charges[quad.point.index]; + quad.charge += quad.pointCharge = k; + cx += k * quad.point.x; + cy += k * quad.point.y; + } + quad.cx = cx / quad.charge; + quad.cy = cy / quad.charge; + } + function d3_layout_forceLinkDistance(link) { + return 20; + } + function d3_layout_forceLinkStrength(link) { + return 1; + } + function d3_layout_stackX(d) { + return d.x; + } + function d3_layout_stackY(d) { + return d.y; + } + function d3_layout_stackOut(d, y0, y) { + d.y0 = y0; + d.y = y; + } + function d3_layout_stackOrderDefault(data) { + return d3.range(data.length); + } + function d3_layout_stackOffsetZero(data) { + var j = -1, m = data[0].length, y0 = []; + while (++j < m) y0[j] = 0; + return y0; + } + function d3_layout_stackMaxIndex(array) { + var i = 1, j = 0, v = array[0][1], k, n = array.length; + for (; i < n; ++i) { + if ((k = array[i][1]) > v) { + j = i; + v = k; + } + } + return j; + } + function d3_layout_stackReduceSum(d) { + return d.reduce(d3_layout_stackSum, 0); + } + function d3_layout_stackSum(p, d) { + return p + d[1]; + } + function d3_layout_histogramBinSturges(range, values) { + return d3_layout_histogramBinFixed(range, Math.ceil(Math.log(values.length) / Math.LN2 + 1)); + } + function d3_layout_histogramBinFixed(range, n) { + var x = -1, b = +range[0], m = (range[1] - b) / n, f = []; + while (++x <= n) f[x] = m * x + b; + return f; + } + function d3_layout_histogramRange(values) { + return [ d3.min(values), d3.max(values) ]; + } + function d3_layout_hierarchyRebind(object, hierarchy) { + d3.rebind(object, hierarchy, "sort", "children", "value"); + object.links = d3_layout_hierarchyLinks; + object.nodes = function(d) { + d3_layout_hierarchyInline = true; + return (object.nodes = object)(d); + }; + return object; + } + function d3_layout_hierarchyChildren(d) { + return d.children; + } + function d3_layout_hierarchyValue(d) { + return d.value; + } + function d3_layout_hierarchySort(a, b) { + return b.value - a.value; + } + function d3_layout_hierarchyLinks(nodes) { + return d3.merge(nodes.map(function(parent) { + return (parent.children || []).map(function(child) { + return { + source: parent, + target: child + }; + }); + })); + } + function d3_layout_packSort(a, b) { + return a.value - b.value; + } + function d3_layout_packInsert(a, b) { + var c = a._pack_next; + a._pack_next = b; + b._pack_prev = a; + b._pack_next = c; + c._pack_prev = b; + } + function d3_layout_packSplice(a, b) { + a._pack_next = b; + b._pack_prev = a; + } + function d3_layout_packIntersects(a, b) { + var dx = b.x - a.x, dy = b.y - a.y, dr = a.r + b.r; + return dr * dr - dx * dx - dy * dy > .001; + } + function d3_layout_packSiblings(node) { + function bound(node) { + xMin = Math.min(node.x - node.r, xMin); + xMax = Math.max(node.x + node.r, xMax); + yMin = Math.min(node.y - node.r, yMin); + yMax = Math.max(node.y + node.r, yMax); + } + if (!(nodes = node.children) || !(n = nodes.length)) return; + var nodes, xMin = Infinity, xMax = -Infinity, yMin = Infinity, yMax = -Infinity, a, b, c, i, j, k, n; + nodes.forEach(d3_layout_packLink); + a = nodes[0]; + a.x = -a.r; + a.y = 0; + bound(a); + if (n > 1) { + b = nodes[1]; + b.x = b.r; + b.y = 0; + bound(b); + if (n > 2) { + c = nodes[2]; + d3_layout_packPlace(a, b, c); + bound(c); + d3_layout_packInsert(a, c); + a._pack_prev = c; + d3_layout_packInsert(c, b); + b = a._pack_next; + for (i = 3; i < n; i++) { + d3_layout_packPlace(a, b, c = nodes[i]); + var isect = 0, s1 = 1, s2 = 1; + for (j = b._pack_next; j !== b; j = j._pack_next, s1++) { + if (d3_layout_packIntersects(j, c)) { + isect = 1; + break; + } + } + if (isect == 1) { + for (k = a._pack_prev; k !== j._pack_prev; k = k._pack_prev, s2++) { + if (d3_layout_packIntersects(k, c)) { + break; + } + } + } + if (isect) { + if (s1 < s2 || s1 == s2 && b.r < a.r) d3_layout_packSplice(a, b = j); else d3_layout_packSplice(a = k, b); + i--; + } else { + d3_layout_packInsert(a, c); + b = c; + bound(c); + } + } + } + } + var cx = (xMin + xMax) / 2, cy = (yMin + yMax) / 2, cr = 0; + for (i = 0; i < n; i++) { + c = nodes[i]; + c.x -= cx; + c.y -= cy; + cr = Math.max(cr, c.r + Math.sqrt(c.x * c.x + c.y * c.y)); + } + node.r = cr; + nodes.forEach(d3_layout_packUnlink); + } + function d3_layout_packLink(node) { + node._pack_next = node._pack_prev = node; + } + function d3_layout_packUnlink(node) { + delete node._pack_next; + delete node._pack_prev; + } + function d3_layout_packTransform(node, x, y, k) { + var children = node.children; + node.x = x += k * node.x; + node.y = y += k * node.y; + node.r *= k; + if (children) { + var i = -1, n = children.length; + while (++i < n) d3_layout_packTransform(children[i], x, y, k); + } + } + function d3_layout_packPlace(a, b, c) { + var db = a.r + c.r, dx = b.x - a.x, dy = b.y - a.y; + if (db && (dx || dy)) { + var da = b.r + c.r, dc = dx * dx + dy * dy; + da *= da; + db *= db; + var x = .5 + (db - da) / (2 * dc), y = Math.sqrt(Math.max(0, 2 * da * (db + dc) - (db -= dc) * db - da * da)) / (2 * dc); + c.x = a.x + x * dx + y * dy; + c.y = a.y + x * dy - y * dx; + } else { + c.x = a.x + db; + c.y = a.y; + } + } + function d3_layout_clusterY(children) { + return 1 + d3.max(children, function(child) { + return child.y; + }); + } + function d3_layout_clusterX(children) { + return children.reduce(function(x, child) { + return x + child.x; + }, 0) / children.length; + } + function d3_layout_clusterLeft(node) { + var children = node.children; + return children && children.length ? d3_layout_clusterLeft(children[0]) : node; + } + function d3_layout_clusterRight(node) { + var children = node.children, n; + return children && (n = children.length) ? d3_layout_clusterRight(children[n - 1]) : node; + } + function d3_layout_treeSeparation(a, b) { + return a.parent == b.parent ? 1 : 2; + } + function d3_layout_treeLeft(node) { + var children = node.children; + return children && children.length ? children[0] : node._tree.thread; + } + function d3_layout_treeRight(node) { + var children = node.children, n; + return children && (n = children.length) ? children[n - 1] : node._tree.thread; + } + function d3_layout_treeSearch(node, compare) { + var children = node.children; + if (children && (n = children.length)) { + var child, n, i = -1; + while (++i < n) { + if (compare(child = d3_layout_treeSearch(children[i], compare), node) > 0) { + node = child; + } + } + } + return node; + } + function d3_layout_treeRightmost(a, b) { + return a.x - b.x; + } + function d3_layout_treeLeftmost(a, b) { + return b.x - a.x; + } + function d3_layout_treeDeepest(a, b) { + return a.depth - b.depth; + } + function d3_layout_treeVisitAfter(node, callback) { + function visit(node, previousSibling) { + var children = node.children; + if (children && (n = children.length)) { + var child, previousChild = null, i = -1, n; + while (++i < n) { + child = children[i]; + visit(child, previousChild); + previousChild = child; + } + } + callback(node, previousSibling); + } + visit(node, null); + } + function d3_layout_treeShift(node) { + var shift = 0, change = 0, children = node.children, i = children.length, child; + while (--i >= 0) { + child = children[i]._tree; + child.prelim += shift; + child.mod += shift; + shift += child.shift + (change += child.change); + } + } + function d3_layout_treeMove(ancestor, node, shift) { + ancestor = ancestor._tree; + node = node._tree; + var change = shift / (node.number - ancestor.number); + ancestor.change += change; + node.change -= change; + node.shift += shift; + node.prelim += shift; + node.mod += shift; + } + function d3_layout_treeAncestor(vim, node, ancestor) { + return vim._tree.ancestor.parent == node.parent ? vim._tree.ancestor : ancestor; + } + function d3_layout_treemapPadNull(node) { + return { + x: node.x, + y: node.y, + dx: node.dx, + dy: node.dy + }; + } + function d3_layout_treemapPad(node, padding) { + var x = node.x + padding[3], y = node.y + padding[0], dx = node.dx - padding[1] - padding[3], dy = node.dy - padding[0] - padding[2]; + if (dx < 0) { + x += dx / 2; + dx = 0; + } + if (dy < 0) { + y += dy / 2; + dy = 0; + } + return { + x: x, + y: y, + dx: dx, + dy: dy + }; + } + function d3_dsv(delimiter, mimeType) { + function dsv(url, callback) { + d3.text(url, mimeType, function(text) { + callback(text && dsv.parse(text)); + }); + } + function formatRow(row) { + return row.map(formatValue).join(delimiter); + } + function formatValue(text) { + return reFormat.test(text) ? '"' + text.replace(/\"/g, '""') + '"' : text; + } + var reParse = new RegExp("\r\n|[" + delimiter + "\r\n]", "g"), reFormat = new RegExp('["' + delimiter + "\n]"), delimiterCode = delimiter.charCodeAt(0); + dsv.parse = function(text) { + var header; + return dsv.parseRows(text, function(row, i) { + if (i) { + var o = {}, j = -1, m = header.length; + while (++j < m) o[header[j]] = row[j]; + return o; + } else { + header = row; + return null; + } + }); + }; + dsv.parseRows = function(text, f) { + function token() { + if (reParse.lastIndex >= text.length) return EOF; + if (eol) { + eol = false; + return EOL; + } + var j = reParse.lastIndex; + if (text.charCodeAt(j) === 34) { + var i = j; + while (i++ < text.length) { + if (text.charCodeAt(i) === 34) { + if (text.charCodeAt(i + 1) !== 34) break; + i++; + } + } + reParse.lastIndex = i + 2; + var c = text.charCodeAt(i + 1); + if (c === 13) { + eol = true; + if (text.charCodeAt(i + 2) === 10) reParse.lastIndex++; + } else if (c === 10) { + eol = true; + } + return text.substring(j + 1, i).replace(/""/g, '"'); + } + var m = reParse.exec(text); + if (m) { + eol = m[0].charCodeAt(0) !== delimiterCode; + return text.substring(j, m.index); + } + reParse.lastIndex = text.length; + return text.substring(j); + } + var EOL = {}, EOF = {}, rows = [], n = 0, t, eol; + reParse.lastIndex = 0; + while ((t = token()) !== EOF) { + var a = []; + while (t !== EOL && t !== EOF) { + a.push(t); + t = token(); + } + if (f && !(a = f(a, n++))) continue; + rows.push(a); + } + return rows; + }; + dsv.format = function(rows) { + return rows.map(formatRow).join("\n"); + }; + return dsv; + } + function d3_geo_type(types, defaultValue) { + return function(object) { + return object && types.hasOwnProperty(object.type) ? types[object.type](object) : defaultValue; + }; + } + function d3_path_circle(radius) { + return "m0," + radius + "a" + radius + "," + radius + " 0 1,1 0," + -2 * radius + "a" + radius + "," + radius + " 0 1,1 0," + +2 * radius + "z"; + } + function d3_geo_bounds(o, f) { + if (d3_geo_boundsTypes.hasOwnProperty(o.type)) d3_geo_boundsTypes[o.type](o, f); + } + function d3_geo_boundsFeature(o, f) { + d3_geo_bounds(o.geometry, f); + } + function d3_geo_boundsFeatureCollection(o, f) { + for (var a = o.features, i = 0, n = a.length; i < n; i++) { + d3_geo_bounds(a[i].geometry, f); + } + } + function d3_geo_boundsGeometryCollection(o, f) { + for (var a = o.geometries, i = 0, n = a.length; i < n; i++) { + d3_geo_bounds(a[i], f); + } + } + function d3_geo_boundsLineString(o, f) { + for (var a = o.coordinates, i = 0, n = a.length; i < n; i++) { + f.apply(null, a[i]); + } + } + function d3_geo_boundsMultiLineString(o, f) { + for (var a = o.coordinates, i = 0, n = a.length; i < n; i++) { + for (var b = a[i], j = 0, m = b.length; j < m; j++) { + f.apply(null, b[j]); + } + } + } + function d3_geo_boundsMultiPolygon(o, f) { + for (var a = o.coordinates, i = 0, n = a.length; i < n; i++) { + for (var b = a[i][0], j = 0, m = b.length; j < m; j++) { + f.apply(null, b[j]); + } + } + } + function d3_geo_boundsPoint(o, f) { + f.apply(null, o.coordinates); + } + function d3_geo_boundsPolygon(o, f) { + for (var a = o.coordinates[0], i = 0, n = a.length; i < n; i++) { + f.apply(null, a[i]); + } + } + function d3_geo_greatArcSource(d) { + return d.source; + } + function d3_geo_greatArcTarget(d) { + return d.target; + } + function d3_geo_greatArcInterpolator() { + function interpolate(t) { + var B = Math.sin(t *= d) * k, A = Math.sin(d - t) * k, x = A * kx0 + B * kx1, y = A * ky0 + B * ky1, z = A * sy0 + B * sy1; + return [ Math.atan2(y, x) / d3_geo_radians, Math.atan2(z, Math.sqrt(x * x + y * y)) / d3_geo_radians ]; + } + var x0, y0, cy0, sy0, kx0, ky0, x1, y1, cy1, sy1, kx1, ky1, d, k; + interpolate.distance = function() { + if (d == null) k = 1 / Math.sin(d = Math.acos(Math.max(-1, Math.min(1, sy0 * sy1 + cy0 * cy1 * Math.cos(x1 - x0))))); + return d; + }; + interpolate.source = function(_) { + var cx0 = Math.cos(x0 = _[0] * d3_geo_radians), sx0 = Math.sin(x0); + cy0 = Math.cos(y0 = _[1] * d3_geo_radians); + sy0 = Math.sin(y0); + kx0 = cy0 * cx0; + ky0 = cy0 * sx0; + d = null; + return interpolate; + }; + interpolate.target = function(_) { + var cx1 = Math.cos(x1 = _[0] * d3_geo_radians), sx1 = Math.sin(x1); + cy1 = Math.cos(y1 = _[1] * d3_geo_radians); + sy1 = Math.sin(y1); + kx1 = cy1 * cx1; + ky1 = cy1 * sx1; + d = null; + return interpolate; + }; + return interpolate; + } + function d3_geo_greatArcInterpolate(a, b) { + var i = d3_geo_greatArcInterpolator().source(a).target(b); + i.distance(); + return i; + } + function d3_geom_contourStart(grid) { + var x = 0, y = 0; + while (true) { + if (grid(x, y)) { + return [ x, y ]; + } + if (x === 0) { + x = y + 1; + y = 0; + } else { + x = x - 1; + y = y + 1; + } + } + } + function d3_geom_hullCCW(i1, i2, i3, v) { + var t, a, b, c, d, e, f; + t = v[i1]; + a = t[0]; + b = t[1]; + t = v[i2]; + c = t[0]; + d = t[1]; + t = v[i3]; + e = t[0]; + f = t[1]; + return (f - b) * (c - a) - (d - b) * (e - a) > 0; + } + function d3_geom_polygonInside(p, a, b) { + return (b[0] - a[0]) * (p[1] - a[1]) < (b[1] - a[1]) * (p[0] - a[0]); + } + function d3_geom_polygonIntersect(c, d, a, b) { + var x1 = c[0], x2 = d[0], x3 = a[0], x4 = b[0], y1 = c[1], y2 = d[1], y3 = a[1], y4 = b[1], x13 = x1 - x3, x21 = x2 - x1, x43 = x4 - x3, y13 = y1 - y3, y21 = y2 - y1, y43 = y4 - y3, ua = (x43 * y13 - y43 * x13) / (y43 * x21 - x43 * y21); + return [ x1 + ua * x21, y1 + ua * y21 ]; + } + function d3_voronoi_tessellate(vertices, callback) { + var Sites = { + list: vertices.map(function(v, i) { + return { + index: i, + x: v[0], + y: v[1] + }; + }).sort(function(a, b) { + return a.y < b.y ? -1 : a.y > b.y ? 1 : a.x < b.x ? -1 : a.x > b.x ? 1 : 0; + }), + bottomSite: null + }; + var EdgeList = { + list: [], + leftEnd: null, + rightEnd: null, + init: function() { + EdgeList.leftEnd = EdgeList.createHalfEdge(null, "l"); + EdgeList.rightEnd = EdgeList.createHalfEdge(null, "l"); + EdgeList.leftEnd.r = EdgeList.rightEnd; + EdgeList.rightEnd.l = EdgeList.leftEnd; + EdgeList.list.unshift(EdgeList.leftEnd, EdgeList.rightEnd); + }, + createHalfEdge: function(edge, side) { + return { + edge: edge, + side: side, + vertex: null, + l: null, + r: null + }; + }, + insert: function(lb, he) { + he.l = lb; + he.r = lb.r; + lb.r.l = he; + lb.r = he; + }, + leftBound: function(p) { + var he = EdgeList.leftEnd; + do { + he = he.r; + } while (he != EdgeList.rightEnd && Geom.rightOf(he, p)); + he = he.l; + return he; + }, + del: function(he) { + he.l.r = he.r; + he.r.l = he.l; + he.edge = null; + }, + right: function(he) { + return he.r; + }, + left: function(he) { + return he.l; + }, + leftRegion: function(he) { + return he.edge == null ? Sites.bottomSite : he.edge.region[he.side]; + }, + rightRegion: function(he) { + return he.edge == null ? Sites.bottomSite : he.edge.region[d3_voronoi_opposite[he.side]]; + } + }; + var Geom = { + bisect: function(s1, s2) { + var newEdge = { + region: { + l: s1, + r: s2 + }, + ep: { + l: null, + r: null + } + }; + var dx = s2.x - s1.x, dy = s2.y - s1.y, adx = dx > 0 ? dx : -dx, ady = dy > 0 ? dy : -dy; + newEdge.c = s1.x * dx + s1.y * dy + (dx * dx + dy * dy) * .5; + if (adx > ady) { + newEdge.a = 1; + newEdge.b = dy / dx; + newEdge.c /= dx; + } else { + newEdge.b = 1; + newEdge.a = dx / dy; + newEdge.c /= dy; + } + return newEdge; + }, + intersect: function(el1, el2) { + var e1 = el1.edge, e2 = el2.edge; + if (!e1 || !e2 || e1.region.r == e2.region.r) { + return null; + } + var d = e1.a * e2.b - e1.b * e2.a; + if (Math.abs(d) < 1e-10) { + return null; + } + var xint = (e1.c * e2.b - e2.c * e1.b) / d, yint = (e2.c * e1.a - e1.c * e2.a) / d, e1r = e1.region.r, e2r = e2.region.r, el, e; + if (e1r.y < e2r.y || e1r.y == e2r.y && e1r.x < e2r.x) { + el = el1; + e = e1; + } else { + el = el2; + e = e2; + } + var rightOfSite = xint >= e.region.r.x; + if (rightOfSite && el.side === "l" || !rightOfSite && el.side === "r") { + return null; + } + return { + x: xint, + y: yint + }; + }, + rightOf: function(he, p) { + var e = he.edge, topsite = e.region.r, rightOfSite = p.x > topsite.x; + if (rightOfSite && he.side === "l") { + return 1; + } + if (!rightOfSite && he.side === "r") { + return 0; + } + if (e.a === 1) { + var dyp = p.y - topsite.y, dxp = p.x - topsite.x, fast = 0, above = 0; + if (!rightOfSite && e.b < 0 || rightOfSite && e.b >= 0) { + above = fast = dyp >= e.b * dxp; + } else { + above = p.x + p.y * e.b > e.c; + if (e.b < 0) { + above = !above; + } + if (!above) { + fast = 1; + } + } + if (!fast) { + var dxs = topsite.x - e.region.l.x; + above = e.b * (dxp * dxp - dyp * dyp) < dxs * dyp * (1 + 2 * dxp / dxs + e.b * e.b); + if (e.b < 0) { + above = !above; + } + } + } else { + var yl = e.c - e.a * p.x, t1 = p.y - yl, t2 = p.x - topsite.x, t3 = yl - topsite.y; + above = t1 * t1 > t2 * t2 + t3 * t3; + } + return he.side === "l" ? above : !above; + }, + endPoint: function(edge, side, site) { + edge.ep[side] = site; + if (!edge.ep[d3_voronoi_opposite[side]]) return; + callback(edge); + }, + distance: function(s, t) { + var dx = s.x - t.x, dy = s.y - t.y; + return Math.sqrt(dx * dx + dy * dy); + } + }; + var EventQueue = { + list: [], + insert: function(he, site, offset) { + he.vertex = site; + he.ystar = site.y + offset; + for (var i = 0, list = EventQueue.list, l = list.length; i < l; i++) { + var next = list[i]; + if (he.ystar > next.ystar || he.ystar == next.ystar && site.x > next.vertex.x) { + continue; + } else { + break; + } + } + list.splice(i, 0, he); + }, + del: function(he) { + for (var i = 0, ls = EventQueue.list, l = ls.length; i < l && ls[i] != he; ++i) {} + ls.splice(i, 1); + }, + empty: function() { + return EventQueue.list.length === 0; + }, + nextEvent: function(he) { + for (var i = 0, ls = EventQueue.list, l = ls.length; i < l; ++i) { + if (ls[i] == he) return ls[i + 1]; + } + return null; + }, + min: function() { + var elem = EventQueue.list[0]; + return { + x: elem.vertex.x, + y: elem.ystar + }; + }, + extractMin: function() { + return EventQueue.list.shift(); + } + }; + EdgeList.init(); + Sites.bottomSite = Sites.list.shift(); + var newSite = Sites.list.shift(), newIntStar; + var lbnd, rbnd, llbnd, rrbnd, bisector; + var bot, top, temp, p, v; + var e, pm; + while (true) { + if (!EventQueue.empty()) { + newIntStar = EventQueue.min(); + } + if (newSite && (EventQueue.empty() || newSite.y < newIntStar.y || newSite.y == newIntStar.y && newSite.x < newIntStar.x)) { + lbnd = EdgeList.leftBound(newSite); + rbnd = EdgeList.right(lbnd); + bot = EdgeList.rightRegion(lbnd); + e = Geom.bisect(bot, newSite); + bisector = EdgeList.createHalfEdge(e, "l"); + EdgeList.insert(lbnd, bisector); + p = Geom.intersect(lbnd, bisector); + if (p) { + EventQueue.del(lbnd); + EventQueue.insert(lbnd, p, Geom.distance(p, newSite)); + } + lbnd = bisector; + bisector = EdgeList.createHalfEdge(e, "r"); + EdgeList.insert(lbnd, bisector); + p = Geom.intersect(bisector, rbnd); + if (p) { + EventQueue.insert(bisector, p, Geom.distance(p, newSite)); + } + newSite = Sites.list.shift(); + } else if (!EventQueue.empty()) { + lbnd = EventQueue.extractMin(); + llbnd = EdgeList.left(lbnd); + rbnd = EdgeList.right(lbnd); + rrbnd = EdgeList.right(rbnd); + bot = EdgeList.leftRegion(lbnd); + top = EdgeList.rightRegion(rbnd); + v = lbnd.vertex; + Geom.endPoint(lbnd.edge, lbnd.side, v); + Geom.endPoint(rbnd.edge, rbnd.side, v); + EdgeList.del(lbnd); + EventQueue.del(rbnd); + EdgeList.del(rbnd); + pm = "l"; + if (bot.y > top.y) { + temp = bot; + bot = top; + top = temp; + pm = "r"; + } + e = Geom.bisect(bot, top); + bisector = EdgeList.createHalfEdge(e, pm); + EdgeList.insert(llbnd, bisector); + Geom.endPoint(e, d3_voronoi_opposite[pm], v); + p = Geom.intersect(llbnd, bisector); + if (p) { + EventQueue.del(llbnd); + EventQueue.insert(llbnd, p, Geom.distance(p, bot)); + } + p = Geom.intersect(bisector, rrbnd); + if (p) { + EventQueue.insert(bisector, p, Geom.distance(p, bot)); + } + } else { + break; + } + } + for (lbnd = EdgeList.right(EdgeList.leftEnd); lbnd != EdgeList.rightEnd; lbnd = EdgeList.right(lbnd)) { + callback(lbnd.edge); + } + } + function d3_geom_quadtreeNode() { + return { + leaf: true, + nodes: [], + point: null + }; + } + function d3_geom_quadtreeVisit(f, node, x1, y1, x2, y2) { + if (!f(node, x1, y1, x2, y2)) { + var sx = (x1 + x2) * .5, sy = (y1 + y2) * .5, children = node.nodes; + if (children[0]) d3_geom_quadtreeVisit(f, children[0], x1, y1, sx, sy); + if (children[1]) d3_geom_quadtreeVisit(f, children[1], sx, y1, x2, sy); + if (children[2]) d3_geom_quadtreeVisit(f, children[2], x1, sy, sx, y2); + if (children[3]) d3_geom_quadtreeVisit(f, children[3], sx, sy, x2, y2); + } + } + function d3_geom_quadtreePoint(p) { + return { + x: p[0], + y: p[1] + }; + } + function d3_time_utc() { + this._ = new Date(arguments.length > 1 ? Date.UTC.apply(this, arguments) : arguments[0]); + } + function d3_time_formatAbbreviate(name) { + return name.substring(0, 3); + } + function d3_time_parse(date, template, string, j) { + var c, p, i = 0, n = template.length, m = string.length; + while (i < n) { + if (j >= m) return -1; + c = template.charCodeAt(i++); + if (c == 37) { + p = d3_time_parsers[template.charAt(i++)]; + if (!p || (j = p(date, string, j)) < 0) return -1; + } else if (c != string.charCodeAt(j++)) { + return -1; + } + } + return j; + } + function d3_time_formatRe(names) { + return new RegExp("^(?:" + names.map(d3.requote).join("|") + ")", "i"); + } + function d3_time_formatLookup(names) { + var map = new d3_Map, i = -1, n = names.length; + while (++i < n) map.set(names[i].toLowerCase(), i); + return map; + } + function d3_time_parseWeekdayAbbrev(date, string, i) { + d3_time_dayAbbrevRe.lastIndex = 0; + var n = d3_time_dayAbbrevRe.exec(string.substring(i)); + return n ? i += n[0].length : -1; + } + function d3_time_parseWeekday(date, string, i) { + d3_time_dayRe.lastIndex = 0; + var n = d3_time_dayRe.exec(string.substring(i)); + return n ? i += n[0].length : -1; + } + function d3_time_parseMonthAbbrev(date, string, i) { + d3_time_monthAbbrevRe.lastIndex = 0; + var n = d3_time_monthAbbrevRe.exec(string.substring(i)); + return n ? (date.m = d3_time_monthAbbrevLookup.get(n[0].toLowerCase()), i += n[0].length) : -1; + } + function d3_time_parseMonth(date, string, i) { + d3_time_monthRe.lastIndex = 0; + var n = d3_time_monthRe.exec(string.substring(i)); + return n ? (date.m = d3_time_monthLookup.get(n[0].toLowerCase()), i += n[0].length) : -1; + } + function d3_time_parseLocaleFull(date, string, i) { + return d3_time_parse(date, d3_time_formats.c.toString(), string, i); + } + function d3_time_parseLocaleDate(date, string, i) { + return d3_time_parse(date, d3_time_formats.x.toString(), string, i); + } + function d3_time_parseLocaleTime(date, string, i) { + return d3_time_parse(date, d3_time_formats.X.toString(), string, i); + } + function d3_time_parseFullYear(date, string, i) { + d3_time_numberRe.lastIndex = 0; + var n = d3_time_numberRe.exec(string.substring(i, i + 4)); + return n ? (date.y = +n[0], i += n[0].length) : -1; + } + function d3_time_parseYear(date, string, i) { + d3_time_numberRe.lastIndex = 0; + var n = d3_time_numberRe.exec(string.substring(i, i + 2)); + return n ? (date.y = d3_time_expandYear(+n[0]), i += n[0].length) : -1; + } + function d3_time_expandYear(d) { + return d + (d > 68 ? 1900 : 2e3); + } + function d3_time_parseMonthNumber(date, string, i) { + d3_time_numberRe.lastIndex = 0; + var n = d3_time_numberRe.exec(string.substring(i, i + 2)); + return n ? (date.m = n[0] - 1, i += n[0].length) : -1; + } + function d3_time_parseDay(date, string, i) { + d3_time_numberRe.lastIndex = 0; + var n = d3_time_numberRe.exec(string.substring(i, i + 2)); + return n ? (date.d = +n[0], i += n[0].length) : -1; + } + function d3_time_parseHour24(date, string, i) { + d3_time_numberRe.lastIndex = 0; + var n = d3_time_numberRe.exec(string.substring(i, i + 2)); + return n ? (date.H = +n[0], i += n[0].length) : -1; + } + function d3_time_parseMinutes(date, string, i) { + d3_time_numberRe.lastIndex = 0; + var n = d3_time_numberRe.exec(string.substring(i, i + 2)); + return n ? (date.M = +n[0], i += n[0].length) : -1; + } + function d3_time_parseSeconds(date, string, i) { + d3_time_numberRe.lastIndex = 0; + var n = d3_time_numberRe.exec(string.substring(i, i + 2)); + return n ? (date.S = +n[0], i += n[0].length) : -1; + } + function d3_time_parseMilliseconds(date, string, i) { + d3_time_numberRe.lastIndex = 0; + var n = d3_time_numberRe.exec(string.substring(i, i + 3)); + return n ? (date.L = +n[0], i += n[0].length) : -1; + } + function d3_time_parseAmPm(date, string, i) { + var n = d3_time_amPmLookup.get(string.substring(i, i += 2).toLowerCase()); + return n == null ? -1 : (date.p = n, i); + } + function d3_time_zone(d) { + var z = d.getTimezoneOffset(), zs = z > 0 ? "-" : "+", zh = ~~(Math.abs(z) / 60), zm = Math.abs(z) % 60; + return zs + d3_time_zfill2(zh) + d3_time_zfill2(zm); + } + function d3_time_formatIsoNative(date) { + return date.toISOString(); + } + function d3_time_interval(local, step, number) { + function round(date) { + var d0 = local(date), d1 = offset(d0, 1); + return date - d0 < d1 - date ? d0 : d1; + } + function ceil(date) { + step(date = local(new d3_time(date - 1)), 1); + return date; + } + function offset(date, k) { + step(date = new d3_time(+date), k); + return date; + } + function range(t0, t1, dt) { + var time = ceil(t0), times = []; + if (dt > 1) { + while (time < t1) { + if (!(number(time) % dt)) times.push(new Date(+time)); + step(time, 1); + } + } else { + while (time < t1) times.push(new Date(+time)), step(time, 1); + } + return times; + } + function range_utc(t0, t1, dt) { + try { + d3_time = d3_time_utc; + var utc = new d3_time_utc; + utc._ = t0; + return range(utc, t1, dt); + } finally { + d3_time = Date; + } + } + local.floor = local; + local.round = round; + local.ceil = ceil; + local.offset = offset; + local.range = range; + var utc = local.utc = d3_time_interval_utc(local); + utc.floor = utc; + utc.round = d3_time_interval_utc(round); + utc.ceil = d3_time_interval_utc(ceil); + utc.offset = d3_time_interval_utc(offset); + utc.range = range_utc; + return local; + } + function d3_time_interval_utc(method) { + return function(date, k) { + try { + d3_time = d3_time_utc; + var utc = new d3_time_utc; + utc._ = date; + return method(utc, k)._; + } finally { + d3_time = Date; + } + }; + } + function d3_time_scale(linear, methods, format) { + function scale(x) { + return linear(x); + } + scale.invert = function(x) { + return d3_time_scaleDate(linear.invert(x)); + }; + scale.domain = function(x) { + if (!arguments.length) return linear.domain().map(d3_time_scaleDate); + linear.domain(x); + return scale; + }; + scale.nice = function(m) { + return scale.domain(d3_scale_nice(scale.domain(), function() { + return m; + })); + }; + scale.ticks = function(m, k) { + var extent = d3_time_scaleExtent(scale.domain()); + if (typeof m !== "function") { + var span = extent[1] - extent[0], target = span / m, i = d3.bisect(d3_time_scaleSteps, target); + if (i == d3_time_scaleSteps.length) return methods.year(extent, m); + if (!i) return linear.ticks(m).map(d3_time_scaleDate); + if (Math.log(target / d3_time_scaleSteps[i - 1]) < Math.log(d3_time_scaleSteps[i] / target)) --i; + m = methods[i]; + k = m[1]; + m = m[0].range; + } + return m(extent[0], new Date(+extent[1] + 1), k); + }; + scale.tickFormat = function() { + return format; + }; + scale.copy = function() { + return d3_time_scale(linear.copy(), methods, format); + }; + return d3.rebind(scale, linear, "range", "rangeRound", "interpolate", "clamp"); + } + function d3_time_scaleExtent(domain) { + var start = domain[0], stop = domain[domain.length - 1]; + return start < stop ? [ start, stop ] : [ stop, start ]; + } + function d3_time_scaleDate(t) { + return new Date(t); + } + function d3_time_scaleFormat(formats) { + return function(date) { + var i = formats.length - 1, f = formats[i]; + while (!f[1](date)) f = formats[--i]; + return f[0](date); + }; + } + function d3_time_scaleSetYear(y) { + var d = new Date(y, 0, 1); + d.setFullYear(y); + return d; + } + function d3_time_scaleGetYear(d) { + var y = d.getFullYear(), d0 = d3_time_scaleSetYear(y), d1 = d3_time_scaleSetYear(y + 1); + return y + (d - d0) / (d1 - d0); + } + function d3_time_scaleUTCSetYear(y) { + var d = new Date(Date.UTC(y, 0, 1)); + d.setUTCFullYear(y); + return d; + } + function d3_time_scaleUTCGetYear(d) { + var y = d.getUTCFullYear(), d0 = d3_time_scaleUTCSetYear(y), d1 = d3_time_scaleUTCSetYear(y + 1); + return y + (d - d0) / (d1 - d0); + } + if (!Date.now) Date.now = function() { + return +(new Date); + }; + try { + document.createElement("div").style.setProperty("opacity", 0, ""); + } catch (error) { + var d3_style_prototype = CSSStyleDeclaration.prototype, d3_style_setProperty = d3_style_prototype.setProperty; + d3_style_prototype.setProperty = function(name, value, priority) { + d3_style_setProperty.call(this, name, value + "", priority); + }; + } + d3 = { + version: "2.10.1" + }; + var d3_array = d3_arraySlice; + try { + d3_array(document.documentElement.childNodes)[0].nodeType; + } catch (e) { + d3_array = d3_arrayCopy; + } + var d3_arraySubclass = [].__proto__ ? function(array, prototype) { + array.__proto__ = prototype; + } : function(array, prototype) { + for (var property in prototype) array[property] = prototype[property]; + }; + d3.map = function(object) { + var map = new d3_Map; + for (var key in object) map.set(key, object[key]); + return map; + }; + d3_class(d3_Map, { + has: function(key) { + return d3_map_prefix + key in this; + }, + get: function(key) { + return this[d3_map_prefix + key]; + }, + set: function(key, value) { + return this[d3_map_prefix + key] = value; + }, + remove: function(key) { + key = d3_map_prefix + key; + return key in this && delete this[key]; + }, + keys: function() { + var keys = []; + this.forEach(function(key) { + keys.push(key); + }); + return keys; + }, + values: function() { + var values = []; + this.forEach(function(key, value) { + values.push(value); + }); + return values; + }, + entries: function() { + var entries = []; + this.forEach(function(key, value) { + entries.push({ + key: key, + value: value + }); + }); + return entries; + }, + forEach: function(f) { + for (var key in this) { + if (key.charCodeAt(0) === d3_map_prefixCode) { + f.call(this, key.substring(1), this[key]); + } + } + } + }); + var d3_map_prefix = "\0", d3_map_prefixCode = d3_map_prefix.charCodeAt(0); + d3.functor = d3_functor; + d3.rebind = function(target, source) { + var i = 1, n = arguments.length, method; + while (++i < n) target[method = arguments[i]] = d3_rebind(target, source, source[method]); + return target; + }; + d3.ascending = function(a, b) { + return a < b ? -1 : a > b ? 1 : a >= b ? 0 : NaN; + }; + d3.descending = function(a, b) { + return b < a ? -1 : b > a ? 1 : b >= a ? 0 : NaN; + }; + d3.mean = function(array, f) { + var n = array.length, a, m = 0, i = -1, j = 0; + if (arguments.length === 1) { + while (++i < n) if (d3_number(a = array[i])) m += (a - m) / ++j; + } else { + while (++i < n) if (d3_number(a = f.call(array, array[i], i))) m += (a - m) / ++j; + } + return j ? m : undefined; + }; + d3.median = function(array, f) { + if (arguments.length > 1) array = array.map(f); + array = array.filter(d3_number); + return array.length ? d3.quantile(array.sort(d3.ascending), .5) : undefined; + }; + d3.min = function(array, f) { + var i = -1, n = array.length, a, b; + if (arguments.length === 1) { + while (++i < n && ((a = array[i]) == null || a != a)) a = undefined; + while (++i < n) if ((b = array[i]) != null && a > b) a = b; + } else { + while (++i < n && ((a = f.call(array, array[i], i)) == null || a != a)) a = undefined; + while (++i < n) if ((b = f.call(array, array[i], i)) != null && a > b) a = b; + } + return a; + }; + d3.max = function(array, f) { + var i = -1, n = array.length, a, b; + if (arguments.length === 1) { + while (++i < n && ((a = array[i]) == null || a != a)) a = undefined; + while (++i < n) if ((b = array[i]) != null && b > a) a = b; + } else { + while (++i < n && ((a = f.call(array, array[i], i)) == null || a != a)) a = undefined; + while (++i < n) if ((b = f.call(array, array[i], i)) != null && b > a) a = b; + } + return a; + }; + d3.extent = function(array, f) { + var i = -1, n = array.length, a, b, c; + if (arguments.length === 1) { + while (++i < n && ((a = c = array[i]) == null || a != a)) a = c = undefined; + while (++i < n) if ((b = array[i]) != null) { + if (a > b) a = b; + if (c < b) c = b; + } + } else { + while (++i < n && ((a = c = f.call(array, array[i], i)) == null || a != a)) a = undefined; + while (++i < n) if ((b = f.call(array, array[i], i)) != null) { + if (a > b) a = b; + if (c < b) c = b; + } + } + return [ a, c ]; + }; + d3.random = { + normal: function(µ, σ) { + var n = arguments.length; + if (n < 2) σ = 1; + if (n < 1) µ = 0; + return function() { + var x, y, r; + do { + x = Math.random() * 2 - 1; + y = Math.random() * 2 - 1; + r = x * x + y * y; + } while (!r || r > 1); + return µ + σ * x * Math.sqrt(-2 * Math.log(r) / r); + }; + }, + logNormal: function(µ, σ) { + var n = arguments.length; + if (n < 2) σ = 1; + if (n < 1) µ = 0; + var random = d3.random.normal(); + return function() { + return Math.exp(µ + σ * random()); + }; + }, + irwinHall: function(m) { + return function() { + for (var s = 0, j = 0; j < m; j++) s += Math.random(); + return s / m; + }; + } + }; + d3.sum = function(array, f) { + var s = 0, n = array.length, a, i = -1; + if (arguments.length === 1) { + while (++i < n) if (!isNaN(a = +array[i])) s += a; + } else { + while (++i < n) if (!isNaN(a = +f.call(array, array[i], i))) s += a; + } + return s; + }; + d3.quantile = function(values, p) { + var H = (values.length - 1) * p + 1, h = Math.floor(H), v = values[h - 1], e = H - h; + return e ? v + e * (values[h] - v) : v; + }; + d3.transpose = function(matrix) { + return d3.zip.apply(d3, matrix); + }; + d3.zip = function() { + if (!(n = arguments.length)) return []; + for (var i = -1, m = d3.min(arguments, d3_zipLength), zips = new Array(m); ++i < m; ) { + for (var j = -1, n, zip = zips[i] = new Array(n); ++j < n; ) { + zip[j] = arguments[j][i]; + } + } + return zips; + }; + d3.bisector = function(f) { + return { + left: function(a, x, lo, hi) { + if (arguments.length < 3) lo = 0; + if (arguments.length < 4) hi = a.length; + while (lo < hi) { + var mid = lo + hi >>> 1; + if (f.call(a, a[mid], mid) < x) lo = mid + 1; else hi = mid; + } + return lo; + }, + right: function(a, x, lo, hi) { + if (arguments.length < 3) lo = 0; + if (arguments.length < 4) hi = a.length; + while (lo < hi) { + var mid = lo + hi >>> 1; + if (x < f.call(a, a[mid], mid)) hi = mid; else lo = mid + 1; + } + return lo; + } + }; + }; + var d3_bisector = d3.bisector(function(d) { + return d; + }); + d3.bisectLeft = d3_bisector.left; + d3.bisect = d3.bisectRight = d3_bisector.right; + d3.first = function(array, f) { + var i = 0, n = array.length, a = array[0], b; + if (arguments.length === 1) f = d3.ascending; + while (++i < n) { + if (f.call(array, a, b = array[i]) > 0) { + a = b; + } + } + return a; + }; + d3.last = function(array, f) { + var i = 0, n = array.length, a = array[0], b; + if (arguments.length === 1) f = d3.ascending; + while (++i < n) { + if (f.call(array, a, b = array[i]) <= 0) { + a = b; + } + } + return a; + }; + d3.nest = function() { + function map(array, depth) { + if (depth >= keys.length) return rollup ? rollup.call(nest, array) : sortValues ? array.sort(sortValues) : array; + var i = -1, n = array.length, key = keys[depth++], keyValue, object, valuesByKey = new d3_Map, values, o = {}; + while (++i < n) { + if (values = valuesByKey.get(keyValue = key(object = array[i]))) { + values.push(object); + } else { + valuesByKey.set(keyValue, [ object ]); + } + } + valuesByKey.forEach(function(keyValue, values) { + o[keyValue] = map(values, depth); + }); + return o; + } + function entries(map, depth) { + if (depth >= keys.length) return map; + var a = [], sortKey = sortKeys[depth++], key; + for (key in map) { + a.push({ + key: key, + values: entries(map[key], depth) + }); + } + if (sortKey) a.sort(function(a, b) { + return sortKey(a.key, b.key); + }); + return a; + } + var nest = {}, keys = [], sortKeys = [], sortValues, rollup; + nest.map = function(array) { + return map(array, 0); + }; + nest.entries = function(array) { + return entries(map(array, 0), 0); + }; + nest.key = function(d) { + keys.push(d); + return nest; + }; + nest.sortKeys = function(order) { + sortKeys[keys.length - 1] = order; + return nest; + }; + nest.sortValues = function(order) { + sortValues = order; + return nest; + }; + nest.rollup = function(f) { + rollup = f; + return nest; + }; + return nest; + }; + d3.keys = function(map) { + var keys = []; + for (var key in map) keys.push(key); + return keys; + }; + d3.values = function(map) { + var values = []; + for (var key in map) values.push(map[key]); + return values; + }; + d3.entries = function(map) { + var entries = []; + for (var key in map) entries.push({ + key: key, + value: map[key] + }); + return entries; + }; + d3.permute = function(array, indexes) { + var permutes = [], i = -1, n = indexes.length; + while (++i < n) permutes[i] = array[indexes[i]]; + return permutes; + }; + d3.merge = function(arrays) { + return Array.prototype.concat.apply([], arrays); + }; + d3.split = function(array, f) { + var arrays = [], values = [], value, i = -1, n = array.length; + if (arguments.length < 2) f = d3_splitter; + while (++i < n) { + if (f.call(values, value = array[i], i)) { + values = []; + } else { + if (!values.length) arrays.push(values); + values.push(value); + } + } + return arrays; + }; + d3.range = function(start, stop, step) { + if (arguments.length < 3) { + step = 1; + if (arguments.length < 2) { + stop = start; + start = 0; + } + } + if ((stop - start) / step === Infinity) throw new Error("infinite range"); + var range = [], k = d3_range_integerScale(Math.abs(step)), i = -1, j; + start *= k, stop *= k, step *= k; + if (step < 0) while ((j = start + step * ++i) > stop) range.push(j / k); else while ((j = start + step * ++i) < stop) range.push(j / k); + return range; + }; + d3.requote = function(s) { + return s.replace(d3_requote_re, "\\$&"); + }; + var d3_requote_re = /[\\\^\$\*\+\?\|\[\]\(\)\.\{\}]/g; + d3.round = function(x, n) { + return n ? Math.round(x * (n = Math.pow(10, n))) / n : Math.round(x); + }; + d3.xhr = function(url, mime, callback) { + var req = new XMLHttpRequest; + if (arguments.length < 3) callback = mime, mime = null; else if (mime && req.overrideMimeType) req.overrideMimeType(mime); + req.open("GET", url, true); + if (mime) req.setRequestHeader("Accept", mime); + req.onreadystatechange = function() { + if (req.readyState === 4) { + var s = req.status; + callback(!s && req.response || s >= 200 && s < 300 || s === 304 ? req : null); + } + }; + req.send(null); + }; + d3.text = function(url, mime, callback) { + function ready(req) { + callback(req && req.responseText); + } + if (arguments.length < 3) { + callback = mime; + mime = null; + } + d3.xhr(url, mime, ready); + }; + d3.json = function(url, callback) { + d3.text(url, "application/json", function(text) { + callback(text ? JSON.parse(text) : null); + }); + }; + d3.html = function(url, callback) { + d3.text(url, "text/html", function(text) { + if (text != null) { + var range = document.createRange(); + range.selectNode(document.body); + text = range.createContextualFragment(text); + } + callback(text); + }); + }; + d3.xml = function(url, mime, callback) { + function ready(req) { + callback(req && req.responseXML); + } + if (arguments.length < 3) { + callback = mime; + mime = null; + } + d3.xhr(url, mime, ready); + }; + var d3_nsPrefix = { + svg: "http://www.w3.org/2000/svg", + xhtml: "http://www.w3.org/1999/xhtml", + xlink: "http://www.w3.org/1999/xlink", + xml: "http://www.w3.org/XML/1998/namespace", + xmlns: "http://www.w3.org/2000/xmlns/" + }; + d3.ns = { + prefix: d3_nsPrefix, + qualify: function(name) { + var i = name.indexOf(":"), prefix = name; + if (i >= 0) { + prefix = name.substring(0, i); + name = name.substring(i + 1); + } + return d3_nsPrefix.hasOwnProperty(prefix) ? { + space: d3_nsPrefix[prefix], + local: name + } : name; + } + }; + d3.dispatch = function() { + var dispatch = new d3_dispatch, i = -1, n = arguments.length; + while (++i < n) dispatch[arguments[i]] = d3_dispatch_event(dispatch); + return dispatch; + }; + d3_dispatch.prototype.on = function(type, listener) { + var i = type.indexOf("."), name = ""; + if (i > 0) { + name = type.substring(i + 1); + type = type.substring(0, i); + } + return arguments.length < 2 ? this[type].on(name) : this[type].on(name, listener); + }; + d3.format = function(specifier) { + var match = d3_format_re.exec(specifier), fill = match[1] || " ", sign = match[3] || "", zfill = match[5], width = +match[6], comma = match[7], precision = match[8], type = match[9], scale = 1, suffix = "", integer = false; + if (precision) precision = +precision.substring(1); + if (zfill) { + fill = "0"; + if (comma) width -= Math.floor((width - 1) / 4); + } + switch (type) { + case "n": + comma = true; + type = "g"; + break; + case "%": + scale = 100; + suffix = "%"; + type = "f"; + break; + case "p": + scale = 100; + suffix = "%"; + type = "r"; + break; + case "d": + integer = true; + precision = 0; + break; + case "s": + scale = -1; + type = "r"; + break; + } + if (type == "r" && !precision) type = "g"; + type = d3_format_types.get(type) || d3_format_typeDefault; + return function(value) { + if (integer && value % 1) return ""; + var negative = value < 0 && (value = -value) ? "-" : sign; + if (scale < 0) { + var prefix = d3.formatPrefix(value, precision); + value = prefix.scale(value); + suffix = prefix.symbol; + } else { + value *= scale; + } + value = type(value, precision); + if (zfill) { + var length = value.length + negative.length; + if (length < width) value = (new Array(width - length + 1)).join(fill) + value; + if (comma) value = d3_format_group(value); + value = negative + value; + } else { + if (comma) value = d3_format_group(value); + value = negative + value; + var length = value.length; + if (length < width) value = (new Array(width - length + 1)).join(fill) + value; + } + return value + suffix; + }; + }; + var d3_format_re = /(?:([^{])?([<>=^]))?([+\- ])?(#)?(0)?([0-9]+)?(,)?(\.[0-9]+)?([a-zA-Z%])?/; + var d3_format_types = d3.map({ + g: function(x, p) { + return x.toPrecision(p); + }, + e: function(x, p) { + return x.toExponential(p); + }, + f: function(x, p) { + return x.toFixed(p); + }, + r: function(x, p) { + return d3.round(x, p = d3_format_precision(x, p)).toFixed(Math.max(0, Math.min(20, p))); + } + }); + var d3_formatPrefixes = [ "y", "z", "a", "f", "p", "n", "μ", "m", "", "k", "M", "G", "T", "P", "E", "Z", "Y" ].map(d3_formatPrefix); + d3.formatPrefix = function(value, precision) { + var i = 0; + if (value) { + if (value < 0) value *= -1; + if (precision) value = d3.round(value, d3_format_precision(value, precision)); + i = 1 + Math.floor(1e-12 + Math.log(value) / Math.LN10); + i = Math.max(-24, Math.min(24, Math.floor((i <= 0 ? i + 1 : i - 1) / 3) * 3)); + } + return d3_formatPrefixes[8 + i / 3]; + }; + var d3_ease_quad = d3_ease_poly(2), d3_ease_cubic = d3_ease_poly(3), d3_ease_default = function() { + return d3_ease_identity; + }; + var d3_ease = d3.map({ + linear: d3_ease_default, + poly: d3_ease_poly, + quad: function() { + return d3_ease_quad; + }, + cubic: function() { + return d3_ease_cubic; + }, + sin: function() { + return d3_ease_sin; + }, + exp: function() { + return d3_ease_exp; + }, + circle: function() { + return d3_ease_circle; + }, + elastic: d3_ease_elastic, + back: d3_ease_back, + bounce: function() { + return d3_ease_bounce; + } + }); + var d3_ease_mode = d3.map({ + "in": d3_ease_identity, + out: d3_ease_reverse, + "in-out": d3_ease_reflect, + "out-in": function(f) { + return d3_ease_reflect(d3_ease_reverse(f)); + } + }); + d3.ease = function(name) { + var i = name.indexOf("-"), t = i >= 0 ? name.substring(0, i) : name, m = i >= 0 ? name.substring(i + 1) : "in"; + t = d3_ease.get(t) || d3_ease_default; + m = d3_ease_mode.get(m) || d3_ease_identity; + return d3_ease_clamp(m(t.apply(null, Array.prototype.slice.call(arguments, 1)))); + }; + d3.event = null; + d3.transform = function(string) { + var g = document.createElementNS(d3.ns.prefix.svg, "g"); + return (d3.transform = function(string) { + g.setAttribute("transform", string); + var t = g.transform.baseVal.consolidate(); + return new d3_transform(t ? t.matrix : d3_transformIdentity); + })(string); + }; + d3_transform.prototype.toString = function() { + return "translate(" + this.translate + ")rotate(" + this.rotate + ")skewX(" + this.skew + ")scale(" + this.scale + ")"; + }; + var d3_transformDegrees = 180 / Math.PI, d3_transformIdentity = { + a: 1, + b: 0, + c: 0, + d: 1, + e: 0, + f: 0 + }; + d3.interpolate = function(a, b) { + var i = d3.interpolators.length, f; + while (--i >= 0 && !(f = d3.interpolators[i](a, b))) ; + return f; + }; + d3.interpolateNumber = function(a, b) { + b -= a; + return function(t) { + return a + b * t; + }; + }; + d3.interpolateRound = function(a, b) { + b -= a; + return function(t) { + return Math.round(a + b * t); + }; + }; + d3.interpolateString = function(a, b) { + var m, i, j, s0 = 0, s1 = 0, s = [], q = [], n, o; + d3_interpolate_number.lastIndex = 0; + for (i = 0; m = d3_interpolate_number.exec(b); ++i) { + if (m.index) s.push(b.substring(s0, s1 = m.index)); + q.push({ + i: s.length, + x: m[0] + }); + s.push(null); + s0 = d3_interpolate_number.lastIndex; + } + if (s0 < b.length) s.push(b.substring(s0)); + for (i = 0, n = q.length; (m = d3_interpolate_number.exec(a)) && i < n; ++i) { + o = q[i]; + if (o.x == m[0]) { + if (o.i) { + if (s[o.i + 1] == null) { + s[o.i - 1] += o.x; + s.splice(o.i, 1); + for (j = i + 1; j < n; ++j) q[j].i--; + } else { + s[o.i - 1] += o.x + s[o.i + 1]; + s.splice(o.i, 2); + for (j = i + 1; j < n; ++j) q[j].i -= 2; + } + } else { + if (s[o.i + 1] == null) { + s[o.i] = o.x; + } else { + s[o.i] = o.x + s[o.i + 1]; + s.splice(o.i + 1, 1); + for (j = i + 1; j < n; ++j) q[j].i--; + } + } + q.splice(i, 1); + n--; + i--; + } else { + o.x = d3.interpolateNumber(parseFloat(m[0]), parseFloat(o.x)); + } + } + while (i < n) { + o = q.pop(); + if (s[o.i + 1] == null) { + s[o.i] = o.x; + } else { + s[o.i] = o.x + s[o.i + 1]; + s.splice(o.i + 1, 1); + } + n--; + } + if (s.length === 1) { + return s[0] == null ? q[0].x : function() { + return b; + }; + } + return function(t) { + for (i = 0; i < n; ++i) s[(o = q[i]).i] = o.x(t); + return s.join(""); + }; + }; + d3.interpolateTransform = function(a, b) { + var s = [], q = [], n, A = d3.transform(a), B = d3.transform(b), ta = A.translate, tb = B.translate, ra = A.rotate, rb = B.rotate, wa = A.skew, wb = B.skew, ka = A.scale, kb = B.scale; + if (ta[0] != tb[0] || ta[1] != tb[1]) { + s.push("translate(", null, ",", null, ")"); + q.push({ + i: 1, + x: d3.interpolateNumber(ta[0], tb[0]) + }, { + i: 3, + x: d3.interpolateNumber(ta[1], tb[1]) + }); + } else if (tb[0] || tb[1]) { + s.push("translate(" + tb + ")"); + } else { + s.push(""); + } + if (ra != rb) { + if (ra - rb > 180) rb += 360; else if (rb - ra > 180) ra += 360; + q.push({ + i: s.push(s.pop() + "rotate(", null, ")") - 2, + x: d3.interpolateNumber(ra, rb) + }); + } else if (rb) { + s.push(s.pop() + "rotate(" + rb + ")"); + } + if (wa != wb) { + q.push({ + i: s.push(s.pop() + "skewX(", null, ")") - 2, + x: d3.interpolateNumber(wa, wb) + }); + } else if (wb) { + s.push(s.pop() + "skewX(" + wb + ")"); + } + if (ka[0] != kb[0] || ka[1] != kb[1]) { + n = s.push(s.pop() + "scale(", null, ",", null, ")"); + q.push({ + i: n - 4, + x: d3.interpolateNumber(ka[0], kb[0]) + }, { + i: n - 2, + x: d3.interpolateNumber(ka[1], kb[1]) + }); + } else if (kb[0] != 1 || kb[1] != 1) { + s.push(s.pop() + "scale(" + kb + ")"); + } + n = q.length; + return function(t) { + var i = -1, o; + while (++i < n) s[(o = q[i]).i] = o.x(t); + return s.join(""); + }; + }; + d3.interpolateRgb = function(a, b) { + a = d3.rgb(a); + b = d3.rgb(b); + var ar = a.r, ag = a.g, ab = a.b, br = b.r - ar, bg = b.g - ag, bb = b.b - ab; + return function(t) { + return "#" + d3_rgb_hex(Math.round(ar + br * t)) + d3_rgb_hex(Math.round(ag + bg * t)) + d3_rgb_hex(Math.round(ab + bb * t)); + }; + }; + d3.interpolateHsl = function(a, b) { + a = d3.hsl(a); + b = d3.hsl(b); + var h0 = a.h, s0 = a.s, l0 = a.l, h1 = b.h - h0, s1 = b.s - s0, l1 = b.l - l0; + if (h1 > 180) h1 -= 360; else if (h1 < -180) h1 += 360; + return function(t) { + return d3_hsl_rgb(h0 + h1 * t, s0 + s1 * t, l0 + l1 * t) + ""; + }; + }; + d3.interpolateLab = function(a, b) { + a = d3.lab(a); + b = d3.lab(b); + var al = a.l, aa = a.a, ab = a.b, bl = b.l - al, ba = b.a - aa, bb = b.b - ab; + return function(t) { + return d3_lab_rgb(al + bl * t, aa + ba * t, ab + bb * t) + ""; + }; + }; + d3.interpolateHcl = function(a, b) { + a = d3.hcl(a); + b = d3.hcl(b); + var ah = a.h, ac = a.c, al = a.l, bh = b.h - ah, bc = b.c - ac, bl = b.l - al; + if (bh > 180) bh -= 360; else if (bh < -180) bh += 360; + return function(t) { + return d3_hcl_lab(ah + bh * t, ac + bc * t, al + bl * t) + ""; + }; + }; + d3.interpolateArray = function(a, b) { + var x = [], c = [], na = a.length, nb = b.length, n0 = Math.min(a.length, b.length), i; + for (i = 0; i < n0; ++i) x.push(d3.interpolate(a[i], b[i])); + for (; i < na; ++i) c[i] = a[i]; + for (; i < nb; ++i) c[i] = b[i]; + return function(t) { + for (i = 0; i < n0; ++i) c[i] = x[i](t); + return c; + }; + }; + d3.interpolateObject = function(a, b) { + var i = {}, c = {}, k; + for (k in a) { + if (k in b) { + i[k] = d3_interpolateByName(k)(a[k], b[k]); + } else { + c[k] = a[k]; + } + } + for (k in b) { + if (!(k in a)) { + c[k] = b[k]; + } + } + return function(t) { + for (k in i) c[k] = i[k](t); + return c; + }; + }; + var d3_interpolate_number = /[-+]?(?:\d+\.?\d*|\.?\d+)(?:[eE][-+]?\d+)?/g; + d3.interpolators = [ d3.interpolateObject, function(a, b) { + return b instanceof Array && d3.interpolateArray(a, b); + }, function(a, b) { + return (typeof a === "string" || typeof b === "string") && d3.interpolateString(a + "", b + ""); + }, function(a, b) { + return (typeof b === "string" ? d3_rgb_names.has(b) || /^(#|rgb\(|hsl\()/.test(b) : b instanceof d3_Rgb || b instanceof d3_Hsl) && d3.interpolateRgb(a, b); + }, function(a, b) { + return !isNaN(a = +a) && !isNaN(b = +b) && d3.interpolateNumber(a, b); + } ]; + d3.rgb = function(r, g, b) { + return arguments.length === 1 ? r instanceof d3_Rgb ? d3_rgb(r.r, r.g, r.b) : d3_rgb_parse("" + r, d3_rgb, d3_hsl_rgb) : d3_rgb(~~r, ~~g, ~~b); + }; + d3_Rgb.prototype.brighter = function(k) { + k = Math.pow(.7, arguments.length ? k : 1); + var r = this.r, g = this.g, b = this.b, i = 30; + if (!r && !g && !b) return d3_rgb(i, i, i); + if (r && r < i) r = i; + if (g && g < i) g = i; + if (b && b < i) b = i; + return d3_rgb(Math.min(255, Math.floor(r / k)), Math.min(255, Math.floor(g / k)), Math.min(255, Math.floor(b / k))); + }; + d3_Rgb.prototype.darker = function(k) { + k = Math.pow(.7, arguments.length ? k : 1); + return d3_rgb(Math.floor(k * this.r), Math.floor(k * this.g), Math.floor(k * this.b)); + }; + d3_Rgb.prototype.hsl = function() { + return d3_rgb_hsl(this.r, this.g, this.b); + }; + d3_Rgb.prototype.toString = function() { + return "#" + d3_rgb_hex(this.r) + d3_rgb_hex(this.g) + d3_rgb_hex(this.b); + }; + var d3_rgb_names = d3.map({ + aliceblue: "#f0f8ff", + antiquewhite: "#faebd7", + aqua: "#00ffff", + aquamarine: "#7fffd4", + azure: "#f0ffff", + beige: "#f5f5dc", + bisque: "#ffe4c4", + black: "#000000", + blanchedalmond: "#ffebcd", + blue: "#0000ff", + blueviolet: "#8a2be2", + brown: "#a52a2a", + burlywood: "#deb887", + cadetblue: "#5f9ea0", + chartreuse: "#7fff00", + chocolate: "#d2691e", + coral: "#ff7f50", + cornflowerblue: "#6495ed", + cornsilk: "#fff8dc", + crimson: "#dc143c", + cyan: "#00ffff", + darkblue: "#00008b", + darkcyan: "#008b8b", + darkgoldenrod: "#b8860b", + darkgray: "#a9a9a9", + darkgreen: "#006400", + darkgrey: "#a9a9a9", + darkkhaki: "#bdb76b", + darkmagenta: "#8b008b", + darkolivegreen: "#556b2f", + darkorange: "#ff8c00", + darkorchid: "#9932cc", + darkred: "#8b0000", + darksalmon: "#e9967a", + darkseagreen: "#8fbc8f", + darkslateblue: "#483d8b", + darkslategray: "#2f4f4f", + darkslategrey: "#2f4f4f", + darkturquoise: "#00ced1", + darkviolet: "#9400d3", + deeppink: "#ff1493", + deepskyblue: "#00bfff", + dimgray: "#696969", + dimgrey: "#696969", + dodgerblue: "#1e90ff", + firebrick: "#b22222", + floralwhite: "#fffaf0", + forestgreen: "#228b22", + fuchsia: "#ff00ff", + gainsboro: "#dcdcdc", + ghostwhite: "#f8f8ff", + gold: "#ffd700", + goldenrod: "#daa520", + gray: "#808080", + green: "#008000", + greenyellow: "#adff2f", + grey: "#808080", + honeydew: "#f0fff0", + hotpink: "#ff69b4", + indianred: "#cd5c5c", + indigo: "#4b0082", + ivory: "#fffff0", + khaki: "#f0e68c", + lavender: "#e6e6fa", + lavenderblush: "#fff0f5", + lawngreen: "#7cfc00", + lemonchiffon: "#fffacd", + lightblue: "#add8e6", + lightcoral: "#f08080", + lightcyan: "#e0ffff", + lightgoldenrodyellow: "#fafad2", + lightgray: "#d3d3d3", + lightgreen: "#90ee90", + lightgrey: "#d3d3d3", + lightpink: "#ffb6c1", + lightsalmon: "#ffa07a", + lightseagreen: "#20b2aa", + lightskyblue: "#87cefa", + lightslategray: "#778899", + lightslategrey: "#778899", + lightsteelblue: "#b0c4de", + lightyellow: "#ffffe0", + lime: "#00ff00", + limegreen: "#32cd32", + linen: "#faf0e6", + magenta: "#ff00ff", + maroon: "#800000", + mediumaquamarine: "#66cdaa", + mediumblue: "#0000cd", + mediumorchid: "#ba55d3", + mediumpurple: "#9370db", + mediumseagreen: "#3cb371", + mediumslateblue: "#7b68ee", + mediumspringgreen: "#00fa9a", + mediumturquoise: "#48d1cc", + mediumvioletred: "#c71585", + midnightblue: "#191970", + mintcream: "#f5fffa", + mistyrose: "#ffe4e1", + moccasin: "#ffe4b5", + navajowhite: "#ffdead", + navy: "#000080", + oldlace: "#fdf5e6", + olive: "#808000", + olivedrab: "#6b8e23", + orange: "#ffa500", + orangered: "#ff4500", + orchid: "#da70d6", + palegoldenrod: "#eee8aa", + palegreen: "#98fb98", + paleturquoise: "#afeeee", + palevioletred: "#db7093", + papayawhip: "#ffefd5", + peachpuff: "#ffdab9", + peru: "#cd853f", + pink: "#ffc0cb", + plum: "#dda0dd", + powderblue: "#b0e0e6", + purple: "#800080", + red: "#ff0000", + rosybrown: "#bc8f8f", + royalblue: "#4169e1", + saddlebrown: "#8b4513", + salmon: "#fa8072", + sandybrown: "#f4a460", + seagreen: "#2e8b57", + seashell: "#fff5ee", + sienna: "#a0522d", + silver: "#c0c0c0", + skyblue: "#87ceeb", + slateblue: "#6a5acd", + slategray: "#708090", + slategrey: "#708090", + snow: "#fffafa", + springgreen: "#00ff7f", + steelblue: "#4682b4", + tan: "#d2b48c", + teal: "#008080", + thistle: "#d8bfd8", + tomato: "#ff6347", + turquoise: "#40e0d0", + violet: "#ee82ee", + wheat: "#f5deb3", + white: "#ffffff", + whitesmoke: "#f5f5f5", + yellow: "#ffff00", + yellowgreen: "#9acd32" + }); + d3_rgb_names.forEach(function(key, value) { + d3_rgb_names.set(key, d3_rgb_parse(value, d3_rgb, d3_hsl_rgb)); + }); + d3.hsl = function(h, s, l) { + return arguments.length === 1 ? h instanceof d3_Hsl ? d3_hsl(h.h, h.s, h.l) : d3_rgb_parse("" + h, d3_rgb_hsl, d3_hsl) : d3_hsl(+h, +s, +l); + }; + d3_Hsl.prototype.brighter = function(k) { + k = Math.pow(.7, arguments.length ? k : 1); + return d3_hsl(this.h, this.s, this.l / k); + }; + d3_Hsl.prototype.darker = function(k) { + k = Math.pow(.7, arguments.length ? k : 1); + return d3_hsl(this.h, this.s, k * this.l); + }; + d3_Hsl.prototype.rgb = function() { + return d3_hsl_rgb(this.h, this.s, this.l); + }; + d3_Hsl.prototype.toString = function() { + return this.rgb().toString(); + }; + d3.hcl = function(h, c, l) { + return arguments.length === 1 ? h instanceof d3_Hcl ? d3_hcl(h.h, h.c, h.l) : h instanceof d3_Lab ? d3_lab_hcl(h.l, h.a, h.b) : d3_lab_hcl((h = d3_rgb_lab((h = d3.rgb(h)).r, h.g, h.b)).l, h.a, h.b) : d3_hcl(+h, +c, +l); + }; + d3_Hcl.prototype.brighter = function(k) { + return d3_hcl(this.h, this.c, Math.min(100, this.l + d3_lab_K * (arguments.length ? k : 1))); + }; + d3_Hcl.prototype.darker = function(k) { + return d3_hcl(this.h, this.c, Math.max(0, this.l - d3_lab_K * (arguments.length ? k : 1))); + }; + d3_Hcl.prototype.rgb = function() { + return d3_hcl_lab(this.h, this.c, this.l).rgb(); + }; + d3_Hcl.prototype.toString = function() { + return this.rgb() + ""; + }; + d3.lab = function(l, a, b) { + return arguments.length === 1 ? l instanceof d3_Lab ? d3_lab(l.l, l.a, l.b) : l instanceof d3_Hcl ? d3_hcl_lab(l.l, l.c, l.h) : d3_rgb_lab((l = d3.rgb(l)).r, l.g, l.b) : d3_lab(+l, +a, +b); + }; + var d3_lab_K = 18; + var d3_lab_X = .95047, d3_lab_Y = 1, d3_lab_Z = 1.08883; + d3_Lab.prototype.brighter = function(k) { + return d3_lab(Math.min(100, this.l + d3_lab_K * (arguments.length ? k : 1)), this.a, this.b); + }; + d3_Lab.prototype.darker = function(k) { + return d3_lab(Math.max(0, this.l - d3_lab_K * (arguments.length ? k : 1)), this.a, this.b); + }; + d3_Lab.prototype.rgb = function() { + return d3_lab_rgb(this.l, this.a, this.b); + }; + d3_Lab.prototype.toString = function() { + return this.rgb() + ""; + }; + var d3_select = function(s, n) { + return n.querySelector(s); + }, d3_selectAll = function(s, n) { + return n.querySelectorAll(s); + }, d3_selectRoot = document.documentElement, d3_selectMatcher = d3_selectRoot.matchesSelector || d3_selectRoot.webkitMatchesSelector || d3_selectRoot.mozMatchesSelector || d3_selectRoot.msMatchesSelector || d3_selectRoot.oMatchesSelector, d3_selectMatches = function(n, s) { + return d3_selectMatcher.call(n, s); + }; + if (typeof Sizzle === "function") { + d3_select = function(s, n) { + return Sizzle(s, n)[0] || null; + }; + d3_selectAll = function(s, n) { + return Sizzle.uniqueSort(Sizzle(s, n)); + }; + d3_selectMatches = Sizzle.matchesSelector; + } + var d3_selectionPrototype = []; + d3.selection = function() { + return d3_selectionRoot; + }; + d3.selection.prototype = d3_selectionPrototype; + d3_selectionPrototype.select = function(selector) { + var subgroups = [], subgroup, subnode, group, node; + if (typeof selector !== "function") selector = d3_selection_selector(selector); + for (var j = -1, m = this.length; ++j < m; ) { + subgroups.push(subgroup = []); + subgroup.parentNode = (group = this[j]).parentNode; + for (var i = -1, n = group.length; ++i < n; ) { + if (node = group[i]) { + subgroup.push(subnode = selector.call(node, node.__data__, i)); + if (subnode && "__data__" in node) subnode.__data__ = node.__data__; + } else { + subgroup.push(null); + } + } + } + return d3_selection(subgroups); + }; + d3_selectionPrototype.selectAll = function(selector) { + var subgroups = [], subgroup, node; + if (typeof selector !== "function") selector = d3_selection_selectorAll(selector); + for (var j = -1, m = this.length; ++j < m; ) { + for (var group = this[j], i = -1, n = group.length; ++i < n; ) { + if (node = group[i]) { + subgroups.push(subgroup = d3_array(selector.call(node, node.__data__, i))); + subgroup.parentNode = node; + } + } + } + return d3_selection(subgroups); + }; + d3_selectionPrototype.attr = function(name, value) { + if (arguments.length < 2) { + if (typeof name === "string") { + var node = this.node(); + name = d3.ns.qualify(name); + return name.local ? node.getAttributeNS(name.space, name.local) : node.getAttribute(name); + } + for (value in name) this.each(d3_selection_attr(value, name[value])); + return this; + } + return this.each(d3_selection_attr(name, value)); + }; + d3_selectionPrototype.classed = function(name, value) { + if (arguments.length < 2) { + if (typeof name === "string") { + var node = this.node(), n = (name = name.trim().split(/^|\s+/g)).length, i = -1; + if (value = node.classList) { + while (++i < n) if (!value.contains(name[i])) return false; + } else { + value = node.className; + if (value.baseVal != null) value = value.baseVal; + while (++i < n) if (!d3_selection_classedRe(name[i]).test(value)) return false; + } + return true; + } + for (value in name) this.each(d3_selection_classed(value, name[value])); + return this; + } + return this.each(d3_selection_classed(name, value)); + }; + d3_selectionPrototype.style = function(name, value, priority) { + var n = arguments.length; + if (n < 3) { + if (typeof name !== "string") { + if (n < 2) value = ""; + for (priority in name) this.each(d3_selection_style(priority, name[priority], value)); + return this; + } + if (n < 2) return window.getComputedStyle(this.node(), null).getPropertyValue(name); + priority = ""; + } + return this.each(d3_selection_style(name, value, priority)); + }; + d3_selectionPrototype.property = function(name, value) { + if (arguments.length < 2) { + if (typeof name === "string") return this.node()[name]; + for (value in name) this.each(d3_selection_property(value, name[value])); + return this; + } + return this.each(d3_selection_property(name, value)); + }; + d3_selectionPrototype.text = function(value) { + return arguments.length < 1 ? this.node().textContent : this.each(typeof value === "function" ? function() { + var v = value.apply(this, arguments); + this.textContent = v == null ? "" : v; + } : value == null ? function() { + this.textContent = ""; + } : function() { + this.textContent = value; + }); + }; + d3_selectionPrototype.html = function(value) { + return arguments.length < 1 ? this.node().innerHTML : this.each(typeof value === "function" ? function() { + var v = value.apply(this, arguments); + this.innerHTML = v == null ? "" : v; + } : value == null ? function() { + this.innerHTML = ""; + } : function() { + this.innerHTML = value; + }); + }; + d3_selectionPrototype.append = function(name) { + function append() { + return this.appendChild(document.createElementNS(this.namespaceURI, name)); + } + function appendNS() { + return this.appendChild(document.createElementNS(name.space, name.local)); + } + name = d3.ns.qualify(name); + return this.select(name.local ? appendNS : append); + }; + d3_selectionPrototype.insert = function(name, before) { + function insert() { + return this.insertBefore(document.createElementNS(this.namespaceURI, name), d3_select(before, this)); + } + function insertNS() { + return this.insertBefore(document.createElementNS(name.space, name.local), d3_select(before, this)); + } + name = d3.ns.qualify(name); + return this.select(name.local ? insertNS : insert); + }; + d3_selectionPrototype.remove = function() { + return this.each(function() { + var parent = this.parentNode; + if (parent) parent.removeChild(this); + }); + }; + d3_selectionPrototype.data = function(value, key) { + function bind(group, groupData) { + var i, n = group.length, m = groupData.length, n0 = Math.min(n, m), n1 = Math.max(n, m), updateNodes = [], enterNodes = [], exitNodes = [], node, nodeData; + if (key) { + var nodeByKeyValue = new d3_Map, keyValues = [], keyValue, j = groupData.length; + for (i = -1; ++i < n; ) { + keyValue = key.call(node = group[i], node.__data__, i); + if (nodeByKeyValue.has(keyValue)) { + exitNodes[j++] = node; + } else { + nodeByKeyValue.set(keyValue, node); + } + keyValues.push(keyValue); + } + for (i = -1; ++i < m; ) { + keyValue = key.call(groupData, nodeData = groupData[i], i); + if (nodeByKeyValue.has(keyValue)) { + updateNodes[i] = node = nodeByKeyValue.get(keyValue); + node.__data__ = nodeData; + enterNodes[i] = exitNodes[i] = null; + } else { + enterNodes[i] = d3_selection_dataNode(nodeData); + updateNodes[i] = exitNodes[i] = null; + } + nodeByKeyValue.remove(keyValue); + } + for (i = -1; ++i < n; ) { + if (nodeByKeyValue.has(keyValues[i])) { + exitNodes[i] = group[i]; + } + } + } else { + for (i = -1; ++i < n0; ) { + node = group[i]; + nodeData = groupData[i]; + if (node) { + node.__data__ = nodeData; + updateNodes[i] = node; + enterNodes[i] = exitNodes[i] = null; + } else { + enterNodes[i] = d3_selection_dataNode(nodeData); + updateNodes[i] = exitNodes[i] = null; + } + } + for (; i < m; ++i) { + enterNodes[i] = d3_selection_dataNode(groupData[i]); + updateNodes[i] = exitNodes[i] = null; + } + for (; i < n1; ++i) { + exitNodes[i] = group[i]; + enterNodes[i] = updateNodes[i] = null; + } + } + enterNodes.update = updateNodes; + enterNodes.parentNode = updateNodes.parentNode = exitNodes.parentNode = group.parentNode; + enter.push(enterNodes); + update.push(updateNodes); + exit.push(exitNodes); + } + var i = -1, n = this.length, group, node; + if (!arguments.length) { + value = new Array(n = (group = this[0]).length); + while (++i < n) { + if (node = group[i]) { + value[i] = node.__data__; + } + } + return value; + } + var enter = d3_selection_enter([]), update = d3_selection([]), exit = d3_selection([]); + if (typeof value === "function") { + while (++i < n) { + bind(group = this[i], value.call(group, group.parentNode.__data__, i)); + } + } else { + while (++i < n) { + bind(group = this[i], value); + } + } + update.enter = function() { + return enter; + }; + update.exit = function() { + return exit; + }; + return update; + }; + d3_selectionPrototype.datum = d3_selectionPrototype.map = function(value) { + return arguments.length < 1 ? this.property("__data__") : this.property("__data__", value); + }; + d3_selectionPrototype.filter = function(filter) { + var subgroups = [], subgroup, group, node; + if (typeof filter !== "function") filter = d3_selection_filter(filter); + for (var j = 0, m = this.length; j < m; j++) { + subgroups.push(subgroup = []); + subgroup.parentNode = (group = this[j]).parentNode; + for (var i = 0, n = group.length; i < n; i++) { + if ((node = group[i]) && filter.call(node, node.__data__, i)) { + subgroup.push(node); + } + } + } + return d3_selection(subgroups); + }; + d3_selectionPrototype.order = function() { + for (var j = -1, m = this.length; ++j < m; ) { + for (var group = this[j], i = group.length - 1, next = group[i], node; --i >= 0; ) { + if (node = group[i]) { + if (next && next !== node.nextSibling) next.parentNode.insertBefore(node, next); + next = node; + } + } + } + return this; + }; + d3_selectionPrototype.sort = function(comparator) { + comparator = d3_selection_sortComparator.apply(this, arguments); + for (var j = -1, m = this.length; ++j < m; ) this[j].sort(comparator); + return this.order(); + }; + d3_selectionPrototype.on = function(type, listener, capture) { + var n = arguments.length; + if (n < 3) { + if (typeof type !== "string") { + if (n < 2) listener = false; + for (capture in type) this.each(d3_selection_on(capture, type[capture], listener)); + return this; + } + if (n < 2) return (n = this.node()["__on" + type]) && n._; + capture = false; + } + return this.each(d3_selection_on(type, listener, capture)); + }; + d3_selectionPrototype.each = function(callback) { + return d3_selection_each(this, function(node, i, j) { + callback.call(node, node.__data__, i, j); + }); + }; + d3_selectionPrototype.call = function(callback) { + callback.apply(this, (arguments[0] = this, arguments)); + return this; + }; + d3_selectionPrototype.empty = function() { + return !this.node(); + }; + d3_selectionPrototype.node = function(callback) { + for (var j = 0, m = this.length; j < m; j++) { + for (var group = this[j], i = 0, n = group.length; i < n; i++) { + var node = group[i]; + if (node) return node; + } + } + return null; + }; + d3_selectionPrototype.transition = function() { + var subgroups = [], subgroup, node; + for (var j = -1, m = this.length; ++j < m; ) { + subgroups.push(subgroup = []); + for (var group = this[j], i = -1, n = group.length; ++i < n; ) { + subgroup.push((node = group[i]) ? { + node: node, + delay: d3_transitionDelay, + duration: d3_transitionDuration + } : null); + } + } + return d3_transition(subgroups, d3_transitionId || ++d3_transitionNextId, Date.now()); + }; + var d3_selectionRoot = d3_selection([ [ document ] ]); + d3_selectionRoot[0].parentNode = d3_selectRoot; + d3.select = function(selector) { + return typeof selector === "string" ? d3_selectionRoot.select(selector) : d3_selection([ [ selector ] ]); + }; + d3.selectAll = function(selector) { + return typeof selector === "string" ? d3_selectionRoot.selectAll(selector) : d3_selection([ d3_array(selector) ]); + }; + var d3_selection_enterPrototype = []; + d3.selection.enter = d3_selection_enter; + d3.selection.enter.prototype = d3_selection_enterPrototype; + d3_selection_enterPrototype.append = d3_selectionPrototype.append; + d3_selection_enterPrototype.insert = d3_selectionPrototype.insert; + d3_selection_enterPrototype.empty = d3_selectionPrototype.empty; + d3_selection_enterPrototype.node = d3_selectionPrototype.node; + d3_selection_enterPrototype.select = function(selector) { + var subgroups = [], subgroup, subnode, upgroup, group, node; + for (var j = -1, m = this.length; ++j < m; ) { + upgroup = (group = this[j]).update; + subgroups.push(subgroup = []); + subgroup.parentNode = group.parentNode; + for (var i = -1, n = group.length; ++i < n; ) { + if (node = group[i]) { + subgroup.push(upgroup[i] = subnode = selector.call(group.parentNode, node.__data__, i)); + subnode.__data__ = node.__data__; + } else { + subgroup.push(null); + } + } + } + return d3_selection(subgroups); + }; + var d3_transitionPrototype = [], d3_transitionNextId = 0, d3_transitionId = 0, d3_transitionDefaultDelay = 0, d3_transitionDefaultDuration = 250, d3_transitionDefaultEase = d3.ease("cubic-in-out"), d3_transitionDelay = d3_transitionDefaultDelay, d3_transitionDuration = d3_transitionDefaultDuration, d3_transitionEase = d3_transitionDefaultEase; + d3_transitionPrototype.call = d3_selectionPrototype.call; + d3.transition = function(selection) { + return arguments.length ? d3_transitionId ? selection.transition() : selection : d3_selectionRoot.transition(); + }; + d3.transition.prototype = d3_transitionPrototype; + d3_transitionPrototype.select = function(selector) { + var subgroups = [], subgroup, subnode, node; + if (typeof selector !== "function") selector = d3_selection_selector(selector); + for (var j = -1, m = this.length; ++j < m; ) { + subgroups.push(subgroup = []); + for (var group = this[j], i = -1, n = group.length; ++i < n; ) { + if ((node = group[i]) && (subnode = selector.call(node.node, node.node.__data__, i))) { + if ("__data__" in node.node) subnode.__data__ = node.node.__data__; + subgroup.push({ + node: subnode, + delay: node.delay, + duration: node.duration + }); + } else { + subgroup.push(null); + } + } + } + return d3_transition(subgroups, this.id, this.time).ease(this.ease()); + }; + d3_transitionPrototype.selectAll = function(selector) { + var subgroups = [], subgroup, subnodes, node; + if (typeof selector !== "function") selector = d3_selection_selectorAll(selector); + for (var j = -1, m = this.length; ++j < m; ) { + for (var group = this[j], i = -1, n = group.length; ++i < n; ) { + if (node = group[i]) { + subnodes = selector.call(node.node, node.node.__data__, i); + subgroups.push(subgroup = []); + for (var k = -1, o = subnodes.length; ++k < o; ) { + subgroup.push({ + node: subnodes[k], + delay: node.delay, + duration: node.duration + }); + } + } + } + } + return d3_transition(subgroups, this.id, this.time).ease(this.ease()); + }; + d3_transitionPrototype.filter = function(filter) { + var subgroups = [], subgroup, group, node; + if (typeof filter !== "function") filter = d3_selection_filter(filter); + for (var j = 0, m = this.length; j < m; j++) { + subgroups.push(subgroup = []); + for (var group = this[j], i = 0, n = group.length; i < n; i++) { + if ((node = group[i]) && filter.call(node.node, node.node.__data__, i)) { + subgroup.push(node); + } + } + } + return d3_transition(subgroups, this.id, this.time).ease(this.ease()); + }; + d3_transitionPrototype.attr = function(name, value) { + if (arguments.length < 2) { + for (value in name) this.attrTween(value, d3_tweenByName(name[value], value)); + return this; + } + return this.attrTween(name, d3_tweenByName(value, name)); + }; + d3_transitionPrototype.attrTween = function(nameNS, tween) { + function attrTween(d, i) { + var f = tween.call(this, d, i, this.getAttribute(name)); + return f === d3_tweenRemove ? (this.removeAttribute(name), null) : f && function(t) { + this.setAttribute(name, f(t)); + }; + } + function attrTweenNS(d, i) { + var f = tween.call(this, d, i, this.getAttributeNS(name.space, name.local)); + return f === d3_tweenRemove ? (this.removeAttributeNS(name.space, name.local), null) : f && function(t) { + this.setAttributeNS(name.space, name.local, f(t)); + }; + } + var name = d3.ns.qualify(nameNS); + return this.tween("attr." + nameNS, name.local ? attrTweenNS : attrTween); + }; + d3_transitionPrototype.style = function(name, value, priority) { + var n = arguments.length; + if (n < 3) { + if (typeof name !== "string") { + if (n < 2) value = ""; + for (priority in name) this.styleTween(priority, d3_tweenByName(name[priority], priority), value); + return this; + } + priority = ""; + } + return this.styleTween(name, d3_tweenByName(value, name), priority); + }; + d3_transitionPrototype.styleTween = function(name, tween, priority) { + if (arguments.length < 3) priority = ""; + return this.tween("style." + name, function(d, i) { + var f = tween.call(this, d, i, window.getComputedStyle(this, null).getPropertyValue(name)); + return f === d3_tweenRemove ? (this.style.removeProperty(name), null) : f && function(t) { + this.style.setProperty(name, f(t), priority); + }; + }); + }; + d3_transitionPrototype.text = function(value) { + return this.tween("text", function(d, i) { + this.textContent = typeof value === "function" ? value.call(this, d, i) : value; + }); + }; + d3_transitionPrototype.remove = function() { + return this.each("end.transition", function() { + var p; + if (!this.__transition__ && (p = this.parentNode)) p.removeChild(this); + }); + }; + d3_transitionPrototype.delay = function(value) { + return d3_selection_each(this, typeof value === "function" ? function(node, i, j) { + node.delay = value.call(node = node.node, node.__data__, i, j) | 0; + } : (value = value | 0, function(node) { + node.delay = value; + })); + }; + d3_transitionPrototype.duration = function(value) { + return d3_selection_each(this, typeof value === "function" ? function(node, i, j) { + node.duration = Math.max(1, value.call(node = node.node, node.__data__, i, j) | 0); + } : (value = Math.max(1, value | 0), function(node) { + node.duration = value; + })); + }; + d3_transitionPrototype.transition = function() { + return this.select(d3_this); + }; + d3.tween = function(b, interpolate) { + function tweenFunction(d, i, a) { + var v = b.call(this, d, i); + return v == null ? a != "" && d3_tweenRemove : a != v && interpolate(a, v); + } + function tweenString(d, i, a) { + return a != b && interpolate(a, b); + } + return typeof b === "function" ? tweenFunction : b == null ? d3_tweenNull : (b += "", tweenString); + }; + var d3_tweenRemove = {}; + var d3_timer_queue = null, d3_timer_interval, d3_timer_timeout; + d3.timer = function(callback, delay, then) { + var found = false, t0, t1 = d3_timer_queue; + if (arguments.length < 3) { + if (arguments.length < 2) delay = 0; else if (!isFinite(delay)) return; + then = Date.now(); + } + while (t1) { + if (t1.callback === callback) { + t1.then = then; + t1.delay = delay; + found = true; + break; + } + t0 = t1; + t1 = t1.next; + } + if (!found) d3_timer_queue = { + callback: callback, + then: then, + delay: delay, + next: d3_timer_queue + }; + if (!d3_timer_interval) { + d3_timer_timeout = clearTimeout(d3_timer_timeout); + d3_timer_interval = 1; + d3_timer_frame(d3_timer_step); + } + }; + d3.timer.flush = function() { + var elapsed, now = Date.now(), t1 = d3_timer_queue; + while (t1) { + elapsed = now - t1.then; + if (!t1.delay) t1.flush = t1.callback(elapsed); + t1 = t1.next; + } + d3_timer_flush(); + }; + var d3_timer_frame = window.requestAnimationFrame || window.webkitRequestAnimationFrame || window.mozRequestAnimationFrame || window.oRequestAnimationFrame || window.msRequestAnimationFrame || function(callback) { + setTimeout(callback, 17); + }; + d3.mouse = function(container) { + return d3_mousePoint(container, d3_eventSource()); + }; + var d3_mouse_bug44083 = /WebKit/.test(navigator.userAgent) ? -1 : 0; + d3.touches = function(container, touches) { + if (arguments.length < 2) touches = d3_eventSource().touches; + return touches ? d3_array(touches).map(function(touch) { + var point = d3_mousePoint(container, touch); + point.identifier = touch.identifier; + return point; + }) : []; + }; + d3.scale = {}; + d3.scale.linear = function() { + return d3_scale_linear([ 0, 1 ], [ 0, 1 ], d3.interpolate, false); + }; + d3.scale.log = function() { + return d3_scale_log(d3.scale.linear(), d3_scale_logp); + }; + var d3_scale_logFormat = d3.format(".0e"); + d3_scale_logp.pow = function(x) { + return Math.pow(10, x); + }; + d3_scale_logn.pow = function(x) { + return -Math.pow(10, -x); + }; + d3.scale.pow = function() { + return d3_scale_pow(d3.scale.linear(), 1); + }; + d3.scale.sqrt = function() { + return d3.scale.pow().exponent(.5); + }; + d3.scale.ordinal = function() { + return d3_scale_ordinal([], { + t: "range", + a: [ [] ] + }); + }; + d3.scale.category10 = function() { + return d3.scale.ordinal().range(d3_category10); + }; + d3.scale.category20 = function() { + return d3.scale.ordinal().range(d3_category20); + }; + d3.scale.category20b = function() { + return d3.scale.ordinal().range(d3_category20b); + }; + d3.scale.category20c = function() { + return d3.scale.ordinal().range(d3_category20c); + }; + var d3_category10 = [ "#1f77b4", "#ff7f0e", "#2ca02c", "#d62728", "#9467bd", "#8c564b", "#e377c2", "#7f7f7f", "#bcbd22", "#17becf" ]; + var d3_category20 = [ "#1f77b4", "#aec7e8", "#ff7f0e", "#ffbb78", "#2ca02c", "#98df8a", "#d62728", "#ff9896", "#9467bd", "#c5b0d5", "#8c564b", "#c49c94", "#e377c2", "#f7b6d2", "#7f7f7f", "#c7c7c7", "#bcbd22", "#dbdb8d", "#17becf", "#9edae5" ]; + var d3_category20b = [ "#393b79", "#5254a3", "#6b6ecf", "#9c9ede", "#637939", "#8ca252", "#b5cf6b", "#cedb9c", "#8c6d31", "#bd9e39", "#e7ba52", "#e7cb94", "#843c39", "#ad494a", "#d6616b", "#e7969c", "#7b4173", "#a55194", "#ce6dbd", "#de9ed6" ]; + var d3_category20c = [ "#3182bd", "#6baed6", "#9ecae1", "#c6dbef", "#e6550d", "#fd8d3c", "#fdae6b", "#fdd0a2", "#31a354", "#74c476", "#a1d99b", "#c7e9c0", "#756bb1", "#9e9ac8", "#bcbddc", "#dadaeb", "#636363", "#969696", "#bdbdbd", "#d9d9d9" ]; + d3.scale.quantile = function() { + return d3_scale_quantile([], []); + }; + d3.scale.quantize = function() { + return d3_scale_quantize(0, 1, [ 0, 1 ]); + }; + d3.scale.threshold = function() { + return d3_scale_threshold([ .5 ], [ 0, 1 ]); + }; + d3.scale.identity = function() { + return d3_scale_identity([ 0, 1 ]); + }; + d3.svg = {}; + d3.svg.arc = function() { + function arc() { + var r0 = innerRadius.apply(this, arguments), r1 = outerRadius.apply(this, arguments), a0 = startAngle.apply(this, arguments) + d3_svg_arcOffset, a1 = endAngle.apply(this, arguments) + d3_svg_arcOffset, da = (a1 < a0 && (da = a0, a0 = a1, a1 = da), a1 - a0), df = da < Math.PI ? "0" : "1", c0 = Math.cos(a0), s0 = Math.sin(a0), c1 = Math.cos(a1), s1 = Math.sin(a1); + return da >= d3_svg_arcMax ? r0 ? "M0," + r1 + "A" + r1 + "," + r1 + " 0 1,1 0," + -r1 + "A" + r1 + "," + r1 + " 0 1,1 0," + r1 + "M0," + r0 + "A" + r0 + "," + r0 + " 0 1,0 0," + -r0 + "A" + r0 + "," + r0 + " 0 1,0 0," + r0 + "Z" : "M0," + r1 + "A" + r1 + "," + r1 + " 0 1,1 0," + -r1 + "A" + r1 + "," + r1 + " 0 1,1 0," + r1 + "Z" : r0 ? "M" + r1 * c0 + "," + r1 * s0 + "A" + r1 + "," + r1 + " 0 " + df + ",1 " + r1 * c1 + "," + r1 * s1 + "L" + r0 * c1 + "," + r0 * s1 + "A" + r0 + "," + r0 + " 0 " + df + ",0 " + r0 * c0 + "," + r0 * s0 + "Z" : "M" + r1 * c0 + "," + r1 * s0 + "A" + r1 + "," + r1 + " 0 " + df + ",1 " + r1 * c1 + "," + r1 * s1 + "L0,0" + "Z"; + } + var innerRadius = d3_svg_arcInnerRadius, outerRadius = d3_svg_arcOuterRadius, startAngle = d3_svg_arcStartAngle, endAngle = d3_svg_arcEndAngle; + arc.innerRadius = function(v) { + if (!arguments.length) return innerRadius; + innerRadius = d3_functor(v); + return arc; + }; + arc.outerRadius = function(v) { + if (!arguments.length) return outerRadius; + outerRadius = d3_functor(v); + return arc; + }; + arc.startAngle = function(v) { + if (!arguments.length) return startAngle; + startAngle = d3_functor(v); + return arc; + }; + arc.endAngle = function(v) { + if (!arguments.length) return endAngle; + endAngle = d3_functor(v); + return arc; + }; + arc.centroid = function() { + var r = (innerRadius.apply(this, arguments) + outerRadius.apply(this, arguments)) / 2, a = (startAngle.apply(this, arguments) + endAngle.apply(this, arguments)) / 2 + d3_svg_arcOffset; + return [ Math.cos(a) * r, Math.sin(a) * r ]; + }; + return arc; + }; + var d3_svg_arcOffset = -Math.PI / 2, d3_svg_arcMax = 2 * Math.PI - 1e-6; + d3.svg.line = function() { + return d3_svg_line(d3_identity); + }; + var d3_svg_lineInterpolators = d3.map({ + linear: d3_svg_lineLinear, + "linear-closed": d3_svg_lineLinearClosed, + "step-before": d3_svg_lineStepBefore, + "step-after": d3_svg_lineStepAfter, + basis: d3_svg_lineBasis, + "basis-open": d3_svg_lineBasisOpen, + "basis-closed": d3_svg_lineBasisClosed, + bundle: d3_svg_lineBundle, + cardinal: d3_svg_lineCardinal, + "cardinal-open": d3_svg_lineCardinalOpen, + "cardinal-closed": d3_svg_lineCardinalClosed, + monotone: d3_svg_lineMonotone + }); + d3_svg_lineInterpolators.forEach(function(key, value) { + value.key = key; + value.closed = /-closed$/.test(key); + }); + var d3_svg_lineBasisBezier1 = [ 0, 2 / 3, 1 / 3, 0 ], d3_svg_lineBasisBezier2 = [ 0, 1 / 3, 2 / 3, 0 ], d3_svg_lineBasisBezier3 = [ 0, 1 / 6, 2 / 3, 1 / 6 ]; + d3.svg.line.radial = function() { + var line = d3_svg_line(d3_svg_lineRadial); + line.radius = line.x, delete line.x; + line.angle = line.y, delete line.y; + return line; + }; + d3_svg_lineStepBefore.reverse = d3_svg_lineStepAfter; + d3_svg_lineStepAfter.reverse = d3_svg_lineStepBefore; + d3.svg.area = function() { + return d3_svg_area(d3_identity); + }; + d3.svg.area.radial = function() { + var area = d3_svg_area(d3_svg_lineRadial); + area.radius = area.x, delete area.x; + area.innerRadius = area.x0, delete area.x0; + area.outerRadius = area.x1, delete area.x1; + area.angle = area.y, delete area.y; + area.startAngle = area.y0, delete area.y0; + area.endAngle = area.y1, delete area.y1; + return area; + }; + d3.svg.chord = function() { + function chord(d, i) { + var s = subgroup(this, source, d, i), t = subgroup(this, target, d, i); + return "M" + s.p0 + arc(s.r, s.p1, s.a1 - s.a0) + (equals(s, t) ? curve(s.r, s.p1, s.r, s.p0) : curve(s.r, s.p1, t.r, t.p0) + arc(t.r, t.p1, t.a1 - t.a0) + curve(t.r, t.p1, s.r, s.p0)) + "Z"; + } + function subgroup(self, f, d, i) { + var subgroup = f.call(self, d, i), r = radius.call(self, subgroup, i), a0 = startAngle.call(self, subgroup, i) + d3_svg_arcOffset, a1 = endAngle.call(self, subgroup, i) + d3_svg_arcOffset; + return { + r: r, + a0: a0, + a1: a1, + p0: [ r * Math.cos(a0), r * Math.sin(a0) ], + p1: [ r * Math.cos(a1), r * Math.sin(a1) ] + }; + } + function equals(a, b) { + return a.a0 == b.a0 && a.a1 == b.a1; + } + function arc(r, p, a) { + return "A" + r + "," + r + " 0 " + +(a > Math.PI) + ",1 " + p; + } + function curve(r0, p0, r1, p1) { + return "Q 0,0 " + p1; + } + var source = d3_svg_chordSource, target = d3_svg_chordTarget, radius = d3_svg_chordRadius, startAngle = d3_svg_arcStartAngle, endAngle = d3_svg_arcEndAngle; + chord.radius = function(v) { + if (!arguments.length) return radius; + radius = d3_functor(v); + return chord; + }; + chord.source = function(v) { + if (!arguments.length) return source; + source = d3_functor(v); + return chord; + }; + chord.target = function(v) { + if (!arguments.length) return target; + target = d3_functor(v); + return chord; + }; + chord.startAngle = function(v) { + if (!arguments.length) return startAngle; + startAngle = d3_functor(v); + return chord; + }; + chord.endAngle = function(v) { + if (!arguments.length) return endAngle; + endAngle = d3_functor(v); + return chord; + }; + return chord; + }; + d3.svg.diagonal = function() { + function diagonal(d, i) { + var p0 = source.call(this, d, i), p3 = target.call(this, d, i), m = (p0.y + p3.y) / 2, p = [ p0, { + x: p0.x, + y: m + }, { + x: p3.x, + y: m + }, p3 ]; + p = p.map(projection); + return "M" + p[0] + "C" + p[1] + " " + p[2] + " " + p[3]; + } + var source = d3_svg_chordSource, target = d3_svg_chordTarget, projection = d3_svg_diagonalProjection; + diagonal.source = function(x) { + if (!arguments.length) return source; + source = d3_functor(x); + return diagonal; + }; + diagonal.target = function(x) { + if (!arguments.length) return target; + target = d3_functor(x); + return diagonal; + }; + diagonal.projection = function(x) { + if (!arguments.length) return projection; + projection = x; + return diagonal; + }; + return diagonal; + }; + d3.svg.diagonal.radial = function() { + var diagonal = d3.svg.diagonal(), projection = d3_svg_diagonalProjection, projection_ = diagonal.projection; + diagonal.projection = function(x) { + return arguments.length ? projection_(d3_svg_diagonalRadialProjection(projection = x)) : projection; + }; + return diagonal; + }; + d3.svg.mouse = d3.mouse; + d3.svg.touches = d3.touches; + d3.svg.symbol = function() { + function symbol(d, i) { + return (d3_svg_symbols.get(type.call(this, d, i)) || d3_svg_symbolCircle)(size.call(this, d, i)); + } + var type = d3_svg_symbolType, size = d3_svg_symbolSize; + symbol.type = function(x) { + if (!arguments.length) return type; + type = d3_functor(x); + return symbol; + }; + symbol.size = function(x) { + if (!arguments.length) return size; + size = d3_functor(x); + return symbol; + }; + return symbol; + }; + var d3_svg_symbols = d3.map({ + circle: d3_svg_symbolCircle, + cross: function(size) { + var r = Math.sqrt(size / 5) / 2; + return "M" + -3 * r + "," + -r + "H" + -r + "V" + -3 * r + "H" + r + "V" + -r + "H" + 3 * r + "V" + r + "H" + r + "V" + 3 * r + "H" + -r + "V" + r + "H" + -3 * r + "Z"; + }, + diamond: function(size) { + var ry = Math.sqrt(size / (2 * d3_svg_symbolTan30)), rx = ry * d3_svg_symbolTan30; + return "M0," + -ry + "L" + rx + ",0" + " 0," + ry + " " + -rx + ",0" + "Z"; + }, + square: function(size) { + var r = Math.sqrt(size) / 2; + return "M" + -r + "," + -r + "L" + r + "," + -r + " " + r + "," + r + " " + -r + "," + r + "Z"; + }, + "triangle-down": function(size) { + var rx = Math.sqrt(size / d3_svg_symbolSqrt3), ry = rx * d3_svg_symbolSqrt3 / 2; + return "M0," + ry + "L" + rx + "," + -ry + " " + -rx + "," + -ry + "Z"; + }, + "triangle-up": function(size) { + var rx = Math.sqrt(size / d3_svg_symbolSqrt3), ry = rx * d3_svg_symbolSqrt3 / 2; + return "M0," + -ry + "L" + rx + "," + ry + " " + -rx + "," + ry + "Z"; + } + }); + d3.svg.symbolTypes = d3_svg_symbols.keys(); + var d3_svg_symbolSqrt3 = Math.sqrt(3), d3_svg_symbolTan30 = Math.tan(30 * Math.PI / 180); + d3.svg.axis = function() { + function axis(g) { + g.each(function() { + var g = d3.select(this); + var ticks = tickValues == null ? scale.ticks ? scale.ticks.apply(scale, tickArguments_) : scale.domain() : tickValues, tickFormat = tickFormat_ == null ? scale.tickFormat ? scale.tickFormat.apply(scale, tickArguments_) : String : tickFormat_; + var subticks = d3_svg_axisSubdivide(scale, ticks, tickSubdivide), subtick = g.selectAll(".minor").data(subticks, String), subtickEnter = subtick.enter().insert("line", "g").attr("class", "tick minor").style("opacity", 1e-6), subtickExit = d3.transition(subtick.exit()).style("opacity", 1e-6).remove(), subtickUpdate = d3.transition(subtick).style("opacity", 1); + var tick = g.selectAll("g").data(ticks, String), tickEnter = tick.enter().insert("g", "path").style("opacity", 1e-6), tickExit = d3.transition(tick.exit()).style("opacity", 1e-6).remove(), tickUpdate = d3.transition(tick).style("opacity", 1), tickTransform; + var range = d3_scaleRange(scale), path = g.selectAll(".domain").data([ 0 ]), pathEnter = path.enter().append("path").attr("class", "domain"), pathUpdate = d3.transition(path); + var scale1 = scale.copy(), scale0 = this.__chart__ || scale1; + this.__chart__ = scale1; + tickEnter.append("line").attr("class", "tick"); + tickEnter.append("text"); + var lineEnter = tickEnter.select("line"), lineUpdate = tickUpdate.select("line"), text = tick.select("text").text(tickFormat), textEnter = tickEnter.select("text"), textUpdate = tickUpdate.select("text"); + switch (orient) { + case "bottom": + { + tickTransform = d3_svg_axisX; + subtickEnter.attr("y2", tickMinorSize); + subtickUpdate.attr("x2", 0).attr("y2", tickMinorSize); + lineEnter.attr("y2", tickMajorSize); + textEnter.attr("y", Math.max(tickMajorSize, 0) + tickPadding); + lineUpdate.attr("x2", 0).attr("y2", tickMajorSize); + textUpdate.attr("x", 0).attr("y", Math.max(tickMajorSize, 0) + tickPadding); + text.attr("dy", ".71em").attr("text-anchor", "middle"); + pathUpdate.attr("d", "M" + range[0] + "," + tickEndSize + "V0H" + range[1] + "V" + tickEndSize); + break; + } + case "top": + { + tickTransform = d3_svg_axisX; + subtickEnter.attr("y2", -tickMinorSize); + subtickUpdate.attr("x2", 0).attr("y2", -tickMinorSize); + lineEnter.attr("y2", -tickMajorSize); + textEnter.attr("y", -(Math.max(tickMajorSize, 0) + tickPadding)); + lineUpdate.attr("x2", 0).attr("y2", -tickMajorSize); + textUpdate.attr("x", 0).attr("y", -(Math.max(tickMajorSize, 0) + tickPadding)); + text.attr("dy", "0em").attr("text-anchor", "middle"); + pathUpdate.attr("d", "M" + range[0] + "," + -tickEndSize + "V0H" + range[1] + "V" + -tickEndSize); + break; + } + case "left": + { + tickTransform = d3_svg_axisY; + subtickEnter.attr("x2", -tickMinorSize); + subtickUpdate.attr("x2", -tickMinorSize).attr("y2", 0); + lineEnter.attr("x2", -tickMajorSize); + textEnter.attr("x", -(Math.max(tickMajorSize, 0) + tickPadding)); + lineUpdate.attr("x2", -tickMajorSize).attr("y2", 0); + textUpdate.attr("x", -(Math.max(tickMajorSize, 0) + tickPadding)).attr("y", 0); + text.attr("dy", ".32em").attr("text-anchor", "end"); + pathUpdate.attr("d", "M" + -tickEndSize + "," + range[0] + "H0V" + range[1] + "H" + -tickEndSize); + break; + } + case "right": + { + tickTransform = d3_svg_axisY; + subtickEnter.attr("x2", tickMinorSize); + subtickUpdate.attr("x2", tickMinorSize).attr("y2", 0); + lineEnter.attr("x2", tickMajorSize); + textEnter.attr("x", Math.max(tickMajorSize, 0) + tickPadding); + lineUpdate.attr("x2", tickMajorSize).attr("y2", 0); + textUpdate.attr("x", Math.max(tickMajorSize, 0) + tickPadding).attr("y", 0); + text.attr("dy", ".32em").attr("text-anchor", "start"); + pathUpdate.attr("d", "M" + tickEndSize + "," + range[0] + "H0V" + range[1] + "H" + tickEndSize); + break; + } + } + if (scale.ticks) { + tickEnter.call(tickTransform, scale0); + tickUpdate.call(tickTransform, scale1); + tickExit.call(tickTransform, scale1); + subtickEnter.call(tickTransform, scale0); + subtickUpdate.call(tickTransform, scale1); + subtickExit.call(tickTransform, scale1); + } else { + var dx = scale1.rangeBand() / 2, x = function(d) { + return scale1(d) + dx; + }; + tickEnter.call(tickTransform, x); + tickUpdate.call(tickTransform, x); + } + }); + } + var scale = d3.scale.linear(), orient = "bottom", tickMajorSize = 6, tickMinorSize = 6, tickEndSize = 6, tickPadding = 3, tickArguments_ = [ 10 ], tickValues = null, tickFormat_, tickSubdivide = 0; + axis.scale = function(x) { + if (!arguments.length) return scale; + scale = x; + return axis; + }; + axis.orient = function(x) { + if (!arguments.length) return orient; + orient = x; + return axis; + }; + axis.ticks = function() { + if (!arguments.length) return tickArguments_; + tickArguments_ = arguments; + return axis; + }; + axis.tickValues = function(x) { + if (!arguments.length) return tickValues; + tickValues = x; + return axis; + }; + axis.tickFormat = function(x) { + if (!arguments.length) return tickFormat_; + tickFormat_ = x; + return axis; + }; + axis.tickSize = function(x, y, z) { + if (!arguments.length) return tickMajorSize; + var n = arguments.length - 1; + tickMajorSize = +x; + tickMinorSize = n > 1 ? +y : tickMajorSize; + tickEndSize = n > 0 ? +arguments[n] : tickMajorSize; + return axis; + }; + axis.tickPadding = function(x) { + if (!arguments.length) return tickPadding; + tickPadding = +x; + return axis; + }; + axis.tickSubdivide = function(x) { + if (!arguments.length) return tickSubdivide; + tickSubdivide = +x; + return axis; + }; + return axis; + }; + d3.svg.brush = function() { + function brush(g) { + g.each(function() { + var g = d3.select(this), bg = g.selectAll(".background").data([ 0 ]), fg = g.selectAll(".extent").data([ 0 ]), tz = g.selectAll(".resize").data(resizes, String), e; + g.style("pointer-events", "all").on("mousedown.brush", brushstart).on("touchstart.brush", brushstart); + bg.enter().append("rect").attr("class", "background").style("visibility", "hidden").style("cursor", "crosshair"); + fg.enter().append("rect").attr("class", "extent").style("cursor", "move"); + tz.enter().append("g").attr("class", function(d) { + return "resize " + d; + }).style("cursor", function(d) { + return d3_svg_brushCursor[d]; + }).append("rect").attr("x", function(d) { + return /[ew]$/.test(d) ? -3 : null; + }).attr("y", function(d) { + return /^[ns]/.test(d) ? -3 : null; + }).attr("width", 6).attr("height", 6).style("visibility", "hidden"); + tz.style("display", brush.empty() ? "none" : null); + tz.exit().remove(); + if (x) { + e = d3_scaleRange(x); + bg.attr("x", e[0]).attr("width", e[1] - e[0]); + redrawX(g); + } + if (y) { + e = d3_scaleRange(y); + bg.attr("y", e[0]).attr("height", e[1] - e[0]); + redrawY(g); + } + redraw(g); + }); + } + function redraw(g) { + g.selectAll(".resize").attr("transform", function(d) { + return "translate(" + extent[+/e$/.test(d)][0] + "," + extent[+/^s/.test(d)][1] + ")"; + }); + } + function redrawX(g) { + g.select(".extent").attr("x", extent[0][0]); + g.selectAll(".extent,.n>rect,.s>rect").attr("width", extent[1][0] - extent[0][0]); + } + function redrawY(g) { + g.select(".extent").attr("y", extent[0][1]); + g.selectAll(".extent,.e>rect,.w>rect").attr("height", extent[1][1] - extent[0][1]); + } + function brushstart() { + function mouse() { + var touches = d3.event.changedTouches; + return touches ? d3.touches(target, touches)[0] : d3.mouse(target); + } + function keydown() { + if (d3.event.keyCode == 32) { + if (!dragging) { + center = null; + origin[0] -= extent[1][0]; + origin[1] -= extent[1][1]; + dragging = 2; + } + d3_eventCancel(); + } + } + function keyup() { + if (d3.event.keyCode == 32 && dragging == 2) { + origin[0] += extent[1][0]; + origin[1] += extent[1][1]; + dragging = 0; + d3_eventCancel(); + } + } + function brushmove() { + var point = mouse(), moved = false; + if (offset) { + point[0] += offset[0]; + point[1] += offset[1]; + } + if (!dragging) { + if (d3.event.altKey) { + if (!center) center = [ (extent[0][0] + extent[1][0]) / 2, (extent[0][1] + extent[1][1]) / 2 ]; + origin[0] = extent[+(point[0] < center[0])][0]; + origin[1] = extent[+(point[1] < center[1])][1]; + } else center = null; + } + if (resizingX && move1(point, x, 0)) { + redrawX(g); + moved = true; + } + if (resizingY && move1(point, y, 1)) { + redrawY(g); + moved = true; + } + if (moved) { + redraw(g); + event_({ + type: "brush", + mode: dragging ? "move" : "resize" + }); + } + } + function move1(point, scale, i) { + var range = d3_scaleRange(scale), r0 = range[0], r1 = range[1], position = origin[i], size = extent[1][i] - extent[0][i], min, max; + if (dragging) { + r0 -= position; + r1 -= size + position; + } + min = Math.max(r0, Math.min(r1, point[i])); + if (dragging) { + max = (min += position) + size; + } else { + if (center) position = Math.max(r0, Math.min(r1, 2 * center[i] - min)); + if (position < min) { + max = min; + min = position; + } else { + max = position; + } + } + if (extent[0][i] !== min || extent[1][i] !== max) { + extentDomain = null; + extent[0][i] = min; + extent[1][i] = max; + return true; + } + } + function brushend() { + brushmove(); + g.style("pointer-events", "all").selectAll(".resize").style("display", brush.empty() ? "none" : null); + d3.select("body").style("cursor", null); + w.on("mousemove.brush", null).on("mouseup.brush", null).on("touchmove.brush", null).on("touchend.brush", null).on("keydown.brush", null).on("keyup.brush", null); + event_({ + type: "brushend" + }); + d3_eventCancel(); + } + var target = this, eventTarget = d3.select(d3.event.target), event_ = event.of(target, arguments), g = d3.select(target), resizing = eventTarget.datum(), resizingX = !/^(n|s)$/.test(resizing) && x, resizingY = !/^(e|w)$/.test(resizing) && y, dragging = eventTarget.classed("extent"), center, origin = mouse(), offset; + var w = d3.select(window).on("mousemove.brush", brushmove).on("mouseup.brush", brushend).on("touchmove.brush", brushmove).on("touchend.brush", brushend).on("keydown.brush", keydown).on("keyup.brush", keyup); + if (dragging) { + origin[0] = extent[0][0] - origin[0]; + origin[1] = extent[0][1] - origin[1]; + } else if (resizing) { + var ex = +/w$/.test(resizing), ey = +/^n/.test(resizing); + offset = [ extent[1 - ex][0] - origin[0], extent[1 - ey][1] - origin[1] ]; + origin[0] = extent[ex][0]; + origin[1] = extent[ey][1]; + } else if (d3.event.altKey) center = origin.slice(); + g.style("pointer-events", "none").selectAll(".resize").style("display", null); + d3.select("body").style("cursor", eventTarget.style("cursor")); + event_({ + type: "brushstart" + }); + brushmove(); + d3_eventCancel(); + } + var event = d3_eventDispatch(brush, "brushstart", "brush", "brushend"), x = null, y = null, resizes = d3_svg_brushResizes[0], extent = [ [ 0, 0 ], [ 0, 0 ] ], extentDomain; + brush.x = function(z) { + if (!arguments.length) return x; + x = z; + resizes = d3_svg_brushResizes[!x << 1 | !y]; + return brush; + }; + brush.y = function(z) { + if (!arguments.length) return y; + y = z; + resizes = d3_svg_brushResizes[!x << 1 | !y]; + return brush; + }; + brush.extent = function(z) { + var x0, x1, y0, y1, t; + if (!arguments.length) { + z = extentDomain || extent; + if (x) { + x0 = z[0][0], x1 = z[1][0]; + if (!extentDomain) { + x0 = extent[0][0], x1 = extent[1][0]; + if (x.invert) x0 = x.invert(x0), x1 = x.invert(x1); + if (x1 < x0) t = x0, x0 = x1, x1 = t; + } + } + if (y) { + y0 = z[0][1], y1 = z[1][1]; + if (!extentDomain) { + y0 = extent[0][1], y1 = extent[1][1]; + if (y.invert) y0 = y.invert(y0), y1 = y.invert(y1); + if (y1 < y0) t = y0, y0 = y1, y1 = t; + } + } + return x && y ? [ [ x0, y0 ], [ x1, y1 ] ] : x ? [ x0, x1 ] : y && [ y0, y1 ]; + } + extentDomain = [ [ 0, 0 ], [ 0, 0 ] ]; + if (x) { + x0 = z[0], x1 = z[1]; + if (y) x0 = x0[0], x1 = x1[0]; + extentDomain[0][0] = x0, extentDomain[1][0] = x1; + if (x.invert) x0 = x(x0), x1 = x(x1); + if (x1 < x0) t = x0, x0 = x1, x1 = t; + extent[0][0] = x0 | 0, extent[1][0] = x1 | 0; + } + if (y) { + y0 = z[0], y1 = z[1]; + if (x) y0 = y0[1], y1 = y1[1]; + extentDomain[0][1] = y0, extentDomain[1][1] = y1; + if (y.invert) y0 = y(y0), y1 = y(y1); + if (y1 < y0) t = y0, y0 = y1, y1 = t; + extent[0][1] = y0 | 0, extent[1][1] = y1 | 0; + } + return brush; + }; + brush.clear = function() { + extentDomain = null; + extent[0][0] = extent[0][1] = extent[1][0] = extent[1][1] = 0; + return brush; + }; + brush.empty = function() { + return x && extent[0][0] === extent[1][0] || y && extent[0][1] === extent[1][1]; + }; + return d3.rebind(brush, event, "on"); + }; + var d3_svg_brushCursor = { + n: "ns-resize", + e: "ew-resize", + s: "ns-resize", + w: "ew-resize", + nw: "nwse-resize", + ne: "nesw-resize", + se: "nwse-resize", + sw: "nesw-resize" + }; + var d3_svg_brushResizes = [ [ "n", "e", "s", "w", "nw", "ne", "se", "sw" ], [ "e", "w" ], [ "n", "s" ], [] ]; + d3.behavior = {}; + d3.behavior.drag = function() { + function drag() { + this.on("mousedown.drag", mousedown).on("touchstart.drag", mousedown); + } + function mousedown() { + function point() { + var p = target.parentNode; + return touchId ? d3.touches(p).filter(function(p) { + return p.identifier === touchId; + })[0] : d3.mouse(p); + } + function dragmove() { + if (!target.parentNode) return dragend(); + var p = point(), dx = p[0] - origin_[0], dy = p[1] - origin_[1]; + moved |= dx | dy; + origin_ = p; + d3_eventCancel(); + event_({ + type: "drag", + x: p[0] + offset[0], + y: p[1] + offset[1], + dx: dx, + dy: dy + }); + } + function dragend() { + event_({ + type: "dragend" + }); + if (moved) { + d3_eventCancel(); + if (d3.event.target === eventTarget) w.on("click.drag", click, true); + } + w.on(touchId ? "touchmove.drag-" + touchId : "mousemove.drag", null).on(touchId ? "touchend.drag-" + touchId : "mouseup.drag", null); + } + function click() { + d3_eventCancel(); + w.on("click.drag", null); + } + var target = this, event_ = event.of(target, arguments), eventTarget = d3.event.target, touchId = d3.event.touches && d3.event.changedTouches[0].identifier, offset, origin_ = point(), moved = 0; + var w = d3.select(window).on(touchId ? "touchmove.drag-" + touchId : "mousemove.drag", dragmove).on(touchId ? "touchend.drag-" + touchId : "mouseup.drag", dragend, true); + if (origin) { + offset = origin.apply(target, arguments); + offset = [ offset.x - origin_[0], offset.y - origin_[1] ]; + } else { + offset = [ 0, 0 ]; + } + if (!touchId) d3_eventCancel(); + event_({ + type: "dragstart" + }); + } + var event = d3_eventDispatch(drag, "drag", "dragstart", "dragend"), origin = null; + drag.origin = function(x) { + if (!arguments.length) return origin; + origin = x; + return drag; + }; + return d3.rebind(drag, event, "on"); + }; + d3.behavior.zoom = function() { + function zoom() { + this.on("mousedown.zoom", mousedown).on("mousewheel.zoom", mousewheel).on("mousemove.zoom", mousemove).on("DOMMouseScroll.zoom", mousewheel).on("dblclick.zoom", dblclick).on("touchstart.zoom", touchstart).on("touchmove.zoom", touchmove).on("touchend.zoom", touchstart); + } + function location(p) { + return [ (p[0] - translate[0]) / scale, (p[1] - translate[1]) / scale ]; + } + function point(l) { + return [ l[0] * scale + translate[0], l[1] * scale + translate[1] ]; + } + function scaleTo(s) { + scale = Math.max(scaleExtent[0], Math.min(scaleExtent[1], s)); + } + function translateTo(p, l) { + l = point(l); + translate[0] += p[0] - l[0]; + translate[1] += p[1] - l[1]; + } + function dispatch(event) { + if (x1) x1.domain(x0.range().map(function(x) { + return (x - translate[0]) / scale; + }).map(x0.invert)); + if (y1) y1.domain(y0.range().map(function(y) { + return (y - translate[1]) / scale; + }).map(y0.invert)); + d3.event.preventDefault(); + event({ + type: "zoom", + scale: scale, + translate: translate + }); + } + function mousedown() { + function mousemove() { + moved = 1; + translateTo(d3.mouse(target), l); + dispatch(event_); + } + function mouseup() { + if (moved) d3_eventCancel(); + w.on("mousemove.zoom", null).on("mouseup.zoom", null); + if (moved && d3.event.target === eventTarget) w.on("click.zoom", click, true); + } + function click() { + d3_eventCancel(); + w.on("click.zoom", null); + } + var target = this, event_ = event.of(target, arguments), eventTarget = d3.event.target, moved = 0, w = d3.select(window).on("mousemove.zoom", mousemove).on("mouseup.zoom", mouseup), l = location(d3.mouse(target)); + window.focus(); + d3_eventCancel(); + } + function mousewheel() { + if (!translate0) translate0 = location(d3.mouse(this)); + scaleTo(Math.pow(2, d3_behavior_zoomDelta() * .002) * scale); + translateTo(d3.mouse(this), translate0); + dispatch(event.of(this, arguments)); + } + function mousemove() { + translate0 = null; + } + function dblclick() { + var p = d3.mouse(this), l = location(p); + scaleTo(d3.event.shiftKey ? scale / 2 : scale * 2); + translateTo(p, l); + dispatch(event.of(this, arguments)); + } + function touchstart() { + var touches = d3.touches(this), now = Date.now(); + scale0 = scale; + translate0 = {}; + touches.forEach(function(t) { + translate0[t.identifier] = location(t); + }); + d3_eventCancel(); + if (touches.length === 1) { + if (now - touchtime < 500) { + var p = touches[0], l = location(touches[0]); + scaleTo(scale * 2); + translateTo(p, l); + dispatch(event.of(this, arguments)); + } + touchtime = now; + } + } + function touchmove() { + var touches = d3.touches(this), p0 = touches[0], l0 = translate0[p0.identifier]; + if (p1 = touches[1]) { + var p1, l1 = translate0[p1.identifier]; + p0 = [ (p0[0] + p1[0]) / 2, (p0[1] + p1[1]) / 2 ]; + l0 = [ (l0[0] + l1[0]) / 2, (l0[1] + l1[1]) / 2 ]; + scaleTo(d3.event.scale * scale0); + } + translateTo(p0, l0); + touchtime = null; + dispatch(event.of(this, arguments)); + } + var translate = [ 0, 0 ], translate0, scale = 1, scale0, scaleExtent = d3_behavior_zoomInfinity, event = d3_eventDispatch(zoom, "zoom"), x0, x1, y0, y1, touchtime; + zoom.translate = function(x) { + if (!arguments.length) return translate; + translate = x.map(Number); + return zoom; + }; + zoom.scale = function(x) { + if (!arguments.length) return scale; + scale = +x; + return zoom; + }; + zoom.scaleExtent = function(x) { + if (!arguments.length) return scaleExtent; + scaleExtent = x == null ? d3_behavior_zoomInfinity : x.map(Number); + return zoom; + }; + zoom.x = function(z) { + if (!arguments.length) return x1; + x1 = z; + x0 = z.copy(); + return zoom; + }; + zoom.y = function(z) { + if (!arguments.length) return y1; + y1 = z; + y0 = z.copy(); + return zoom; + }; + return d3.rebind(zoom, event, "on"); + }; + var d3_behavior_zoomDiv, d3_behavior_zoomInfinity = [ 0, Infinity ]; + d3.layout = {}; + d3.layout.bundle = function() { + return function(links) { + var paths = [], i = -1, n = links.length; + while (++i < n) paths.push(d3_layout_bundlePath(links[i])); + return paths; + }; + }; + d3.layout.chord = function() { + function relayout() { + var subgroups = {}, groupSums = [], groupIndex = d3.range(n), subgroupIndex = [], k, x, x0, i, j; + chords = []; + groups = []; + k = 0, i = -1; + while (++i < n) { + x = 0, j = -1; + while (++j < n) { + x += matrix[i][j]; + } + groupSums.push(x); + subgroupIndex.push(d3.range(n)); + k += x; + } + if (sortGroups) { + groupIndex.sort(function(a, b) { + return sortGroups(groupSums[a], groupSums[b]); + }); + } + if (sortSubgroups) { + subgroupIndex.forEach(function(d, i) { + d.sort(function(a, b) { + return sortSubgroups(matrix[i][a], matrix[i][b]); + }); + }); + } + k = (2 * Math.PI - padding * n) / k; + x = 0, i = -1; + while (++i < n) { + x0 = x, j = -1; + while (++j < n) { + var di = groupIndex[i], dj = subgroupIndex[di][j], v = matrix[di][dj], a0 = x, a1 = x += v * k; + subgroups[di + "-" + dj] = { + index: di, + subindex: dj, + startAngle: a0, + endAngle: a1, + value: v + }; + } + groups[di] = { + index: di, + startAngle: x0, + endAngle: x, + value: (x - x0) / k + }; + x += padding; + } + i = -1; + while (++i < n) { + j = i - 1; + while (++j < n) { + var source = subgroups[i + "-" + j], target = subgroups[j + "-" + i]; + if (source.value || target.value) { + chords.push(source.value < target.value ? { + source: target, + target: source + } : { + source: source, + target: target + }); + } + } + } + if (sortChords) resort(); + } + function resort() { + chords.sort(function(a, b) { + return sortChords((a.source.value + a.target.value) / 2, (b.source.value + b.target.value) / 2); + }); + } + var chord = {}, chords, groups, matrix, n, padding = 0, sortGroups, sortSubgroups, sortChords; + chord.matrix = function(x) { + if (!arguments.length) return matrix; + n = (matrix = x) && matrix.length; + chords = groups = null; + return chord; + }; + chord.padding = function(x) { + if (!arguments.length) return padding; + padding = x; + chords = groups = null; + return chord; + }; + chord.sortGroups = function(x) { + if (!arguments.length) return sortGroups; + sortGroups = x; + chords = groups = null; + return chord; + }; + chord.sortSubgroups = function(x) { + if (!arguments.length) return sortSubgroups; + sortSubgroups = x; + chords = null; + return chord; + }; + chord.sortChords = function(x) { + if (!arguments.length) return sortChords; + sortChords = x; + if (chords) resort(); + return chord; + }; + chord.chords = function() { + if (!chords) relayout(); + return chords; + }; + chord.groups = function() { + if (!groups) relayout(); + return groups; + }; + return chord; + }; + d3.layout.force = function() { + function repulse(node) { + return function(quad, x1, y1, x2, y2) { + if (quad.point !== node) { + var dx = quad.cx - node.x, dy = quad.cy - node.y, dn = 1 / Math.sqrt(dx * dx + dy * dy); + if ((x2 - x1) * dn < theta) { + var k = quad.charge * dn * dn; + node.px -= dx * k; + node.py -= dy * k; + return true; + } + if (quad.point && isFinite(dn)) { + var k = quad.pointCharge * dn * dn; + node.px -= dx * k; + node.py -= dy * k; + } + } + return !quad.charge; + }; + } + function dragmove(d) { + d.px = d3.event.x; + d.py = d3.event.y; + force.resume(); + } + var force = {}, event = d3.dispatch("start", "tick", "end"), size = [ 1, 1 ], drag, alpha, friction = .9, linkDistance = d3_layout_forceLinkDistance, linkStrength = d3_layout_forceLinkStrength, charge = -30, gravity = .1, theta = .8, interval, nodes = [], links = [], distances, strengths, charges; + force.tick = function() { + if ((alpha *= .99) < .005) { + event.end({ + type: "end", + alpha: alpha = 0 + }); + return true; + } + var n = nodes.length, m = links.length, q, i, o, s, t, l, k, x, y; + for (i = 0; i < m; ++i) { + o = links[i]; + s = o.source; + t = o.target; + x = t.x - s.x; + y = t.y - s.y; + if (l = x * x + y * y) { + l = alpha * strengths[i] * ((l = Math.sqrt(l)) - distances[i]) / l; + x *= l; + y *= l; + t.x -= x * (k = s.weight / (t.weight + s.weight)); + t.y -= y * k; + s.x += x * (k = 1 - k); + s.y += y * k; + } + } + if (k = alpha * gravity) { + x = size[0] / 2; + y = size[1] / 2; + i = -1; + if (k) while (++i < n) { + o = nodes[i]; + o.x += (x - o.x) * k; + o.y += (y - o.y) * k; + } + } + if (charge) { + d3_layout_forceAccumulate(q = d3.geom.quadtree(nodes), alpha, charges); + i = -1; + while (++i < n) { + if (!(o = nodes[i]).fixed) { + q.visit(repulse(o)); + } + } + } + i = -1; + while (++i < n) { + o = nodes[i]; + if (o.fixed) { + o.x = o.px; + o.y = o.py; + } else { + o.x -= (o.px - (o.px = o.x)) * friction; + o.y -= (o.py - (o.py = o.y)) * friction; + } + } + event.tick({ + type: "tick", + alpha: alpha + }); + }; + force.nodes = function(x) { + if (!arguments.length) return nodes; + nodes = x; + return force; + }; + force.links = function(x) { + if (!arguments.length) return links; + links = x; + return force; + }; + force.size = function(x) { + if (!arguments.length) return size; + size = x; + return force; + }; + force.linkDistance = function(x) { + if (!arguments.length) return linkDistance; + linkDistance = d3_functor(x); + return force; + }; + force.distance = force.linkDistance; + force.linkStrength = function(x) { + if (!arguments.length) return linkStrength; + linkStrength = d3_functor(x); + return force; + }; + force.friction = function(x) { + if (!arguments.length) return friction; + friction = x; + return force; + }; + force.charge = function(x) { + if (!arguments.length) return charge; + charge = typeof x === "function" ? x : +x; + return force; + }; + force.gravity = function(x) { + if (!arguments.length) return gravity; + gravity = x; + return force; + }; + force.theta = function(x) { + if (!arguments.length) return theta; + theta = x; + return force; + }; + force.alpha = function(x) { + if (!arguments.length) return alpha; + if (alpha) { + if (x > 0) alpha = x; else alpha = 0; + } else if (x > 0) { + event.start({ + type: "start", + alpha: alpha = x + }); + d3.timer(force.tick); + } + return force; + }; + force.start = function() { + function position(dimension, size) { + var neighbors = neighbor(i), j = -1, m = neighbors.length, x; + while (++j < m) if (!isNaN(x = neighbors[j][dimension])) return x; + return Math.random() * size; + } + function neighbor() { + if (!neighbors) { + neighbors = []; + for (j = 0; j < n; ++j) { + neighbors[j] = []; + } + for (j = 0; j < m; ++j) { + var o = links[j]; + neighbors[o.source.index].push(o.target); + neighbors[o.target.index].push(o.source); + } + } + return neighbors[i]; + } + var i, j, n = nodes.length, m = links.length, w = size[0], h = size[1], neighbors, o; + for (i = 0; i < n; ++i) { + (o = nodes[i]).index = i; + o.weight = 0; + } + distances = []; + strengths = []; + for (i = 0; i < m; ++i) { + o = links[i]; + if (typeof o.source == "number") o.source = nodes[o.source]; + if (typeof o.target == "number") o.target = nodes[o.target]; + distances[i] = linkDistance.call(this, o, i); + strengths[i] = linkStrength.call(this, o, i); + ++o.source.weight; + ++o.target.weight; + } + for (i = 0; i < n; ++i) { + o = nodes[i]; + if (isNaN(o.x)) o.x = position("x", w); + if (isNaN(o.y)) o.y = position("y", h); + if (isNaN(o.px)) o.px = o.x; + if (isNaN(o.py)) o.py = o.y; + } + charges = []; + if (typeof charge === "function") { + for (i = 0; i < n; ++i) { + charges[i] = +charge.call(this, nodes[i], i); + } + } else { + for (i = 0; i < n; ++i) { + charges[i] = charge; + } + } + return force.resume(); + }; + force.resume = function() { + return force.alpha(.1); + }; + force.stop = function() { + return force.alpha(0); + }; + force.drag = function() { + if (!drag) drag = d3.behavior.drag().origin(d3_identity).on("dragstart", d3_layout_forceDragstart).on("drag", dragmove).on("dragend", d3_layout_forceDragend); + this.on("mouseover.force", d3_layout_forceMouseover).on("mouseout.force", d3_layout_forceMouseout).call(drag); + }; + return d3.rebind(force, event, "on"); + }; + d3.layout.partition = function() { + function position(node, x, dx, dy) { + var children = node.children; + node.x = x; + node.y = node.depth * dy; + node.dx = dx; + node.dy = dy; + if (children && (n = children.length)) { + var i = -1, n, c, d; + dx = node.value ? dx / node.value : 0; + while (++i < n) { + position(c = children[i], x, d = c.value * dx, dy); + x += d; + } + } + } + function depth(node) { + var children = node.children, d = 0; + if (children && (n = children.length)) { + var i = -1, n; + while (++i < n) d = Math.max(d, depth(children[i])); + } + return 1 + d; + } + function partition(d, i) { + var nodes = hierarchy.call(this, d, i); + position(nodes[0], 0, size[0], size[1] / depth(nodes[0])); + return nodes; + } + var hierarchy = d3.layout.hierarchy(), size = [ 1, 1 ]; + partition.size = function(x) { + if (!arguments.length) return size; + size = x; + return partition; + }; + return d3_layout_hierarchyRebind(partition, hierarchy); + }; + d3.layout.pie = function() { + function pie(data, i) { + var values = data.map(function(d, i) { + return +value.call(pie, d, i); + }); + var a = +(typeof startAngle === "function" ? startAngle.apply(this, arguments) : startAngle); + var k = ((typeof endAngle === "function" ? endAngle.apply(this, arguments) : endAngle) - startAngle) / d3.sum(values); + var index = d3.range(data.length); + if (sort != null) index.sort(sort === d3_layout_pieSortByValue ? function(i, j) { + return values[j] - values[i]; + } : function(i, j) { + return sort(data[i], data[j]); + }); + var arcs = []; + index.forEach(function(i) { + var d; + arcs[i] = { + data: data[i], + value: d = values[i], + startAngle: a, + endAngle: a += d * k + }; + }); + return arcs; + } + var value = Number, sort = d3_layout_pieSortByValue, startAngle = 0, endAngle = 2 * Math.PI; + pie.value = function(x) { + if (!arguments.length) return value; + value = x; + return pie; + }; + pie.sort = function(x) { + if (!arguments.length) return sort; + sort = x; + return pie; + }; + pie.startAngle = function(x) { + if (!arguments.length) return startAngle; + startAngle = x; + return pie; + }; + pie.endAngle = function(x) { + if (!arguments.length) return endAngle; + endAngle = x; + return pie; + }; + return pie; + }; + var d3_layout_pieSortByValue = {}; + d3.layout.stack = function() { + function stack(data, index) { + var series = data.map(function(d, i) { + return values.call(stack, d, i); + }); + var points = series.map(function(d, i) { + return d.map(function(v, i) { + return [ x.call(stack, v, i), y.call(stack, v, i) ]; + }); + }); + var orders = order.call(stack, points, index); + series = d3.permute(series, orders); + points = d3.permute(points, orders); + var offsets = offset.call(stack, points, index); + var n = series.length, m = series[0].length, i, j, o; + for (j = 0; j < m; ++j) { + out.call(stack, series[0][j], o = offsets[j], points[0][j][1]); + for (i = 1; i < n; ++i) { + out.call(stack, series[i][j], o += points[i - 1][j][1], points[i][j][1]); + } + } + return data; + } + var values = d3_identity, order = d3_layout_stackOrderDefault, offset = d3_layout_stackOffsetZero, out = d3_layout_stackOut, x = d3_layout_stackX, y = d3_layout_stackY; + stack.values = function(x) { + if (!arguments.length) return values; + values = x; + return stack; + }; + stack.order = function(x) { + if (!arguments.length) return order; + order = typeof x === "function" ? x : d3_layout_stackOrders.get(x) || d3_layout_stackOrderDefault; + return stack; + }; + stack.offset = function(x) { + if (!arguments.length) return offset; + offset = typeof x === "function" ? x : d3_layout_stackOffsets.get(x) || d3_layout_stackOffsetZero; + return stack; + }; + stack.x = function(z) { + if (!arguments.length) return x; + x = z; + return stack; + }; + stack.y = function(z) { + if (!arguments.length) return y; + y = z; + return stack; + }; + stack.out = function(z) { + if (!arguments.length) return out; + out = z; + return stack; + }; + return stack; + }; + var d3_layout_stackOrders = d3.map({ + "inside-out": function(data) { + var n = data.length, i, j, max = data.map(d3_layout_stackMaxIndex), sums = data.map(d3_layout_stackReduceSum), index = d3.range(n).sort(function(a, b) { + return max[a] - max[b]; + }), top = 0, bottom = 0, tops = [], bottoms = []; + for (i = 0; i < n; ++i) { + j = index[i]; + if (top < bottom) { + top += sums[j]; + tops.push(j); + } else { + bottom += sums[j]; + bottoms.push(j); + } + } + return bottoms.reverse().concat(tops); + }, + reverse: function(data) { + return d3.range(data.length).reverse(); + }, + "default": d3_layout_stackOrderDefault + }); + var d3_layout_stackOffsets = d3.map({ + silhouette: function(data) { + var n = data.length, m = data[0].length, sums = [], max = 0, i, j, o, y0 = []; + for (j = 0; j < m; ++j) { + for (i = 0, o = 0; i < n; i++) o += data[i][j][1]; + if (o > max) max = o; + sums.push(o); + } + for (j = 0; j < m; ++j) { + y0[j] = (max - sums[j]) / 2; + } + return y0; + }, + wiggle: function(data) { + var n = data.length, x = data[0], m = x.length, max = 0, i, j, k, s1, s2, s3, dx, o, o0, y0 = []; + y0[0] = o = o0 = 0; + for (j = 1; j < m; ++j) { + for (i = 0, s1 = 0; i < n; ++i) s1 += data[i][j][1]; + for (i = 0, s2 = 0, dx = x[j][0] - x[j - 1][0]; i < n; ++i) { + for (k = 0, s3 = (data[i][j][1] - data[i][j - 1][1]) / (2 * dx); k < i; ++k) { + s3 += (data[k][j][1] - data[k][j - 1][1]) / dx; + } + s2 += s3 * data[i][j][1]; + } + y0[j] = o -= s1 ? s2 / s1 * dx : 0; + if (o < o0) o0 = o; + } + for (j = 0; j < m; ++j) y0[j] -= o0; + return y0; + }, + expand: function(data) { + var n = data.length, m = data[0].length, k = 1 / n, i, j, o, y0 = []; + for (j = 0; j < m; ++j) { + for (i = 0, o = 0; i < n; i++) o += data[i][j][1]; + if (o) for (i = 0; i < n; i++) data[i][j][1] /= o; else for (i = 0; i < n; i++) data[i][j][1] = k; + } + for (j = 0; j < m; ++j) y0[j] = 0; + return y0; + }, + zero: d3_layout_stackOffsetZero + }); + d3.layout.histogram = function() { + function histogram(data, i) { + var bins = [], values = data.map(valuer, this), range = ranger.call(this, values, i), thresholds = binner.call(this, range, values, i), bin, i = -1, n = values.length, m = thresholds.length - 1, k = frequency ? 1 : 1 / n, x; + while (++i < m) { + bin = bins[i] = []; + bin.dx = thresholds[i + 1] - (bin.x = thresholds[i]); + bin.y = 0; + } + if (m > 0) { + i = -1; + while (++i < n) { + x = values[i]; + if (x >= range[0] && x <= range[1]) { + bin = bins[d3.bisect(thresholds, x, 1, m) - 1]; + bin.y += k; + bin.push(data[i]); + } + } + } + return bins; + } + var frequency = true, valuer = Number, ranger = d3_layout_histogramRange, binner = d3_layout_histogramBinSturges; + histogram.value = function(x) { + if (!arguments.length) return valuer; + valuer = x; + return histogram; + }; + histogram.range = function(x) { + if (!arguments.length) return ranger; + ranger = d3_functor(x); + return histogram; + }; + histogram.bins = function(x) { + if (!arguments.length) return binner; + binner = typeof x === "number" ? function(range) { + return d3_layout_histogramBinFixed(range, x); + } : d3_functor(x); + return histogram; + }; + histogram.frequency = function(x) { + if (!arguments.length) return frequency; + frequency = !!x; + return histogram; + }; + return histogram; + }; + d3.layout.hierarchy = function() { + function recurse(data, depth, nodes) { + var childs = children.call(hierarchy, data, depth), node = d3_layout_hierarchyInline ? data : { + data: data + }; + node.depth = depth; + nodes.push(node); + if (childs && (n = childs.length)) { + var i = -1, n, c = node.children = [], v = 0, j = depth + 1, d; + while (++i < n) { + d = recurse(childs[i], j, nodes); + d.parent = node; + c.push(d); + v += d.value; + } + if (sort) c.sort(sort); + if (value) node.value = v; + } else if (value) { + node.value = +value.call(hierarchy, data, depth) || 0; + } + return node; + } + function revalue(node, depth) { + var children = node.children, v = 0; + if (children && (n = children.length)) { + var i = -1, n, j = depth + 1; + while (++i < n) v += revalue(children[i], j); + } else if (value) { + v = +value.call(hierarchy, d3_layout_hierarchyInline ? node : node.data, depth) || 0; + } + if (value) node.value = v; + return v; + } + function hierarchy(d) { + var nodes = []; + recurse(d, 0, nodes); + return nodes; + } + var sort = d3_layout_hierarchySort, children = d3_layout_hierarchyChildren, value = d3_layout_hierarchyValue; + hierarchy.sort = function(x) { + if (!arguments.length) return sort; + sort = x; + return hierarchy; + }; + hierarchy.children = function(x) { + if (!arguments.length) return children; + children = x; + return hierarchy; + }; + hierarchy.value = function(x) { + if (!arguments.length) return value; + value = x; + return hierarchy; + }; + hierarchy.revalue = function(root) { + revalue(root, 0); + return root; + }; + return hierarchy; + }; + var d3_layout_hierarchyInline = false; + d3.layout.pack = function() { + function pack(d, i) { + var nodes = hierarchy.call(this, d, i), root = nodes[0]; + root.x = 0; + root.y = 0; + d3_layout_treeVisitAfter(root, function(d) { + d.r = Math.sqrt(d.value); + }); + d3_layout_treeVisitAfter(root, d3_layout_packSiblings); + var w = size[0], h = size[1], k = Math.max(2 * root.r / w, 2 * root.r / h); + if (padding > 0) { + var dr = padding * k / 2; + d3_layout_treeVisitAfter(root, function(d) { + d.r += dr; + }); + d3_layout_treeVisitAfter(root, d3_layout_packSiblings); + d3_layout_treeVisitAfter(root, function(d) { + d.r -= dr; + }); + k = Math.max(2 * root.r / w, 2 * root.r / h); + } + d3_layout_packTransform(root, w / 2, h / 2, 1 / k); + return nodes; + } + var hierarchy = d3.layout.hierarchy().sort(d3_layout_packSort), padding = 0, size = [ 1, 1 ]; + pack.size = function(x) { + if (!arguments.length) return size; + size = x; + return pack; + }; + pack.padding = function(_) { + if (!arguments.length) return padding; + padding = +_; + return pack; + }; + return d3_layout_hierarchyRebind(pack, hierarchy); + }; + d3.layout.cluster = function() { + function cluster(d, i) { + var nodes = hierarchy.call(this, d, i), root = nodes[0], previousNode, x = 0, kx, ky; + d3_layout_treeVisitAfter(root, function(node) { + var children = node.children; + if (children && children.length) { + node.x = d3_layout_clusterX(children); + node.y = d3_layout_clusterY(children); + } else { + node.x = previousNode ? x += separation(node, previousNode) : 0; + node.y = 0; + previousNode = node; + } + }); + var left = d3_layout_clusterLeft(root), right = d3_layout_clusterRight(root), x0 = left.x - separation(left, right) / 2, x1 = right.x + separation(right, left) / 2; + d3_layout_treeVisitAfter(root, function(node) { + node.x = (node.x - x0) / (x1 - x0) * size[0]; + node.y = (1 - (root.y ? node.y / root.y : 1)) * size[1]; + }); + return nodes; + } + var hierarchy = d3.layout.hierarchy().sort(null).value(null), separation = d3_layout_treeSeparation, size = [ 1, 1 ]; + cluster.separation = function(x) { + if (!arguments.length) return separation; + separation = x; + return cluster; + }; + cluster.size = function(x) { + if (!arguments.length) return size; + size = x; + return cluster; + }; + return d3_layout_hierarchyRebind(cluster, hierarchy); + }; + d3.layout.tree = function() { + function tree(d, i) { + function firstWalk(node, previousSibling) { + var children = node.children, layout = node._tree; + if (children && (n = children.length)) { + var n, firstChild = children[0], previousChild, ancestor = firstChild, child, i = -1; + while (++i < n) { + child = children[i]; + firstWalk(child, previousChild); + ancestor = apportion(child, previousChild, ancestor); + previousChild = child; + } + d3_layout_treeShift(node); + var midpoint = .5 * (firstChild._tree.prelim + child._tree.prelim); + if (previousSibling) { + layout.prelim = previousSibling._tree.prelim + separation(node, previousSibling); + layout.mod = layout.prelim - midpoint; + } else { + layout.prelim = midpoint; + } + } else { + if (previousSibling) { + layout.prelim = previousSibling._tree.prelim + separation(node, previousSibling); + } + } + } + function secondWalk(node, x) { + node.x = node._tree.prelim + x; + var children = node.children; + if (children && (n = children.length)) { + var i = -1, n; + x += node._tree.mod; + while (++i < n) { + secondWalk(children[i], x); + } + } + } + function apportion(node, previousSibling, ancestor) { + if (previousSibling) { + var vip = node, vop = node, vim = previousSibling, vom = node.parent.children[0], sip = vip._tree.mod, sop = vop._tree.mod, sim = vim._tree.mod, som = vom._tree.mod, shift; + while (vim = d3_layout_treeRight(vim), vip = d3_layout_treeLeft(vip), vim && vip) { + vom = d3_layout_treeLeft(vom); + vop = d3_layout_treeRight(vop); + vop._tree.ancestor = node; + shift = vim._tree.prelim + sim - vip._tree.prelim - sip + separation(vim, vip); + if (shift > 0) { + d3_layout_treeMove(d3_layout_treeAncestor(vim, node, ancestor), node, shift); + sip += shift; + sop += shift; + } + sim += vim._tree.mod; + sip += vip._tree.mod; + som += vom._tree.mod; + sop += vop._tree.mod; + } + if (vim && !d3_layout_treeRight(vop)) { + vop._tree.thread = vim; + vop._tree.mod += sim - sop; + } + if (vip && !d3_layout_treeLeft(vom)) { + vom._tree.thread = vip; + vom._tree.mod += sip - som; + ancestor = node; + } + } + return ancestor; + } + var nodes = hierarchy.call(this, d, i), root = nodes[0]; + d3_layout_treeVisitAfter(root, function(node, previousSibling) { + node._tree = { + ancestor: node, + prelim: 0, + mod: 0, + change: 0, + shift: 0, + number: previousSibling ? previousSibling._tree.number + 1 : 0 + }; + }); + firstWalk(root); + secondWalk(root, -root._tree.prelim); + var left = d3_layout_treeSearch(root, d3_layout_treeLeftmost), right = d3_layout_treeSearch(root, d3_layout_treeRightmost), deep = d3_layout_treeSearch(root, d3_layout_treeDeepest), x0 = left.x - separation(left, right) / 2, x1 = right.x + separation(right, left) / 2, y1 = deep.depth || 1; + d3_layout_treeVisitAfter(root, function(node) { + node.x = (node.x - x0) / (x1 - x0) * size[0]; + node.y = node.depth / y1 * size[1]; + delete node._tree; + }); + return nodes; + } + var hierarchy = d3.layout.hierarchy().sort(null).value(null), separation = d3_layout_treeSeparation, size = [ 1, 1 ]; + tree.separation = function(x) { + if (!arguments.length) return separation; + separation = x; + return tree; + }; + tree.size = function(x) { + if (!arguments.length) return size; + size = x; + return tree; + }; + return d3_layout_hierarchyRebind(tree, hierarchy); + }; + d3.layout.treemap = function() { + function scale(children, k) { + var i = -1, n = children.length, child, area; + while (++i < n) { + area = (child = children[i]).value * (k < 0 ? 0 : k); + child.area = isNaN(area) || area <= 0 ? 0 : area; + } + } + function squarify(node) { + var children = node.children; + if (children && children.length) { + var rect = pad(node), row = [], remaining = children.slice(), child, best = Infinity, score, u = Math.min(rect.dx, rect.dy), n; + scale(remaining, rect.dx * rect.dy / node.value); + row.area = 0; + while ((n = remaining.length) > 0) { + row.push(child = remaining[n - 1]); + row.area += child.area; + if ((score = worst(row, u)) <= best) { + remaining.pop(); + best = score; + } else { + row.area -= row.pop().area; + position(row, u, rect, false); + u = Math.min(rect.dx, rect.dy); + row.length = row.area = 0; + best = Infinity; + } + } + if (row.length) { + position(row, u, rect, true); + row.length = row.area = 0; + } + children.forEach(squarify); + } + } + function stickify(node) { + var children = node.children; + if (children && children.length) { + var rect = pad(node), remaining = children.slice(), child, row = []; + scale(remaining, rect.dx * rect.dy / node.value); + row.area = 0; + while (child = remaining.pop()) { + row.push(child); + row.area += child.area; + if (child.z != null) { + position(row, child.z ? rect.dx : rect.dy, rect, !remaining.length); + row.length = row.area = 0; + } + } + children.forEach(stickify); + } + } + function worst(row, u) { + var s = row.area, r, rmax = 0, rmin = Infinity, i = -1, n = row.length; + while (++i < n) { + if (!(r = row[i].area)) continue; + if (r < rmin) rmin = r; + if (r > rmax) rmax = r; + } + s *= s; + u *= u; + return s ? Math.max(u * rmax * ratio / s, s / (u * rmin * ratio)) : Infinity; + } + function position(row, u, rect, flush) { + var i = -1, n = row.length, x = rect.x, y = rect.y, v = u ? round(row.area / u) : 0, o; + if (u == rect.dx) { + if (flush || v > rect.dy) v = rect.dy; + while (++i < n) { + o = row[i]; + o.x = x; + o.y = y; + o.dy = v; + x += o.dx = Math.min(rect.x + rect.dx - x, v ? round(o.area / v) : 0); + } + o.z = true; + o.dx += rect.x + rect.dx - x; + rect.y += v; + rect.dy -= v; + } else { + if (flush || v > rect.dx) v = rect.dx; + while (++i < n) { + o = row[i]; + o.x = x; + o.y = y; + o.dx = v; + y += o.dy = Math.min(rect.y + rect.dy - y, v ? round(o.area / v) : 0); + } + o.z = false; + o.dy += rect.y + rect.dy - y; + rect.x += v; + rect.dx -= v; + } + } + function treemap(d) { + var nodes = stickies || hierarchy(d), root = nodes[0]; + root.x = 0; + root.y = 0; + root.dx = size[0]; + root.dy = size[1]; + if (stickies) hierarchy.revalue(root); + scale([ root ], root.dx * root.dy / root.value); + (stickies ? stickify : squarify)(root); + if (sticky) stickies = nodes; + return nodes; + } + var hierarchy = d3.layout.hierarchy(), round = Math.round, size = [ 1, 1 ], padding = null, pad = d3_layout_treemapPadNull, sticky = false, stickies, ratio = .5 * (1 + Math.sqrt(5)); + treemap.size = function(x) { + if (!arguments.length) return size; + size = x; + return treemap; + }; + treemap.padding = function(x) { + function padFunction(node) { + var p = x.call(treemap, node, node.depth); + return p == null ? d3_layout_treemapPadNull(node) : d3_layout_treemapPad(node, typeof p === "number" ? [ p, p, p, p ] : p); + } + function padConstant(node) { + return d3_layout_treemapPad(node, x); + } + if (!arguments.length) return padding; + var type; + pad = (padding = x) == null ? d3_layout_treemapPadNull : (type = typeof x) === "function" ? padFunction : type === "number" ? (x = [ x, x, x, x ], padConstant) : padConstant; + return treemap; + }; + treemap.round = function(x) { + if (!arguments.length) return round != Number; + round = x ? Math.round : Number; + return treemap; + }; + treemap.sticky = function(x) { + if (!arguments.length) return sticky; + sticky = x; + stickies = null; + return treemap; + }; + treemap.ratio = function(x) { + if (!arguments.length) return ratio; + ratio = x; + return treemap; + }; + return d3_layout_hierarchyRebind(treemap, hierarchy); + }; + d3.csv = d3_dsv(",", "text/csv"); + d3.tsv = d3_dsv("\t", "text/tab-separated-values"); + d3.geo = {}; + var d3_geo_radians = Math.PI / 180; + d3.geo.azimuthal = function() { + function azimuthal(coordinates) { + var x1 = coordinates[0] * d3_geo_radians - x0, y1 = coordinates[1] * d3_geo_radians, cx1 = Math.cos(x1), sx1 = Math.sin(x1), cy1 = Math.cos(y1), sy1 = Math.sin(y1), cc = mode !== "orthographic" ? sy0 * sy1 + cy0 * cy1 * cx1 : null, c, k = mode === "stereographic" ? 1 / (1 + cc) : mode === "gnomonic" ? 1 / cc : mode === "equidistant" ? (c = Math.acos(cc), c ? c / Math.sin(c) : 0) : mode === "equalarea" ? Math.sqrt(2 / (1 + cc)) : 1, x = k * cy1 * sx1, y = k * (sy0 * cy1 * cx1 - cy0 * sy1); + return [ scale * x + translate[0], scale * y + translate[1] ]; + } + var mode = "orthographic", origin, scale = 200, translate = [ 480, 250 ], x0, y0, cy0, sy0; + azimuthal.invert = function(coordinates) { + var x = (coordinates[0] - translate[0]) / scale, y = (coordinates[1] - translate[1]) / scale, p = Math.sqrt(x * x + y * y), c = mode === "stereographic" ? 2 * Math.atan(p) : mode === "gnomonic" ? Math.atan(p) : mode === "equidistant" ? p : mode === "equalarea" ? 2 * Math.asin(.5 * p) : Math.asin(p), sc = Math.sin(c), cc = Math.cos(c); + return [ (x0 + Math.atan2(x * sc, p * cy0 * cc + y * sy0 * sc)) / d3_geo_radians, Math.asin(cc * sy0 - (p ? y * sc * cy0 / p : 0)) / d3_geo_radians ]; + }; + azimuthal.mode = function(x) { + if (!arguments.length) return mode; + mode = x + ""; + return azimuthal; + }; + azimuthal.origin = function(x) { + if (!arguments.length) return origin; + origin = x; + x0 = origin[0] * d3_geo_radians; + y0 = origin[1] * d3_geo_radians; + cy0 = Math.cos(y0); + sy0 = Math.sin(y0); + return azimuthal; + }; + azimuthal.scale = function(x) { + if (!arguments.length) return scale; + scale = +x; + return azimuthal; + }; + azimuthal.translate = function(x) { + if (!arguments.length) return translate; + translate = [ +x[0], +x[1] ]; + return azimuthal; + }; + return azimuthal.origin([ 0, 0 ]); + }; + d3.geo.albers = function() { + function albers(coordinates) { + var t = n * (d3_geo_radians * coordinates[0] - lng0), p = Math.sqrt(C - 2 * n * Math.sin(d3_geo_radians * coordinates[1])) / n; + return [ scale * p * Math.sin(t) + translate[0], scale * (p * Math.cos(t) - p0) + translate[1] ]; + } + function reload() { + var phi1 = d3_geo_radians * parallels[0], phi2 = d3_geo_radians * parallels[1], lat0 = d3_geo_radians * origin[1], s = Math.sin(phi1), c = Math.cos(phi1); + lng0 = d3_geo_radians * origin[0]; + n = .5 * (s + Math.sin(phi2)); + C = c * c + 2 * n * s; + p0 = Math.sqrt(C - 2 * n * Math.sin(lat0)) / n; + return albers; + } + var origin = [ -98, 38 ], parallels = [ 29.5, 45.5 ], scale = 1e3, translate = [ 480, 250 ], lng0, n, C, p0; + albers.invert = function(coordinates) { + var x = (coordinates[0] - translate[0]) / scale, y = (coordinates[1] - translate[1]) / scale, p0y = p0 + y, t = Math.atan2(x, p0y), p = Math.sqrt(x * x + p0y * p0y); + return [ (lng0 + t / n) / d3_geo_radians, Math.asin((C - p * p * n * n) / (2 * n)) / d3_geo_radians ]; + }; + albers.origin = function(x) { + if (!arguments.length) return origin; + origin = [ +x[0], +x[1] ]; + return reload(); + }; + albers.parallels = function(x) { + if (!arguments.length) return parallels; + parallels = [ +x[0], +x[1] ]; + return reload(); + }; + albers.scale = function(x) { + if (!arguments.length) return scale; + scale = +x; + return albers; + }; + albers.translate = function(x) { + if (!arguments.length) return translate; + translate = [ +x[0], +x[1] ]; + return albers; + }; + return reload(); + }; + d3.geo.albersUsa = function() { + function albersUsa(coordinates) { + var lon = coordinates[0], lat = coordinates[1]; + return (lat > 50 ? alaska : lon < -140 ? hawaii : lat < 21 ? puertoRico : lower48)(coordinates); + } + var lower48 = d3.geo.albers(); + var alaska = d3.geo.albers().origin([ -160, 60 ]).parallels([ 55, 65 ]); + var hawaii = d3.geo.albers().origin([ -160, 20 ]).parallels([ 8, 18 ]); + var puertoRico = d3.geo.albers().origin([ -60, 10 ]).parallels([ 8, 18 ]); + albersUsa.scale = function(x) { + if (!arguments.length) return lower48.scale(); + lower48.scale(x); + alaska.scale(x * .6); + hawaii.scale(x); + puertoRico.scale(x * 1.5); + return albersUsa.translate(lower48.translate()); + }; + albersUsa.translate = function(x) { + if (!arguments.length) return lower48.translate(); + var dz = lower48.scale() / 1e3, dx = x[0], dy = x[1]; + lower48.translate(x); + alaska.translate([ dx - 400 * dz, dy + 170 * dz ]); + hawaii.translate([ dx - 190 * dz, dy + 200 * dz ]); + puertoRico.translate([ dx + 580 * dz, dy + 430 * dz ]); + return albersUsa; + }; + return albersUsa.scale(lower48.scale()); + }; + d3.geo.bonne = function() { + function bonne(coordinates) { + var x = coordinates[0] * d3_geo_radians - x0, y = coordinates[1] * d3_geo_radians - y0; + if (y1) { + var p = c1 + y1 - y, E = x * Math.cos(y) / p; + x = p * Math.sin(E); + y = p * Math.cos(E) - c1; + } else { + x *= Math.cos(y); + y *= -1; + } + return [ scale * x + translate[0], scale * y + translate[1] ]; + } + var scale = 200, translate = [ 480, 250 ], x0, y0, y1, c1; + bonne.invert = function(coordinates) { + var x = (coordinates[0] - translate[0]) / scale, y = (coordinates[1] - translate[1]) / scale; + if (y1) { + var c = c1 + y, p = Math.sqrt(x * x + c * c); + y = c1 + y1 - p; + x = x0 + p * Math.atan2(x, c) / Math.cos(y); + } else { + y *= -1; + x /= Math.cos(y); + } + return [ x / d3_geo_radians, y / d3_geo_radians ]; + }; + bonne.parallel = function(x) { + if (!arguments.length) return y1 / d3_geo_radians; + c1 = 1 / Math.tan(y1 = x * d3_geo_radians); + return bonne; + }; + bonne.origin = function(x) { + if (!arguments.length) return [ x0 / d3_geo_radians, y0 / d3_geo_radians ]; + x0 = x[0] * d3_geo_radians; + y0 = x[1] * d3_geo_radians; + return bonne; + }; + bonne.scale = function(x) { + if (!arguments.length) return scale; + scale = +x; + return bonne; + }; + bonne.translate = function(x) { + if (!arguments.length) return translate; + translate = [ +x[0], +x[1] ]; + return bonne; + }; + return bonne.origin([ 0, 0 ]).parallel(45); + }; + d3.geo.equirectangular = function() { + function equirectangular(coordinates) { + var x = coordinates[0] / 360, y = -coordinates[1] / 360; + return [ scale * x + translate[0], scale * y + translate[1] ]; + } + var scale = 500, translate = [ 480, 250 ]; + equirectangular.invert = function(coordinates) { + var x = (coordinates[0] - translate[0]) / scale, y = (coordinates[1] - translate[1]) / scale; + return [ 360 * x, -360 * y ]; + }; + equirectangular.scale = function(x) { + if (!arguments.length) return scale; + scale = +x; + return equirectangular; + }; + equirectangular.translate = function(x) { + if (!arguments.length) return translate; + translate = [ +x[0], +x[1] ]; + return equirectangular; + }; + return equirectangular; + }; + d3.geo.mercator = function() { + function mercator(coordinates) { + var x = coordinates[0] / 360, y = -(Math.log(Math.tan(Math.PI / 4 + coordinates[1] * d3_geo_radians / 2)) / d3_geo_radians) / 360; + return [ scale * x + translate[0], scale * Math.max(-.5, Math.min(.5, y)) + translate[1] ]; + } + var scale = 500, translate = [ 480, 250 ]; + mercator.invert = function(coordinates) { + var x = (coordinates[0] - translate[0]) / scale, y = (coordinates[1] - translate[1]) / scale; + return [ 360 * x, 2 * Math.atan(Math.exp(-360 * y * d3_geo_radians)) / d3_geo_radians - 90 ]; + }; + mercator.scale = function(x) { + if (!arguments.length) return scale; + scale = +x; + return mercator; + }; + mercator.translate = function(x) { + if (!arguments.length) return translate; + translate = [ +x[0], +x[1] ]; + return mercator; + }; + return mercator; + }; + d3.geo.path = function() { + function path(d, i) { + if (typeof pointRadius === "function") pointCircle = d3_path_circle(pointRadius.apply(this, arguments)); + pathType(d); + var result = buffer.length ? buffer.join("") : null; + buffer = []; + return result; + } + function project(coordinates) { + return projection(coordinates).join(","); + } + function polygonArea(coordinates) { + var sum = area(coordinates[0]), i = 0, n = coordinates.length; + while (++i < n) sum -= area(coordinates[i]); + return sum; + } + function polygonCentroid(coordinates) { + var polygon = d3.geom.polygon(coordinates[0].map(projection)), area = polygon.area(), centroid = polygon.centroid(area < 0 ? (area *= -1, 1) : -1), x = centroid[0], y = centroid[1], z = area, i = 0, n = coordinates.length; + while (++i < n) { + polygon = d3.geom.polygon(coordinates[i].map(projection)); + area = polygon.area(); + centroid = polygon.centroid(area < 0 ? (area *= -1, 1) : -1); + x -= centroid[0]; + y -= centroid[1]; + z -= area; + } + return [ x, y, 6 * z ]; + } + function area(coordinates) { + return Math.abs(d3.geom.polygon(coordinates.map(projection)).area()); + } + var pointRadius = 4.5, pointCircle = d3_path_circle(pointRadius), projection = d3.geo.albersUsa(), buffer = []; + var pathType = d3_geo_type({ + FeatureCollection: function(o) { + var features = o.features, i = -1, n = features.length; + while (++i < n) buffer.push(pathType(features[i].geometry)); + }, + Feature: function(o) { + pathType(o.geometry); + }, + Point: function(o) { + buffer.push("M", project(o.coordinates), pointCircle); + }, + MultiPoint: function(o) { + var coordinates = o.coordinates, i = -1, n = coordinates.length; + while (++i < n) buffer.push("M", project(coordinates[i]), pointCircle); + }, + LineString: function(o) { + var coordinates = o.coordinates, i = -1, n = coordinates.length; + buffer.push("M"); + while (++i < n) buffer.push(project(coordinates[i]), "L"); + buffer.pop(); + }, + MultiLineString: function(o) { + var coordinates = o.coordinates, i = -1, n = coordinates.length, subcoordinates, j, m; + while (++i < n) { + subcoordinates = coordinates[i]; + j = -1; + m = subcoordinates.length; + buffer.push("M"); + while (++j < m) buffer.push(project(subcoordinates[j]), "L"); + buffer.pop(); + } + }, + Polygon: function(o) { + var coordinates = o.coordinates, i = -1, n = coordinates.length, subcoordinates, j, m; + while (++i < n) { + subcoordinates = coordinates[i]; + j = -1; + if ((m = subcoordinates.length - 1) > 0) { + buffer.push("M"); + while (++j < m) buffer.push(project(subcoordinates[j]), "L"); + buffer[buffer.length - 1] = "Z"; + } + } + }, + MultiPolygon: function(o) { + var coordinates = o.coordinates, i = -1, n = coordinates.length, subcoordinates, j, m, subsubcoordinates, k, p; + while (++i < n) { + subcoordinates = coordinates[i]; + j = -1; + m = subcoordinates.length; + while (++j < m) { + subsubcoordinates = subcoordinates[j]; + k = -1; + if ((p = subsubcoordinates.length - 1) > 0) { + buffer.push("M"); + while (++k < p) buffer.push(project(subsubcoordinates[k]), "L"); + buffer[buffer.length - 1] = "Z"; + } + } + } + }, + GeometryCollection: function(o) { + var geometries = o.geometries, i = -1, n = geometries.length; + while (++i < n) buffer.push(pathType(geometries[i])); + } + }); + var areaType = path.area = d3_geo_type({ + FeatureCollection: function(o) { + var area = 0, features = o.features, i = -1, n = features.length; + while (++i < n) area += areaType(features[i]); + return area; + }, + Feature: function(o) { + return areaType(o.geometry); + }, + Polygon: function(o) { + return polygonArea(o.coordinates); + }, + MultiPolygon: function(o) { + var sum = 0, coordinates = o.coordinates, i = -1, n = coordinates.length; + while (++i < n) sum += polygonArea(coordinates[i]); + return sum; + }, + GeometryCollection: function(o) { + var sum = 0, geometries = o.geometries, i = -1, n = geometries.length; + while (++i < n) sum += areaType(geometries[i]); + return sum; + } + }, 0); + var centroidType = path.centroid = d3_geo_type({ + Feature: function(o) { + return centroidType(o.geometry); + }, + Polygon: function(o) { + var centroid = polygonCentroid(o.coordinates); + return [ centroid[0] / centroid[2], centroid[1] / centroid[2] ]; + }, + MultiPolygon: function(o) { + var area = 0, coordinates = o.coordinates, centroid, x = 0, y = 0, z = 0, i = -1, n = coordinates.length; + while (++i < n) { + centroid = polygonCentroid(coordinates[i]); + x += centroid[0]; + y += centroid[1]; + z += centroid[2]; + } + return [ x / z, y / z ]; + } + }); + path.projection = function(x) { + projection = x; + return path; + }; + path.pointRadius = function(x) { + if (typeof x === "function") pointRadius = x; else { + pointRadius = +x; + pointCircle = d3_path_circle(pointRadius); + } + return path; + }; + return path; + }; + d3.geo.bounds = function(feature) { + var left = Infinity, bottom = Infinity, right = -Infinity, top = -Infinity; + d3_geo_bounds(feature, function(x, y) { + if (x < left) left = x; + if (x > right) right = x; + if (y < bottom) bottom = y; + if (y > top) top = y; + }); + return [ [ left, bottom ], [ right, top ] ]; + }; + var d3_geo_boundsTypes = { + Feature: d3_geo_boundsFeature, + FeatureCollection: d3_geo_boundsFeatureCollection, + GeometryCollection: d3_geo_boundsGeometryCollection, + LineString: d3_geo_boundsLineString, + MultiLineString: d3_geo_boundsMultiLineString, + MultiPoint: d3_geo_boundsLineString, + MultiPolygon: d3_geo_boundsMultiPolygon, + Point: d3_geo_boundsPoint, + Polygon: d3_geo_boundsPolygon + }; + d3.geo.circle = function() { + function circle() {} + function visible(point) { + return arc.distance(point) < radians; + } + function clip(coordinates) { + var i = -1, n = coordinates.length, clipped = [], p0, p1, p2, d0, d1; + while (++i < n) { + d1 = arc.distance(p2 = coordinates[i]); + if (d1 < radians) { + if (p1) clipped.push(d3_geo_greatArcInterpolate(p1, p2)((d0 - radians) / (d0 - d1))); + clipped.push(p2); + p0 = p1 = null; + } else { + p1 = p2; + if (!p0 && clipped.length) { + clipped.push(d3_geo_greatArcInterpolate(clipped[clipped.length - 1], p1)((radians - d0) / (d1 - d0))); + p0 = p1; + } + } + d0 = d1; + } + p0 = coordinates[0]; + p1 = clipped[0]; + if (p1 && p2[0] === p0[0] && p2[1] === p0[1] && !(p2[0] === p1[0] && p2[1] === p1[1])) { + clipped.push(p1); + } + return resample(clipped); + } + function resample(coordinates) { + var i = 0, n = coordinates.length, j, m, resampled = n ? [ coordinates[0] ] : coordinates, resamples, origin = arc.source(); + while (++i < n) { + resamples = arc.source(coordinates[i - 1])(coordinates[i]).coordinates; + for (j = 0, m = resamples.length; ++j < m; ) resampled.push(resamples[j]); + } + arc.source(origin); + return resampled; + } + var origin = [ 0, 0 ], degrees = 90 - .01, radians = degrees * d3_geo_radians, arc = d3.geo.greatArc().source(origin).target(d3_identity); + circle.clip = function(d) { + if (typeof origin === "function") arc.source(origin.apply(this, arguments)); + return clipType(d) || null; + }; + var clipType = d3_geo_type({ + FeatureCollection: function(o) { + var features = o.features.map(clipType).filter(d3_identity); + return features && (o = Object.create(o), o.features = features, o); + }, + Feature: function(o) { + var geometry = clipType(o.geometry); + return geometry && (o = Object.create(o), o.geometry = geometry, o); + }, + Point: function(o) { + return visible(o.coordinates) && o; + }, + MultiPoint: function(o) { + var coordinates = o.coordinates.filter(visible); + return coordinates.length && { + type: o.type, + coordinates: coordinates + }; + }, + LineString: function(o) { + var coordinates = clip(o.coordinates); + return coordinates.length && (o = Object.create(o), o.coordinates = coordinates, o); + }, + MultiLineString: function(o) { + var coordinates = o.coordinates.map(clip).filter(function(d) { + return d.length; + }); + return coordinates.length && (o = Object.create(o), o.coordinates = coordinates, o); + }, + Polygon: function(o) { + var coordinates = o.coordinates.map(clip); + return coordinates[0].length && (o = Object.create(o), o.coordinates = coordinates, o); + }, + MultiPolygon: function(o) { + var coordinates = o.coordinates.map(function(d) { + return d.map(clip); + }).filter(function(d) { + return d[0].length; + }); + return coordinates.length && (o = Object.create(o), o.coordinates = coordinates, o); + }, + GeometryCollection: function(o) { + var geometries = o.geometries.map(clipType).filter(d3_identity); + return geometries.length && (o = Object.create(o), o.geometries = geometries, o); + } + }); + circle.origin = function(x) { + if (!arguments.length) return origin; + origin = x; + if (typeof origin !== "function") arc.source(origin); + return circle; + }; + circle.angle = function(x) { + if (!arguments.length) return degrees; + radians = (degrees = +x) * d3_geo_radians; + return circle; + }; + return d3.rebind(circle, arc, "precision"); + }; + d3.geo.greatArc = function() { + function greatArc() { + var d = greatArc.distance.apply(this, arguments), t = 0, dt = precision / d, coordinates = [ p0 ]; + while ((t += dt) < 1) coordinates.push(interpolate(t)); + coordinates.push(p1); + return { + type: "LineString", + coordinates: coordinates + }; + } + var source = d3_geo_greatArcSource, p0, target = d3_geo_greatArcTarget, p1, precision = 6 * d3_geo_radians, interpolate = d3_geo_greatArcInterpolator(); + greatArc.distance = function() { + if (typeof source === "function") interpolate.source(p0 = source.apply(this, arguments)); + if (typeof target === "function") interpolate.target(p1 = target.apply(this, arguments)); + return interpolate.distance(); + }; + greatArc.source = function(_) { + if (!arguments.length) return source; + source = _; + if (typeof source !== "function") interpolate.source(p0 = source); + return greatArc; + }; + greatArc.target = function(_) { + if (!arguments.length) return target; + target = _; + if (typeof target !== "function") interpolate.target(p1 = target); + return greatArc; + }; + greatArc.precision = function(_) { + if (!arguments.length) return precision / d3_geo_radians; + precision = _ * d3_geo_radians; + return greatArc; + }; + return greatArc; + }; + d3.geo.greatCircle = d3.geo.circle; + d3.geom = {}; + d3.geom.contour = function(grid, start) { + var s = start || d3_geom_contourStart(grid), c = [], x = s[0], y = s[1], dx = 0, dy = 0, pdx = NaN, pdy = NaN, i = 0; + do { + i = 0; + if (grid(x - 1, y - 1)) i += 1; + if (grid(x, y - 1)) i += 2; + if (grid(x - 1, y)) i += 4; + if (grid(x, y)) i += 8; + if (i === 6) { + dx = pdy === -1 ? -1 : 1; + dy = 0; + } else if (i === 9) { + dx = 0; + dy = pdx === 1 ? -1 : 1; + } else { + dx = d3_geom_contourDx[i]; + dy = d3_geom_contourDy[i]; + } + if (dx != pdx && dy != pdy) { + c.push([ x, y ]); + pdx = dx; + pdy = dy; + } + x += dx; + y += dy; + } while (s[0] != x || s[1] != y); + return c; + }; + var d3_geom_contourDx = [ 1, 0, 1, 1, -1, 0, -1, 1, 0, 0, 0, 0, -1, 0, -1, NaN ], d3_geom_contourDy = [ 0, -1, 0, 0, 0, -1, 0, 0, 1, -1, 1, 1, 0, -1, 0, NaN ]; + d3.geom.hull = function(vertices) { + if (vertices.length < 3) return []; + var len = vertices.length, plen = len - 1, points = [], stack = [], i, j, h = 0, x1, y1, x2, y2, u, v, a, sp; + for (i = 1; i < len; ++i) { + if (vertices[i][1] < vertices[h][1]) { + h = i; + } else if (vertices[i][1] == vertices[h][1]) { + h = vertices[i][0] < vertices[h][0] ? i : h; + } + } + for (i = 0; i < len; ++i) { + if (i === h) continue; + y1 = vertices[i][1] - vertices[h][1]; + x1 = vertices[i][0] - vertices[h][0]; + points.push({ + angle: Math.atan2(y1, x1), + index: i + }); + } + points.sort(function(a, b) { + return a.angle - b.angle; + }); + a = points[0].angle; + v = points[0].index; + u = 0; + for (i = 1; i < plen; ++i) { + j = points[i].index; + if (a == points[i].angle) { + x1 = vertices[v][0] - vertices[h][0]; + y1 = vertices[v][1] - vertices[h][1]; + x2 = vertices[j][0] - vertices[h][0]; + y2 = vertices[j][1] - vertices[h][1]; + if (x1 * x1 + y1 * y1 >= x2 * x2 + y2 * y2) { + points[i].index = -1; + } else { + points[u].index = -1; + a = points[i].angle; + u = i; + v = j; + } + } else { + a = points[i].angle; + u = i; + v = j; + } + } + stack.push(h); + for (i = 0, j = 0; i < 2; ++j) { + if (points[j].index !== -1) { + stack.push(points[j].index); + i++; + } + } + sp = stack.length; + for (; j < plen; ++j) { + if (points[j].index === -1) continue; + while (!d3_geom_hullCCW(stack[sp - 2], stack[sp - 1], points[j].index, vertices)) { + --sp; + } + stack[sp++] = points[j].index; + } + var poly = []; + for (i = 0; i < sp; ++i) { + poly.push(vertices[stack[i]]); + } + return poly; + }; + d3.geom.polygon = function(coordinates) { + coordinates.area = function() { + var i = 0, n = coordinates.length, a = coordinates[n - 1][0] * coordinates[0][1], b = coordinates[n - 1][1] * coordinates[0][0]; + while (++i < n) { + a += coordinates[i - 1][0] * coordinates[i][1]; + b += coordinates[i - 1][1] * coordinates[i][0]; + } + return (b - a) * .5; + }; + coordinates.centroid = function(k) { + var i = -1, n = coordinates.length, x = 0, y = 0, a, b = coordinates[n - 1], c; + if (!arguments.length) k = -1 / (6 * coordinates.area()); + while (++i < n) { + a = b; + b = coordinates[i]; + c = a[0] * b[1] - b[0] * a[1]; + x += (a[0] + b[0]) * c; + y += (a[1] + b[1]) * c; + } + return [ x * k, y * k ]; + }; + coordinates.clip = function(subject) { + var input, i = -1, n = coordinates.length, j, m, a = coordinates[n - 1], b, c, d; + while (++i < n) { + input = subject.slice(); + subject.length = 0; + b = coordinates[i]; + c = input[(m = input.length) - 1]; + j = -1; + while (++j < m) { + d = input[j]; + if (d3_geom_polygonInside(d, a, b)) { + if (!d3_geom_polygonInside(c, a, b)) { + subject.push(d3_geom_polygonIntersect(c, d, a, b)); + } + subject.push(d); + } else if (d3_geom_polygonInside(c, a, b)) { + subject.push(d3_geom_polygonIntersect(c, d, a, b)); + } + c = d; + } + a = b; + } + return subject; + }; + return coordinates; + }; + d3.geom.voronoi = function(vertices) { + var polygons = vertices.map(function() { + return []; + }); + d3_voronoi_tessellate(vertices, function(e) { + var s1, s2, x1, x2, y1, y2; + if (e.a === 1 && e.b >= 0) { + s1 = e.ep.r; + s2 = e.ep.l; + } else { + s1 = e.ep.l; + s2 = e.ep.r; + } + if (e.a === 1) { + y1 = s1 ? s1.y : -1e6; + x1 = e.c - e.b * y1; + y2 = s2 ? s2.y : 1e6; + x2 = e.c - e.b * y2; + } else { + x1 = s1 ? s1.x : -1e6; + y1 = e.c - e.a * x1; + x2 = s2 ? s2.x : 1e6; + y2 = e.c - e.a * x2; + } + var v1 = [ x1, y1 ], v2 = [ x2, y2 ]; + polygons[e.region.l.index].push(v1, v2); + polygons[e.region.r.index].push(v1, v2); + }); + return polygons.map(function(polygon, i) { + var cx = vertices[i][0], cy = vertices[i][1]; + polygon.forEach(function(v) { + v.angle = Math.atan2(v[0] - cx, v[1] - cy); + }); + return polygon.sort(function(a, b) { + return a.angle - b.angle; + }).filter(function(d, i) { + return !i || d.angle - polygon[i - 1].angle > 1e-10; + }); + }); + }; + var d3_voronoi_opposite = { + l: "r", + r: "l" + }; + d3.geom.delaunay = function(vertices) { + var edges = vertices.map(function() { + return []; + }), triangles = []; + d3_voronoi_tessellate(vertices, function(e) { + edges[e.region.l.index].push(vertices[e.region.r.index]); + }); + edges.forEach(function(edge, i) { + var v = vertices[i], cx = v[0], cy = v[1]; + edge.forEach(function(v) { + v.angle = Math.atan2(v[0] - cx, v[1] - cy); + }); + edge.sort(function(a, b) { + return a.angle - b.angle; + }); + for (var j = 0, m = edge.length - 1; j < m; j++) { + triangles.push([ v, edge[j], edge[j + 1] ]); + } + }); + return triangles; + }; + d3.geom.quadtree = function(points, x1, y1, x2, y2) { + function insert(n, p, x1, y1, x2, y2) { + if (isNaN(p.x) || isNaN(p.y)) return; + if (n.leaf) { + var v = n.point; + if (v) { + if (Math.abs(v.x - p.x) + Math.abs(v.y - p.y) < .01) { + insertChild(n, p, x1, y1, x2, y2); + } else { + n.point = null; + insertChild(n, v, x1, y1, x2, y2); + insertChild(n, p, x1, y1, x2, y2); + } + } else { + n.point = p; + } + } else { + insertChild(n, p, x1, y1, x2, y2); + } + } + function insertChild(n, p, x1, y1, x2, y2) { + var sx = (x1 + x2) * .5, sy = (y1 + y2) * .5, right = p.x >= sx, bottom = p.y >= sy, i = (bottom << 1) + right; + n.leaf = false; + n = n.nodes[i] || (n.nodes[i] = d3_geom_quadtreeNode()); + if (right) x1 = sx; else x2 = sx; + if (bottom) y1 = sy; else y2 = sy; + insert(n, p, x1, y1, x2, y2); + } + var p, i = -1, n = points.length; + if (n && isNaN(points[0].x)) points = points.map(d3_geom_quadtreePoint); + if (arguments.length < 5) { + if (arguments.length === 3) { + y2 = x2 = y1; + y1 = x1; + } else { + x1 = y1 = Infinity; + x2 = y2 = -Infinity; + while (++i < n) { + p = points[i]; + if (p.x < x1) x1 = p.x; + if (p.y < y1) y1 = p.y; + if (p.x > x2) x2 = p.x; + if (p.y > y2) y2 = p.y; + } + var dx = x2 - x1, dy = y2 - y1; + if (dx > dy) y2 = y1 + dx; else x2 = x1 + dy; + } + } + var root = d3_geom_quadtreeNode(); + root.add = function(p) { + insert(root, p, x1, y1, x2, y2); + }; + root.visit = function(f) { + d3_geom_quadtreeVisit(f, root, x1, y1, x2, y2); + }; + points.forEach(root.add); + return root; + }; + d3.time = {}; + var d3_time = Date, d3_time_daySymbols = [ "Sunday", "Monday", "Tuesday", "Wednesday", "Thursday", "Friday", "Saturday" ]; + d3_time_utc.prototype = { + getDate: function() { + return this._.getUTCDate(); + }, + getDay: function() { + return this._.getUTCDay(); + }, + getFullYear: function() { + return this._.getUTCFullYear(); + }, + getHours: function() { + return this._.getUTCHours(); + }, + getMilliseconds: function() { + return this._.getUTCMilliseconds(); + }, + getMinutes: function() { + return this._.getUTCMinutes(); + }, + getMonth: function() { + return this._.getUTCMonth(); + }, + getSeconds: function() { + return this._.getUTCSeconds(); + }, + getTime: function() { + return this._.getTime(); + }, + getTimezoneOffset: function() { + return 0; + }, + valueOf: function() { + return this._.valueOf(); + }, + setDate: function() { + d3_time_prototype.setUTCDate.apply(this._, arguments); + }, + setDay: function() { + d3_time_prototype.setUTCDay.apply(this._, arguments); + }, + setFullYear: function() { + d3_time_prototype.setUTCFullYear.apply(this._, arguments); + }, + setHours: function() { + d3_time_prototype.setUTCHours.apply(this._, arguments); + }, + setMilliseconds: function() { + d3_time_prototype.setUTCMilliseconds.apply(this._, arguments); + }, + setMinutes: function() { + d3_time_prototype.setUTCMinutes.apply(this._, arguments); + }, + setMonth: function() { + d3_time_prototype.setUTCMonth.apply(this._, arguments); + }, + setSeconds: function() { + d3_time_prototype.setUTCSeconds.apply(this._, arguments); + }, + setTime: function() { + d3_time_prototype.setTime.apply(this._, arguments); + } + }; + var d3_time_prototype = Date.prototype; + var d3_time_formatDateTime = "%a %b %e %H:%M:%S %Y", d3_time_formatDate = "%m/%d/%y", d3_time_formatTime = "%H:%M:%S"; + var d3_time_days = d3_time_daySymbols, d3_time_dayAbbreviations = d3_time_days.map(d3_time_formatAbbreviate), d3_time_months = [ "January", "February", "March", "April", "May", "June", "July", "August", "September", "October", "November", "December" ], d3_time_monthAbbreviations = d3_time_months.map(d3_time_formatAbbreviate); + d3.time.format = function(template) { + function format(date) { + var string = [], i = -1, j = 0, c, f; + while (++i < n) { + if (template.charCodeAt(i) == 37) { + string.push(template.substring(j, i), (f = d3_time_formats[c = template.charAt(++i)]) ? f(date) : c); + j = i + 1; + } + } + string.push(template.substring(j, i)); + return string.join(""); + } + var n = template.length; + format.parse = function(string) { + var d = { + y: 1900, + m: 0, + d: 1, + H: 0, + M: 0, + S: 0, + L: 0 + }, i = d3_time_parse(d, template, string, 0); + if (i != string.length) return null; + if ("p" in d) d.H = d.H % 12 + d.p * 12; + var date = new d3_time; + date.setFullYear(d.y, d.m, d.d); + date.setHours(d.H, d.M, d.S, d.L); + return date; + }; + format.toString = function() { + return template; + }; + return format; + }; + var d3_time_zfill2 = d3.format("02d"), d3_time_zfill3 = d3.format("03d"), d3_time_zfill4 = d3.format("04d"), d3_time_sfill2 = d3.format("2d"); + var d3_time_dayRe = d3_time_formatRe(d3_time_days), d3_time_dayAbbrevRe = d3_time_formatRe(d3_time_dayAbbreviations), d3_time_monthRe = d3_time_formatRe(d3_time_months), d3_time_monthLookup = d3_time_formatLookup(d3_time_months), d3_time_monthAbbrevRe = d3_time_formatRe(d3_time_monthAbbreviations), d3_time_monthAbbrevLookup = d3_time_formatLookup(d3_time_monthAbbreviations); + var d3_time_formats = { + a: function(d) { + return d3_time_dayAbbreviations[d.getDay()]; + }, + A: function(d) { + return d3_time_days[d.getDay()]; + }, + b: function(d) { + return d3_time_monthAbbreviations[d.getMonth()]; + }, + B: function(d) { + return d3_time_months[d.getMonth()]; + }, + c: d3.time.format(d3_time_formatDateTime), + d: function(d) { + return d3_time_zfill2(d.getDate()); + }, + e: function(d) { + return d3_time_sfill2(d.getDate()); + }, + H: function(d) { + return d3_time_zfill2(d.getHours()); + }, + I: function(d) { + return d3_time_zfill2(d.getHours() % 12 || 12); + }, + j: function(d) { + return d3_time_zfill3(1 + d3.time.dayOfYear(d)); + }, + L: function(d) { + return d3_time_zfill3(d.getMilliseconds()); + }, + m: function(d) { + return d3_time_zfill2(d.getMonth() + 1); + }, + M: function(d) { + return d3_time_zfill2(d.getMinutes()); + }, + p: function(d) { + return d.getHours() >= 12 ? "PM" : "AM"; + }, + S: function(d) { + return d3_time_zfill2(d.getSeconds()); + }, + U: function(d) { + return d3_time_zfill2(d3.time.sundayOfYear(d)); + }, + w: function(d) { + return d.getDay(); + }, + W: function(d) { + return d3_time_zfill2(d3.time.mondayOfYear(d)); + }, + x: d3.time.format(d3_time_formatDate), + X: d3.time.format(d3_time_formatTime), + y: function(d) { + return d3_time_zfill2(d.getFullYear() % 100); + }, + Y: function(d) { + return d3_time_zfill4(d.getFullYear() % 1e4); + }, + Z: d3_time_zone, + "%": function(d) { + return "%"; + } + }; + var d3_time_parsers = { + a: d3_time_parseWeekdayAbbrev, + A: d3_time_parseWeekday, + b: d3_time_parseMonthAbbrev, + B: d3_time_parseMonth, + c: d3_time_parseLocaleFull, + d: d3_time_parseDay, + e: d3_time_parseDay, + H: d3_time_parseHour24, + I: d3_time_parseHour24, + L: d3_time_parseMilliseconds, + m: d3_time_parseMonthNumber, + M: d3_time_parseMinutes, + p: d3_time_parseAmPm, + S: d3_time_parseSeconds, + x: d3_time_parseLocaleDate, + X: d3_time_parseLocaleTime, + y: d3_time_parseYear, + Y: d3_time_parseFullYear + }; + var d3_time_numberRe = /^\s*\d+/; + var d3_time_amPmLookup = d3.map({ + am: 0, + pm: 1 + }); + d3.time.format.utc = function(template) { + function format(date) { + try { + d3_time = d3_time_utc; + var utc = new d3_time; + utc._ = date; + return local(utc); + } finally { + d3_time = Date; + } + } + var local = d3.time.format(template); + format.parse = function(string) { + try { + d3_time = d3_time_utc; + var date = local.parse(string); + return date && date._; + } finally { + d3_time = Date; + } + }; + format.toString = local.toString; + return format; + }; + var d3_time_formatIso = d3.time.format.utc("%Y-%m-%dT%H:%M:%S.%LZ"); + d3.time.format.iso = Date.prototype.toISOString ? d3_time_formatIsoNative : d3_time_formatIso; + d3_time_formatIsoNative.parse = function(string) { + var date = new Date(string); + return isNaN(date) ? null : date; + }; + d3_time_formatIsoNative.toString = d3_time_formatIso.toString; + d3.time.second = d3_time_interval(function(date) { + return new d3_time(Math.floor(date / 1e3) * 1e3); + }, function(date, offset) { + date.setTime(date.getTime() + Math.floor(offset) * 1e3); + }, function(date) { + return date.getSeconds(); + }); + d3.time.seconds = d3.time.second.range; + d3.time.seconds.utc = d3.time.second.utc.range; + d3.time.minute = d3_time_interval(function(date) { + return new d3_time(Math.floor(date / 6e4) * 6e4); + }, function(date, offset) { + date.setTime(date.getTime() + Math.floor(offset) * 6e4); + }, function(date) { + return date.getMinutes(); + }); + d3.time.minutes = d3.time.minute.range; + d3.time.minutes.utc = d3.time.minute.utc.range; + d3.time.hour = d3_time_interval(function(date) { + var timezone = date.getTimezoneOffset() / 60; + return new d3_time((Math.floor(date / 36e5 - timezone) + timezone) * 36e5); + }, function(date, offset) { + date.setTime(date.getTime() + Math.floor(offset) * 36e5); + }, function(date) { + return date.getHours(); + }); + d3.time.hours = d3.time.hour.range; + d3.time.hours.utc = d3.time.hour.utc.range; + d3.time.day = d3_time_interval(function(date) { + var day = new d3_time(1970, 0); + day.setFullYear(date.getFullYear(), date.getMonth(), date.getDate()); + return day; + }, function(date, offset) { + date.setDate(date.getDate() + offset); + }, function(date) { + return date.getDate() - 1; + }); + d3.time.days = d3.time.day.range; + d3.time.days.utc = d3.time.day.utc.range; + d3.time.dayOfYear = function(date) { + var year = d3.time.year(date); + return Math.floor((date - year - (date.getTimezoneOffset() - year.getTimezoneOffset()) * 6e4) / 864e5); + }; + d3_time_daySymbols.forEach(function(day, i) { + day = day.toLowerCase(); + i = 7 - i; + var interval = d3.time[day] = d3_time_interval(function(date) { + (date = d3.time.day(date)).setDate(date.getDate() - (date.getDay() + i) % 7); + return date; + }, function(date, offset) { + date.setDate(date.getDate() + Math.floor(offset) * 7); + }, function(date) { + var day = d3.time.year(date).getDay(); + return Math.floor((d3.time.dayOfYear(date) + (day + i) % 7) / 7) - (day !== i); + }); + d3.time[day + "s"] = interval.range; + d3.time[day + "s"].utc = interval.utc.range; + d3.time[day + "OfYear"] = function(date) { + var day = d3.time.year(date).getDay(); + return Math.floor((d3.time.dayOfYear(date) + (day + i) % 7) / 7); + }; + }); + d3.time.week = d3.time.sunday; + d3.time.weeks = d3.time.sunday.range; + d3.time.weeks.utc = d3.time.sunday.utc.range; + d3.time.weekOfYear = d3.time.sundayOfYear; + d3.time.month = d3_time_interval(function(date) { + date = d3.time.day(date); + date.setDate(1); + return date; + }, function(date, offset) { + date.setMonth(date.getMonth() + offset); + }, function(date) { + return date.getMonth(); + }); + d3.time.months = d3.time.month.range; + d3.time.months.utc = d3.time.month.utc.range; + d3.time.year = d3_time_interval(function(date) { + date = d3.time.day(date); + date.setMonth(0, 1); + return date; + }, function(date, offset) { + date.setFullYear(date.getFullYear() + offset); + }, function(date) { + return date.getFullYear(); + }); + d3.time.years = d3.time.year.range; + d3.time.years.utc = d3.time.year.utc.range; + var d3_time_scaleSteps = [ 1e3, 5e3, 15e3, 3e4, 6e4, 3e5, 9e5, 18e5, 36e5, 108e5, 216e5, 432e5, 864e5, 1728e5, 6048e5, 2592e6, 7776e6, 31536e6 ]; + var d3_time_scaleLocalMethods = [ [ d3.time.second, 1 ], [ d3.time.second, 5 ], [ d3.time.second, 15 ], [ d3.time.second, 30 ], [ d3.time.minute, 1 ], [ d3.time.minute, 5 ], [ d3.time.minute, 15 ], [ d3.time.minute, 30 ], [ d3.time.hour, 1 ], [ d3.time.hour, 3 ], [ d3.time.hour, 6 ], [ d3.time.hour, 12 ], [ d3.time.day, 1 ], [ d3.time.day, 2 ], [ d3.time.week, 1 ], [ d3.time.month, 1 ], [ d3.time.month, 3 ], [ d3.time.year, 1 ] ]; + var d3_time_scaleLocalFormats = [ [ d3.time.format("%Y"), function(d) { + return true; + } ], [ d3.time.format("%B"), function(d) { + return d.getMonth(); + } ], [ d3.time.format("%b %d"), function(d) { + return d.getDate() != 1; + } ], [ d3.time.format("%a %d"), function(d) { + return d.getDay() && d.getDate() != 1; + } ], [ d3.time.format("%I %p"), function(d) { + return d.getHours(); + } ], [ d3.time.format("%I:%M"), function(d) { + return d.getMinutes(); + } ], [ d3.time.format(":%S"), function(d) { + return d.getSeconds(); + } ], [ d3.time.format(".%L"), function(d) { + return d.getMilliseconds(); + } ] ]; + var d3_time_scaleLinear = d3.scale.linear(), d3_time_scaleLocalFormat = d3_time_scaleFormat(d3_time_scaleLocalFormats); + d3_time_scaleLocalMethods.year = function(extent, m) { + return d3_time_scaleLinear.domain(extent.map(d3_time_scaleGetYear)).ticks(m).map(d3_time_scaleSetYear); + }; + d3.time.scale = function() { + return d3_time_scale(d3.scale.linear(), d3_time_scaleLocalMethods, d3_time_scaleLocalFormat); + }; + var d3_time_scaleUTCMethods = d3_time_scaleLocalMethods.map(function(m) { + return [ m[0].utc, m[1] ]; + }); + var d3_time_scaleUTCFormats = [ [ d3.time.format.utc("%Y"), function(d) { + return true; + } ], [ d3.time.format.utc("%B"), function(d) { + return d.getUTCMonth(); + } ], [ d3.time.format.utc("%b %d"), function(d) { + return d.getUTCDate() != 1; + } ], [ d3.time.format.utc("%a %d"), function(d) { + return d.getUTCDay() && d.getUTCDate() != 1; + } ], [ d3.time.format.utc("%I %p"), function(d) { + return d.getUTCHours(); + } ], [ d3.time.format.utc("%I:%M"), function(d) { + return d.getUTCMinutes(); + } ], [ d3.time.format.utc(":%S"), function(d) { + return d.getUTCSeconds(); + } ], [ d3.time.format.utc(".%L"), function(d) { + return d.getUTCMilliseconds(); + } ] ]; + var d3_time_scaleUTCFormat = d3_time_scaleFormat(d3_time_scaleUTCFormats); + d3_time_scaleUTCMethods.year = function(extent, m) { + return d3_time_scaleLinear.domain(extent.map(d3_time_scaleUTCGetYear)).ticks(m).map(d3_time_scaleUTCSetYear); + }; + d3.time.scale.utc = function() { + return d3_time_scale(d3.scale.linear(), d3_time_scaleUTCMethods, d3_time_scaleUTCFormat); + }; +})(); \ No newline at end of file diff --git a/Modules/QmitkExt/resources/exporting.js b/Modules/QmitkExt/resources/exporting.js new file mode 100644 index 0000000000..6f7bc74299 --- /dev/null +++ b/Modules/QmitkExt/resources/exporting.js @@ -0,0 +1,23 @@ +/* + Highcharts JS v2.3.5 (2012-12-19) + Exporting module + + (c) 2010-2011 Torstein Hønsi + + License: www.highcharts.com/license +*/ +(function(e){function y(a){for(var b=a.length;b--;)typeof a[b]==="number"&&(a[b]=Math.round(a[b])-0.5);return a}var z=e.Chart,u=e.addEvent,B=e.removeEvent,j=e.createElement,v=e.discardElement,t=e.css,l=e.merge,k=e.each,o=e.extend,C=Math.max,i=document,D=window,E=e.isTouchDevice,A=e.Renderer.prototype.symbols,w=e.getOptions();o(w.lang,{downloadPNG:"Download PNG image",downloadJPEG:"Download JPEG image",downloadPDF:"Download PDF document",downloadSVG:"Download SVG vector image",exportButtonTitle:"Export to raster or vector image", +printButtonTitle:"Print the chart"});w.navigation={menuStyle:{border:"1px solid #A0A0A0",background:"#FFFFFF"},menuItemStyle:{padding:"0 5px",background:"none",color:"#303030",fontSize:E?"14px":"11px"},menuItemHoverStyle:{background:"#4572A5",color:"#FFFFFF"},buttonOptions:{align:"right",backgroundColor:{linearGradient:[0,0,0,20],stops:[[0.4,"#F7F7F7"],[0.6,"#E3E3E3"]]},borderColor:"#B0B0B0",borderRadius:3,borderWidth:1,height:20,hoverBorderColor:"#909090",hoverSymbolFill:"#81A7CF",hoverSymbolStroke:"#4572A5", +symbolFill:"#E0E0E0",symbolStroke:"#A0A0A0",symbolX:11.5,symbolY:10.5,verticalAlign:"top",width:24,y:10}};w.exporting={type:"image/png",url:"http://export.highcharts.com/",width:800,buttons:{exportButton:{symbol:"exportIcon",x:-10,symbolFill:"#A8BF77",hoverSymbolFill:"#768F3E",_id:"exportButton",_titleKey:"exportButtonTitle",menuItems:[{textKey:"downloadPNG",onclick:function(){this.exportChart()}},{textKey:"downloadJPEG",onclick:function(){this.exportChart({type:"image/jpeg"})}},{textKey:"downloadPDF", +onclick:function(){this.exportChart({type:"application/pdf"})}},{textKey:"downloadSVG",onclick:function(){this.exportChart({type:"image/svg+xml"})}}]},printButton:{symbol:"printIcon",x:-36,symbolFill:"#B5C9DF",hoverSymbolFill:"#779ABF",_id:"printButton",_titleKey:"printButtonTitle",onclick:function(){this.print()}}}};e.post=function(a,b){var c,d;d=j("form",{method:"post",action:a,enctype:"multipart/form-data"},{display:"none"},i.body);for(c in b)j("input",{type:"hidden",name:c,value:b[c]},null,d); +d.submit();v(d)};o(z.prototype,{getSVG:function(a){var b=this,c,d,f,g=l(b.options,a);if(!i.createElementNS)i.createElementNS=function(a,b){return i.createElement(b)};a=j("div",null,{position:"absolute",top:"-9999em",width:b.chartWidth+"px",height:b.chartHeight+"px"},i.body);o(g.chart,{renderTo:a,forExport:!0});g.exporting.enabled=!1;g.chart.plotBackgroundImage=null;g.series=[];k(b.series,function(a){f=l(a.options,{animation:!1,showCheckbox:!1,visible:a.visible});f.isInternal||g.series.push(f)});c= +new e.Chart(g);k(["xAxis","yAxis"],function(a){k(b[a],function(b,d){var f=c[a][d],g=b.getExtremes(),e=g.userMin,g=g.userMax;(e!==void 0||g!==void 0)&&f.setExtremes(e,g,!0,!1)})});d=c.container.innerHTML;g=null;c.destroy();v(a);d=d.replace(/zIndex="[^"]+"/g,"").replace(/isShadow="[^"]+"/g,"").replace(/symbolName="[^"]+"/g,"").replace(/jQuery[0-9]+="[^"]+"/g,"").replace(/isTracker="[^"]+"/g,"").replace(/url\([^#]+#/g,"url(#").replace(/.*?$/,"").replace(/ /g," ").replace(/­/g,"­").replace(//g,'xlink:href="$1"/>').replace(/id=([^" >]+)/g,'id="$1"').replace(/class=([^" ]+)/g,'class="$1"').replace(/ transform /g," ").replace(/:(path|rect)/g,"$1").replace(/style="([^"]+)"/g,function(a){return a.toLowerCase()});d=d.replace(/(url\(#highcharts-[0-9]+)"/g, +"$1").replace(/"/g,"'");d.match(/ xmlns="/g).length===2&&(d=d.replace(/xmlns="[^"]+"/,""));return d},exportChart:function(a,b){var c=this.options.exporting,d=this.getSVG(l(c.chartOptions,b)),a=l(c,a);e.post(a.url,{filename:a.filename||"chart",type:a.type,width:a.width,scale:a.scale||2,svg:d})},print:function(){var a=this,b=a.container,c=[],d=b.parentNode,f=i.body,g=f.childNodes;if(!a.isPrinting)a.isPrinting=!0,k(g,function(a,b){if(a.nodeType===1)c[b]=a.style.display,a.style.display="none"}), +f.appendChild(b),D.print(),setTimeout(function(){d.appendChild(b);k(g,function(a,b){if(a.nodeType===1)a.style.display=c[b]});a.isPrinting=!1},1E3)},contextMenu:function(a,b,c,d,f,g){var e=this,p=e.options.navigation,i=p.menuItemStyle,q=e.chartWidth,r=e.chartHeight,s="cache-"+a,h=e[s],m=C(f,g),x,n,l;if(!h)e[s]=h=j("div",{className:"highcharts-"+a},{position:"absolute",zIndex:1E3,padding:m+"px"},e.container),x=j("div",null,o({MozBoxShadow:"3px 3px 10px #888",WebkitBoxShadow:"3px 3px 10px #888",boxShadow:"3px 3px 10px #888"}, +p.menuStyle),h),n=function(){t(h,{display:"none"})},u(h,"mouseleave",function(){l=setTimeout(n,500)}),u(h,"mouseenter",function(){clearTimeout(l)}),k(b,function(a){if(a){var b=j("div",{onmouseover:function(){t(this,p.menuItemHoverStyle)},onmouseout:function(){t(this,i)},innerHTML:a.text||e.options.lang[a.textKey]},o({cursor:"pointer"},i),x);b.onclick=function(){n();a.onclick.apply(e,arguments)};e.exportDivElements.push(b)}}),e.exportDivElements.push(x,h),e.exportMenuWidth=h.offsetWidth,e.exportMenuHeight= +h.offsetHeight;a={display:"block"};c+e.exportMenuWidth>q?a.right=q-c-f-m+"px":a.left=c-m+"px";d+g+e.exportMenuHeight>r?a.bottom=r-d-m+"px":a.top=d+g-m+"px";t(h,a)},addButton:function(a){function b(){r.attr(k);q.attr(m)}var c=this,d=c.renderer,f=l(c.options.navigation.buttonOptions,a),e=f.onclick,i=f.menuItems,p=f.width,j=f.height,q,r,s,h,a=f.borderWidth,m={stroke:f.borderColor},k={stroke:f.symbolStroke,fill:f.symbolFill},n=f.symbolSize||12;if(!c.btnCount)c.btnCount=0;h=c.btnCount++;if(!c.exportDivElements)c.exportDivElements= +[],c.exportSVGElements=[];f.enabled!==!1&&(q=d.rect(0,0,p,j,f.borderRadius,a).align(f,!0).attr(o({fill:f.backgroundColor,"stroke-width":a,zIndex:19},m)).add(),s=d.rect(0,0,p,j,0).align(f).attr({id:f._id,fill:"rgba(255, 255, 255, 0.001)",title:c.options.lang[f._titleKey],zIndex:21}).css({cursor:"pointer"}).on("mouseover",function(){r.attr({stroke:f.hoverSymbolStroke,fill:f.hoverSymbolFill});q.attr({stroke:f.hoverBorderColor})}).on("mouseout",b).on("click",b).add(),i&&(e=function(){b();var a=s.getBBox(); +c.contextMenu("menu"+h,i,a.x,a.y,p,j)}),s.on("click",function(){e.apply(c,arguments)}),r=d.symbol(f.symbol,f.symbolX-n/2,f.symbolY-n/2,n,n).align(f,!0).attr(o(k,{"stroke-width":f.symbolStrokeWidth||1,zIndex:20})).add(),c.exportSVGElements.push(q,s,r))},destroyExport:function(){var a,b;for(a=0;a-1?b.split(".")[1].length:0):a=isNaN(b=M(b))?2:b;var b=a,c=c===void 0?e.decimalPoint:c,d=d===void 0?e.thousandsSep:d,e=f<0?"-":"",a=String(z(f=M(+f||0).toFixed(b))),g=a.length>3?a.length%3:0;return e+(g?a.substr(0,g)+d:"")+a.substr(g).replace(/(\d{3})(?=\d)/g, +"$1"+d)+(b?c+M(f-a).toFixed(b).slice(2):"")}function ua(a,b){return Array((b||2)+1-String(a).length).join(0)+a}function hb(a,b,c,d){var e,c=n(c,1);e=a/c;b||(b=[1,2,2.5,5,10],d&&d.allowDecimals===!1&&(c===1?b=[1,2,5,10]:c<=0.1&&(b=[1/c])));for(d=0;d=D[ib]&&(i.setMilliseconds(0),i.setSeconds(j>=D[Va]?0:k*U(i.getSeconds()/k)));if(j>=D[Va])i[Db](j>=D[Ka]?0:k*U(i[jb]()/k));if(j>=D[Ka])i[Eb](j>=D[ma]? +0:k*U(i[kb]()/k));if(j>=D[ma])i[lb](j>=D[La]?1:k*U(i[Ma]()/k));j>=D[La]&&(i[Fb](j>=D[va]?0:k*U(i[Xa]()/k)),h=i[Ya]());j>=D[va]&&(h-=h%k,i[Gb](h));if(j===D[Wa])i[lb](i[Ma]()-i[mb]()+n(d,1));b=1;h=i[Ya]();for(var d=i.getTime(),l=i[Xa](),m=i[Ma](),i=g?0:(864E5+i.getTimezoneOffset()*6E4)%864E5;dc&&(c=a[b]);return c}function Ga(a,b){for(var c in a)a[c]&&a[c]!==b&&a[c].destroy&&a[c].destroy(),delete a[c]}function Na(a){$a||($a=T(ga));a&&$a.appendChild(a);$a.innerHTML= +""}function Oa(a,b){var c="Highcharts error #"+a+": www.highcharts.com/errors/"+a;if(b)throw c;else L.console&&console.log(c)}function da(a){return parseFloat(a.toPrecision(14))}function xa(a,b){Pa=n(a,b.animation)}function Jb(){var a=N.global.useUTC,b=a?"getUTC":"get",c=a?"setUTC":"set";Za=a?Date.UTC:function(a,b,c,g,h,i){return(new Date(a,b,n(c,1),n(g,0),n(h,0),n(i,0))).getTime()};jb=b+"Minutes";kb=b+"Hours";mb=b+"Day";Ma=b+"Date";Xa=b+"Month";Ya=b+"FullYear";Db=c+"Minutes";Eb=c+"Hours";lb=c+"Date"; +Fb=c+"Month";Gb=c+"FullYear"}function ya(){}function Qa(a,b,c){this.axis=a;this.pos=b;this.type=c||"";this.isNew=!0;c||this.addLabel()}function nb(a,b){this.axis=a;if(b)this.options=b,this.id=b.id;return this}function Kb(a,b,c,d,e,f){var g=a.chart.inverted;this.axis=a;this.isNegative=c;this.options=b;this.x=d;this.stack=e;this.percent=f==="percent";this.alignOptions={align:b.align||(g?c?"left":"right":"center"),verticalAlign:b.verticalAlign||(g?"middle":c?"bottom":"top"),y:n(b.y,g?4:c?14:-6),x:n(b.x, +g?c?-6:6:0)};this.textAlign=b.textAlign||(g?c?"right":"left":"center")}function ob(){this.init.apply(this,arguments)}function pb(a,b){var c=b.borderWidth,d=b.style,e=z(d.padding);this.chart=a;this.options=b;this.crosshairs=[];this.now={x:0,y:0};this.isHidden=!0;this.label=a.renderer.label("",0,0,b.shape,null,null,b.useHTML,null,"tooltip").attr({padding:e,fill:b.backgroundColor,"stroke-width":c,r:b.borderRadius,zIndex:8}).css(d).css({padding:0}).hide().add();V||this.label.shadow(b.shadow);this.shared= +b.shared}function qb(a,b){var c=V?"":b.chart.zoomType;this.zoomX=/x/.test(c);this.zoomY=/y/.test(c);this.options=b;this.chart=a;this.init(a,b.tooltip)}function rb(a){this.init(a)}function sb(){this.init.apply(this,arguments)}var A,C=document,L=window,K=Math,u=K.round,U=K.floor,za=K.ceil,s=K.max,O=K.min,M=K.abs,W=K.cos,Z=K.sin,Aa=K.PI,ab=Aa*2/360,na=navigator.userAgent,Lb=L.opera,Ea=/msie/i.test(na)&&!Lb,Ra=C.documentMode===8,bb=/AppleWebKit/.test(na),cb=/Firefox/.test(na),Mb=/(Mobile|Android|Windows Phone)/.test(na), +oa="http://www.w3.org/2000/svg",ca=!!C.createElementNS&&!!C.createElementNS(oa,"svg").createSVGRect,Sb=cb&&parseInt(na.split("Firefox/")[1],10)<4,V=!ca&&!Ea&&!!C.createElement("canvas").getContext,Sa,Ba=C.documentElement.ontouchstart!==A,Nb={},tb=0,$a,N,db,Pa,ub,D,pa=function(){},Ha=[],ga="div",Q="none",vb="rgba(192,192,192,"+(ca?1.0E-4:0.002)+")",Bb="millisecond",ib="second",Va="minute",Ka="hour",ma="day",Wa="week",La="month",va="year",wb="stroke-width",Za,jb,kb,mb,Ma,Xa,Ya,Db,Eb,lb,Fb,Gb,$={};L.Highcharts= +{};db=function(a,b,c){if(!r(b)||isNaN(b))return"Invalid date";var a=n(a,"%Y-%m-%d %H:%M:%S"),d=new Date(b),e,f=d[kb](),g=d[mb](),h=d[Ma](),i=d[Xa](),j=d[Ya](),k=N.lang,l=k.weekdays,b={a:l[g].substr(0,3),A:l[g],d:ua(h),e:h,b:k.shortMonths[i],B:k.months[i],m:ua(i+1),y:j.toString().substr(2,2),Y:j,H:ua(f),I:ua(f%12||12),l:f%12||12,M:ua(d[jb]()),p:f<12?"AM":"PM",P:f<12?"am":"pm",S:ua(d.getSeconds()),L:ua(u(b%1E3),3)};for(e in b)for(;a.indexOf("%"+e)!==-1;)a=a.replace("%"+e,b[e]);return c?a.substr(0,1).toUpperCase()+ +a.substr(1):a};Hb.prototype={wrapColor:function(a){if(this.color>=a)this.color=0},wrapSymbol:function(a){if(this.symbol>=a)this.symbol=0}};D=ia(Bb,1,ib,1E3,Va,6E4,Ka,36E5,ma,864E5,Wa,6048E5,La,26784E5,va,31556952E3);ub={init:function(a,b,c){var b=b||"",d=a.shift,e=b.indexOf("C")>-1,f=e?7:3,g,b=b.split(" "),c=[].concat(c),h,i,j=function(a){for(g=a.length;g--;)a[g]==="M"&&a.splice(g+1,0,a[g+1],a[g+2],a[g+1],a[g+2])};e&&(j(b),j(c));a.isArea&&(h=b.splice(b.length-6,6),i=c.splice(c.length-6,6));if(d<= +c.length/f)for(;d--;)c=[].concat(c).splice(0,f).concat(c);a.shift=0;if(b.length)for(a=c.length;b.length{point.key}
',pointFormat:'{series.name}: {point.y}
',shadow:!0,shared:V,snap:Mb?25:10,style:{color:"#333333",fontSize:"12px",padding:"5px",whiteSpace:"nowrap"}},credits:{enabled:!0, +text:"Highcharts.com",href:"http://www.highcharts.com",position:{align:"right",x:-10,verticalAlign:"bottom",y:-5},style:{cursor:"pointer",color:"#909090",fontSize:"10px"}}};var X=N.plotOptions,ea=X.line;Jb();var qa=function(a){var b=[],c;(function(a){(c=/rgba\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]?(?:\.[0-9]+)?)\s*\)/.exec(a))?b=[z(c[1]),z(c[2]),z(c[3]),parseFloat(c[4],10)]:(c=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(a))&&(b=[z(c[1],16),z(c[2],16),z(c[3], +16),1])})(a);return{get:function(c){return b&&!isNaN(b[0])?c==="rgb"?"rgb("+b[0]+","+b[1]+","+b[2]+")":c==="a"?b[3]:"rgba("+b.join(",")+")":a},brighten:function(a){if(Da(a)&&a!==0){var c;for(c=0;c<3;c++)b[c]+=z(a*255),b[c]<0&&(b[c]=0),b[c]>255&&(b[c]=255)}return this},setOpacity:function(a){b[3]=a;return this}}};ya.prototype={init:function(a,b){this.element=b==="span"?T(b):C.createElementNS(oa,b);this.renderer=a;this.attrSetters={}},animate:function(a,b,c){b=n(b,Pa,!0);fb(this);if(b){b=B(b);if(c)b.complete= +c;xb(this,a,b)}else this.attr(a),c&&c()},attr:function(a,b){var c,d,e,f,g=this.element,h=g.nodeName.toLowerCase(),i=this.renderer,j,k=this.attrSetters,l=this.shadows,m,q,p=this;ja(a)&&r(b)&&(c=a,a={},a[c]=b);if(ja(a))c=a,h==="circle"?c={x:"cx",y:"cy"}[c]||c:c==="strokeWidth"&&(c="stroke-width"),p=w(g,c)||this[c]||0,c!=="d"&&c!=="visibility"&&(p=parseFloat(p));else for(c in a)if(j=!1,d=a[c],e=k[c]&&k[c].call(this,d,c),e!==!1){e!==A&&(d=e);if(c==="d")d&&d.join&&(d=d.join(" ")),/(NaN| {2}|^$)/.test(d)&& +(d="M 0 0");else if(c==="x"&&h==="text"){for(e=0;em&&/[ \-]/.test(b.textContent||b.innerText))I(b,{width:m+"px",display:"block",whiteSpace:"normal"}),k=m;m=a.fontMetrics(b.style.fontSize).b;t= +p<0&&-k;H=q<0&&-l;y=p*q<0;t+=q*m*(y?1-h:h);H-=p*m*(j?y?h:1-h:1);i&&(t-=k*h*(p<0?-1:1),j&&(H-=l*h*(q<0?-1:1)),I(b,{textAlign:g}));this.xCorr=t;this.yCorr=H}I(b,{left:e+t+"px",top:f+H+"px"});if(bb)l=b.offsetHeight;this.cTT=ra}}else this.alignOnAdd=!0},updateTransform:function(){var a=this.translateX||0,b=this.translateY||0,c=this.inverted,d=this.rotation,e=[];c&&(a+=this.attr("width"),b+=this.attr("height"));(a||b)&&e.push("translate("+a+","+b+")");c?e.push("rotate(90) scale(-1,1)"):d&&e.push("rotate("+ +d+" "+(this.x||0)+" "+(this.y||0)+")");e.length&&w(this.element,"transform",e.join(" "))},toFront:function(){var a=this.element;a.parentNode.appendChild(a);return this},align:function(a,b,c){a?(this.alignOptions=a,this.alignByTranslate=b,c||this.renderer.alignedObjects.push(this)):(a=this.alignOptions,b=this.alignByTranslate);var c=n(c,this.renderer),d=a.align,e=a.verticalAlign,f=(c.x||0)+(a.x||0),g=(c.y||0)+(a.y||0),h={};if(d==="right"||d==="center")f+=(c.width-(a.width||0))/{right:1,center:2}[d]; +h[b?"translateX":"x"]=u(f);if(e==="bottom"||e==="middle")g+=(c.height-(a.height||0))/({bottom:1,middle:2}[e]||1);h[b?"translateY":"y"]=u(g);this[this.placed?"animate":"attr"](h);this.placed=!0;this.alignAttr=h;return this},getBBox:function(){var a=this.bBox,b=this.renderer,c,d=this.rotation;c=this.element;var e=this.styles,f=d*ab;if(!a){if(c.namespaceURI===oa||b.forExport){try{a=c.getBBox?x({},c.getBBox()):{width:c.offsetWidth,height:c.offsetHeight}}catch(g){}if(!a||a.width<0)a={width:0,height:0}}else a= +this.htmlGetBBox();if(b.isSVG){b=a.width;c=a.height;if(Ea&&e&&e.fontSize==="11px"&&c===22.700000762939453)a.height=c=14;if(d)a.width=M(c*Z(f))+M(b*W(f)),a.height=M(c*W(f))+M(b*Z(f))}this.bBox=a}return a},show:function(){return this.attr({visibility:"visible"})},hide:function(){return this.attr({visibility:"hidden"})},add:function(a){var b=this.renderer,c=a||b,d=c.element||b.box,e=d.childNodes,f=this.element,g=w(f,"zIndex"),h;if(a)this.parentGroup=a;this.parentInverted=a&&a.inverted;this.textStr!== +void 0&&b.buildText(this);if(g)c.handleZ=!0,g=z(g);if(c.handleZ)for(c=0;cg||!r(g)&&r(b))){d.insertBefore(f,a);h=!0;break}h||d.appendChild(f);this.added=!0;F(this,"add");return this},safeRemoveChild:function(a){var b=a.parentNode;b&&b.removeChild(a)},destroy:function(){var a=this,b=a.element||{},c=a.shadows,d,e;b.onclick=b.onmouseout=b.onmouseover=b.onmousemove=null;fb(a);if(a.clipPath)a.clipPath=a.clipPath.destroy();if(a.stops){for(e=0;e/g,'').replace(/<(i|em)>/g,'').replace(//g,"").split(//g),d=b.childNodes,e=/style="([^"]+)"/,f=/href="([^"]+)"/,g=w(b,"x"),h=a.styles,i=h&&h.width&&z(h.width),j=h&&h.lineHeight,k,h=d.length,l=[];h--;)b.removeChild(d[h]);i&&!a.added&&this.box.appendChild(b);c[c.length-1]===""&&c.pop();o(c,function(c,d){var h,y=0,t,c=c.replace(//g,"|||");h=c.split("|||");o(h,function(c){if(c!==""||h.length===1){var m={},n=C.createElementNS(oa,"tspan"),o;e.test(c)&& +(o=c.match(e)[1].replace(/(;| |^)color([ :])/,"$1fill$2"),w(n,"style",o));f.test(c)&&(w(n,"onclick",'location.href="'+c.match(f)[1]+'"'),I(n,{cursor:"pointer"}));c=(c.replace(/<(.|\n)*?>/g,"")||" ").replace(/</g,"<").replace(/>/g,">");n.appendChild(C.createTextNode(c));y?m.dx=3:m.x=g;if(!y){if(d){!ca&&a.renderer.forExport&&I(n,{display:"block"});t=L.getComputedStyle&&z(L.getComputedStyle(k,null).getPropertyValue("line-height"));if(!t||isNaN(t)){var r;if(!(r=j))if(!(r=k.offsetHeight))l[d]=b.getBBox? +b.getBBox().height:a.renderer.fontMetrics(b.style.fontSize).h,r=u(l[d]-(l[d-1]||0))||18;t=r}w(n,"dy",t)}k=n}w(n,m);b.appendChild(n);y++;if(i)for(var c=c.replace(/([^\^])-/g,"$1- ").split(" "),E=[];c.length||E.length;)delete a.bBox,r=a.getBBox().width,m=r>i,!m||c.length===1?(c=E,E=[],c.length&&(n=C.createElementNS(oa,"tspan"),w(n,{dy:j||16,x:g}),o&&w(n,"style",o),b.appendChild(n),r>i&&(i=r))):(n.removeChild(n.firstChild),E.unshift(c.pop())),c.length&&n.appendChild(C.createTextNode(c.join(" ").replace(/- /g, +"-")))}})})},button:function(a,b,c,d,e,f,g){var h=this.label(a,b,c),i=0,j,k,l,m,q,a={x1:0,y1:0,x2:0,y2:1},e=B(ia(wb,1,"stroke","#999","fill",ia("linearGradient",a,"stops",[[0,"#FFF"],[1,"#DDD"]]),"r",3,"padding",3,"style",ia("color","black")),e);l=e.style;delete e.style;f=B(e,ia("stroke","#68A","fill",ia("linearGradient",a,"stops",[[0,"#FFF"],[1,"#ACF"]])),f);m=f.style;delete f.style;g=B(e,ia("stroke","#68A","fill",ia("linearGradient",a,"stops",[[0,"#9BD"],[1,"#CDF"]])),g);q=g.style;delete g.style; +J(h.element,"mouseenter",function(){h.attr(f).css(m)});J(h.element,"mouseleave",function(){j=[e,f,g][i];k=[l,m,q][i];h.attr(j).css(k)});h.setState=function(a){(i=a)?a===2&&h.attr(g).css(q):h.attr(e).css(l)};return h.on("click",function(){d.call(h)}).attr(e).css(x({cursor:"default"},l))},crispLine:function(a,b){a[1]===a[4]&&(a[1]=a[4]=u(a[1])-b%2/2);a[2]===a[5]&&(a[2]=a[5]=u(a[2])+b%2/2);return a},path:function(a){var b={fill:Q};Ia(a)?b.d=a:Y(a)&&x(b,a);return this.createElement("path").attr(b)},circle:function(a, +b,c){a=Y(a)?a:{x:a,y:b,r:c};return this.createElement("circle").attr(a)},arc:function(a,b,c,d,e,f){if(Y(a))b=a.y,c=a.r,d=a.innerR,e=a.start,f=a.end,a=a.x;return this.symbol("arc",a||0,b||0,c||0,c||0,{innerR:d||0,start:e||0,end:f||0})},rect:function(a,b,c,d,e,f){e=Y(a)?a.r:e;e=this.createElement("rect").attr({rx:e,ry:e,fill:Q});return e.attr(Y(a)?a:e.crisp(f,a,b,s(c,0),s(d,0)))},setSize:function(a,b,c){var d=this.alignedObjects,e=d.length;this.width=a;this.height=b;for(this.boxWrapper[n(c,!0)?"animate": +"attr"]({width:a,height:b});e--;)d[e].align()},g:function(a){var b=this.createElement("g");return r(a)?b.attr({"class":"highcharts-"+a}):b},image:function(a,b,c,d,e){var f={preserveAspectRatio:Q};arguments.length>1&&x(f,{x:b,y:c,width:d,height:e});f=this.createElement("image").attr(f);f.element.setAttributeNS?f.element.setAttributeNS("http://www.w3.org/1999/xlink","href",a):f.element.setAttribute("hc-svg-href",a);return f},symbol:function(a,b,c,d,e,f){var g,h=this.symbols[a],h=h&&h(u(b),u(c),d,e, +f),i=/^url\((.*?)\)$/,j,k;h?(g=this.path(h),x(g,{symbolName:a,x:b,y:c,width:d,height:e}),f&&x(g,f)):i.test(a)&&(k=function(a,b){a.element&&(a.attr({width:b[0],height:b[1]}),a.alignByTranslate||a.translate(u((d-b[0])/2),u((e-b[1])/2)))},j=a.match(i)[1],a=Nb[j],g=this.image(j).attr({x:b,y:c}),a?k(g,a):(g.attr({width:0,height:0}),T("img",{onload:function(){k(g,Nb[j]=[this.width,this.height])},src:j})));return g},symbols:{circle:function(a,b,c,d){var e=0.166*c;return["M",a+c/2,b,"C",a+c+e,b,a+c+e,b+d, +a+c/2,b+d,"C",a-e,b+d,a-e,b,a+c/2,b,"Z"]},square:function(a,b,c,d){return["M",a,b,"L",a+c,b,a+c,b+d,a,b+d,"Z"]},triangle:function(a,b,c,d){return["M",a+c/2,b,"L",a+c,b+d,a,b+d,"Z"]},"triangle-down":function(a,b,c,d){return["M",a,b,"L",a+c,b,a+c/2,b+d,"Z"]},diamond:function(a,b,c,d){return["M",a+c/2,b,"L",a+c,b+d/2,a+c/2,b+d,a,b+d/2,"Z"]},arc:function(a,b,c,d,e){var f=e.start,c=e.r||c||d,g=e.end-1.0E-6,d=e.innerR,h=e.open,i=W(f),j=Z(f),k=W(g),g=Z(g),e=e.end-f');if(b)c=b===ga||b==="span"||b==="img"?c.join(""):a.prepVML(c),this.element=T(c);this.renderer=a;this.attrSetters={}},add:function(a){var b=this.renderer,c=this.element,d=b.box,d=a?a.element||a:d;a&&a.inverted&&b.invertChild(c,d);d.appendChild(c);this.added=!0;this.alignOnAdd&&!this.deferUpdateTransform&&this.updateTransform();F(this,"add");return this}, +updateTransform:ya.prototype.htmlUpdateTransform,attr:function(a,b){var c,d,e,f=this.element||{},g=f.style,h=f.nodeName,i=this.renderer,j=this.symbolName,k,l=this.shadows,m,q=this.attrSetters,p=this;ja(a)&&r(b)&&(c=a,a={},a[c]=b);if(ja(a))c=a,p=c==="strokeWidth"||c==="stroke-width"?this.strokeweight:this[c];else for(c in a)if(d=a[c],m=!1,e=q[c]&&q[c].call(this,d,c),e!==!1&&d!==null){e!==A&&(d=e);if(j&&/^(x|y|r|start|end|width|height|innerR|anchorX|anchorY)/.test(c))k||(this.symbolAttr(a),k=!0),m= +!0;else if(c==="d"){d=d||[];this.d=d.join(" ");e=d.length;for(m=[];e--;)m[e]=Da(d[e])?u(d[e]*10)-5:d[e]==="Z"?"x":d[e];d=m.join(" ")||"x";f.path=d;if(l)for(e=l.length;e--;)l[e].path=l[e].cutOff?this.cutOffPath(d,l[e].cutOff):d;m=!0}else if(c==="visibility"){if(l)for(e=l.length;e--;)l[e].style[c]=d;h==="DIV"&&(d=d==="hidden"?"-999em":0,c="top");g[c]=d;m=!0}else if(c==="zIndex")d&&(g[c]=d),m=!0;else if(c==="width"||c==="height")d=s(0,d),this[c]=d,this.updateClipping?(this[c]=d,this.updateClipping()): +g[c]=d,m=!0;else if(c==="x"||c==="y")this[c]=d,g[{x:"left",y:"top"}[c]]=d;else if(c==="class")f.className=d;else if(c==="stroke")d=i.color(d,f,c),c="strokecolor";else if(c==="stroke-width"||c==="strokeWidth")f.stroked=d?!0:!1,c="strokeweight",this[c]=d,Da(d)&&(d+="px");else if(c==="dashstyle")(f.getElementsByTagName("stroke")[0]||T(i.prepVML([""]),null,null,f))[c]=d||"solid",this.dashstyle=d,m=!0;else if(c==="fill")if(h==="SPAN")g.color=d;else{if(h!=="IMG")f.filled=d!==Q?!0:!1,d=i.color(d, +f,c,this),c="fillcolor"}else if(h==="shape"&&c==="rotation")this[c]=d,f.style.left=-u(Z(d*ab)+1)+"px",f.style.top=u(W(d*ab))+"px";else if(c==="translateX"||c==="translateY"||c==="rotation")this[c]=d,this.updateTransform(),m=!0;else if(c==="text")this.bBox=null,f.innerHTML=d,m=!0;m||(Ra?f[c]=d:w(f,c,d))}return p},clip:function(a){var b=this,c,d=b.element,e=d.parentNode;a?(c=a.members,ta(c,b),c.push(b),b.destroyClip=function(){ta(c,b)},e&&e.className==="highcharts-tracker"&&!Ra&&I(d,{visibility:"hidden"}), +a=a.getCSS(b)):(b.destroyClip&&b.destroyClip(),a={clip:Ra?"inherit":"rect(auto)"});return b.css(a)},css:ya.prototype.htmlCss,safeRemoveChild:function(a){a.parentNode&&Na(a)},destroy:function(){this.destroyClip&&this.destroyClip();return ya.prototype.destroy.apply(this)},empty:function(){for(var a=this.element.childNodes,b=a.length,c;b--;)c=a[b],c.parentNode.removeChild(c)},on:function(a,b){this.element["on"+a]=function(){var a=L.event;a.target=a.srcElement;b(a)};return this},cutOffPath:function(a, +b){var c,a=a.split(/[ ,]/);c=a.length;if(c===9||c===11)a[c-4]=a[c-2]=z(a[c-2])-10*b;return a.join(" ")},shadow:function(a,b,c){var d=[],e,f=this.element,g=this.renderer,h,i=f.style,j,k=f.path,l,m,q,p;k&&typeof k.value!=="string"&&(k="x");m=k;if(a){q=n(a.width,3);p=(a.opacity||0.15)/q;for(e=1;e<=3;e++){l=q*2+1-2*e;c&&(m=this.cutOffPath(k.value,l+0.5));j=[''];h=T(g.prepVML(j),null, +{left:z(i.left)+n(a.offsetX,1),top:z(i.top)+n(a.offsetY,1)});if(c)h.cutOff=l+1;j=[''];T(g.prepVML(j),null,null,h);b?b.element.appendChild(h):f.parentNode.insertBefore(h,f);d.push(h)}this.shadows=d}return this}};ha=ba(ya,ha);var fa={Element:ha,isIE8:na.indexOf("MSIE 8.0")>-1,init:function(a,b,c){var d,e;this.alignedObjects=[];d=this.createElement(ga);e=d.element;e.style.position="relative";a.appendChild(d.element);this.box=e;this.boxWrapper=d; +this.setSize(b,c,!1);if(!C.namespaces.hcv)C.namespaces.add("hcv","urn:schemas-microsoft-com:vml"),C.createStyleSheet().cssText="hcv\\:fill, hcv\\:path, hcv\\:shape, hcv\\:stroke{ behavior:url(#default#VML); display: inline-block; } "},isHidden:function(){return!this.box.offsetWidth},clipRect:function(a,b,c,d){var e=this.createElement(),f=Y(a);return x(e,{members:[],left:f?a.x:a,top:f?a.y:b,width:f?a.width:c,height:f?a.height:d,getCSS:function(a){var b=a.inverted,c=this.top,d=this.left,e=d+this.width, +f=c+this.height,c={clip:"rect("+u(b?d:c)+"px,"+u(b?f:e)+"px,"+u(b?e:f)+"px,"+u(b?c:d)+"px)"};!b&&Ra&&a.element.nodeName!=="IMG"&&x(c,{width:e+"px",height:f+"px"});return c},updateClipping:function(){o(e.members,function(a){a.css(e.getCSS(a))})}})},color:function(a,b,c,d){var e=this,f,g=/^rgba/,h,i,j=Q;a&&a.linearGradient?i="gradient":a&&a.radialGradient&&(i="pattern");if(i){var k,l,m=a.linearGradient||a.radialGradient,q,p,n,t,H,r="",a=a.stops,v,s=[],u=function(){h=[''];T(e.prepVML(h),null,null,b)};q=a[0];v=a[a.length-1];q[0]>0&&a.unshift([0,q[1]]);v[0]<1&&a.push([1,v[1]]);o(a,function(a,b){g.test(a[1])?(f=qa(a[1]),k=f.get("rgb"),l=f.get("a")):(k=a[1],l=1);s.push(a[0]*100+"% "+k);b?(n=l,t=k):(p=l,H=k)});if(c==="fill")if(i==="gradient")c=m.x1||m[0]||0,a=m.y1||m[1]||0,q=m.x2||m[2]||0,m=m.y2||m[3]||0,r='angle="'+(90-K.atan((m-a)/(q-c))*180/Aa)+'"',u();else{var j=m.r,E=j*2,S=j*2,x=m.cx,A=m.cy,w= +b.radialReference,z,j=function(){w&&(z=d.getBBox(),x+=(w[0]-z.x)/z.width-0.5,A+=(w[1]-z.y)/z.height-0.5,E*=w[2]/z.width,S*=w[2]/z.height);r='src="'+N.global.VMLRadialGradientURL+'" size="'+E+","+S+'" origin="0.5,0.5" position="'+x+","+A+'" color2="'+H+'" ';u()};d.added?j():J(d,"add",j);j=t}else j=k}else if(g.test(a)&&b.tagName!=="IMG")f=qa(a),h=["<",c,' opacity="',f.get("a"),'"/>'],T(this.prepVML(h),null,null,b),j=f.get("rgb");else{j=b.getElementsByTagName(c);if(j.length)j[0].opacity=1;j=a}return j}, +prepVML:function(a){var b=this.isIE8,a=a.join("");b?(a=a.replace("/>",' xmlns="urn:schemas-microsoft-com:vml" />'),a=a.indexOf('style="')===-1?a.replace("/>",' style="display:inline-block;behavior:url(#default#VML);" />'):a.replace('style="','style="display:inline-block;behavior:url(#default#VML);')):a=a.replace("<","1&&f.attr({x:b,y:c,width:d,height:e});return f},rect:function(a,b,c,d,e,f){if(Y(a))b=a.y,c=a.width,d=a.height,f=a.strokeWidth,a=a.x;var g=this.symbol("rect");g.r=e;return g.attr(g.crisp(f,a,b,s(c,0),s(d,0)))},invertChild:function(a,b){var c=b.style;I(a,{flip:"x", +left:z(c.width)-1,top:z(c.height)-1,rotation:-90})},symbols:{arc:function(a,b,c,d,e){var f=e.start,g=e.end,h=e.r||c||d,c=W(f),d=Z(f),i=W(g),j=Z(g),k=e.innerR,l=0.08/h,m=k&&0.1/k||0;if(g-f===0)return["x"];else 2*Aa-g+fj&&(c=!1)):h+k>m&&(h=m-k,d&&h+l0&&b.height>0){f=B({align:c&&k&&"center",x:c?!k&&4:10,verticalAlign:!c&&k&&"middle",y:c?k?16:10:k?6:-4,rotation:c&&!k&&90},f);if(!g)a.label=g=v.text(f.text,0,0).attr({align:f.textAlign||f.align,rotation:f.rotation,zIndex:o}).css(f.style).add();b=[p[1],p[4],n(p[6],p[1])];p=[p[2],p[5],n(p[7],p[2])];c=Fa(b);k=Fa(p);g.align(f,!1,{x:c,y:k,width:wa(b)-c,height:wa(p)-k});g.show()}else g&&g.hide();return a},destroy:function(){ta(this.axis.plotLinesAndBands, +this);Ga(this,this.axis)}};Kb.prototype={destroy:function(){Ga(this,this.axis)},setTotal:function(a){this.cum=this.total=a},render:function(a){var b=this.options.formatter.call(this);this.label?this.label.attr({text:b,visibility:"hidden"}):this.label=this.axis.chart.renderer.text(b,0,0).css(this.options.style).attr({align:this.textAlign,rotation:this.options.rotation,visibility:"hidden"}).add(a)},setOffset:function(a,b){var c=this.axis,d=c.chart,e=d.inverted,f=this.isNegative,g=c.translate(this.percent? +100:this.total,0,0,0,1),c=c.translate(0),c=M(g-c),h=d.xAxis[0].translate(this.x)+a,i=d.plotHeight,f={x:e?f?g:g-c:h,y:e?i-h-b:f?i-g-c:i-g,width:e?c:b,height:e?b:c};if(e=this.label)e.align(this.alignOptions,null,f),f=e.alignAttr,e.attr({visibility:this.options.crop===!1||d.isInsidePlot(f.x,f.y)?ca?"inherit":"visible":"hidden"})}};ob.prototype={defaultOptions:{dateTimeLabelFormats:{millisecond:"%H:%M:%S.%L",second:"%H:%M:%S",minute:"%H:%M",hour:"%H:%M",day:"%e. %b",week:"%e. %b",month:"%b '%y",year:"%Y"}, +endOnTick:!1,gridLineColor:"#C0C0C0",labels:G,lineColor:"#C0D0E0",lineWidth:1,minPadding:0.01,maxPadding:0.01,minorGridLineColor:"#E0E0E0",minorGridLineWidth:1,minorTickColor:"#A0A0A0",minorTickLength:2,minorTickPosition:"outside",startOfWeek:1,startOnTick:!1,tickColor:"#C0D0E0",tickLength:5,tickmarkPlacement:"between",tickPixelInterval:100,tickPosition:"outside",tickWidth:1,title:{align:"middle",style:{color:"#6D869F",fontWeight:"bold"}},type:"linear"},defaultYAxisOptions:{endOnTick:!0,gridLineWidth:1, +tickPixelInterval:72,showLastLabel:!0,labels:{align:"right",x:-8,y:3},lineWidth:0,maxPadding:0.05,minPadding:0.05,startOnTick:!0,tickWidth:0,title:{rotation:270,text:"Y-values"},stackLabels:{enabled:!1,formatter:function(){return this.total},style:G.style}},defaultLeftAxisOptions:{labels:{align:"right",x:-8,y:null},title:{rotation:270}},defaultRightAxisOptions:{labels:{align:"left",x:8,y:null},title:{rotation:90}},defaultBottomAxisOptions:{labels:{align:"center",x:0,y:14},title:{rotation:0}},defaultTopAxisOptions:{labels:{align:"center", +x:0,y:-5},title:{rotation:0}},init:function(a,b){var c=b.isX;this.horiz=a.inverted?!c:c;this.xOrY=(this.isXAxis=c)?"x":"y";this.opposite=b.opposite;this.side=this.horiz?this.opposite?0:2:this.opposite?1:3;this.setOptions(b);var d=this.options,e=d.type,f=e==="datetime";this.labelFormatter=d.labels.formatter||this.defaultLabelFormatter;this.staggerLines=this.horiz&&d.labels.staggerLines;this.userOptions=b;this.minPixelPadding=0;this.chart=a;this.reversed=d.reversed;this.categories=d.categories;this.isLog= +e==="logarithmic";this.isLinked=r(d.linkedTo);this.isDatetimeAxis=f;this.tickmarkOffset=d.categories&&d.tickmarkPlacement==="between"?0.5:0;this.ticks={};this.minorTicks={};this.plotLinesAndBands=[];this.alternateBands={};this.len=0;this.minRange=this.userMinRange=d.minRange||d.maxZoom;this.range=d.range;this.offset=d.offset||0;this.stacks={};this.min=this.max=null;var g,d=this.options.events;a.axes.push(this);a[c?"xAxis":"yAxis"].push(this);this.series=[];if(a.inverted&&c&&this.reversed===A)this.reversed= +!0;this.removePlotLine=this.removePlotBand=this.removePlotBandOrLine;this.addPlotLine=this.addPlotBand=this.addPlotBandOrLine;for(g in d)J(this,g,d[g]);if(this.isLog)this.val2lin=ka,this.lin2val=aa},setOptions:function(a){this.options=B(this.defaultOptions,this.isXAxis?{}:this.defaultYAxisOptions,[this.defaultTopAxisOptions,this.defaultRightAxisOptions,this.defaultBottomAxisOptions,this.defaultLeftAxisOptions][this.side],B(N[this.isXAxis?"xAxis":"yAxis"],a))},defaultLabelFormatter:function(){var a= +this.axis,b=this.value,c=this.dateTimeLabelFormat,d=N.lang.numericSymbols,e=d&&d.length,f,g=a.isLog?b:a.tickInterval;if(a.categories)f=b;else if(c)f=db(c,b);else if(e&&g>=1E3)for(;e--&&f===A;)a=Math.pow(1E3,e+1),g>=a&&d[e]!==null&&(f=Ja(b/a,-1)+d[e]);f===A&&(f=b>=1E3?Ja(b,0):Ja(b,-1));return f},getSeriesExtremes:function(){var a=this,b=a.chart,c=a.stacks,d=[],e=[],f;a.hasVisibleSeries=!1;a.dataMin=a.dataMax=null;o(a.series,function(g){if(g.visible||!b.options.chart.ignoreHiddenSeries){var h=g.options, +i,j,k,l,m,q,p,y,t,o=h.threshold,u,v=[],x=0;a.hasVisibleSeries=!0;if(a.isLog&&o<=0)o=h.threshold=null;if(a.isXAxis){if(h=g.xData,h.length)a.dataMin=O(n(a.dataMin,h[0]),Fa(h)),a.dataMax=s(n(a.dataMax,h[0]),wa(h))}else{var z,E,S,w=g.cropped,B=g.xAxis.getExtremes(),C=!!g.modifyValue;i=h.stacking;a.usePercentage=i==="percent";if(i)m=h.stack,l=g.type+n(m,""),q="-"+l,g.stackKey=l,j=d[l]||[],d[l]=j,k=e[q]||[],e[q]=k;if(a.usePercentage)a.dataMin=0,a.dataMax=99;h=g.processedXData;p=g.processedYData;u=p.length; +for(f=0;f=B.min&&(h[f-1]||y)<=B.max))if(y=t.length)for(;y--;)t[y]!==null&&(v[x++]=t[y]);else v[x++]=t;if(!a.usePercentage&&v.length)a.dataMin=O(n(a.dataMin,v[0]),Fa(v)),a.dataMax=s(n(a.dataMax,v[0]),wa(v));if(r(o))if(a.dataMin>=o)a.dataMin=o,a.ignoreMinPadding= +!0;else if(a.dataMaxe+this.width)l=!0}else if(c=e,h=k-this.right,gf+this.height)l=!0;return l?null:d.renderer.crispLine(["M",c,g,"L",h,i],b||0)},getPlotBandPath:function(a,b){var c=this.getPlotLinePath(b),d=this.getPlotLinePath(a);d&&c?d.push(c[4],c[5],c[1],c[2]):d=null;return d},getLinearTickPositions:function(a, +b,c){for(var d,b=da(U(b/a)*a),c=da(za(c/a)*a),e=[];b<=c;){e.push(b);b=da(b+a);if(b===d)break;d=b}return e},getLogTickPositions:function(a,b,c,d){var e=this.options,f=this.len,g=[];if(!d)this._minorAutoInterval=null;if(a>=0.5)a=u(a),g=this.getLinearTickPositions(a,b,c);else if(a>=0.08)for(var f=U(b),h,i,j,k,l,e=a>0.3?[1,2,4]:a>0.15?[1,2,4,6,8]:[1,2,3,4,5,6,7,8,9];fb&&g.push(k),k>c&&(l=!0),k=j}else if(b=aa(b),c=aa(c),a=e[d?"minorTickInterval": +"tickInterval"],a=n(a==="auto"?null:a,this._minorAutoInterval,(c-b)*(e.tickPixelInterval/(d?5:1))/((d?f/this.tickPositions.length:f)||1)),a=hb(a,null,K.pow(10,U(K.log(a)/K.LN10))),g=Ta(this.getLinearTickPositions(a,b,c),ka),!d)this._minorAutoInterval=a/5;if(!d)this.tickInterval=a;return g},getMinorTickPositions:function(){var a=this.options,b=this.tickPositions,c=this.minorTickInterval,d=[],e;if(this.isLog){e=b.length;for(a=1;a=this.minRange,f,g,h,i,j;if(this.isXAxis&&this.minRange===A&&!this.isLog)r(a.min)||r(a.max)?this.minRange=null:(o(this.series,function(a){i=a.xData;for(g=j=a.xIncrement?1:i.length-1;g>0;g--)if(h=i[g]-i[g-1],f===A||h0||!b.ignoreMaxPadding))b.max+=c*j}b.tickInterval=b.min===b.max||b.min===void 0||b.max===void 0?1:h&&!l&&q===b.linkedParent.options.tickPixelInterval?b.linkedParent.tickInterval:n(l,p?1:(b.max-b.min)*q/(b.len||1));g&&!a&&o(b.series,function(a){a.processData(b.min!==b.oldMin||b.max!==b.oldMax)});b.setAxisTranslation(a); +b.beforeSetTickPositions&&b.beforeSetTickPositions();if(b.postProcessTickInterval)b.tickInterval=b.postProcessTickInterval(b.tickInterval);if(!l&&b.tickIntervale&&i.shift(),d.endOnTick?b.max=f:b.max+hb[d]&&this.options.alignTicks!==!1)b[d]=c.length;a.maxTicks=b},adjustTickAmount:function(){var a=this.xOrY,b=this.tickPositions,c=this.chart.maxTicks;if(c&&c[a]&&!this.isDatetimeAxis&&!this.categories&&!this.isLinked&&this.options.alignTicks!==!1){var d=this.tickAmount,e=b.length;this.tickAmount=a=c[a];if(ea||a===null?a=c:b=a.min&&b<=a.max)j[b]||(j[b]=new Qa(a,b)),H&&j[b].isNew&&j[b].render(c,!0),j[b].isActive=!0,j[b].render(c)}),q&&o(g,function(b,c){if(c%2===0&&b1||M(b-f.y)>1))clearTimeout(this.tooltipTimeout),this.tooltipTimeout=setTimeout(function(){e&&e.move(a,b,c,d)},32)},hide:function(){if(!this.isHidden){var a=this.chart.hoverPoints;this.label.hide();a&&o(a,function(a){a.setState()});this.chart.hoverPoints=null;this.isHidden=!0}},hideCrosshairs:function(){o(this.crosshairs, +function(a){a&&a.hide()})},getAnchor:function(a,b){var c,d=this.chart,e=d.inverted,f=0,g=0,h,a=la(a);c=a[0].tooltipPos;c||(o(a,function(a){h=a.series.yAxis;f+=a.plotX;g+=(a.plotLow?(a.plotLow+a.plotHigh)/2:a.plotY)+(!e&&h?h.top-d.plotTop:0)}),f/=a.length,g/=a.length,c=[e?d.plotWidth-g:f,this.shared&&!e&&a.length>1&&b?b.chartY-d.plotTop:e?d.plotHeight-f:g]);return Ta(c,u)},getPosition:function(a,b,c){var d=this.chart,e=d.plotLeft,f=d.plotTop,g=d.plotWidth,h=d.plotHeight,i=n(this.options.distance,12), +j=c.plotX,c=c.plotY,d=j+e+(d.inverted?i:-a-i),k=c-b+f+15,l;d<7&&(d=e+s(j,0)+i);d+a>e+g&&(d-=d+a-(e+g),k=c-b+f-i,l=!0);k=k&&c<=k+b&&(k=c+f+i));k+b>f+h&&(k=s(f,f+h-b-i));return{x:d,y:k}},refresh:function(a,b){function c(){var a=this.points||la(this),b=a[0].series,c;c=[b.tooltipHeaderFormatter(a[0].key)];o(a,function(a){b=a.series;c.push(b.tooltipFormatter&&b.tooltipFormatter(a)||a.point.tooltipFormatter(b.tooltipOptions.pointFormat))});c.push(f.footerFormat||"");return c.join("")} +var d=this.chart,e=this.label,f=this.options,g,h,i,j={},k,l=[];k=f.formatter||c;var j=d.hoverPoints,m,q=f.crosshairs;i=this.shared;h=this.getAnchor(a,b);g=h[0];h=h[1];i&&(!a.series||!a.series.noSharedTooltip)?(d.hoverPoints=a,j&&o(j,function(a){a.setState()}),o(a,function(a){a.setState("hover");l.push(a.getLabelConfig())}),j={x:a[0].category,y:a[0].y},j.points=l,a=a[0]):j=a.getLabelConfig();k=k.call(j);j=a.series;i=i||!j.isCartesian||j.tooltipOutsidePlot||d.isInsidePlot(g,h);k===!1||!i?this.hide(): +(this.isHidden&&e.show(),e.attr({text:k}),m=f.borderColor||a.color||j.color||"#606060",e.attr({stroke:m}),e=(f.positioner||this.getPosition).call(this,e.width,e.height,{plotX:g,plotY:h}),this.move(u(e.x),u(e.y),g+d.plotLeft,h+d.plotTop),this.isHidden=!1);if(q){q=la(q);for(e=q.length;e--;)if(i=a.series[e?"yAxis":"xAxis"],q[e]&&i)if(i=i.getPlotLinePath(e?n(a.stackY,a.y):a.x,1),this.crosshairs[e])this.crosshairs[e].attr({d:i,visibility:"visible"});else{j={"stroke-width":q[e].width||1,stroke:q[e].color|| +"#C0C0C0",zIndex:q[e].zIndex||2};if(q[e].dashStyle)j.dashstyle=q[e].dashStyle;this.crosshairs[e]=d.renderer.path(i).attr(j).add()}}F(d,"tooltipRefresh",{text:k,x:g+d.plotLeft,y:h+d.plotTop,borderColor:m})}};qb.prototype={normalizeMouseEvent:function(a){var b,c,d,a=a||L.event;if(!a.target)a.target=a.srcElement;a=Pb(a);d=a.touches?a.touches.item(0):a;this.chartPosition=b=Vb(this.chart.container);d.pageX===A?(c=a.x,b=a.y):(c=d.pageX-b.left,b=d.pageY-b.top);return x(a,{chartX:u(c),chartY:u(b)})},getMouseCoordinates:function(a){var b= +{xAxis:[],yAxis:[]},c=this.chart;o(c.axes,function(d){var e=d.isXAxis;b[e?"xAxis":"yAxis"].push({axis:d,value:d.translate(((c.inverted?!e:e)?a.chartX-c.plotLeft:d.top+d.len-a.chartY)-d.minPixelPadding,!0)})});return b},getIndex:function(a){var b=this.chart;return b.inverted?b.plotHeight+b.plotTop-a.chartY:a.chartX-b.plotLeft},onmousemove:function(a){var b=this.chart,c=b.series,d=b.tooltip,e,f=b.hoverPoint,g=b.hoverSeries,h,i,j=b.chartWidth,k=this.getIndex(a);if(d&&this.options.tooltip.shared&&(!g|| +!g.noSharedTooltip)){e=[];h=c.length;for(i=0;ij&&e.splice(h,1);if(e.length&&e[0].plotX!==this.hoverX)d.refresh(e,a),this.hoverX=e[0].plotX}if(g&&g.tracker&&(b=g.tooltipPoints[k])&&b!==f)b.onMouseOver()},resetTracker:function(a){var b=this.chart, +c=b.hoverSeries,d=b.hoverPoint,e=b.tooltip,b=e&&e.shared?b.hoverPoints:d;(a=a&&e&&b)&&la(b)[0].plotX===A&&(a=!1);if(a)e.refresh(b);else{if(d)d.onMouseOut();if(c)c.onMouseOut();e&&(e.hide(),e.hideCrosshairs());this.hoverX=null}},setDOMEvents:function(){function a(){if(b.selectionMarker){var f={xAxis:[],yAxis:[]},g=b.selectionMarker.getBBox(),h=g.x-c.plotLeft,l=g.y-c.plotTop,m;e&&(o(c.axes,function(a){if(a.options.zoomEnabled!==!1){var b=a.isXAxis,d=c.inverted?!b:b,e=a.translate(d?h:c.plotHeight-l- +g.height,!0,0,0,1),d=a.translate((d?h+g.width:c.plotHeight-l)-2*a.minPixelPadding,!0,0,0,1);!isNaN(e)&&!isNaN(d)&&(f[b?"xAxis":"yAxis"].push({axis:a,min:O(e,d),max:s(e,d)}),m=!0)}}),m&&F(c,"selection",f,function(a){c.zoom(a)}));b.selectionMarker=b.selectionMarker.destroy()}if(c)I(d,{cursor:"auto"}),c.cancelClick=e,c.mouseIsDown=e=!1;R(C,"mouseup",a);Ba&&R(C,"touchend",a)}var b=this,c=b.chart,d=c.container,e,f=b.zoomX&&!c.inverted||b.zoomY&&c.inverted,g=b.zoomY&&!c.inverted||b.zoomX&&c.inverted;b.hideTooltipOnMouseMove= +function(a){a=Pb(a);b.chartPosition&&c.hoverSeries&&c.hoverSeries.isCartesian&&!c.isInsidePlot(a.pageX-b.chartPosition.left-c.plotLeft,a.pageY-b.chartPosition.top-c.plotTop)&&b.resetTracker()};b.hideTooltipOnMouseLeave=function(){b.resetTracker();b.chartPosition=null};d.onmousedown=function(d){d=b.normalizeMouseEvent(d);d.type.indexOf("touch")===-1&&d.preventDefault&&d.preventDefault();c.mouseIsDown=!0;c.cancelClick=!1;c.mouseDownX=b.mouseDownX=d.chartX;b.mouseDownY=d.chartY;J(C,"mouseup",a);Ba&& +J(C,"touchend",a)};var h=function(a){if(!a||!(a.touches&&a.touches.length>1)){var a=b.normalizeMouseEvent(a),d=a.type,h=a.chartX,l=a.chartY,m=!c.isInsidePlot(h-c.plotLeft,l-c.plotTop);if(d.indexOf("touch")===-1)a.returnValue=!1;d==="touchstart"&&(w(a.target,"isTracker")?c.runTrackerClick||a.preventDefault():!c.runChartClick&&!m&&a.preventDefault());if(m)hc.plotLeft+c.plotWidth&&(h=c.plotLeft+c.plotWidth),lc.plotTop+c.plotHeight&&(l=c.plotTop+c.plotHeight); +if(c.mouseIsDown&&d!=="touchstart"&&(e=Math.sqrt(Math.pow(b.mouseDownX-h,2)+Math.pow(b.mouseDownY-l,2)),e>10)){d=c.isInsidePlot(b.mouseDownX-c.plotLeft,b.mouseDownY-c.plotTop);if(c.hasCartesianSeries&&(b.zoomX||b.zoomY)&&d&&!b.selectionMarker)b.selectionMarker=c.renderer.rect(c.plotLeft,c.plotTop,f?1:c.plotWidth,g?1:c.plotHeight,0).attr({fill:b.options.chart.selectionMarkerFill||"rgba(69,114,167,0.25)",zIndex:7}).add();if(b.selectionMarker&&f){var q=h-b.mouseDownX;b.selectionMarker.attr({width:M(q), +x:(q>0?0:q)+b.mouseDownX})}b.selectionMarker&&g&&(l-=b.mouseDownY,b.selectionMarker.attr({height:M(l),y:(l>0?0:l)+b.mouseDownY}));d&&!b.selectionMarker&&b.options.chart.panning&&c.pan(h)}if(!m)b.onmousemove(a);return m||!c.hasCartesianSeries}};if(!/Android 4\.0/.test(na))d.onmousemove=h;J(d,"mouseleave",b.hideTooltipOnMouseLeave);Ba||J(C,"mousemove",b.hideTooltipOnMouseMove);d.ontouchstart=function(a){if(b.zoomX||b.zoomY)d.onmousedown(a);h(a)};d.ontouchmove=h;d.ontouchend=function(){e&&b.resetTracker()}; +d.onclick=function(a){var d=c.hoverPoint,e,f,a=b.normalizeMouseEvent(a);a.cancelBubble=!0;if(!c.cancelClick)d&&(w(a.target,"isTracker")||w(a.target.parentNode,"isTracker"))?(e=d.plotX,f=d.plotY,x(d,{pageX:b.chartPosition.left+c.plotLeft+(c.inverted?c.plotWidth-f:e),pageY:b.chartPosition.top+c.plotTop+(c.inverted?c.plotHeight-e:f)}),F(d.series,"click",x(a,{point:d})),d.firePointEvent("click",a)):(x(a,b.getMouseCoordinates(a)),c.isInsidePlot(a.chartX-c.plotLeft,a.chartY-c.plotTop)&&F(c,"click",a))}}, +destroy:function(){var a=this.chart,b=a.container;if(a.trackerGroup)a.trackerGroup=a.trackerGroup.destroy();R(b,"mouseleave",this.hideTooltipOnMouseLeave);R(C,"mousemove",this.hideTooltipOnMouseMove);b.onclick=b.onmousedown=b.onmousemove=b.ontouchstart=b.ontouchend=b.ontouchmove=null;clearInterval(this.tooltipTimeout)},init:function(a,b){if(!a.trackerGroup)a.trackerGroup=a.renderer.g("tracker").attr({zIndex:9}).add();if(b.enabled)a.tooltip=new pb(a,b);this.setDOMEvents()}};rb.prototype={init:function(a){var b= +this,c=b.options=a.options.legend;if(c.enabled){var d=c.itemStyle,e=n(c.padding,8),f=c.itemMarginTop||0;b.baseline=z(d.fontSize)+3+f;b.itemStyle=d;b.itemHiddenStyle=B(d,c.itemHiddenStyle);b.itemMarginTop=f;b.padding=e;b.initialItemX=e;b.initialItemY=e-5;b.maxItemWidth=0;b.chart=a;b.itemHeight=0;b.lastLineHeight=0;b.render();J(b.chart,"endResize",function(){b.positionCheckboxes()})}},colorizeItem:function(a,b){var c=this.options,d=a.legendItem,e=a.legendLine,f=a.legendSymbol,g=this.itemHiddenStyle.color, +c=b?c.itemStyle.color:g,h=b?a.color:g,g=a.options&&a.options.marker,i={stroke:h,fill:h},j;d&&d.css({fill:c});e&&e.attr({stroke:h});if(f){if(g)for(j in g=a.convertAttribs(g),g)d=g[j],d!==A&&(i[j]=d);f.attr(i)}},positionItem:function(a){var b=this.options,c=b.symbolPadding,b=!b.rtl,d=a._legendItemPos,e=d[0],d=d[1],f=a.checkbox;a.legendGroup&&a.legendGroup.translate(b?e:this.legendWidth-e-2*c-4,d);if(f)f.x=e,f.y=d},destroyItem:function(a){var b=a.checkbox;o(["legendItem","legendLine","legendSymbol", +"legendGroup"],function(b){a[b]&&a[b].destroy()});b&&Na(a.checkbox)},destroy:function(){var a=this.group,b=this.box;if(b)this.box=b.destroy();if(a)this.group=a.destroy()},positionCheckboxes:function(a){var b=this.group.alignAttr,c,d=this.clipHeight||this.legendHeight;if(b)c=b.translateY,o(this.allItems,function(e){var f=e.checkbox,g;f&&(g=c+f.y+(a||0)+3,I(f,{left:b.translateX+e.legendItemWidth+f.x-20+"px",top:g+"px",display:g>c-6&&g(m||c.chartWidth-2*k-o))b.itemX=o,b.itemY+=n+b.lastLineHeight+q,b.lastLineHeight=0;b.maxItemWidth=s(b.maxItemWidth,e);b.lastItemY=n+b.itemY+q;b.lastLineHeight=s(g,b.lastLineHeight);a._legendItemPos=[b.itemX,b.itemY];f?b.itemX+=e:(b.itemY+=n+g+q,b.lastLineHeight=g);b.offsetWidth= +m||s(f?b.itemX-o:e,b.offsetWidth)},render:function(){var a=this,b=a.chart,c=b.renderer,d=a.group,e,f,g,h,i=a.box,j=a.options,k=a.padding,l=j.borderWidth,m=j.backgroundColor;a.itemX=a.initialItemX;a.itemY=a.initialItemY;a.offsetWidth=0;a.lastItemY=0;if(!d)a.group=d=c.g("legend").attr({zIndex:7}).add(),a.contentGroup=c.g().attr({zIndex:1}).add(d),a.scrollGroup=c.g().add(a.contentGroup),a.clipRect=c.clipRect(0,0,9999,b.chartHeight),a.contentGroup.clip(a.clipRect);e=[];o(b.series,function(a){var b=a.options; +b.showInLegend&&(e=e.concat(a.legendItems||(b.legendType==="point"?a.data:a)))});Ib(e,function(a,b){return(a.options&&a.options.legendIndex||0)-(b.options&&b.options.legendIndex||0)});j.reversed&&e.reverse();a.allItems=e;a.display=f=!!e.length;o(e,function(b){a.renderItem(b)});g=j.width||a.offsetWidth;h=a.lastItemY+a.lastLineHeight;h=a.handleOverflow(h);if(l||m){g+=k;h+=k;if(i){if(g>0&&h>0)i[i.isNew?"attr":"animate"](i.crisp(null,null,null,g,h)),i.isNew=!1}else a.box=i=c.rect(0,0,g,h,j.borderRadius, +l||0).attr({stroke:j.borderColor,"stroke-width":l||0,fill:m||Q}).add(d).shadow(j.shadow),i.isNew=!0;i[f?"show":"hide"]()}a.legendWidth=g;a.legendHeight=h;o(e,function(b){a.positionItem(b)});f&&d.align(x({width:g,height:h},j),!0,b.spacingBox);b.isResizing||this.positionCheckboxes()},handleOverflow:function(a){var b=this,c=this.chart,d=c.renderer,e=this.options,f=e.y,f=c.spacingBox.height+(e.verticalAlign==="top"?-f:f)-this.padding,g=e.maxHeight,h=this.clipRect,i=e.navigation,j=n(i.animation,!0),k= +i.arrowSize||12,l=this.nav;e.layout==="horizontal"&&(f/=2);g&&(f=O(f,g));if(a>f){this.clipHeight=c=f-20;this.pageCount=za(a/c);this.currentPage=n(this.currentPage,1);this.fullHeight=a;h.attr({height:c});if(!l)this.nav=l=d.g().attr({zIndex:1}).add(this.group),this.up=d.symbol("triangle",0,0,k,k).on("click",function(){b.scroll(-1,j)}).add(l),this.pager=d.text("",15,10).css(i.style).add(l),this.down=d.symbol("triangle-down",0,0,k,k).on("click",function(){b.scroll(1,j)}).add(l);b.scroll(0);a=f}else if(l)h.attr({height:c.chartHeight}), +l.hide(),this.scrollGroup.attr({translateY:1}),this.clipHeight=0;return a},scroll:function(a,b){var c=this.pageCount,d=this.currentPage+a,e=this.clipHeight,f=this.options.navigation,g=f.activeColor,h=f.inactiveColor,f=this.pager,i=this.padding;d>c&&(d=c);if(d>0)b!==A&&xa(b,this.chart),this.nav.attr({translateX:i,translateY:e+7,visibility:"visible"}),this.up.attr({fill:d===1?h:g}).css({cursor:d===1?"default":"pointer"}),f.attr({text:d+"/"+this.pageCount}),this.down.attr({x:18+this.pager.getBBox().width, +fill:d===c?h:g}).css({cursor:d===c?"default":"pointer"}),e=-O(e*(d-1),this.fullHeight-e+i)+1,this.scrollGroup.animate({translateY:e}),f.attr({text:d+"/"+c}),this.currentPage=d,this.positionCheckboxes(e)}};sb.prototype={init:function(a,b){var c,d=a.series;a.series=null;c=B(N,a);c.series=a.series=d;var d=c.chart,e=d.margin,e=Y(e)?e:[e,e,e,e];this.optionsMarginTop=n(d.marginTop,e[0]);this.optionsMarginRight=n(d.marginRight,e[1]);this.optionsMarginBottom=n(d.marginBottom,e[2]);this.optionsMarginLeft= +n(d.marginLeft,e[3]);this.runChartClick=(e=d.events)&&!!e.click;this.callback=b;this.isResizing=0;this.options=c;this.axes=[];this.series=[];this.hasCartesianSeries=d.showAxes;var f;this.index=Ha.length;Ha.push(this);d.reflow!==!1&&J(this,"load",this.initReflow);if(e)for(f in e)J(this,f,e[f]);this.xAxis=[];this.yAxis=[];this.animation=V?!1:n(d.animation,!0);this.pointCount=0;this.counters=new Hb;this.firstRender()},initSeries:function(a){var b=this.options.chart,b=new $[a.type||b.type||b.defaultSeriesType]; +b.init(this,a);return b},addSeries:function(a,b,c){var d,e=this;a&&(xa(c,e),b=n(b,!0),F(e,"addSeries",{options:a},function(){d=e.initSeries(a);e.isDirtyLegend=!0;b&&e.redraw()}));return d},isInsidePlot:function(a,b,c){var d=c?b:a,a=c?a:b;return d>=0&&d<=this.plotWidth&&a>=0&&a<=this.plotHeight},adjustTickAmounts:function(){this.options.chart.alignTicks!==!1&&o(this.axes,function(a){a.adjustTickAmount()});this.maxTicks=null},redraw:function(a){var b=this.axes,c=this.series,d=this.tracker,e=this.legend, +f=this.isDirtyLegend,g,h=this.isDirtyBox,i=c.length,j=i,k=this.renderer,l=k.isHidden(),m=[];xa(a,this);for(l&&this.cloneRenderTo();j--;)if(a=c[j],a.isDirty&&a.options.stacking){g=!0;break}if(g)for(j=i;j--;)if(a=c[j],a.options.stacking)a.isDirty=!0;o(c,function(a){a.isDirty&&a.options.legendType==="point"&&(f=!0)});if(f&&e.options.enabled)e.render(),this.isDirtyLegend=!1;if(this.hasCartesianSeries){if(!this.isResizing)this.maxTicks=null,o(b,function(a){a.setScale()});this.adjustTickAmounts();this.getMargins(); +o(b,function(a){if(a.isDirtyExtremes)a.isDirtyExtremes=!1,m.push(function(){F(a,"afterSetExtremes",a.getExtremes())});if(a.isDirty||h||g)a.redraw(),h=!0})}h&&this.drawChartBox();o(c,function(a){a.isDirty&&a.visible&&(!a.isCartesian||a.xAxis)&&a.redraw()});d&&d.resetTracker&&d.resetTracker(!0);k.draw();F(this,"redraw");l&&this.cloneRenderTo(!0);o(m,function(a){a.call()})},showLoading:function(a){var b=this.options,c=this.loadingDiv,d=b.loading;if(!c)this.loadingDiv=c=T(ga,{className:"highcharts-loading"}, +x(d.style,{left:this.plotLeft+"px",top:this.plotTop+"px",width:this.plotWidth+"px",height:this.plotHeight+"px",zIndex:10,display:Q}),this.container),this.loadingSpan=T("span",null,d.labelStyle,c);this.loadingSpan.innerHTML=a||b.lang.loading;if(!this.loadingShown)I(c,{opacity:0,display:""}),xb(c,{opacity:d.style.opacity},{duration:d.showDuration||0}),this.loadingShown=!0},hideLoading:function(){var a=this.options,b=this.loadingDiv;b&&xb(b,{opacity:0},{duration:a.loading.hideDuration||100,complete:function(){I(b, +{display:Q})}});this.loadingShown=!1},get:function(a){var b=this.axes,c=this.series,d,e;for(d=0;dO(e.dataMin,e.min)&&c19?this.containerHeight:400))},cloneRenderTo:function(a){var b=this.renderToClone,c=this.container;a?b&&(this.renderTo.appendChild(c),Na(b),delete this.renderToClone):(c&&this.renderTo.removeChild(c),this.renderToClone=b=this.renderTo.cloneNode(0),I(b,{position:"absolute",top:"-9999px",display:"block"}),C.body.appendChild(b),c&&b.appendChild(c))},getContainer:function(){var a,b=this.options.chart,c,d,e;this.renderTo=a=b.renderTo;e="highcharts-"+tb++;if(ja(a))this.renderTo= +a=C.getElementById(a);a||Oa(13,!0);c=z(w(a,"data-highcharts-chart"));!isNaN(c)&&Ha[c]&&Ha[c].destroy();w(a,"data-highcharts-chart",this.index);a.innerHTML="";a.offsetWidth||this.cloneRenderTo();this.getChartSize();c=this.chartWidth;d=this.chartHeight;this.container=a=T(ga,{className:"highcharts-container"+(b.className?" "+b.className:""),id:e},x({position:"relative",overflow:"hidden",width:c+"px",height:d+"px",textAlign:"left",lineHeight:"normal",zIndex:0},b.style),this.renderToClone||a);this.renderer= +b.forExport?new sa(a,c,d,!0):new Sa(a,c,d);V&&this.renderer.create(this,a,c,d)},getMargins:function(){var a=this.options.chart,b=a.spacingTop,c=a.spacingRight,d=a.spacingBottom,a=a.spacingLeft,e,f=this.legend,g=this.optionsMarginTop,h=this.optionsMarginLeft,i=this.optionsMarginRight,j=this.optionsMarginBottom,k=this.chartTitleOptions,l=this.chartSubtitleOptions,m=this.options.legend,q=n(m.margin,10),p=m.x,y=m.y,t=m.align,u=m.verticalAlign;this.resetMargins();e=this.axisOffset;if((this.title||this.subtitle)&& +!r(this.optionsMarginTop))if(l=s(this.title&&!k.floating&&!k.verticalAlign&&k.y||0,this.subtitle&&!l.floating&&!l.verticalAlign&&l.y||0))this.plotTop=s(this.plotTop,l+n(k.margin,15)+b);if(f.display&&!m.floating)if(t==="right"){if(!r(i))this.marginRight=s(this.marginRight,f.legendWidth-p+q+c)}else if(t==="left"){if(!r(h))this.plotLeft=s(this.plotLeft,f.legendWidth+p+q+a)}else if(u==="top"){if(!r(g))this.plotTop=s(this.plotTop,f.legendHeight+y+q+b)}else if(u==="bottom"&&!r(j))this.marginBottom=s(this.marginBottom, +f.legendHeight-y+q+d);this.extraBottomMargin&&(this.marginBottom+=this.extraBottomMargin);this.extraTopMargin&&(this.plotTop+=this.extraTopMargin);this.hasCartesianSeries&&o(this.axes,function(a){a.getOffset()});r(h)||(this.plotLeft+=e[3]);r(g)||(this.plotTop+=e[0]);r(j)||(this.marginBottom+=e[2]);r(i)||(this.marginRight+=e[1]);this.setChartSize()},initReflow:function(){function a(a){var g=c.width||eb(d,"width"),h=c.height||eb(d,"height"),a=a?a.target:L;if(!b.hasUserSize&&g&&h&&(a===L||a===C)){if(g!== +b.containerWidth||h!==b.containerHeight)clearTimeout(e),b.reflowTimeout=e=setTimeout(function(){if(b.container)b.setSize(g,h,!1),b.hasUserSize=null},100);b.containerWidth=g;b.containerHeight=h}}var b=this,c=b.options.chart,d=b.renderTo,e;J(L,"resize",a);J(b,"destroy",function(){R(L,"resize",a)})},setSize:function(a,b,c){var d=this,e,f,g=d.resetZoomButton,h=d.title,i=d.subtitle,j;d.isResizing+=1;j=function(){d&&F(d,"endResize",null,function(){d.isResizing-=1})};xa(c,d);d.oldChartHeight=d.chartHeight; +d.oldChartWidth=d.chartWidth;if(r(a))d.chartWidth=e=s(0,u(a)),d.hasUserSize=!!e;if(r(b))d.chartHeight=f=s(0,u(b));I(d.container,{width:e+"px",height:f+"px"});d.renderer.setSize(e,f,c);d.plotWidth=e-d.plotLeft-d.marginRight;d.plotHeight=f-d.plotTop-d.marginBottom;d.maxTicks=null;o(d.axes,function(a){a.isDirty=!0;a.setScale()});o(d.series,function(a){a.isDirty=!0});d.isDirtyLegend=!0;d.isDirtyBox=!0;d.getMargins();a=d.spacingBox;h&&h.align(null,null,a);i&&i.align(null,null,a);g&&g.align&&g.align(null, +null,d[g.alignTo]);d.redraw(c);d.oldChartHeight=null;F(d,"resize");Pa===!1?j():setTimeout(j,Pa&&Pa.duration||500)},setChartSize:function(){var a=this.inverted,b=this.chartWidth,c=this.chartHeight,d=this.options.chart,e=d.spacingTop,f=d.spacingRight,g=d.spacingBottom,h=d.spacingLeft,i,j,k,l;this.plotLeft=i=u(this.plotLeft);this.plotTop=j=u(this.plotTop);this.plotWidth=k=s(0,u(b-i-this.marginRight));this.plotHeight=l=s(0,u(c-j-this.marginBottom));this.plotSizeX=a?l:k;this.plotSizeY=a?k:l;this.plotBorderWidth= +a=d.plotBorderWidth||0;this.spacingBox={x:h,y:e,width:b-h-f,height:c-e-g};this.plotBox={x:i,y:j,width:k,height:l};this.clipBox={x:a/2,y:a/2,width:this.plotSizeX-a,height:this.plotSizeY-a};o(this.axes,function(a){a.setAxisSize();a.setAxisTranslation()})},resetMargins:function(){var a=this.options.chart,b=a.spacingRight,c=a.spacingBottom,d=a.spacingLeft;this.plotTop=n(this.optionsMarginTop,a.spacingTop);this.marginRight=n(this.optionsMarginRight,b);this.marginBottom=n(this.optionsMarginBottom,c);this.plotLeft= +n(this.optionsMarginLeft,d);this.axisOffset=[0,0,0,0]},drawChartBox:function(){var a=this.options.chart,b=this.renderer,c=this.chartWidth,d=this.chartHeight,e=this.chartBackground,f=this.plotBackground,g=this.plotBorder,h=this.plotBGImage,i=a.borderWidth||0,j=a.backgroundColor,k=a.plotBackgroundColor,l=a.plotBackgroundImage,m=a.plotBorderWidth||0,n,p=this.plotLeft,o=this.plotTop,t=this.plotWidth,r=this.plotHeight,u=this.plotBox,v=this.clipRect,s=this.clipBox;n=i+(a.shadow?8:0);if(i||j)if(e)e.animate(e.crisp(null, +null,null,c-n,d-n));else{e={fill:j||Q};if(i)e.stroke=a.borderColor,e["stroke-width"]=i;this.chartBackground=b.rect(n/2,n/2,c-n,d-n,a.borderRadius,i).attr(e).add().shadow(a.shadow)}if(k)f?f.animate(u):this.plotBackground=b.rect(p,o,t,r,0).attr({fill:k}).add().shadow(a.plotShadow);if(l)h?h.animate(u):this.plotBGImage=b.image(l,p,o,t,r).add();v?v.animate({width:s.width,height:s.height}):this.clipRect=b.clipRect(s);if(m)g?g.animate(g.crisp(null,p,o,t,r)):this.plotBorder=b.rect(p,o,t,r,0,m).attr({stroke:a.plotBorderColor, +"stroke-width":m,zIndex:1}).add();this.isDirtyBox=!1},propFromSeries:function(){var a=this,b=a.options.chart,c,d=a.options.series,e,f;o(["inverted","angular","polar"],function(g){c=$[b.type||b.defaultSeriesType];f=a[g]||b[g]||c&&c.prototype[g];for(e=d&&d.length;!f&&e--;)(c=$[d[e].type])&&c.prototype[g]&&(f=!0);a[g]=f})},render:function(){var a=this,b=a.axes,c=a.renderer,d=a.options,e=d.labels,d=d.credits,f;a.setTitle();a.legend=new rb(a);o(b,function(a){a.setScale()});a.getMargins();a.maxTicks=null; +o(b,function(a){a.setTickPositions(!0);a.setMaxTicks()});a.adjustTickAmounts();a.getMargins();a.drawChartBox();a.hasCartesianSeries&&o(b,function(a){a.render()});if(!a.seriesGroup)a.seriesGroup=c.g("series-group").attr({zIndex:3}).add();o(a.series,function(a){a.translate();a.setTooltipPoints();a.render()});e.items&&o(e.items,function(b){var d=x(e.style,b.style),f=z(d.left)+a.plotLeft,j=z(d.top)+a.plotTop+12;delete d.left;delete d.top;c.text(b.html,f,j).attr({zIndex:2}).css(d).add()});if(d.enabled&& +!a.credits)f=d.href,a.credits=c.text(d.text,0,0).on("click",function(){if(f)location.href=f}).attr({align:d.position.align,zIndex:8}).css(d.style).add().align(d.position);a.hasRendered=!0},destroy:function(){var a=this,b=a.axes,c=a.series,d=a.container,e,f=d&&d.parentNode;F(a,"destroy");Ha[a.index]=A;a.renderTo.removeAttribute("data-highcharts-chart");R(a);for(e=b.length;e--;)b[e]=b[e].destroy();for(e=c.length;e--;)c[e]=c[e].destroy();o("title,subtitle,chartBackground,plotBackground,plotBGImage,plotBorder,seriesGroup,clipRect,credits,tracker,scroller,rangeSelector,legend,resetZoomButton,tooltip,renderer".split(","), +function(b){var c=a[b];c&&c.destroy&&(a[b]=c.destroy())});if(d)d.innerHTML="",R(d),f&&Na(d);for(e in a)delete a[e]},isReadyToRender:function(){var a=this;return!ca&&L==L.top&&C.readyState!=="complete"||V&&!L.canvg?(V?Rb.push(function(){a.firstRender()},a.options.global.canvasToolsURL):C.attachEvent("onreadystatechange",function(){C.detachEvent("onreadystatechange",a.firstRender);C.readyState==="complete"&&a.firstRender()}),!1):!0},firstRender:function(){var a=this,b=a.options,c=a.callback;if(a.isReadyToRender()){a.getContainer(); +F(a,"init");if(Highcharts.RangeSelector&&b.rangeSelector.enabled)a.rangeSelector=new Highcharts.RangeSelector(a);a.resetMargins();a.setChartSize();a.propFromSeries();a.getAxes();o(b.series||[],function(b){a.initSeries(b)});if(Highcharts.Scroller&&(b.navigator.enabled||b.scrollbar.enabled))a.scroller=new Highcharts.Scroller(a);a.tracker=new qb(a,b);a.render();a.renderer.draw();c&&c.apply(a,[a]);o(a.callbacks,function(b){b.apply(a,[a])});a.cloneRenderTo(!0);F(a,"load")}}};sb.prototype.callbacks=[]; +var Ua=function(){};Ua.prototype={init:function(a,b,c){var d=a.chart.counters;this.series=a;this.applyOptions(b,c);this.pointAttr={};if(a.options.colorByPoint)b=a.chart.options.colors,this.color=this.color||b[d.color++],d.wrapColor(b.length);a.chart.pointCount++;return this},applyOptions:function(a,b){var c=this.series,d=typeof a;this.config=a;if(d==="number"||a===null)this.y=a;else if(typeof a[0]==="number")this.x=a[0],this.y=a[1];else if(d==="object"&&typeof a.length!=="number"){x(this,a);this.options= +a;if(a.dataLabels)c._hasPointLabels=!0;if(a.marker)c._hasPointMarkers=!0}else if(typeof a[0]==="string")this.name=a[0],this.y=a[1];if(this.x===A)this.x=b===A?c.autoIncrement():b},destroy:function(){var a=this.series.chart,b=a.hoverPoints,c;a.pointCount--;if(b&&(this.setState(),ta(b,this),!b.length))a.hoverPoints=null;if(this===a.hoverPoint)this.onMouseOut();if(this.graphic||this.dataLabel)R(this),this.destroyElements();this.legendItem&&a.legend.destroyItem(this);for(c in this)this[c]=null},destroyElements:function(){for(var a= +"graphic,tracker,dataLabel,dataLabelUpper,group,connector,shadowGroup".split(","),b,c=6;c--;)b=a[c],this[b]&&(this[b]=this[b].destroy())},getLabelConfig:function(){return{x:this.category,y:this.y,key:this.name||this.category,series:this.series,point:this,percentage:this.percentage,total:this.total||this.stackTotal}},select:function(a,b){var c=this,d=c.series.chart,a=n(a,!c.selected);c.firePointEvent(a?"select":"unselect",{accumulate:b},function(){c.selected=a;c.setState(a&&"select");b||o(d.getSelectedPoints(), +function(a){if(a.selected&&a!==c)a.selected=!1,a.setState(""),a.firePointEvent("unselect")})})},onMouseOver:function(){var a=this.series,b=a.chart,c=b.tooltip,d=b.hoverPoint;if(d&&d!==this)d.onMouseOut();this.firePointEvent("mouseOver");c&&(!c.shared||a.noSharedTooltip)&&c.refresh(this);this.setState("hover");b.hoverPoint=this},onMouseOut:function(){var a=this.series.chart,b=a.hoverPoints;if(!b||Ub(this,b)===-1)this.firePointEvent("mouseOut"),this.setState(),a.hoverPoint=null},tooltipFormatter:function(a){var b= +this.series,c=b.tooltipOptions,d=a.match(/\{(series|point)\.[a-zA-Z]+\}/g),e=/[{\.}]/,f,g,h,i,j={y:0,open:0,high:0,low:0,close:0,percentage:1,total:1};c.valuePrefix=c.valuePrefix||c.yPrefix;c.valueDecimals=n(c.valueDecimals,c.yDecimals);c.valueSuffix=c.valueSuffix||c.ySuffix;for(i in d)g=d[i],ja(g)&&g!==a&&(h=(" "+g).split(e),f={point:this,series:b}[h[1]],h=h[2],f===this&&j.hasOwnProperty(h)?(f=j[h]?h:"value",f=(c[f+"Prefix"]||"")+Ja(this[h],n(c[f+"Decimals"],-1))+(c[f+"Suffix"]||"")):f=f[h],a=a.replace(g, +f));return a},update:function(a,b,c){var d=this,e=d.series,f=d.graphic,g,h=e.data,i=h.length,j=e.chart,b=n(b,!0);d.firePointEvent("update",{options:a},function(){d.applyOptions(a);Y(a)&&(e.getAttribs(),f&&f.attr(d.pointAttr[e.state]));for(g=0;ga+1&&b.push(d.slice(a+1,g)),a=g):g===e-1&&b.push(d.slice(a+1,g+1))});this.segments=b},setOptions:function(a){var b=this.chart.options,c=b.plotOptions,d=c[this.type],e=a.data;a.data=null;c=B(d,c.series,a);c.data=a.data=e;this.tooltipOptions=B(b.tooltip,c.tooltip);d.marker===null&&delete c.marker;return c},getColor:function(){var a=this.options, +b=this.chart.options.colors,c=this.chart.counters;this.color=a.color||!a.colorByPoint&&b[c.color++]||"gray";c.wrapColor(b.length)},getSymbol:function(){var a=this.options.marker,b=this.chart,c=b.options.symbols,b=b.counters;this.symbol=a.symbol||c[b.symbol++];if(/^url/.test(this.symbol))a.radius=0;b.wrapSymbol(c.length)},drawLegendSymbol:function(a){var b=this.options,c=b.marker,d=a.options.symbolWidth,e=this.chart.renderer,f=this.legendGroup,a=a.baseline,g;if(b.lineWidth){g={"stroke-width":b.lineWidth}; +if(b.dashStyle)g.dashstyle=b.dashStyle;this.legendLine=e.path(["M",0,a-4,"L",d,a-4]).attr(g).add(f)}if(c&&c.enabled)b=c.radius,this.legendSymbol=e.symbol(this.symbol,d/2-b,a-4-b,2*b,2*b).add(f)},addPoint:function(a,b,c,d){var e=this.options,f=this.data,g=this.graph,h=this.area,i=this.chart,j=this.xData,k=this.yData,l=g&&g.shift||0,m=e.data,q=this.pointClass.prototype;xa(d,i);if(g&&c)g.shift=l+1;if(h){if(c)h.shift=l+1;h.isArea=!0}b=n(b,!0);d={series:this};q.applyOptions.apply(d,[a]);j.push(d.x);k.push(q.toYData? +q.toYData.call(d):d.y);m.push(a);e.legendType==="point"&&this.generatePoints();c&&(f[0]&&f[0].remove?f[0].remove(!1):(f.shift(),j.shift(),k.shift(),m.shift()));this.getAttribs();this.isDirtyData=this.isDirty=!0;b&&i.redraw()},setData:function(a,b){var c=this.points,d=this.options,e=this.initialColor,f=this.chart,g=null,h=this.xAxis,i,j=this.pointClass.prototype;this.xIncrement=null;this.pointRange=h&&h.categories?1:d.pointRange;if(r(e))f.counters.color=e;var e=[],k=[],l=a?a.length:[],m=(i=this.pointArrayMap)&& +i.length;if(l>(d.turboThreshold||1E3)){for(i=0;g===null&&i1&&e[1]k||this.forceCrop))if(a=i.getExtremes(),i=a.min,k=a.max,b[d-1]k)b=[],c=[];else if(b[0]k){for(a=0;a=i){e=s(0,a-1);break}for(;ak){f=a+1;break}b=b.slice(e,f);c=c.slice(e,f);g=!0}for(a=b.length-1;a>0;a--)if(d=b[a]-b[a-1],d>0&&(h===A||d=0&&c<=d;)i[c++]=g}this.tooltipPoints=i}},tooltipHeaderFormatter:function(a){var b=this.tooltipOptions,c=b.xDateFormat,d=this.xAxis,e=d&&d.options.type==="datetime", +f;if(e&&!c)for(f in D)if(D[f]>=d.closestPointRange){c=b.dateTimeLabelFormats[f];break}return b.headerFormat.replace("{point.key}",e&&Da(a)?db(c,a):a).replace("{series.name}",this.name).replace("{series.color}",this.color)},onMouseOver:function(){var a=this.chart,b=a.hoverSeries;if(b&&b!==this)b.onMouseOut();this.options.events.mouseOver&&F(this,"mouseOver");this.setState("hover");a.hoverSeries=this},onMouseOut:function(){var a=this.options,b=this.chart,c=b.tooltip,d=b.hoverPoint;if(d)d.onMouseOut(); +this&&a.events.mouseOut&&F(this,"mouseOut");c&&!a.stickyTracking&&!c.shared&&c.hide();this.setState();b.hoverSeries=null},animate:function(a){var b=this,c=b.chart,d=c.renderer,e;e=b.options.animation;var f=c.clipBox,g=c.inverted,h;if(e&&!Y(e))e=X[b.type].animation;h="_sharedClip"+e.duration+e.easing;if(a)a=c[h],e=c[h+"m"],a||(c[h]=a=d.clipRect(x(f,{width:0})),c[h+"m"]=e=d.clipRect(-99,g?-c.plotLeft:-c.plotTop,99,g?c.chartWidth:c.chartHeight)),b.group.clip(a),b.markerGroup.clip(e),b.sharedClipKey= +h;else{if(a=c[h])a.animate({width:c.plotSizeX},e),c[h+"m"].animate({width:c.plotSizeX+99},e);b.animate=null;b.animationTimeout=setTimeout(function(){b.afterAnimate()},e.duration)}},afterAnimate:function(){var a=this.chart,b=this.sharedClipKey,c=this.group,d=this.trackerGroup;c&&this.options.clip!==!1&&(c.clip(a.clipRect),d&&d.clip(a.clipRect),this.markerGroup.clip());setTimeout(function(){b&&a[b]&&(a[b]=a[b].destroy(),a[b+"m"]=a[b+"m"].destroy())},100)},drawPoints:function(){var a,b=this.points,c= +this.chart,d,e,f,g,h,i,j,k,l=this.options.marker,m,o=this.markerGroup;if(l.enabled||this._hasPointMarkers)for(f=b.length;f--;)if(g=b[f],d=g.plotX,e=g.plotY,k=g.graphic,i=g.marker||{},a=l.enabled&&i.enabled===A||i.enabled,m=c.isInsidePlot(d,e,c.inverted),a&&e!==A&&!isNaN(e))if(a=g.pointAttr[g.selected?"select":""],h=a.r,i=n(i.symbol,this.symbol),j=i.indexOf("url")===0,k)k.attr({visibility:m?ca?"inherit":"visible":"hidden"}).animate(x({x:d-h,y:e-h},k.symbolName?{width:2*h,height:2*h}:{}));else{if(m&& +(h>0||j))g.graphic=c.renderer.symbol(i,d-h,e-h,2*h,2*h).attr(a).add(o)}else if(k)g.graphic=k.destroy()},convertAttribs:function(a,b,c,d){var e=this.pointAttrToOptions,f,g,h={},a=a||{},b=b||{},c=c||{},d=d||{};for(f in e)g=e[f],h[f]=n(a[g],b[f],c[f],d[f]);return h},getAttribs:function(){var a=this,b=X[a.type].marker?a.options.marker:a.options,c=b.states,d=c.hover,e,f=a.color,g={stroke:f,fill:f},h=a.points||[],i=[],j,k=a.pointAttrToOptions,l;a.options.marker?(d.radius=d.radius||b.radius+2,d.lineWidth= +d.lineWidth||b.lineWidth+1):d.color=d.color||qa(d.color||f).brighten(d.brightness).get();i[""]=a.convertAttribs(b,g);o(["hover","select"],function(b){i[b]=a.convertAttribs(c[b],i[""])});a.pointAttr=i;for(f=h.length;f--;){g=h[f];if((b=g.options&&g.options.marker||g.options)&&b.enabled===!1)b.radius=0;e=a.options.colorByPoint;if(g.options)for(l in k)r(b[k[l]])&&(e=!0);if(e){b=b||{};j=[];c=b.states||{};e=c.hover=c.hover||{};if(!a.options.marker)e.color=qa(e.color||g.color).brighten(e.brightness||d.brightness).get(); +j[""]=a.convertAttribs(x({color:g.color},b),i[""]);j.hover=a.convertAttribs(c.hover,i.hover,j[""]);j.select=a.convertAttribs(c.select,i.select,j[""])}else j=i;g.pointAttr=j}},destroy:function(){var a=this,b=a.chart,c=/AppleWebKit\/533/.test(na),d,e,f=a.data||[],g,h,i;F(a,"destroy");R(a);o(["xAxis","yAxis"],function(b){if(i=a[b])ta(i.series,a),i.isDirty=!0});a.legendItem&&a.chart.legend.destroyItem(a);for(e=f.length;e--;)(g=f[e])&&g.destroy&&g.destroy();a.points=null;clearTimeout(a.animationTimeout); +o("area,graph,dataLabelsGroup,group,markerGroup,tracker,trackerGroup".split(","),function(b){a[b]&&(d=c&&b==="group"?"hide":"destroy",a[b][d]())});if(b.hoverSeries===a)b.hoverSeries=null;ta(b.series,a);for(h in a)delete a[h]},drawDataLabels:function(){var a=this,b=a.options.dataLabels,c=a.points,d,e,f,g;if(b.enabled||a._hasPointLabels)a.dlProcessOptions&&a.dlProcessOptions(b),g=a.plotGroup("dataLabelsGroup","data-labels",a.visible?"visible":"hidden",b.zIndex||6),e=b,o(c,function(c){var i,j=c.dataLabel, +k,l=!0;d=c.options&&c.options.dataLabels;i=e.enabled||d&&d.enabled;if(j&&!i)c.dataLabel=j.destroy();else if(i){i=b.rotation;b=B(e,d);f=b.formatter.call(c.getLabelConfig(),b);b.style.color=n(b.color,b.style.color,a.color,"black");if(j)j.attr({text:f}),l=!1;else if(r(f)){j={fill:b.backgroundColor,stroke:b.borderColor,"stroke-width":b.borderWidth,r:b.borderRadius||0,rotation:i,padding:b.padding,zIndex:1};for(k in j)j[k]===A&&delete j[k];j=c.dataLabel=a.chart.renderer[i?"text":"label"](f,0,-999,null, +null,null,b.useHTML).attr(j).css(b.style).add(g).shadow(b.shadow)}j&&a.alignDataLabel(c,j,b,null,l)}})},alignDataLabel:function(a,b,c,d,e){var f=this.chart,g=f.inverted,h=n(a.plotX,-999),a=n(a.plotY,-999),i=b.getBBox(),d=x({x:g?f.plotWidth-a:h,y:u(g?f.plotHeight-h:a),width:0,height:0},d);x(c,{width:i.width,height:i.height});c.rotation?(d={align:c.align,x:d.x+c.x+d.width/2,y:d.y+c.y+d.height/2},b[e?"attr":"animate"](d)):(b.align(c,null,d),d=b.alignAttr);b.attr({visibility:c.crop===!1||f.isInsidePlot(d.x, +d.y)||f.isInsidePlot(h,a,g)?f.renderer.isSVG?"inherit":"visible":"hidden"})},getSegmentPath:function(a){var b=this,c=[],d=b.options.step;o(a,function(e,f){var g=e.plotX,h=e.plotY,i;b.getPointSpline?c.push.apply(c,b.getPointSpline(a,e,f)):(c.push(f?"L":"M"),d&&f&&(i=a[f-1],d==="right"?c.push(i.plotX,h):d==="center"?c.push((i.plotX+g)/2,i.plotY,(i.plotX+g)/2,h):c.push(g,i.plotY)),c.push(e.plotX,e.plotY))});return c},getGraphPath:function(){var a=this,b=[],c,d=[];o(a.segments,function(e){c=a.getSegmentPath(e); +e.length>1?b=b.concat(c):d.push(e[0])});a.singlePoints=d;return a.graphPath=b},drawGraph:function(){var a=this.options,b=this.graph,c=this.group,d=a.lineColor||this.color,e=a.lineWidth,f=a.dashStyle,g=this.getGraphPath();if(b)fb(b),b.animate({d:g});else if(e){b={stroke:d,"stroke-width":e,zIndex:1};if(f)b.dashstyle=f;this.graph=this.chart.renderer.path(g).attr(b).add(c).shadow(a.shadow)}},invertGroups:function(){function a(){var a={width:b.yAxis.len,height:b.xAxis.len};o(["group","trackerGroup","markerGroup"], +function(c){b[c]&&b[c].attr(a).invert()})}var b=this,c=b.chart;J(c,"resize",a);J(b,"destroy",function(){R(c,"resize",a)});a();b.invertGroups=a},plotGroup:function(a,b,c,d,e){var f=this[a],g=this.chart,h=this.xAxis,i=this.yAxis;f||(this[a]=f=g.renderer.g(b).attr({visibility:c,zIndex:d||0.1}).add(e));f.translate(h?h.left:g.plotLeft,i?i.top:g.plotTop);return f},render:function(){var a=this.chart,b,c=this.options,d=c.animation&&!!this.animate,e=this.visible?"visible":"hidden",f=c.zIndex,g=this.hasRendered, +h=a.seriesGroup;b=this.plotGroup("group","series",e,f,h);this.markerGroup=this.plotGroup("markerGroup","markers",e,f,h);d&&this.animate(!0);this.getAttribs();b.inverted=a.inverted;this.drawGraph&&this.drawGraph();this.drawPoints();this.drawDataLabels();this.options.enableMouseTracking!==!1&&this.drawTracker();a.inverted&&this.invertGroups();c.clip!==!1&&!this.sharedClipKey&&!g&&(b.clip(a.clipRect),this.trackerGroup&&this.trackerGroup.clip(a.clipRect));d?this.animate():g||this.afterAnimate();this.isDirty= +this.isDirtyData=!1;this.hasRendered=!0},redraw:function(){var a=this.chart,b=this.isDirtyData,c=this.group;c&&(a.inverted&&c.attr({width:a.plotWidth,height:a.plotHeight}),c.animate({translateX:this.xAxis.left,translateY:this.yAxis.top}));this.translate();this.setTooltipPoints(!0);this.render();b&&F(this,"updatedData")},setState:function(a){var b=this.options,c=this.graph,d=b.states,b=b.lineWidth,a=a||"";if(this.state!==a)this.state=a,d[a]&&d[a].enabled===!1||(a&&(b=d[a].lineWidth||b+1),c&&!c.dashstyle&& +c.attr({"stroke-width":b},a?0:500))},setVisible:function(a,b){var c=this.chart,d=this.legendItem,e=this.group,f=this.tracker,g=this.dataLabelsGroup,h=this.markerGroup,i,j=this.points,k=c.options.chart.ignoreHiddenSeries;i=this.visible;i=(this.visible=a=a===A?!i:a)?"show":"hide";if(e)e[i]();if(h)h[i]();if(f)f[i]();else if(j)for(e=j.length;e--;)if(f=j[e],f.tracker)f.tracker[i]();if(c.hoverSeries===this)this.onMouseOut();if(g)g[i]();d&&c.legend.colorizeItem(this,a);this.isDirty=!0;this.options.stacking&& +o(c.series,function(a){if(a.options.stacking&&a.visible)a.isDirty=!0});if(k)c.isDirtyBox=!0;b!==!1&&c.redraw();F(this,i)},show:function(){this.setVisible(!0)},hide:function(){this.setVisible(!1)},select:function(a){this.selected=a=a===A?!this.selected:a;if(this.checkbox)this.checkbox.checked=a;F(this,a?"select":"unselect")},drawTracker:function(){var a=this,b=a.options,c=b.trackByArea,d=[].concat(c?a.areaPath:a.graphPath),e=d.length,f=a.chart,g=f.renderer,h=f.options.tooltip.snap,i=a.tracker,j=b.cursor, +j=j&&{cursor:j},k=a.singlePoints,l=this.isCartesian&&this.plotGroup("trackerGroup",null,"visible",b.zIndex||1,f.trackerGroup),m,n=function(){if(f.hoverSeries!==a)a.onMouseOver()},o=function(){if(!b.stickyTracking)a.onMouseOut()};if(e&&!c)for(m=e+1;m--;)d[m]==="M"&&d.splice(m+1,0,d[m+1]-h,d[m+2],"L"),(m&&d[m]==="M"||m===e)&&d.splice(m,0,"L",d[m-2]+h,d[m-1]);for(m=0;m=0;d--)da&&i>e?(i=s(a,e),k=2*e-i):ig&&k>e?(k=s(g,e),i=2*e-k):kw?g-w:z-(f<=z?w:0));c.barX=i;c.pointWidth=u;c.shapeType= +"rect";c.shapeArgs=f=b.renderer.Element.prototype.crisp.call(0,e,i,j,x,k);e%2&&(f.y-=1,f.height+=1);c.trackerArgs=M(k)<3&&B(c.shapeArgs,{height:6,y:j-3})})},getSymbol:pa,drawLegendSymbol:G.prototype.drawLegendSymbol,drawGraph:pa,drawPoints:function(){var a=this,b=a.options,c=a.chart.renderer,d;o(a.points,function(e){var f=e.plotY,g=e.graphic;if(f!==A&&!isNaN(f)&&e.y!==null)d=e.shapeArgs,g?(fb(g),g.animate(B(d))):e.graphic=c[e.shapeType](d).attr(e.pointAttr[e.selected?"select":""]).add(a.group).shadow(b.shadow, +null,b.stacking&&!b.borderRadius);else if(g)e.graphic=g.destroy()})},drawTracker:function(){for(var a=this,b=a.chart,c=b.renderer,d,e,f=+new Date,g=a.options,h=(d=g.cursor)&&{cursor:d},i=a.isCartesian&&a.plotGroup("trackerGroup",null,"visible",g.zIndex||1,b.trackerGroup),j,k,l=a.points,m,n=l.length,o=function(c){j=c.relatedTarget||c.fromElement;if(b.hoverSeries!==a&&w(j,"isTracker")!==f)a.onMouseOver();l[c.target._i].onMouseOver()},r=function(b){if(!g.stickyTracking&&(j=b.relatedTarget||b.toElement, +w(j,"isTracker")!==f))a.onMouseOut()};n--;)if(m=l[n],e=m.tracker,d=m.trackerArgs||m.shapeArgs,k=m.plotY,k=!a.isCartesian||k!==A&&!isNaN(k),delete d.strokeWidth,m.y!==null&&k){if(e)e.attr(d);else if(m.tracker=e=c[m.shapeType](d).attr({isTracker:f,fill:vb,visibility:a.visible?"visible":"hidden"}).on("mouseover",o).on("mouseout",r).css(h).add(m.group||i),Ba)e.on("touchstart",o);e.element._i=n}},alignDataLabel:function(a,b,c,d,e){var f=this.chart,g=f.inverted,h=a.below||a.plotY>n(this.translatedThreshold, +f.plotSizeY),i=this.options.stacking||c.inside;if(a.shapeArgs&&(d=B(a.shapeArgs),g&&(d={x:f.plotWidth-d.y-d.height,y:f.plotHeight-d.x-d.width,width:d.height,height:d.width}),!i))g?(d.x+=h?0:d.width,d.width=0):(d.y+=h?d.height:0,d.height=0);c.align=n(c.align,!g||i?"center":h?"right":"left");c.verticalAlign=n(c.verticalAlign,g||i?"middle":h?"top":"bottom");P.prototype.alignDataLabel.call(this,a,b,c,d,e)},animate:function(a){var b=this,c=b.points,d=b.options;if(!a)o(c,function(a){var c=a.graphic,a=a.shapeArgs, +g=b.yAxis,h=d.threshold;c&&(c.attr({height:0,y:r(h)?g.getThreshold(h):g.translate(g.getExtremes().min,0,1,0,1)}),c.animate({height:a.height,y:a.y},d.animation))}),b.animate=null},remove:function(){var a=this,b=a.chart;b.hasRendered&&o(b.series,function(b){if(b.type===a.type)b.isDirty=!0});P.prototype.remove.apply(a,arguments)}});$.column=fa;X.bar=B(X.column);Ca=ba(fa,{type:"bar",inverted:!0});$.bar=Ca;X.scatter=B(ea,{lineWidth:0,states:{hover:{lineWidth:0}},tooltip:{headerFormat:'{series.name}
', +pointFormat:"x: {point.x}
y: {point.y}
"}});Ca=ba(P,{type:"scatter",sorted:!1,requireSorting:!1,translate:function(){var a=this;P.prototype.translate.apply(a);o(a.points,function(b){b.shapeType="circle";b.shapeArgs={x:b.plotX,y:b.plotY,r:a.chart.options.tooltip.snap}})},drawTracker:function(){for(var a=this,b=a.options.cursor,b=b&&{cursor:b},c=a.points,d=c.length,e,f=a.markerGroup,g=function(b){a.onMouseOver();if(b.target._i!==A)c[b.target._i].onMouseOver()};d--;)if(e=c[d].graphic)e.element._i= +d;if(a._hasTracking)a._hasTracking=!0;else if(f.attr({isTracker:!0}).on("mouseover",g).on("mouseout",function(){if(!a.options.stickyTracking)a.onMouseOut()}).css(b),Ba)f.on("touchstart",g)},setTooltipPoints:pa});$.scatter=Ca;X.pie=B(ea,{borderColor:"#FFFFFF",borderWidth:1,center:["50%","50%"],colorByPoint:!0,dataLabels:{distance:30,enabled:!0,formatter:function(){return this.point.name}},legendType:"point",marker:null,size:"75%",showInLegend:!1,slicedOffset:10,states:{hover:{brightness:0.1,shadow:!1}}}); +pa={type:"pie",isCartesian:!1,pointClass:ba(Ua,{init:function(){Ua.prototype.init.apply(this,arguments);var a=this,b;x(a,{visible:a.visible!==!1,name:n(a.name,"Slice")});b=function(){a.slice()};J(a,"select",b);J(a,"unselect",b);return a},setVisible:function(a){var b=this.series,c=b.chart,d=this.tracker,e=this.dataLabel,f=this.connector,g=this.shadowGroup,h;h=(this.visible=a=a===A?!this.visible:a)?"show":"hide";this.group[h]();if(d)d[h]();if(e)e[h]();if(f)f[h]();if(g)g[h]();this.legendItem&&c.legend.colorizeItem(this, +a);if(!b.isDirty&&b.options.ignoreHiddenPoint)b.isDirty=!0,c.redraw()},slice:function(a,b,c){var d=this.series.chart,e=this.slicedTranslation;xa(c,d);n(b,!0);a=this.sliced=r(a)?a:!this.sliced;a={translateX:a?e[0]:d.plotLeft,translateY:a?e[1]:d.plotTop};this.group.animate(a);this.shadowGroup&&this.shadowGroup.animate(a)}}),requireSorting:!1,pointAttrToOptions:{stroke:"borderColor","stroke-width":"borderWidth",fill:"color"},getColor:function(){this.initialColor=this.chart.counters.color},animate:function(){var a= +this,b=a.startAngleRad;o(a.points,function(c){var d=c.graphic,c=c.shapeArgs;d&&(d.attr({r:a.center[3]/2,start:b,end:b}),d.animate({r:c.r,start:c.start,end:c.end},a.options.animation))});a.animate=null},setData:function(a,b){P.prototype.setData.call(this,a,!1);this.processData();this.generatePoints();n(b,!0)&&this.chart.redraw()},getCenter:function(){var a=this.options,b=this.chart,c=b.plotWidth,d=b.plotHeight,a=a.center.concat([a.size,a.innerSize||0]),e=O(c,d),f;return Ta(a,function(a,b){return(f= +/%$/.test(a))?[c,d,e,e][b]*z(a)/100:a})},translate:function(){this.generatePoints();var a=0,b=0,c=this.options,d=c.slicedOffset,e=d+c.borderWidth,f,g=this.chart,h,i,j,k=this.startAngleRad=Aa/180*((c.startAngle||0)%360-90),l=this.points,m=2*Aa,n=c.dataLabels.distance,o=c.ignoreHiddenPoint,r,t=l.length,s;this.center=f=this.getCenter();this.getX=function(a,b){j=K.asin((a-f[1])/(f[2]/2+n));return f[0]+(b?-1:1)*W(j)*(f[2]/2+n)};for(r=0;r0.75*m&&(j-=2*Aa);s.slicedTranslation=Ta([W(j)*d+g.plotLeft,Z(j)*d+g.plotTop],u);h=W(j)*f[2]/2;i=Z(j)*f[2]/2;s.tooltipPos=[f[0]+h*0.7,f[1]+i*0.7];s.half=j0,p=[[],[]],r,t,s,u=2,v,x=function(a,b){return b.y- +a.y},z=function(a,b){a.sort(function(a,c){return(c.angle-a.angle)*b})};if(d.enabled||this._hasPointLabels){P.prototype.drawDataLabels.apply(this);o(a,function(a){a.dataLabel&&p[a.half].push(a)});for(a=p[0][0]&&p[0][0].dataLabel&&(p[0][0].dataLabel.getBBox().height||21);u--;){var w=[],A=[],B=p[u],C=B.length,D;z(B,u-0.5);if(j>0){for(v=m-l-j;v<=m+l+j;v+=a)w.push(v);s=w.length;if(C>s){h=[].concat(B);h.sort(x);for(v=C;v--;)h[v].rank=v;for(v=C;v--;)B[v].rank>=s&&B.splice(v,1);C=B.length}for(v=0;v0){if(t=A.pop(),D=t.i,t=t.y,r>t&&w[D+1]!==null||r type pairs + class2type = {}, + + // List of deleted data cache ids, so we can reuse them + core_deletedIds = [], + + core_version = "2.0.0pre", + + // Save a reference to some core methods + core_concat = core_deletedIds.concat, + core_push = core_deletedIds.push, + core_slice = core_deletedIds.slice, + core_indexOf = core_deletedIds.indexOf, + core_toString = class2type.toString, + core_hasOwn = class2type.hasOwnProperty, + core_trim = core_version.trim, + + // Define a local copy of jQuery + jQuery = function( selector, context ) { + // The jQuery object is actually just the init constructor 'enhanced' + return new jQuery.fn.init( selector, context, rootjQuery ); + }, + + // Used for matching numbers + core_pnum = /[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/.source, + + // Used for splitting on whitespace + core_rnotwhite = /\S+/g, + + // A simple way to check for HTML strings + // Prioritize #id over to avoid XSS via location.hash (#9521) + // Strict HTML recognition (#11290: must start with <) + rquickExpr = /^(?:(<[\w\W]+>)[^>]*|#([\w-]*))$/, + + // Match a standalone tag + rsingleTag = /^<(\w+)\s*\/?>(?:<\/\1>|)$/, + + // Matches dashed string for camelizing + rmsPrefix = /^-ms-/, + rdashAlpha = /-([\da-z])/gi, + + // Used by jQuery.camelCase as callback to replace() + fcamelCase = function( all, letter ) { + return letter.toUpperCase(); + }, + + // The ready event handler and self cleanup method + DOMContentLoaded = function() { + document.removeEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + jQuery.ready(); + }; + +jQuery.fn = jQuery.prototype = { + // The current version of jQuery being used + jquery: core_version, + + constructor: jQuery, + init: function( selector, context, rootjQuery ) { + var match, elem; + + // HANDLE: $(""), $(null), $(undefined), $(false) + if ( !selector ) { + return this; + } + + // Handle HTML strings + if ( typeof selector === "string" ) { + if ( selector.charAt(0) === "<" && selector.charAt( selector.length - 1 ) === ">" && selector.length >= 3 ) { + // Assume that strings that start and end with <> are HTML and skip the regex check + match = [ null, selector, null ]; + + } else { + match = rquickExpr.exec( selector ); + } + + // Match html or make sure no context is specified for #id + if ( match && (match[1] || !context) ) { + + // HANDLE: $(html) -> $(array) + if ( match[1] ) { + context = context instanceof jQuery ? context[0] : context; + + // scripts is true for back-compat + jQuery.merge( this, jQuery.parseHTML( + match[1], + context && context.nodeType ? context.ownerDocument || context : document, + true + ) ); + + // HANDLE: $(html, props) + if ( rsingleTag.test( match[1] ) && jQuery.isPlainObject( context ) ) { + for ( match in context ) { + // Properties of context are called as methods if possible + if ( jQuery.isFunction( this[ match ] ) ) { + this[ match ]( context[ match ] ); + + // ...and otherwise set as attributes + } else { + this.attr( match, context[ match ] ); + } + } + } + + return this; + + // HANDLE: $(#id) + } else { + elem = document.getElementById( match[2] ); + + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + if ( elem && elem.parentNode ) { + // Handle the case where IE and Opera return items + // by name instead of ID + if ( elem.id !== match[2] ) { + return rootjQuery.find( selector ); + } + + // Otherwise, we inject the element directly into the jQuery object + this.length = 1; + this[0] = elem; + } + + this.context = document; + this.selector = selector; + return this; + } + + // HANDLE: $(expr, $(...)) + } else if ( !context || context.jquery ) { + return ( context || rootjQuery ).find( selector ); + + // HANDLE: $(expr, context) + // (which is just equivalent to: $(context).find(expr) + } else { + return this.constructor( context ).find( selector ); + } + + // HANDLE: $(DOMElement) + } else if ( selector.nodeType ) { + this.context = this[0] = selector; + this.length = 1; + return this; + + // HANDLE: $(function) + // Shortcut for document ready + } else if ( jQuery.isFunction( selector ) ) { + return rootjQuery.ready( selector ); + } + + if ( selector.selector !== undefined ) { + this.selector = selector.selector; + this.context = selector.context; + } + + return jQuery.makeArray( selector, this ); + }, + + // Start with an empty selector + selector: "", + + // The default length of a jQuery object is 0 + length: 0, + + // The number of elements contained in the matched element set + size: function() { + return this.length; + }, + + toArray: function() { + return core_slice.call( this ); + }, + + // Get the Nth element in the matched element set OR + // Get the whole matched element set as a clean array + get: function( num ) { + return num == null ? + + // Return a 'clean' array + this.toArray() : + + // Return just the object + ( num < 0 ? this[ this.length + num ] : this[ num ] ); + }, + + // Take an array of elements and push it onto the stack + // (returning the new matched element set) + pushStack: function( elems ) { + + // Build a new jQuery matched element set + var ret = jQuery.merge( this.constructor(), elems ); + + // Add the old object onto the stack (as a reference) + ret.prevObject = this; + ret.context = this.context; + + // Return the newly-formed element set + return ret; + }, + + // Execute a callback for every element in the matched set. + // (You can seed the arguments with an array of args, but this is + // only used internally.) + each: function( callback, args ) { + return jQuery.each( this, callback, args ); + }, + + ready: function( fn ) { + // Add the callback + jQuery.ready.promise().done( fn ); + + return this; + }, + + slice: function() { + return this.pushStack( core_slice.apply( this, arguments ) ); + }, + + first: function() { + return this.eq( 0 ); + }, + + last: function() { + return this.eq( -1 ); + }, + + eq: function( i ) { + var len = this.length, + j = +i + ( i < 0 ? len : 0 ); + return this.pushStack( j >= 0 && j < len ? [ this[j] ] : [] ); + }, + + map: function( callback ) { + return this.pushStack( jQuery.map(this, function( elem, i ) { + return callback.call( elem, i, elem ); + })); + }, + + end: function() { + return this.prevObject || this.constructor(null); + }, + + // For internal use only. + // Behaves like an Array's method, not like a jQuery method. + push: core_push, + sort: [].sort, + splice: [].splice +}; + +// Give the init function the jQuery prototype for later instantiation +jQuery.fn.init.prototype = jQuery.fn; + +jQuery.extend = jQuery.fn.extend = function() { + var options, name, src, copy, copyIsArray, clone, + target = arguments[0] || {}, + i = 1, + length = arguments.length, + deep = false; + + // Handle a deep copy situation + if ( typeof target === "boolean" ) { + deep = target; + target = arguments[1] || {}; + // skip the boolean and the target + i = 2; + } + + // Handle case when target is a string or something (possible in deep copy) + if ( typeof target !== "object" && !jQuery.isFunction(target) ) { + target = {}; + } + + // extend jQuery itself if only one argument is passed + if ( length === i ) { + target = this; + --i; + } + + for ( ; i < length; i++ ) { + // Only deal with non-null/undefined values + if ( (options = arguments[ i ]) != null ) { + // Extend the base object + for ( name in options ) { + src = target[ name ]; + copy = options[ name ]; + + // Prevent never-ending loop + if ( target === copy ) { + continue; + } + + // Recurse if we're merging plain objects or arrays + if ( deep && copy && ( jQuery.isPlainObject(copy) || (copyIsArray = jQuery.isArray(copy)) ) ) { + if ( copyIsArray ) { + copyIsArray = false; + clone = src && jQuery.isArray(src) ? src : []; + + } else { + clone = src && jQuery.isPlainObject(src) ? src : {}; + } + + // Never move original objects, clone them + target[ name ] = jQuery.extend( deep, clone, copy ); + + // Don't bring in undefined values + } else if ( copy !== undefined ) { + target[ name ] = copy; + } + } + } + } + + // Return the modified object + return target; +}; + +jQuery.extend({ + noConflict: function( deep ) { + if ( window.$ === jQuery ) { + window.$ = _$; + } + + if ( deep && window.jQuery === jQuery ) { + window.jQuery = _jQuery; + } + + return jQuery; + }, + + // Is the DOM ready to be used? Set to true once it occurs. + isReady: false, + + // A counter to track how many items to wait for before + // the ready event fires. See #6781 + readyWait: 1, + + // Hold (or release) the ready event + holdReady: function( hold ) { + if ( hold ) { + jQuery.readyWait++; + } else { + jQuery.ready( true ); + } + }, + + // Handle when the DOM is ready + ready: function( wait ) { + + // Abort if there are pending holds or we're already ready + if ( wait === true ? --jQuery.readyWait : jQuery.isReady ) { + return; + } + + // Remember that the DOM is ready + jQuery.isReady = true; + + // If a normal DOM Ready event fired, decrement, and wait if need be + if ( wait !== true && --jQuery.readyWait > 0 ) { + return; + } + + // If there are functions bound, to execute + readyList.resolveWith( document, [ jQuery ] ); + + // Trigger any bound ready events + if ( jQuery.fn.trigger ) { + jQuery( document ).trigger("ready").off("ready"); + } + }, + + // See test/unit/core.js for details concerning isFunction. + // Since version 1.3, DOM methods and functions like alert + // aren't supported. They return false on IE (#2968). + isFunction: function( obj ) { + return jQuery.type(obj) === "function"; + }, + + isArray: Array.isArray, + + isWindow: function( obj ) { + return obj != null && obj == obj.window; + }, + + isNumeric: function( obj ) { + return !isNaN( parseFloat(obj) ) && isFinite( obj ); + }, + + type: function( obj ) { + if ( obj == null ) { + return String( obj ); + } + return typeof obj === "object" || typeof obj === "function" ? + class2type[ core_toString.call(obj) ] || "object" : + typeof obj; + }, + + isPlainObject: function( obj ) { + // Not plain objects: + // - Any object or value whose internal [[Class]] property is not "[object Object]" + // - DOM nodes + // - window + if ( jQuery.type( obj ) !== "object" || obj.nodeType || jQuery.isWindow( obj ) ) { + return false; + } + + // Support: Firefox >16 + // The try/catch supresses exceptions thrown when attempting to access + // the "constructor" property of certain host objects, ie. |window.location| + try { + if ( obj.constructor && + !core_hasOwn.call( obj.constructor.prototype, "isPrototypeOf" ) ) { + return false; + } + } catch ( e ) { + return false; + } + + // If the function hasn't returned already, we're confident that + // |obj| is a plain object, created by {} or constructed with new Object + return true; + }, + + isEmptyObject: function( obj ) { + var name; + for ( name in obj ) { + return false; + } + return true; + }, + + error: function( msg ) { + throw new Error( msg ); + }, + + // data: string of html + // context (optional): If specified, the fragment will be created in this context, defaults to document + // keepScripts (optional): If true, will include scripts passed in the html string + parseHTML: function( data, context, keepScripts ) { + if ( !data || typeof data !== "string" ) { + return null; + } + if ( typeof context === "boolean" ) { + keepScripts = context; + context = false; + } + context = context || document; + + var parsed = rsingleTag.exec( data ), + scripts = !keepScripts && []; + + // Single tag + if ( parsed ) { + return [ context.createElement( parsed[1] ) ]; + } + + parsed = context.createDocumentFragment(); + jQuery.clean( [ data ], context, parsed, scripts ); + if ( scripts ) { + jQuery( scripts ).remove(); + } + return jQuery.merge( [], parsed.childNodes ); + }, + + parseJSON: JSON.parse, + + // Cross-browser xml parsing + parseXML: function( data ) { + var xml, tmp; + if ( !data || typeof data !== "string" ) { + return null; + } + + // Support: IE9 + try { + tmp = new DOMParser(); + xml = tmp.parseFromString( data , "text/xml" ); + } catch ( e ) { + xml = undefined; + } + + if ( !xml || xml.getElementsByTagName( "parsererror" ).length ) { + jQuery.error( "Invalid XML: " + data ); + } + return xml; + }, + + noop: function() {}, + + // Evaluates a script in a global context + globalEval: function( data ) { + var indirect = eval; + if ( jQuery.trim( data ) ) { + indirect( data + ";" ); + } + }, + + // Convert dashed to camelCase; used by the css and data modules + // Microsoft forgot to hump their vendor prefix (#9572) + camelCase: function( string ) { + return string.replace( rmsPrefix, "ms-" ).replace( rdashAlpha, fcamelCase ); + }, + + nodeName: function( elem, name ) { + return elem.nodeName && elem.nodeName.toLowerCase() === name.toLowerCase(); + }, + + // args is for internal usage only + each: function( obj, callback, args ) { + var value, + i = 0, + length = obj.length, + isArray = isArraylike( obj ); + + if ( args ) { + if ( isArray ) { + for ( ; i < length; i++ ) { + value = callback.apply( obj[ i ], args ); + + if ( value === false ) { + break; + } + } + } else { + for ( i in obj ) { + value = callback.apply( obj[ i ], args ); + + if ( value === false ) { + break; + } + } + } + + // A special, fast, case for the most common use of each + } else { + if ( isArray ) { + for ( ; i < length; i++ ) { + value = callback.call( obj[ i ], i, obj[ i ] ); + + if ( value === false ) { + break; + } + } + } else { + for ( i in obj ) { + value = callback.call( obj[ i ], i, obj[ i ] ); + + if ( value === false ) { + break; + } + } + } + } + + return obj; + }, + + trim: function( text ) { + return text == null ? "" : core_trim.call( text ); + }, + + // results is for internal usage only + makeArray: function( arr, results ) { + var ret = results || []; + + if ( arr != null ) { + if ( isArraylike( Object(arr) ) ) { + jQuery.merge( ret, + typeof arr === "string" ? + [ arr ] : arr + ); + } else { + core_push.call( ret, arr ); + } + } + + return ret; + }, + + inArray: function( elem, arr, i ) { + return arr == null ? -1 : core_indexOf.call( arr, elem, i ); + }, + + merge: function( first, second ) { + var l = second.length, + i = first.length, + j = 0; + + if ( typeof l === "number" ) { + for ( ; j < l; j++ ) { + first[ i++ ] = second[ j ]; + } + } else { + while ( second[j] !== undefined ) { + first[ i++ ] = second[ j++ ]; + } + } + + first.length = i; + + return first; + }, + + grep: function( elems, callback, inv ) { + var retVal, + ret = [], + i = 0, + length = elems.length; + inv = !!inv; + + // Go through the array, only saving the items + // that pass the validator function + for ( ; i < length; i++ ) { + retVal = !!callback( elems[ i ], i ); + if ( inv !== retVal ) { + ret.push( elems[ i ] ); + } + } + + return ret; + }, + + // arg is for internal usage only + map: function( elems, callback, arg ) { + var value, + i = 0, + length = elems.length, + isArray = isArraylike( elems ), + ret = []; + + // Go through the array, translating each of the items to their + if ( isArray ) { + for ( ; i < length; i++ ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret[ ret.length ] = value; + } + } + + // Go through every key on the object, + } else { + for ( i in elems ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret[ ret.length ] = value; + } + } + } + + // Flatten any nested arrays + return core_concat.apply( [], ret ); + }, + + // A global GUID counter for objects + guid: 1, + + // Bind a function to a context, optionally partially applying any + // arguments. + proxy: function( fn, context ) { + var tmp, args, proxy; + + if ( typeof context === "string" ) { + tmp = fn[ context ]; + context = fn; + fn = tmp; + } + + // Quick check to determine if target is callable, in the spec + // this throws a TypeError, but we will just return undefined. + if ( !jQuery.isFunction( fn ) ) { + return undefined; + } + + // Simulated bind + args = core_slice.call( arguments, 2 ); + proxy = function() { + return fn.apply( context || this, args.concat( core_slice.call( arguments ) ) ); + }; + + // Set the guid of unique handler to the same of original handler, so it can be removed + proxy.guid = fn.guid = fn.guid || jQuery.guid++; + + return proxy; + }, + + // Multifunctional method to get and set values of a collection + // The value/s can optionally be executed if it's a function + access: function( elems, fn, key, value, chainable, emptyGet, raw ) { + var i = 0, + length = elems.length, + bulk = key == null; + + // Sets many values + if ( jQuery.type( key ) === "object" ) { + chainable = true; + for ( i in key ) { + jQuery.access( elems, fn, i, key[i], true, emptyGet, raw ); + } + + // Sets one value + } else if ( value !== undefined ) { + chainable = true; + + if ( !jQuery.isFunction( value ) ) { + raw = true; + } + + if ( bulk ) { + // Bulk operations run against the entire set + if ( raw ) { + fn.call( elems, value ); + fn = null; + + // ...except when executing function values + } else { + bulk = fn; + fn = function( elem, key, value ) { + return bulk.call( jQuery( elem ), value ); + }; + } + } + + if ( fn ) { + for ( ; i < length; i++ ) { + fn( elems[i], key, raw ? value : value.call( elems[i], i, fn( elems[i], key ) ) ); + } + } + } + + return chainable ? + elems : + + // Gets + bulk ? + fn.call( elems ) : + length ? fn( elems[0], key ) : emptyGet; + }, + + now: Date.now +}); + +jQuery.ready.promise = function( obj ) { + if ( !readyList ) { + + readyList = jQuery.Deferred(); + + // Catch cases where $(document).ready() is called after the browser event has already occurred. + // we once tried to use readyState "interactive" here, but it caused issues like the one + // discovered by ChrisS here: http://bugs.jquery.com/ticket/12282#comment:15 + if ( document.readyState === "complete" ) { + // Handle it asynchronously to allow scripts the opportunity to delay ready + setTimeout( jQuery.ready ); + + // Standards-based browsers support DOMContentLoaded + } else { + // Use the handy event callback + document.addEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + + // A fallback to window.onload, that will always work + window.addEventListener( "load", jQuery.ready, false ); + } + } + return readyList.promise( obj ); +}; + +// Populate the class2type map +jQuery.each("Boolean Number String Function Array Date RegExp Object Error".split(" "), function(i, name) { + class2type[ "[object " + name + "]" ] = name.toLowerCase(); +}); + +function isArraylike( obj ) { + var length = obj.length, + type = jQuery.type( obj ); + + if ( jQuery.isWindow( obj ) ) { + return false; + } + + if ( obj.nodeType === 1 && length ) { + return true; + } + + return type === "array" || type !== "function" && + ( length === 0 || + typeof length === "number" && length > 0 && ( length - 1 ) in obj ); +} + +// All jQuery objects should point back to these +rootjQuery = jQuery(document); +// String to Object options format cache +var optionsCache = {}; + +// Convert String-formatted options into Object-formatted ones and store in cache +function createOptions( options ) { + var object = optionsCache[ options ] = {}; + jQuery.each( options.match( core_rnotwhite ) || [], function( _, flag ) { + object[ flag ] = true; + }); + return object; +} + +/* + * Create a callback list using the following parameters: + * + * options: an optional list of space-separated options that will change how + * the callback list behaves or a more traditional option object + * + * By default a callback list will act like an event callback list and can be + * "fired" multiple times. + * + * Possible options: + * + * once: will ensure the callback list can only be fired once (like a Deferred) + * + * memory: will keep track of previous values and will call any callback added + * after the list has been fired right away with the latest "memorized" + * values (like a Deferred) + * + * unique: will ensure a callback can only be added once (no duplicate in the list) + * + * stopOnFalse: interrupt callings when a callback returns false + * + */ +jQuery.Callbacks = function( options ) { + + // Convert options from String-formatted to Object-formatted if needed + // (we check in cache first) + options = typeof options === "string" ? + ( optionsCache[ options ] || createOptions( options ) ) : + jQuery.extend( {}, options ); + + var // Last fire value (for non-forgettable lists) + memory, + // Flag to know if list was already fired + fired, + // Flag to know if list is currently firing + firing, + // First callback to fire (used internally by add and fireWith) + firingStart, + // End of the loop when firing + firingLength, + // Index of currently firing callback (modified by remove if needed) + firingIndex, + // Actual callback list + list = [], + // Stack of fire calls for repeatable lists + stack = !options.once && [], + // Fire callbacks + fire = function( data ) { + memory = options.memory && data; + fired = true; + firingIndex = firingStart || 0; + firingStart = 0; + firingLength = list.length; + firing = true; + for ( ; list && firingIndex < firingLength; firingIndex++ ) { + if ( list[ firingIndex ].apply( data[ 0 ], data[ 1 ] ) === false && options.stopOnFalse ) { + memory = false; // To prevent further calls using add + break; + } + } + firing = false; + if ( list ) { + if ( stack ) { + if ( stack.length ) { + fire( stack.shift() ); + } + } else if ( memory ) { + list = []; + } else { + self.disable(); + } + } + }, + // Actual Callbacks object + self = { + // Add a callback or a collection of callbacks to the list + add: function() { + if ( list ) { + // First, we save the current length + var start = list.length; + (function add( args ) { + jQuery.each( args, function( _, arg ) { + var type = jQuery.type( arg ); + if ( type === "function" ) { + if ( !options.unique || !self.has( arg ) ) { + list.push( arg ); + } + } else if ( arg && arg.length && type !== "string" ) { + // Inspect recursively + add( arg ); + } + }); + })( arguments ); + // Do we need to add the callbacks to the + // current firing batch? + if ( firing ) { + firingLength = list.length; + // With memory, if we're not firing then + // we should call right away + } else if ( memory ) { + firingStart = start; + fire( memory ); + } + } + return this; + }, + // Remove a callback from the list + remove: function() { + if ( list ) { + jQuery.each( arguments, function( _, arg ) { + var index; + while( ( index = jQuery.inArray( arg, list, index ) ) > -1 ) { + list.splice( index, 1 ); + // Handle firing indexes + if ( firing ) { + if ( index <= firingLength ) { + firingLength--; + } + if ( index <= firingIndex ) { + firingIndex--; + } + } + } + }); + } + return this; + }, + // Control if a given callback is in the list + has: function( fn ) { + return jQuery.inArray( fn, list ) > -1; + }, + // Remove all callbacks from the list + empty: function() { + list = []; + return this; + }, + // Have the list do nothing anymore + disable: function() { + list = stack = memory = undefined; + return this; + }, + // Is it disabled? + disabled: function() { + return !list; + }, + // Lock the list in its current state + lock: function() { + stack = undefined; + if ( !memory ) { + self.disable(); + } + return this; + }, + // Is it locked? + locked: function() { + return !stack; + }, + // Call all callbacks with the given context and arguments + fireWith: function( context, args ) { + args = args || []; + args = [ context, args.slice ? args.slice() : args ]; + if ( list && ( !fired || stack ) ) { + if ( firing ) { + stack.push( args ); + } else { + fire( args ); + } + } + return this; + }, + // Call all the callbacks with the given arguments + fire: function() { + self.fireWith( this, arguments ); + return this; + }, + // To know if the callbacks have already been called at least once + fired: function() { + return !!fired; + } + }; + + return self; +}; +jQuery.extend({ + + Deferred: function( func ) { + var tuples = [ + // action, add listener, listener list, final state + [ "resolve", "done", jQuery.Callbacks("once memory"), "resolved" ], + [ "reject", "fail", jQuery.Callbacks("once memory"), "rejected" ], + [ "notify", "progress", jQuery.Callbacks("memory") ] + ], + state = "pending", + promise = { + state: function() { + return state; + }, + always: function() { + deferred.done( arguments ).fail( arguments ); + return this; + }, + then: function( /* fnDone, fnFail, fnProgress */ ) { + var fns = arguments; + return jQuery.Deferred(function( newDefer ) { + jQuery.each( tuples, function( i, tuple ) { + var action = tuple[ 0 ], + fn = fns[ i ]; + // deferred[ done | fail | progress ] for forwarding actions to newDefer + deferred[ tuple[1] ]( jQuery.isFunction( fn ) ? + function() { + var returned = fn.apply( this, arguments ); + if ( returned && jQuery.isFunction( returned.promise ) ) { + returned.promise() + .done( newDefer.resolve ) + .fail( newDefer.reject ) + .progress( newDefer.notify ); + } else { + newDefer[ action + "With" ]( this === promise ? newDefer.promise() : this, [ returned ] ); + } + } : + newDefer[ action ] + ); + }); + fns = null; + }).promise(); + }, + // Get a promise for this deferred + // If obj is provided, the promise aspect is added to the object + promise: function( obj ) { + return obj != null ? jQuery.extend( obj, promise ) : promise; + } + }, + deferred = {}; + + // Keep pipe for back-compat + promise.pipe = promise.then; + + // Add list-specific methods + jQuery.each( tuples, function( i, tuple ) { + var list = tuple[ 2 ], + stateString = tuple[ 3 ]; + + // promise[ done | fail | progress ] = list.add + promise[ tuple[1] ] = list.add; + + // Handle state + if ( stateString ) { + list.add(function() { + // state = [ resolved | rejected ] + state = stateString; + + // [ reject_list | resolve_list ].disable; progress_list.lock + }, tuples[ i ^ 1 ][ 2 ].disable, tuples[ 2 ][ 2 ].lock ); + } + + // deferred[ resolve | reject | notify ] + deferred[ tuple[0] ] = function() { + deferred[ tuple[0] + "With" ]( promise, arguments ); + return this; + }; + deferred[ tuple[0] + "With" ] = list.fireWith; + }); + + // Make the deferred a promise + promise.promise( deferred ); + + // Call given func if any + if ( func ) { + func.call( deferred, deferred ); + } + + // All done! + return deferred; + }, + + // Deferred helper + when: function( subordinate /* , ..., subordinateN */ ) { + var i = 0, + resolveValues = core_slice.call( arguments ), + length = resolveValues.length, + + // the count of uncompleted subordinates + remaining = length !== 1 || ( subordinate && jQuery.isFunction( subordinate.promise ) ) ? length : 0, + + // the master Deferred. If resolveValues consist of only a single Deferred, just use that. + deferred = remaining === 1 ? subordinate : jQuery.Deferred(), + + // Update function for both resolve and progress values + updateFunc = function( i, contexts, values ) { + return function( value ) { + contexts[ i ] = this; + values[ i ] = arguments.length > 1 ? core_slice.call( arguments ) : value; + if( values === progressValues ) { + deferred.notifyWith( contexts, values ); + } else if ( !( --remaining ) ) { + deferred.resolveWith( contexts, values ); + } + }; + }, + + progressValues, progressContexts, resolveContexts; + + // add listeners to Deferred subordinates; treat others as resolved + if ( length > 1 ) { + progressValues = new Array( length ); + progressContexts = new Array( length ); + resolveContexts = new Array( length ); + for ( ; i < length; i++ ) { + if ( resolveValues[ i ] && jQuery.isFunction( resolveValues[ i ].promise ) ) { + resolveValues[ i ].promise() + .done( updateFunc( i, resolveContexts, resolveValues ) ) + .fail( deferred.reject ) + .progress( updateFunc( i, progressContexts, progressValues ) ); + } else { + --remaining; + } + } + } + + // if we're not waiting on anything, resolve the master + if ( !remaining ) { + deferred.resolveWith( resolveContexts, resolveValues ); + } + + return deferred.promise(); + } +}); +jQuery.support = (function() { + + var support, all, a, select, opt, input, fragment, eventName, isSupported, i, + div = document.createElement("div"); + + // Setup + div.setAttribute( "className", "t" ); + div.innerHTML = "
a"; + + // Support tests won't run in some limited or non-browser environments + all = div.getElementsByTagName("*"); + a = div.getElementsByTagName("a")[ 0 ]; + if ( !all || !a || !all.length ) { + return {}; + } + + // First batch of tests + select = document.createElement("select"); + opt = select.appendChild( document.createElement("option") ); + input = div.getElementsByTagName("input")[ 0 ]; + + a.style.cssText = "float:left;opacity:.5"; + support = { + // Test setAttribute on camelCase class. If it works, we need attrFixes when doing get/setAttribute (ie6/7) + getSetAttribute: div.className !== "t", + + // IE strips leading whitespace when .innerHTML is used + leadingWhitespace: div.firstChild.nodeType === 3, + + // Make sure that tbody elements aren't automatically inserted + // IE will insert them into empty tables + tbody: !div.getElementsByTagName("tbody").length, + + // Make sure that link elements get serialized correctly by innerHTML + // This requires a wrapper element in IE + htmlSerialize: !!div.getElementsByTagName("link").length, + + // Make sure that element opacity exists + // (IE uses filter instead) + // Use a regex to work around a WebKit issue. See #5145 + opacity: /^0.5/.test( a.style.opacity ), + + // Verify style float existence + // (IE uses styleFloat instead of cssFloat) + cssFloat: !!a.style.cssFloat, + + // Check the default checkbox/radio value ("" on WebKit; "on" elsewhere) + checkOn: !!input.value, + + // Must access the parent to make an option select properly + // Support: IE9, IE10 + optSelected: opt.selected, + + // Makes sure cloning an html5 element does not cause problems + // Where outerHTML is undefined, this still works + html5Clone: document.createElement("nav").cloneNode( true ).outerHTML !== "<:nav>", + + // jQuery.support.boxModel DEPRECATED in 1.8 since we don't support Quirks Mode + boxModel: document.compatMode === "CSS1Compat", + + // Will be defined later + deleteExpando: true, + noCloneEvent: true, + inlineBlockNeedsLayout: false, + shrinkWrapBlocks: false, + reliableMarginRight: true, + boxSizingReliable: true, + pixelPosition: false + }; + + // Make sure checked status is properly cloned + input.checked = true; + support.noCloneChecked = input.cloneNode( true ).checked; + + // Make sure that the options inside disabled selects aren't marked as disabled + // (WebKit marks them as disabled) + select.disabled = true; + support.optDisabled = !opt.disabled; + + // Support: IE<9 + try { + delete div.test; + } catch( e ) { + support.deleteExpando = false; + } + + // Check if an input maintains its value after becoming a radio + input = document.createElement("input"); + input.value = "t"; + input.setAttribute( "type", "radio" ); + support.radioValue = input.value === "t"; + + // #11217 - WebKit loses check when the name is after the checked attribute + input.setAttribute( "checked", "t" ); + input.setAttribute( "name", "t" ); + + fragment = document.createDocumentFragment(); + fragment.appendChild( input ); + + // Check if a disconnected checkbox will retain its checked + // value of true after appended to the DOM (IE6/7) + support.appendChecked = input.checked; + + // WebKit doesn't clone checked state correctly in fragments + support.checkClone = fragment.cloneNode( true ).cloneNode( true ).lastChild.checked; + + // Support: IE<9 + // Opera does not clone events (and typeof div.attachEvent === undefined). + // IE9-10 clones events bound via attachEvent, but they don't trigger with .click() + if ( div.attachEvent ) { + div.attachEvent( "onclick", function() { + support.noCloneEvent = false; + }); + + div.cloneNode( true ).click(); + } + + // Support: IE<9 (lack submit/change bubble), Firefox 17+ (lack focusin event) + // Beware of CSP restrictions (https://developer.mozilla.org/en/Security/CSP), test/csp.php + for ( i in { submit: true, change: true, focusin: true }) { + div.setAttribute( eventName = "on" + i, "t" ); + + support[ i + "Bubbles" ] = eventName in window || div.attributes[ eventName ].expando === false; + } + + // Run tests that need a body at doc ready + jQuery(function() { + var container, marginDiv, tds, + divReset = "padding:0;margin:0;border:0;display:block;box-sizing:content-box;-moz-box-sizing:content-box;-webkit-box-sizing:content-box;", + body = document.getElementsByTagName("body")[0]; + + if ( !body ) { + // Return for frameset docs that don't have a body + return; + } + + container = document.createElement("div"); + container.style.cssText = "border:0;width:0;height:0;position:absolute;top:0;left:-9999px;margin-top:1px"; + + body.appendChild( container ).appendChild( div ); + + // Support: IE8 + // Check if table cells still have offsetWidth/Height when they are set + // to display:none and there are still other visible table cells in a + // table row; if so, offsetWidth/Height are not reliable for use when + // determining if an element has been hidden directly using + // display:none (it is still safe to use offsets if a parent element is + // hidden; don safety goggles and see bug #4512 for more information). + div.innerHTML = "
t
"; + tds = div.getElementsByTagName("td"); + tds[ 0 ].style.cssText = "padding:0;margin:0;border:0;display:none"; + isSupported = ( tds[ 0 ].offsetHeight === 0 ); + + tds[ 0 ].style.display = ""; + tds[ 1 ].style.display = "none"; + + // Support: IE8 + // Check if empty table cells still have offsetWidth/Height + support.reliableHiddenOffsets = isSupported && ( tds[ 0 ].offsetHeight === 0 ); + + // Check box-sizing and margin behavior + div.innerHTML = ""; + div.style.cssText = "box-sizing:border-box;-moz-box-sizing:border-box;-webkit-box-sizing:border-box;padding:1px;border:1px;display:block;width:4px;margin-top:1%;position:absolute;top:1%;"; + support.boxSizing = ( div.offsetWidth === 4 ); + support.doesNotIncludeMarginInBodyOffset = ( body.offsetTop !== 1 ); + + // Use window.getComputedStyle because jsdom on node.js will break without it. + if ( window.getComputedStyle ) { + support.pixelPosition = ( window.getComputedStyle( div, null ) || {} ).top !== "1%"; + support.boxSizingReliable = ( window.getComputedStyle( div, null ) || { width: "4px" } ).width === "4px"; + + // Check if div with explicit width and no margin-right incorrectly + // gets computed margin-right based on width of container. (#3333) + // Fails in WebKit before Feb 2011 nightlies + // WebKit Bug 13343 - getComputedStyle returns wrong value for margin-right + marginDiv = div.appendChild( document.createElement("div") ); + marginDiv.style.cssText = div.style.cssText = divReset; + marginDiv.style.marginRight = marginDiv.style.width = "0"; + div.style.width = "1px"; + + support.reliableMarginRight = + !parseFloat( ( window.getComputedStyle( marginDiv, null ) || {} ).marginRight ); + } + + if ( typeof div.style.zoom !== "undefined" ) { + // Support: IE<8 + // Check if natively block-level elements act like inline-block + // elements when setting their display to 'inline' and giving + // them layout + div.innerHTML = ""; + div.style.cssText = divReset + "width:1px;padding:1px;display:inline;zoom:1"; + support.inlineBlockNeedsLayout = ( div.offsetWidth === 3 ); + + // Support: IE6 + // Check if elements with layout shrink-wrap their children + div.style.display = "block"; + div.innerHTML = "
"; + div.firstChild.style.width = "5px"; + support.shrinkWrapBlocks = ( div.offsetWidth !== 3 ); + + // Prevent IE 6 from affecting layout for positioned elements #11048 + // Prevent IE from shrinking the body in IE 7 mode #12869 + body.style.zoom = 1; + } + + body.removeChild( container ); + + // Null elements to avoid leaks in IE + container = div = tds = marginDiv = null; + }); + + // Null elements to avoid leaks in IE + all = select = fragment = opt = a = input = null; + + return support; +})(); + +var user, priv, data_user, data_priv, + rbrace = /(?:\{[\s\S]*\}|\[[\s\S]*\])$/, + rmultiDash = /([A-Z])/g; + +function Data() { + // Nodes|Objects + this.owners = []; + // Data objects + this.cache = []; +} + +Data.prototype = { + add: function( owner ) { + this.owners.push( owner ); + return (this.cache[ this.owners.length - 1 ] = {}); + }, + set: function( owner, data, value ) { + var prop, + index = this.owners.indexOf( owner ); + + if ( index === -1 ) { + this.add( owner ); + index = this.owners.length - 1; + } + if ( typeof data === "string" ) { + this.cache[ index ][ data ] = value; + } else { + + if ( jQuery.isEmptyObject( this.cache[ index ] ) ) { + this.cache[ index ] = data; + } else { + for ( prop in data ) { + this.cache[ index ][ prop ] = data[ prop ]; + } + } + } + return this; + }, + get: function( owner, key ) { + var cache, + index = this.owners.indexOf( owner ); + + // A valid cache is found, or needs to be created. + // New entries will be added and return the current + // empty data object to be used as a return reference + // return this.add( owner ); + cache = index === -1 ? + this.add( owner ) : this.cache[ index ]; + + return key === undefined ? + cache : cache[ key ]; + }, + access: function( owner, key, value ) { + if ( value === undefined && (key && typeof key !== "object") ) { + // Assume this is a request to read the cached data + return this.get( owner, key ); + } else { + + // If only an owner was specified, return the entire + // cache object. + if ( key === undefined ) { + return this.get( owner ); + } + + // Allow setting or extending (existing objects) with an + // object of properties, or a key and val + this.set( owner, key, value ); + return value !== undefined ? value : key; + } + // Otherwise, this is a read request. + return this.get( owner, key ); + }, + remove: function( owner, key ) { + var i, l, name, + camel = jQuery.camelCase, + index = this.owners.indexOf( owner ), + cache = this.cache[ index ]; + + if ( key === undefined ) { + cache = {}; + } else { + if ( cache ) { + // Support array or space separated string of keys + if ( !Array.isArray( key ) ) { + // Try the string as a key before any manipulation + // + + if ( key in cache ) { + name = [ key ]; + } else { + // split the camel cased version by spaces unless a key with the spaces exists + name = camel( key ); + name = name in cache ? + [ name ] : name.split(" "); + } + } else { + // If "name" is an array of keys... + // When data is initially created, via ("key", "val") signature, + // keys will be converted to camelCase. + // Since there is no way to tell _how_ a key was added, remove + // both plain key and camelCase key. #12786 + // This will only penalize the array argument path. + name = key.concat( key.map( camel ) ); + } + i = 0; + l = name.length; + + for ( ; i < l; i++ ) { + delete cache[ name[i] ]; + } + } + } + this.cache[ index ] = cache; + }, + hasData: function( owner ) { + var index = this.owners.indexOf( owner ); + + if ( index > -1 ) { + return !jQuery.isEmptyObject( this.cache[ index ] ); + } + return false; + }, + discard: function( owner ) { + var index = this.owners.indexOf( owner ); + + if ( index >= 0 ) { + this.owners.splice( index, 1 ); + this.cache.splice( index, 1 ); + } + return this; + } +}; + +// This will be used by remove() in manipulation to sever +// remaining references to node objects. One day we'll replace the dual +// arrays with a WeakMap and this won't be an issue. +function data_discard( owner ) { + user.discard( owner ); + priv.discard( owner ); +} + +// These may used throughout the jQuery core codebase +user = data_user = new Data(); +priv = data_priv = new Data(); + + +jQuery.extend({ + acceptData: function() { + return true; + }, + // Unique for each copy of jQuery on the page + // Non-digits removed to match rinlinejQuery + expando: "jQuery" + ( core_version + Math.random() ).replace( /\D/g, "" ), + + hasData: function( elem ) { + return user.hasData( elem ) || priv.hasData( elem ); + }, + + data: function( elem, name, data ) { + return user.access( elem, name, data ); + }, + + removeData: function( elem, name ) { + return user.remove( elem, name ); + }, + + // TODO: Replace all calls to _data and _removeData with direct + // calls to + // + // priv.access( elem, name, data ); + // + // priv.remove( elem, name ); + // + _data: function( elem, name, data ) { + return priv.access( elem, name, data ); + }, + + _removeData: function( elem, name ) { + return priv.remove( elem, name ); + } +}); + +jQuery.fn.extend({ + data: function( key, value ) { + var attrs, name, + elem = this[0], + i = 0, + data = null; + + // Gets all values + if ( key === undefined ) { + if ( this.length ) { + data = user.get( elem ); + + if ( elem.nodeType === 1 && !priv.get( elem, "hasDataAttrs" ) ) { + attrs = elem.attributes; + for ( ; i < attrs.length; i++ ) { + name = attrs[i].name; + + if ( name.indexOf( "data-" ) === 0 ) { + name = jQuery.camelCase( name.substring(5) ); + dataAttr( elem, name, data[ name ] ); + } + } + priv.set( elem, "hasDataAttrs", true ); + } + } + + return data; + } + + // Sets multiple values + if ( typeof key === "object" ) { + return this.each(function() { + user.set( this, key ); + }); + } + + return jQuery.access( this, function( value ) { + var data, + camelKey = jQuery.camelCase( key ); + + // Get the Data... + if ( value === undefined ) { + + // Attempt to get data from the cache + // with the key as-is + data = user.get( elem, key ); + if ( data !== undefined ) { + return data; + } + + // Attempt to "discover" the data in + // HTML5 custom data-* attrs + data = dataAttr( elem, key, undefined ); + if ( data !== undefined ) { + return data; + } + + // As a last resort, attempt to find + // the data by checking AGAIN, but with + // a camelCased key. + data = user.get( elem, camelKey ); + if ( data !== undefined ) { + return data; + } + + // We tried really hard, but the data doesn't exist. + return undefined; + } + + // Set the data... + this.each(function() { + // First, attempt to store a copy or reference of any + // data that might've been store with a camelCased key. + var data = user.get( this, camelKey ); + + // For HTML5 data-* attribute interop, we have to + // store property names with dashes in a camelCase form. + // This might not apply to all properties...* + user.set( this, camelKey, value ); + + // *... In the case of properties that might ACTUALLY + // have dashes, we need to also store a copy of that + // unchanged property. + if ( /-/.test( key ) && data !== undefined ) { + user.set( this, key, value ); + } + }); + }, null, value, arguments.length > 1, null, true ); + }, + + removeData: function( key ) { + return this.each(function() { + user.remove( this, key ); + }); + } +}); + +function dataAttr( elem, key, data ) { + var name; + + // If nothing was found internally, try to fetch any + // data from the HTML5 data-* attribute + if ( data === undefined && elem.nodeType === 1 ) { + + name = "data-" + key.replace( rmultiDash, "-$1" ).toLowerCase(); + data = elem.getAttribute( name ); + + if ( typeof data === "string" ) { + try { + data = data === "true" ? true : + data === "false" ? false : + data === "null" ? null : + // Only convert to a number if it doesn't change the string + +data + "" === data ? +data : + rbrace.test( data ) ? + JSON.parse( data ) : data; + } catch( e ) {} + + // Make sure we set the data so it isn't changed later + user.set( elem, key, data ); + } else { + data = undefined; + } + } + + return data; +} +jQuery.extend({ + queue: function( elem, type, data ) { + var queue; + + if ( elem ) { + type = ( type || "fx" ) + "queue"; + queue = jQuery._data( elem, type ); + + // Speed up dequeue by getting out quickly if this is just a lookup + if ( data ) { + if ( !queue || jQuery.isArray(data) ) { + queue = jQuery._data( elem, type, jQuery.makeArray(data) ); + } else { + queue.push( data ); + } + } + return queue || []; + } + }, + + dequeue: function( elem, type ) { + type = type || "fx"; + + var queue = jQuery.queue( elem, type ), + startLength = queue.length, + fn = queue.shift(), + hooks = jQuery._queueHooks( elem, type ), + next = function() { + jQuery.dequeue( elem, type ); + }; + + // If the fx queue is dequeued, always remove the progress sentinel + if ( fn === "inprogress" ) { + fn = queue.shift(); + startLength--; + } + + if ( fn ) { + + // Add a progress sentinel to prevent the fx queue from being + // automatically dequeued + if ( type === "fx" ) { + queue.unshift( "inprogress" ); + } + + // clear up the last queue stop function + delete hooks.stop; + fn.call( elem, next, hooks ); + } + + if ( !startLength && hooks ) { + hooks.empty.fire(); + } + }, + + // not intended for public consumption - generates a queueHooks object, or returns the current one + _queueHooks: function( elem, type ) { + var key = type + "queueHooks"; + return jQuery._data( elem, key ) || jQuery._data( elem, key, { + empty: jQuery.Callbacks("once memory").add(function() { + jQuery._removeData( elem, type + "queue" ); + jQuery._removeData( elem, key ); + }) + }); + } +}); + +jQuery.fn.extend({ + queue: function( type, data ) { + var setter = 2; + + if ( typeof type !== "string" ) { + data = type; + type = "fx"; + setter--; + } + + if ( arguments.length < setter ) { + return jQuery.queue( this[0], type ); + } + + return data === undefined ? + this : + this.each(function() { + var queue = jQuery.queue( this, type, data ); + + // ensure a hooks for this queue + jQuery._queueHooks( this, type ); + + if ( type === "fx" && queue[0] !== "inprogress" ) { + jQuery.dequeue( this, type ); + } + }); + }, + dequeue: function( type ) { + return this.each(function() { + jQuery.dequeue( this, type ); + }); + }, + // Based off of the plugin by Clint Helfers, with permission. + // http://blindsignals.com/index.php/2009/07/jquery-delay/ + delay: function( time, type ) { + time = jQuery.fx ? jQuery.fx.speeds[ time ] || time : time; + type = type || "fx"; + + return this.queue( type, function( next, hooks ) { + var timeout = setTimeout( next, time ); + hooks.stop = function() { + clearTimeout( timeout ); + }; + }); + }, + clearQueue: function( type ) { + return this.queue( type || "fx", [] ); + }, + // Get a promise resolved when queues of a certain type + // are emptied (fx is the type by default) + promise: function( type, obj ) { + var tmp, + count = 1, + defer = jQuery.Deferred(), + elements = this, + i = this.length, + resolve = function() { + if ( !( --count ) ) { + defer.resolveWith( elements, [ elements ] ); + } + }; + + if ( typeof type !== "string" ) { + obj = type; + type = undefined; + } + type = type || "fx"; + + while( i-- ) { + tmp = jQuery._data( elements[ i ], type + "queueHooks" ); + if ( tmp && tmp.empty ) { + count++; + tmp.empty.add( resolve ); + } + } + resolve(); + return defer.promise( obj ); + } +}); +var nodeHook, boolHook, + rclass = /[\t\r\n]/g, + rreturn = /\r/g, + rfocusable = /^(?:input|select|textarea|button|object)$/i, + rclickable = /^(?:a|area)$/i, + rboolean = /^(?:checked|selected|autofocus|autoplay|async|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped)$/i; + +jQuery.fn.extend({ + attr: function( name, value ) { + return jQuery.access( this, jQuery.attr, name, value, arguments.length > 1 ); + }, + + removeAttr: function( name ) { + return this.each(function() { + jQuery.removeAttr( this, name ); + }); + }, + + prop: function( name, value ) { + return jQuery.access( this, jQuery.prop, name, value, arguments.length > 1 ); + }, + + removeProp: function( name ) { + name = jQuery.propFix[ name ] || name; + return this.each(function() { + // try/catch handles cases where IE balks (such as removing a property on window) + try { + this[ name ] = undefined; + delete this[ name ]; + } catch( e ) {} + }); + }, + + addClass: function( value ) { + var classes, elem, cur, clazz, j, + i = 0, + len = this.length, + proceed = typeof value === "string" && value; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( j ) { + jQuery( this ).addClass( value.call( this, j, this.className ) ); + }); + } + + if ( proceed ) { + // The disjunction here is for better compressibility (see removeClass) + classes = ( value || "" ).match( core_rnotwhite ) || []; + + for ( ; i < len; i++ ) { + elem = this[ i ]; + cur = elem.nodeType === 1 && ( elem.className ? + ( " " + elem.className + " " ).replace( rclass, " " ) : + " " + ); + + if ( cur ) { + j = 0; + while ( (clazz = classes[j++]) ) { + if ( cur.indexOf( " " + clazz + " " ) < 0 ) { + cur += clazz + " "; + } + } + elem.className = jQuery.trim( cur ); + + } + } + } + + return this; + }, + + removeClass: function( value ) { + var classes, elem, cur, clazz, j, + i = 0, + len = this.length, + proceed = arguments.length === 0 || typeof value === "string" && value; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( j ) { + jQuery( this ).removeClass( value.call( this, j, this.className ) ); + }); + } + if ( proceed ) { + classes = ( value || "" ).match( core_rnotwhite ) || []; + + for ( ; i < len; i++ ) { + elem = this[ i ]; + // This expression is here for better compressibility (see addClass) + cur = elem.nodeType === 1 && ( elem.className ? + ( " " + elem.className + " " ).replace( rclass, " " ) : + "" + ); + + if ( cur ) { + j = 0; + while ( (clazz = classes[j++]) ) { + // Remove *all* instances + while ( cur.indexOf( " " + clazz + " " ) >= 0 ) { + cur = cur.replace( " " + clazz + " ", " " ); + } + } + elem.className = value ? jQuery.trim( cur ) : ""; + } + } + } + + return this; + }, + + toggleClass: function( value, stateVal ) { + var type = typeof value, + isBool = typeof stateVal === "boolean"; + + if ( jQuery.isFunction( value ) ) { + return this.each(function( i ) { + jQuery( this ).toggleClass( value.call(this, i, this.className, stateVal), stateVal ); + }); + } + + return this.each(function() { + if ( type === "string" ) { + // toggle individual class names + var className, + i = 0, + self = jQuery( this ), + state = stateVal, + classNames = value.match( core_rnotwhite ) || []; + + while ( (className = classNames[ i++ ]) ) { + // check each className given, space separated list + state = isBool ? state : !self.hasClass( className ); + self[ state ? "addClass" : "removeClass" ]( className ); + } + + // Toggle whole class name + } else if ( type === "undefined" || type === "boolean" ) { + if ( this.className ) { + // store className if set + jQuery._data( this, "__className__", this.className ); + } + + // If the element has a class name or if we're passed "false", + // then remove the whole classname (if there was one, the above saved it). + // Otherwise bring back whatever was previously saved (if anything), + // falling back to the empty string if nothing was stored. + this.className = this.className || value === false ? "" : jQuery._data( this, "__className__" ) || ""; + } + }); + }, + + hasClass: function( selector ) { + var className = " " + selector + " ", + i = 0, + l = this.length; + for ( ; i < l; i++ ) { + if ( this[i].nodeType === 1 && (" " + this[i].className + " ").replace(rclass, " ").indexOf( className ) >= 0 ) { + return true; + } + } + + return false; + }, + + val: function( value ) { + var hooks, ret, isFunction, + elem = this[0]; + + if ( !arguments.length ) { + if ( elem ) { + hooks = jQuery.valHooks[ elem.type ] || jQuery.valHooks[ elem.nodeName.toLowerCase() ]; + + if ( hooks && "get" in hooks && (ret = hooks.get( elem, "value" )) !== undefined ) { + return ret; + } + + ret = elem.value; + + return typeof ret === "string" ? + // handle most common string cases + ret.replace(rreturn, "") : + // handle cases where value is null/undef or number + ret == null ? "" : ret; + } + + return; + } + + isFunction = jQuery.isFunction( value ); + + return this.each(function( i ) { + var val, + self = jQuery(this); + + if ( this.nodeType !== 1 ) { + return; + } + + if ( isFunction ) { + val = value.call( this, i, self.val() ); + } else { + val = value; + } + + // Treat null/undefined as ""; convert numbers to string + if ( val == null ) { + val = ""; + } else if ( typeof val === "number" ) { + val += ""; + } else if ( jQuery.isArray( val ) ) { + val = jQuery.map(val, function ( value ) { + return value == null ? "" : value + ""; + }); + } + + hooks = jQuery.valHooks[ this.type ] || jQuery.valHooks[ this.nodeName.toLowerCase() ]; + + // If set returns undefined, fall back to normal setting + if ( !hooks || !("set" in hooks) || hooks.set( this, val, "value" ) === undefined ) { + this.value = val; + } + }); + } +}); + +jQuery.extend({ + valHooks: { + option: { + get: function( elem ) { + // attributes.value is undefined in Blackberry 4.7 but + // uses .value. See #6932 + var val = elem.attributes.value; + return !val || val.specified ? elem.value : elem.text; + } + }, + select: { + get: function( elem ) { + var value, option, + options = elem.options, + index = elem.selectedIndex, + one = elem.type === "select-one" || index < 0, + values = one ? null : [], + max = one ? index + 1 : options.length, + i = index < 0 ? + max : + one ? index : 0; + + // Loop through all the selected options + for ( ; i < max; i++ ) { + option = options[ i ]; + + // oldIE doesn't update selected after form reset (#2551) + if ( ( option.selected || i === index ) && + // Don't return options that are disabled or in a disabled optgroup + ( jQuery.support.optDisabled ? !option.disabled : option.getAttribute("disabled") === null ) && + ( !option.parentNode.disabled || !jQuery.nodeName( option.parentNode, "optgroup" ) ) ) { + + // Get the specific value for the option + value = jQuery( option ).val(); + + // We don't need an array for one selects + if ( one ) { + return value; + } + + // Multi-Selects return an array + values.push( value ); + } + } + + return values; + }, + + set: function( elem, value ) { + var values = jQuery.makeArray( value ); + + jQuery(elem).find("option").each(function() { + this.selected = jQuery.inArray( jQuery(this).val(), values ) >= 0; + }); + + if ( !values.length ) { + elem.selectedIndex = -1; + } + return values; + } + } + }, + + attr: function( elem, name, value ) { + var ret, hooks, notxml, + nType = elem.nodeType; + + // don't get/set attributes on text, comment and attribute nodes + if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + // Fallback to prop when attributes are not supported + if ( typeof elem.getAttribute === "undefined" ) { + return jQuery.prop( elem, name, value ); + } + + notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); + + // All attributes are lowercase + // Grab necessary hook if one is defined + if ( notxml ) { + name = name.toLowerCase(); + hooks = jQuery.attrHooks[ name ] || ( rboolean.test( name ) ? boolHook : nodeHook ); + } + + if ( value !== undefined ) { + + if ( value === null ) { + jQuery.removeAttr( elem, name ); + + } else if ( hooks && notxml && "set" in hooks && (ret = hooks.set( elem, value, name )) !== undefined ) { + return ret; + + } else { + elem.setAttribute( name, value + "" ); + return value; + } + + } else if ( hooks && notxml && "get" in hooks && (ret = hooks.get( elem, name )) !== null ) { + return ret; + + } else { + + ret = elem.getAttribute( name ); + + // Non-existent attributes return null, we normalize to undefined + return ret == null ? + undefined : + ret; + } + }, + + removeAttr: function( elem, value ) { + var name, propName, + i = 0, + attrNames = value && value.match( core_rnotwhite ); + + if ( attrNames && elem.nodeType === 1 ) { + while ( (name = attrNames[i++]) ) { + propName = jQuery.propFix[ name ] || name; + + // Boolean attributes get special treatment (#10870) + // Set corresponding property to false for boolean attributes + if ( rboolean.test( name ) ) { + elem[ propName ] = false; + } + + elem.removeAttribute( name ); + } + } + }, + + attrHooks: { + type: { + set: function( elem, value ) { + if ( !jQuery.support.radioValue && value === "radio" && jQuery.nodeName(elem, "input") ) { + // Setting the type on a radio button after the value resets the value in IE6-9 + // Reset value to default in case type is set after value during creation + var val = elem.value; + elem.setAttribute( "type", value ); + if ( val ) { + elem.value = val; + } + return value; + } + } + } + }, + + propFix: { + tabindex: "tabIndex", + readonly: "readOnly", + "for": "htmlFor", + "class": "className", + maxlength: "maxLength", + cellspacing: "cellSpacing", + cellpadding: "cellPadding", + rowspan: "rowSpan", + colspan: "colSpan", + usemap: "useMap", + frameborder: "frameBorder", + contenteditable: "contentEditable" + }, + + prop: function( elem, name, value ) { + var ret, hooks, notxml, + nType = elem.nodeType; + + // don't get/set properties on text, comment and attribute nodes + if ( !elem || nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + notxml = nType !== 1 || !jQuery.isXMLDoc( elem ); + + if ( notxml ) { + // Fix name and attach hooks + name = jQuery.propFix[ name ] || name; + hooks = jQuery.propHooks[ name ]; + } + + if ( value !== undefined ) { + if ( hooks && "set" in hooks && (ret = hooks.set( elem, value, name )) !== undefined ) { + return ret; + + } else { + return ( elem[ name ] = value ); + } + + } else { + if ( hooks && "get" in hooks && (ret = hooks.get( elem, name )) !== null ) { + return ret; + + } else { + return elem[ name ]; + } + } + }, + + propHooks: { + tabIndex: { + get: function( elem ) { + // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set + // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ + var attributeNode = elem.getAttributeNode("tabindex"); + + return attributeNode && attributeNode.specified ? + parseInt( attributeNode.value, 10 ) : + rfocusable.test( elem.nodeName ) || rclickable.test( elem.nodeName ) && elem.href ? + 0 : + undefined; + } + } + } +}); + +// Hook for boolean attributes +boolHook = { + get: function( elem, name ) { + return elem.getAttribute( name ) !== null ? + name.toLowerCase() : + undefined; + }, + set: function( elem, value, name ) { + if ( value === false ) { + // Remove boolean attributes when set to false + jQuery.removeAttr( elem, name ); + } else { + elem.setAttribute( name, name ); + } + return name; + } +}; + +// Radios and checkboxes getter/setter +if ( !jQuery.support.checkOn ) { + jQuery.each([ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = { + get: function( elem ) { + // Handle the case where in Webkit "" is returned instead of "on" if a value isn't specified + return elem.getAttribute("value") === null ? "on" : elem.value; + } + }; + }); +} +jQuery.each([ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = jQuery.extend( jQuery.valHooks[ this ], { + set: function( elem, value ) { + if ( jQuery.isArray( value ) ) { + return ( elem.checked = jQuery.inArray( jQuery(elem).val(), value ) >= 0 ); + } + } + }); +}); + +// IE9/10 do not see a selected option inside an optgroup unless you access it +// Support: IE9, IE10 +if ( !jQuery.support.optSelected ) { + jQuery.propHooks.selected = jQuery.extend( jQuery.propHooks.selected, { + get: function( elem ) { + var parent = elem.parentNode; + if ( parent && parent.parentNode ) { + parent.parentNode.selectedIndex; + } + return null; + } + }); +} +var rkeyEvent = /^key/, + rmouseEvent = /^(?:mouse|contextmenu)|click/, + rfocusMorph = /^(?:focusinfocus|focusoutblur)$/, + rtypenamespace = /^([^.]*)(?:\.(.+)|)$/; + +/* + * Helper functions for managing events -- not part of the public interface. + * Props to Dean Edwards' addEvent library for many of the ideas. + */ +jQuery.event = { + + add: function( elem, types, handler, data, selector ) { + var elemData, eventHandle, events, + tns, type, namespaces, handleObj, + handleObjIn, handlers, special, + t = 0; + + // Don't attach events to noData or text/comment nodes (allow plain objects tho) + if ( elem.nodeType === 3 || elem.nodeType === 8 || !types || !handler || !(elemData = data_priv.get( elem )) ) { + return; + } + + // Caller can pass in an object of custom data in lieu of the handler + if ( handler.handler ) { + handleObjIn = handler; + handler = handleObjIn.handler; + selector = handleObjIn.selector; + } + + // Make sure that the handler has a unique ID, used to find/remove it later + if ( !handler.guid ) { + handler.guid = jQuery.guid++; + } + + // Init the element's event structure and main handler, if this is the first + events = elemData.events; + if ( !events ) { + elemData.events = events = {}; + } + eventHandle = elemData.handle; + if ( !eventHandle ) { + elemData.handle = eventHandle = function( e ) { + // Discard the second event of a jQuery.event.trigger() and + // when an event is called after a page has unloaded + return typeof jQuery !== "undefined" && (!e || jQuery.event.triggered !== e.type) ? + jQuery.event.dispatch.apply( eventHandle.elem, arguments ) : + undefined; + }; + // Add elem as a property of the handle fn to prevent a memory leak with IE non-native events + eventHandle.elem = elem; + } + + // Handle multiple events separated by a space + types = ( types || "" ).match( core_rnotwhite ) || [""]; + for ( ; t < types.length; t++ ) { + + tns = rtypenamespace.exec( types[t] ) || []; + type = tns[1]; + namespaces = ( tns[2] || "" ).split( "." ).sort(); + + // If event changes its type, use the special event handlers for the changed type + special = jQuery.event.special[ type ] || {}; + + // If selector defined, determine special event api type, otherwise given type + type = ( selector ? special.delegateType : special.bindType ) || type; + + // Update special based on newly reset type + special = jQuery.event.special[ type ] || {}; + + // handleObj is passed to all event handlers + handleObj = jQuery.extend({ + type: type, + origType: tns[1], + data: data, + handler: handler, + guid: handler.guid, + selector: selector, + needsContext: selector && jQuery.expr.match.needsContext.test( selector ), + namespace: namespaces.join(".") + }, handleObjIn ); + + // Init the event handler queue if we're the first + handlers = events[ type ]; + if ( !handlers ) { + handlers = events[ type ] = []; + handlers.delegateCount = 0; + + // Only use addEventListener if the special events handler returns false + if ( !special.setup || special.setup.call( elem, data, namespaces, eventHandle ) === false ) { + if ( elem.addEventListener ) { + elem.addEventListener( type, eventHandle, false ); + } + } + } + + if ( special.add ) { + special.add.call( elem, handleObj ); + + if ( !handleObj.handler.guid ) { + handleObj.handler.guid = handler.guid; + } + } + + // Add to the element's handler list, delegates in front + if ( selector ) { + handlers.splice( handlers.delegateCount++, 0, handleObj ); + } else { + handlers.push( handleObj ); + } + + // Keep track of which events have ever been used, for event optimization + jQuery.event.global[ type ] = true; + } + + // Nullify elem to prevent memory leaks in IE + elem = null; + }, + + global: {}, + + // Detach an event or set of events from an element + remove: function( elem, types, handler, selector, mappedTypes ) { + + var tns, type, origType, namespaces, origCount, + j, events, special, eventType, handleObj, + t = 0, + elemData = data_priv.hasData( elem ) && data_priv.get( elem ); + + if ( !elemData || !(events = elemData.events) ) { + return; + } + + // Once for each type.namespace in types; type may be omitted + types = ( types || "" ).match( core_rnotwhite ) || [""]; + for ( ; t < types.length; t++ ) { + tns = rtypenamespace.exec( types[t] ) || []; + type = origType = tns[1]; + namespaces = tns[2]; + + // Unbind all events (on this namespace, if provided) for the element + if ( !type ) { + for ( type in events ) { + jQuery.event.remove( elem, type + types[ t ], handler, selector, true ); + } + continue; + } + + special = jQuery.event.special[ type ] || {}; + type = ( selector? special.delegateType : special.bindType ) || type; + eventType = events[ type ] || []; + origCount = eventType.length; + namespaces = namespaces ? new RegExp("(^|\\.)" + namespaces.split(".").sort().join("\\.(?:.*\\.|)") + "(\\.|$)") : null; + + // Remove matching events + for ( j = 0; j < eventType.length; j++ ) { + handleObj = eventType[ j ]; + + if ( ( mappedTypes || origType === handleObj.origType ) && + ( !handler || handler.guid === handleObj.guid ) && + ( !namespaces || namespaces.test( handleObj.namespace ) ) && + ( !selector || selector === handleObj.selector || selector === "**" && handleObj.selector ) ) { + eventType.splice( j--, 1 ); + + if ( handleObj.selector ) { + eventType.delegateCount--; + } + if ( special.remove ) { + special.remove.call( elem, handleObj ); + } + } + } + + // Remove generic event handler if we removed something and no more handlers exist + // (avoids potential for endless recursion during removal of special event handlers) + if ( eventType.length === 0 && origCount !== eventType.length ) { + if ( !special.teardown || special.teardown.call( elem, namespaces, elemData.handle ) === false ) { + jQuery.removeEvent( elem, type, elemData.handle ); + } + + delete events[ type ]; + } + } + + // Remove the expando if it's no longer used + if ( jQuery.isEmptyObject( events ) ) { + delete elemData.handle; + + // removeData also checks for emptiness and clears the expando if empty + // so use it instead of delete + jQuery._removeData( elem, "events" ); + } + }, + + trigger: function( event, data, elem, onlyHandlers ) { + + var i, cur, old, ontype, special, handle, eventPath, bubbleType, + type = event.type || event, + namespaces = event.namespace ? event.namespace.split(".") : []; + + elem = elem || document; + + // Don't do events on text and comment nodes + if ( elem.nodeType === 3 || elem.nodeType === 8 ) { + return; + } + + // focus/blur morphs to focusin/out; ensure we're not firing them right now + if ( rfocusMorph.test( type + jQuery.event.triggered ) ) { + return; + } + + if ( type.indexOf(".") >= 0 ) { + // Namespaced trigger; create a regexp to match event type in handle() + namespaces = type.split("."); + type = namespaces.shift(); + namespaces.sort(); + } + + // Caller can pass in an Event, Object, or just an event type string + event = typeof event === "object" ? + // jQuery.Event object + event[ jQuery.expando ] ? event : + // Object literal + new jQuery.Event( type, event ) : + // Just the event type (string) + new jQuery.Event( type ); + + event.type = type; + event.isTrigger = true; + event.namespace = namespaces.join("."); + event.namespace_re = event.namespace? new RegExp("(^|\\.)" + namespaces.join("\\.(?:.*\\.|)") + "(\\.|$)") : null; + ontype = type.indexOf(":") < 0 ? "on" + type : ""; + + // Clean up the event in case it is being reused + event.result = undefined; + if ( !event.target ) { + event.target = elem; + } + + // Clone any incoming data and prepend the event, creating the handler arg list + data = data != null ? jQuery.makeArray( data ) : []; + data.unshift( event ); + + // Allow special events to draw outside the lines + special = jQuery.event.special[ type ] || {}; + if ( !onlyHandlers && special.trigger && special.trigger.apply( elem, data ) === false ) { + return; + } + + // Determine event propagation path in advance, per W3C events spec (#9951) + // Bubble up to document, then to window; watch for a global ownerDocument var (#9724) + eventPath = [[ elem, special.bindType || type ]]; + if ( !onlyHandlers && !special.noBubble && !jQuery.isWindow( elem ) ) { + + bubbleType = special.delegateType || type; + cur = rfocusMorph.test( bubbleType + type ) ? elem : elem.parentNode; + for ( old = elem; cur; cur = cur.parentNode ) { + eventPath.push([ cur, bubbleType ]); + old = cur; + } + + // Only add window if we got to document (e.g., not plain obj or detached DOM) + if ( old === (elem.ownerDocument || document) ) { + eventPath.push([ old.defaultView || old.parentWindow || window, bubbleType ]); + } + } + + // Fire handlers on the event path + for ( i = 0; i < eventPath.length && !event.isPropagationStopped(); i++ ) { + + cur = eventPath[i][0]; + event.type = eventPath[i][1]; + + handle = ( jQuery._data( cur, "events" ) || {} )[ event.type ] && jQuery._data( cur, "handle" ); + if ( handle ) { + handle.apply( cur, data ); + } + // Note that this is a bare JS function and not a jQuery handler + handle = ontype && cur[ ontype ]; + if ( handle && jQuery.acceptData( cur ) && handle.apply && handle.apply( cur, data ) === false ) { + event.preventDefault(); + } + } + event.type = type; + + // If nobody prevented the default action, do it now + if ( !onlyHandlers && !event.isDefaultPrevented() ) { + + if ( (!special._default || special._default.apply( elem.ownerDocument, data ) === false) && + !(type === "click" && jQuery.nodeName( elem, "a" )) && jQuery.acceptData( elem ) ) { + + // Call a native DOM method on the target with the same name name as the event. + // Don't do default actions on window, that's where global variables be (#6170) + if ( ontype && jQuery.isFunction( elem[ type ] ) && !jQuery.isWindow( elem ) ) { + + // Don't re-trigger an onFOO event when we call its FOO() method + old = elem[ ontype ]; + + if ( old ) { + elem[ ontype ] = null; + } + + // Prevent re-triggering of the same event, since we already bubbled it above + jQuery.event.triggered = type; + elem[ type ](); + jQuery.event.triggered = undefined; + + if ( old ) { + elem[ ontype ] = old; + } + } + } + } + + return event.result; + }, + + dispatch: function( event ) { + + // Make a writable jQuery.Event from the native event object + event = jQuery.event.fix( event ); + + var i, j, cur, ret, selMatch, matched, matches, handleObj, sel, + handlers = ( (jQuery._data( this, "events" ) || {} )[ event.type ] || []), + delegateCount = handlers.delegateCount, + args = core_slice.call( arguments ), + special = jQuery.event.special[ event.type ] || {}, + handlerQueue = []; + + // Use the fix-ed jQuery.Event rather than the (read-only) native event + args[0] = event; + event.delegateTarget = this; + + // Call the preDispatch hook for the mapped type, and let it bail if desired + if ( special.preDispatch && special.preDispatch.call( this, event ) === false ) { + return; + } + + // Determine handlers that should run if there are delegated events + // Avoid non-left-click bubbling in Firefox (#3861) + if ( delegateCount && !(event.button && event.type === "click") ) { + + for ( cur = event.target; cur != this; cur = cur.parentNode || this ) { + + // Ignore clicks (ONLY) on disabled elements (#6911, #8165, #11382, #11764) + if ( cur.disabled !== true || event.type !== "click" ) { + selMatch = {}; + matches = []; + for ( i = 0; i < delegateCount; i++ ) { + handleObj = handlers[ i ]; + sel = handleObj.selector; + + if ( selMatch[ sel ] === undefined ) { + selMatch[ sel ] = handleObj.needsContext ? + jQuery( sel, this ).index( cur ) >= 0 : + jQuery.find( sel, this, null, [ cur ] ).length; + } + if ( selMatch[ sel ] ) { + matches.push( handleObj ); + } + } + if ( matches.length ) { + handlerQueue.push({ elem: cur, matches: matches }); + } + } + } + } + + // Add the remaining (directly-bound) handlers + if ( handlers.length > delegateCount ) { + handlerQueue.push({ elem: this, matches: handlers.slice( delegateCount ) }); + } + + // Run delegates first; they may want to stop propagation beneath us + for ( i = 0; i < handlerQueue.length && !event.isPropagationStopped(); i++ ) { + matched = handlerQueue[ i ]; + event.currentTarget = matched.elem; + + for ( j = 0; j < matched.matches.length && !event.isImmediatePropagationStopped(); j++ ) { + handleObj = matched.matches[ j ]; + + // Triggered event must either 1) have no namespace, or + // 2) have namespace(s) a subset or equal to those in the bound event (both can have no namespace). + if ( !event.namespace || event.namespace_re && event.namespace_re.test( handleObj.namespace ) ) { + + event.data = handleObj.data; + event.handleObj = handleObj; + + ret = ( (jQuery.event.special[ handleObj.origType ] || {}).handle || handleObj.handler ) + .apply( matched.elem, args ); + + if ( ret !== undefined ) { + event.result = ret; + if ( ret === false ) { + event.preventDefault(); + event.stopPropagation(); + } + } + } + } + } + + // Call the postDispatch hook for the mapped type + if ( special.postDispatch ) { + special.postDispatch.call( this, event ); + } + + return event.result; + }, + + // Includes some event props shared by KeyEvent and MouseEvent + props: "altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "), + + fixHooks: {}, + + keyHooks: { + props: "char charCode key keyCode".split(" "), + filter: function( event, original ) { + + // Add which for key events + if ( event.which == null ) { + event.which = original.charCode != null ? original.charCode : original.keyCode; + } + + return event; + } + }, + + mouseHooks: { + props: "button buttons clientX clientY offsetX offsetY pageX pageY screenX screenY toElement".split(" "), + filter: function( event, original ) { + var eventDoc, doc, body, + button = original.button; + + // Calculate pageX/Y if missing and clientX/Y available + if ( event.pageX == null && original.clientX != null ) { + eventDoc = event.target.ownerDocument || document; + doc = eventDoc.documentElement; + body = eventDoc.body; + + event.pageX = original.clientX + ( doc && doc.scrollLeft || body && body.scrollLeft || 0 ) - ( doc && doc.clientLeft || body && body.clientLeft || 0 ); + event.pageY = original.clientY + ( doc && doc.scrollTop || body && body.scrollTop || 0 ) - ( doc && doc.clientTop || body && body.clientTop || 0 ); + } + + // Add which for click: 1 === left; 2 === middle; 3 === right + // Note: button is not normalized, so don't use it + if ( !event.which && button !== undefined ) { + event.which = ( button & 1 ? 1 : ( button & 2 ? 3 : ( button & 4 ? 2 : 0 ) ) ); + } + + return event; + } + }, + + fix: function( event ) { + if ( event[ jQuery.expando ] ) { + return event; + } + + // Create a writable copy of the event object and normalize some properties + var i, prop, + originalEvent = event, + fixHook = jQuery.event.fixHooks[ event.type ] || {}, + copy = fixHook.props ? this.props.concat( fixHook.props ) : this.props; + + event = jQuery.Event( originalEvent ); + + for ( i = copy.length; i; ) { + prop = copy[ --i ]; + event[ prop ] = originalEvent[ prop ]; + } + + return fixHook.filter? fixHook.filter( event, originalEvent ) : event; + }, + + special: { + load: { + // Prevent triggered image.load events from bubbling to window.load + noBubble: true + }, + click: { + // For checkbox, fire native event so checked state will be right + trigger: function() { + if ( jQuery.nodeName( this, "input" ) && this.type === "checkbox" && this.click ) { + this.click(); + return false; + } + } + }, + focus: { + // Fire native event if possible so blur/focus sequence is correct + trigger: function() { + if ( this !== document.activeElement && this.focus ) { + this.focus(); + return false; + } + }, + delegateType: "focusin" + }, + blur: { + trigger: function() { + if ( this === document.activeElement && this.blur ) { + this.blur(); + return false; + } + }, + delegateType: "focusout" + }, + + beforeunload: { + postDispatch: function( event ) { + + // Support: Firefox 10+ + if ( event.result !== undefined ) { + event.originalEvent.returnValue = event.result; + } + } + } + }, + + simulate: function( type, elem, event, bubble ) { + // Piggyback on a donor event to simulate a different one. + // Fake originalEvent to avoid donor's stopPropagation, but if the + // simulated event prevents default then we do the same on the donor. + var e = jQuery.extend( + new jQuery.Event(), + event, + { type: type, + isSimulated: true, + originalEvent: {} + } + ); + if ( bubble ) { + jQuery.event.trigger( e, null, elem ); + } else { + jQuery.event.dispatch.call( elem, e ); + } + if ( e.isDefaultPrevented() ) { + event.preventDefault(); + } + } +}; + +// Some plugins are using, but it's undocumented/deprecated and will be removed. +// The 1.7 special event interface should provide all the hooks needed now. +jQuery.event.handle = jQuery.event.dispatch; + +jQuery.removeEvent = function( elem, type, handle ) { + if ( elem.removeEventListener ) { + elem.removeEventListener( type, handle, false ); + } +}; + +jQuery.Event = function( src, props ) { + // Allow instantiation without the 'new' keyword + if ( !(this instanceof jQuery.Event) ) { + return new jQuery.Event( src, props ); + } + + // Event object + if ( src && src.type ) { + this.originalEvent = src; + this.type = src.type; + + // Events bubbling up the document may have been marked as prevented + // by a handler lower down the tree; reflect the correct value. + this.isDefaultPrevented = ( src.defaultPrevented || + src.getPreventDefault && src.getPreventDefault() ) ? returnTrue : returnFalse; + + // Event type + } else { + this.type = src; + } + + // Put explicitly provided properties onto the event object + if ( props ) { + jQuery.extend( this, props ); + } + + // Create a timestamp if incoming event doesn't have one + this.timeStamp = src && src.timeStamp || jQuery.now(); + + // Mark it as fixed + this[ jQuery.expando ] = true; +}; + +function returnFalse() { + return false; +} +function returnTrue() { + return true; +} + +// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding +// http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html +jQuery.Event.prototype = { + preventDefault: function() { + this.isDefaultPrevented = returnTrue; + + var e = this.originalEvent; + if ( e && e.preventDefault ) { + e.preventDefault(); + } + }, + stopPropagation: function() { + this.isPropagationStopped = returnTrue; + + var e = this.originalEvent; + if ( e && e.stopPropagation ) { + e.stopPropagation(); + } + }, + stopImmediatePropagation: function() { + this.isImmediatePropagationStopped = returnTrue; + this.stopPropagation(); + }, + isDefaultPrevented: returnFalse, + isPropagationStopped: returnFalse, + isImmediatePropagationStopped: returnFalse +}; + +// Create mouseenter/leave events using mouseover/out and event-time checks +// Support: Chrome 15+ +jQuery.each({ + mouseenter: "mouseover", + mouseleave: "mouseout" +}, function( orig, fix ) { + jQuery.event.special[ orig ] = { + delegateType: fix, + bindType: fix, + + handle: function( event ) { + var ret, + target = this, + related = event.relatedTarget, + handleObj = event.handleObj; + + // For mousenter/leave call the handler if related is outside the target. + // NB: No relatedTarget if the mouse left/entered the browser window + if ( !related || (related !== target && !jQuery.contains( target, related )) ) { + event.type = handleObj.origType; + ret = handleObj.handler.apply( this, arguments ); + event.type = fix; + } + return ret; + } + }; +}); + +// Create "bubbling" focus and blur events +// Support: Firefox 10+ +if ( !jQuery.support.focusinBubbles ) { + jQuery.each({ focus: "focusin", blur: "focusout" }, function( orig, fix ) { + + // Attach a single capturing handler while someone wants focusin/focusout + var attaches = 0, + handler = function( event ) { + jQuery.event.simulate( fix, event.target, jQuery.event.fix( event ), true ); + }; + + jQuery.event.special[ fix ] = { + setup: function() { + if ( attaches++ === 0 ) { + document.addEventListener( orig, handler, true ); + } + }, + teardown: function() { + if ( --attaches === 0 ) { + document.removeEventListener( orig, handler, true ); + } + } + }; + }); +} + +jQuery.fn.extend({ + + on: function( types, selector, data, fn, /*INTERNAL*/ one ) { + var origFn, type; + + // Types can be a map of types/handlers + if ( typeof types === "object" ) { + // ( types-Object, selector, data ) + if ( typeof selector !== "string" ) { // && selector != null + // ( types-Object, data ) + data = data || selector; + selector = undefined; + } + for ( type in types ) { + this.on( type, selector, data, types[ type ], one ); + } + return this; + } + + if ( data == null && fn == null ) { + // ( types, fn ) + fn = selector; + data = selector = undefined; + } else if ( fn == null ) { + if ( typeof selector === "string" ) { + // ( types, selector, fn ) + fn = data; + data = undefined; + } else { + // ( types, data, fn ) + fn = data; + data = selector; + selector = undefined; + } + } + if ( fn === false ) { + fn = returnFalse; + } else if ( !fn ) { + return this; + } + + if ( one === 1 ) { + origFn = fn; + fn = function( event ) { + // Can use an empty set, since event contains the info + jQuery().off( event ); + return origFn.apply( this, arguments ); + }; + // Use same guid so caller can remove using origFn + fn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ ); + } + return this.each( function() { + jQuery.event.add( this, types, fn, data, selector ); + }); + }, + one: function( types, selector, data, fn ) { + return this.on( types, selector, data, fn, 1 ); + }, + off: function( types, selector, fn ) { + var handleObj, type; + if ( types && types.preventDefault && types.handleObj ) { + // ( event ) dispatched jQuery.Event + handleObj = types.handleObj; + jQuery( types.delegateTarget ).off( + handleObj.namespace ? handleObj.origType + "." + handleObj.namespace : handleObj.origType, + handleObj.selector, + handleObj.handler + ); + return this; + } + if ( typeof types === "object" ) { + // ( types-object [, selector] ) + for ( type in types ) { + this.off( type, selector, types[ type ] ); + } + return this; + } + if ( selector === false || typeof selector === "function" ) { + // ( types [, fn] ) + fn = selector; + selector = undefined; + } + if ( fn === false ) { + fn = returnFalse; + } + return this.each(function() { + jQuery.event.remove( this, types, fn, selector ); + }); + }, + + bind: function( types, data, fn ) { + return this.on( types, null, data, fn ); + }, + unbind: function( types, fn ) { + return this.off( types, null, fn ); + }, + + delegate: function( selector, types, data, fn ) { + return this.on( types, selector, data, fn ); + }, + undelegate: function( selector, types, fn ) { + // ( namespace ) or ( selector, types [, fn] ) + return arguments.length === 1 ? this.off( selector, "**" ) : this.off( types, selector || "**", fn ); + }, + + trigger: function( type, data ) { + return this.each(function() { + jQuery.event.trigger( type, data, this ); + }); + }, + triggerHandler: function( type, data ) { + if ( this[0] ) { + return jQuery.event.trigger( type, data, this[0], true ); + } + }, + + hover: function( fnOver, fnOut ) { + return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver ); + } +}); + +jQuery.each( ("blur focus focusin focusout load resize scroll unload click dblclick " + + "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " + + "change select submit keydown keypress keyup error contextmenu").split(" "), function( i, name ) { + + // Handle event binding + jQuery.fn[ name ] = function( data, fn ) { + return arguments.length > 0 ? + this.on( name, null, data, fn ) : + this.trigger( name ); + }; + + if ( rkeyEvent.test( name ) ) { + jQuery.event.fixHooks[ name ] = jQuery.event.keyHooks; + } + + if ( rmouseEvent.test( name ) ) { + jQuery.event.fixHooks[ name ] = jQuery.event.mouseHooks; + } +}); +/*! + * Sizzle CSS Selector Engine + * Copyright 2012 jQuery Foundation and other contributors + * Released under the MIT license + * http://sizzlejs.com/ + */ +(function( window, undefined ) { + +var i, + cachedruns, + Expr, + getText, + isXML, + compile, + hasDuplicate, + outermostContext, + + // Local document vars + setDocument, + document, + docElem, + documentIsXML, + rbuggyQSA, + rbuggyMatches, + matches, + contains, + sortOrder, + + // Instance-specific data + expando = "sizzle" + -(new Date()), + preferredDoc = window.document, + support = {}, + dirruns = 0, + done = 0, + classCache = createCache(), + tokenCache = createCache(), + compilerCache = createCache(), + + // General-purpose constants + Token = String, + strundefined = typeof undefined, + MAX_NEGATIVE = 1 << 31, + + // Array methods + arr = [], + pop = arr.pop, + push = arr.push, + slice = arr.slice, + // Use a stripped-down indexOf if we can't use a native one + indexOf = arr.indexOf || function( elem ) { + var i = 0, + len = this.length; + for ( ; i < len; i++ ) { + if ( this[i] === elem ) { + return i; + } + } + return -1; + }, + + + // Regular expressions + + // Whitespace characters http://www.w3.org/TR/css3-selectors/#whitespace + whitespace = "[\\x20\\t\\r\\n\\f]", + // http://www.w3.org/TR/css3-syntax/#characters + characterEncoding = "(?:\\\\.|[\\w-]|[^\\x00-\\xa0])+", + + // Loosely modeled on CSS identifier characters + // An unquoted value should be a CSS identifier http://www.w3.org/TR/css3-selectors/#attribute-selectors + // Proper syntax: http://www.w3.org/TR/CSS21/syndata.html#value-def-identifier + identifier = characterEncoding.replace( "w", "w#" ), + + // Acceptable operators http://www.w3.org/TR/selectors/#attribute-selectors + operators = "([*^$|!~]?=)", + attributes = "\\[" + whitespace + "*(" + characterEncoding + ")" + whitespace + + "*(?:" + operators + whitespace + "*(?:(['\"])((?:\\\\.|[^\\\\])*?)\\3|(" + identifier + ")|)|)" + whitespace + "*\\]", + + // Prefer arguments quoted, + // then not containing pseudos/brackets, + // then attribute selectors/non-parenthetical expressions, + // then anything else + // These preferences are here to reduce the number of selectors + // needing tokenize in the PSEUDO preFilter + pseudos = ":(" + characterEncoding + ")(?:\\(((['\"])((?:\\\\.|[^\\\\])*?)\\3|((?:\\\\.|[^\\\\()[\\]]|" + attributes.replace( 3, 8 ) + ")*)|.*)\\)|)", + + // Leading and non-escaped trailing whitespace, capturing some non-whitespace characters preceding the latter + rtrim = new RegExp( "^" + whitespace + "+|((?:^|[^\\\\])(?:\\\\.)*)" + whitespace + "+$", "g" ), + + rcomma = new RegExp( "^" + whitespace + "*," + whitespace + "*" ), + rcombinators = new RegExp( "^" + whitespace + "*([\\x20\\t\\r\\n\\f>+~])" + whitespace + "*" ), + rpseudo = new RegExp( pseudos ), + ridentifier = new RegExp( "^" + identifier + "$" ), + + matchExpr = { + "ID": new RegExp( "^#(" + characterEncoding + ")" ), + "CLASS": new RegExp( "^\\.(" + characterEncoding + ")" ), + "NAME": new RegExp( "^\\[name=['\"]?(" + characterEncoding + ")['\"]?\\]" ), + "TAG": new RegExp( "^(" + characterEncoding.replace( "w", "w*" ) + ")" ), + "ATTR": new RegExp( "^" + attributes ), + "PSEUDO": new RegExp( "^" + pseudos ), + "CHILD": new RegExp( "^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\(" + whitespace + + "*(even|odd|(([+-]|)(\\d*)n|)" + whitespace + "*(?:([+-]|)" + whitespace + + "*(\\d+)|))" + whitespace + "*\\)|)", "i" ), + // For use in libraries implementing .is() + // We use this for POS matching in `select` + "needsContext": new RegExp( "^" + whitespace + "*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\(" + + whitespace + "*((?:-\\d)?\\d*)" + whitespace + "*\\)|)(?=[^-]|$)", "i" ) + }, + + rsibling = /[\x20\t\r\n\f]*[+~]/, + + rnative = /\{\s*\[native code\]\s*\}/, + + // Easily-parseable/retrievable ID or TAG or CLASS selectors + rquickExpr = /^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/, + + rinputs = /^(?:input|select|textarea|button)$/i, + rheader = /^h\d$/i, + + rescape = /'|\\/g, + rattributeQuotes = /\=[\x20\t\r\n\f]*([^'"\]]*)[\x20\t\r\n\f]*\]/g, + + // CSS escapes http://www.w3.org/TR/CSS21/syndata.html#escaped-characters + runescape = /\\([\da-fA-F]{1,6}[\x20\t\r\n\f]?|.)/g, + funescape = function( _, escaped ) { + var high = "0x" + escaped - 0x10000; + // NaN means non-codepoint + return high !== high ? + escaped : + // BMP codepoint + high < 0 ? + String.fromCharCode( high + 0x10000 ) : + // Supplemental Plane codepoint (surrogate pair) + String.fromCharCode( high >> 10 | 0xD800, high & 0x3FF | 0xDC00 ); + }; + +// Use a stripped-down slice if we can't use a native one +try { + slice.call( docElem.childNodes, 0 )[0].nodeType; +} catch ( e ) { + slice = function( i ) { + var elem, + results = []; + for ( ; (elem = this[i]); i++ ) { + results.push( elem ); + } + return results; + }; +} + +/** + * For feature detection + * @param {Function} fn The function to test for native support + */ +function isNative( fn ) { + return rnative.test( fn + "" ); +} + +/** + * Create key-value caches of limited size + * @returns {Function(string, Object)} Returns the Object data after storing it on itself with + * property name the (space-suffixed) string and (if the cache is larger than Expr.cacheLength) + * deleting the oldest entry + */ +function createCache() { + var cache, + keys = []; + + return (cache = function( key, value ) { + // Use (key + " ") to avoid collision with native prototype properties (see Issue #157) + if ( keys.push( key += " " ) > Expr.cacheLength ) { + // Only keep the most recent entries + delete cache[ keys.shift() ]; + } + return (cache[ key ] = value); + }); +} + +/** + * Mark a function for special use by Sizzle + * @param {Function} fn The function to mark + */ +function markFunction( fn ) { + fn[ expando ] = true; + return fn; +} + +/** + * Support testing using an element + * @param {Function} fn Passed the created div and expects a boolean result + */ +function assert( fn ) { + var div = document.createElement("div"); + + try { + return fn( div ); + } catch (e) { + return false; + } finally { + // release memory in IE + div = null; + } +} + +function Sizzle( selector, context, results, seed ) { + var match, elem, m, nodeType, + // QSA vars + i, groups, old, nid, newContext, newSelector; + + if ( ( context ? context.ownerDocument || context : preferredDoc ) !== document ) { + setDocument( context ); + } + + context = context || document; + results = results || []; + + if ( !selector || typeof selector !== "string" ) { + return results; + } + + if ( (nodeType = context.nodeType) !== 1 && nodeType !== 9 ) { + return []; + } + + if ( !documentIsXML && !seed ) { + + // Shortcuts + if ( (match = rquickExpr.exec( selector )) ) { + // Speed-up: Sizzle("#ID") + if ( (m = match[1]) ) { + if ( nodeType === 9 ) { + elem = context.getElementById( m ); + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + if ( elem && elem.parentNode ) { + // Handle the case where IE, Opera, and Webkit return items + // by name instead of ID + if ( elem.id === m ) { + results.push( elem ); + return results; + } + } else { + return results; + } + } else { + // Context is not a document + if ( context.ownerDocument && (elem = context.ownerDocument.getElementById( m )) && + contains( context, elem ) && elem.id === m ) { + results.push( elem ); + return results; + } + } + + // Speed-up: Sizzle("TAG") + } else if ( match[2] ) { + push.apply( results, slice.call(context.getElementsByTagName( selector ), 0) ); + return results; + + // Speed-up: Sizzle(".CLASS") + } else if ( (m = match[3]) && support.getByClassName && context.getElementsByClassName ) { + push.apply( results, slice.call(context.getElementsByClassName( m ), 0) ); + return results; + } + } + + // QSA path + if ( support.qsa && !rbuggyQSA.test(selector) ) { + old = true; + nid = expando; + newContext = context; + newSelector = nodeType === 9 && selector; + + // qSA works strangely on Element-rooted queries + // We can work around this by specifying an extra ID on the root + // and working up from there (Thanks to Andrew Dupont for the technique) + // IE 8 doesn't work on object elements + if ( nodeType === 1 && context.nodeName.toLowerCase() !== "object" ) { + groups = tokenize( selector ); + + if ( (old = context.getAttribute("id")) ) { + nid = old.replace( rescape, "\\$&" ); + } else { + context.setAttribute( "id", nid ); + } + nid = "[id='" + nid + "'] "; + + i = groups.length; + while ( i-- ) { + groups[i] = nid + groups[i].join(""); + } + newContext = rsibling.test( selector ) && context.parentNode || context; + newSelector = groups.join(","); + } + + if ( newSelector ) { + try { + push.apply( results, slice.call( newContext.querySelectorAll( + newSelector + ), 0 ) ); + return results; + } catch(qsaError) { + } finally { + if ( !old ) { + context.removeAttribute("id"); + } + } + } + } + } + + // All others + return select( selector.replace( rtrim, "$1" ), context, results, seed ); +} + +/** + * Detect xml + * @param {Element|Object} elem An element or a document + */ +isXML = Sizzle.isXML = function( elem ) { + // documentElement is verified for cases where it doesn't yet exist + // (such as loading iframes in IE - #4833) + var documentElement = elem && (elem.ownerDocument || elem).documentElement; + return documentElement ? documentElement.nodeName !== "HTML" : false; +}; + +/** + * Sets document-related variables once based on the current document + * @param {Element|Object} [doc] An element or document object to use to set the document + * @returns {Object} Returns the current document + */ +setDocument = Sizzle.setDocument = function( node ) { + var doc = node ? node.ownerDocument || node : preferredDoc; + + // If no document and documentElement is available, return + if ( doc === document || doc.nodeType !== 9 || !doc.documentElement ) { + return document; + } + + // Set our document + document = doc; + docElem = doc.documentElement; + + // Support tests + documentIsXML = isXML( doc ); + + // Check if getElementsByTagName("*") returns only elements + support.tagNameNoComments = assert(function( div ) { + div.appendChild( doc.createComment("") ); + return !div.getElementsByTagName("*").length; + }); + + // Check if attributes should be retrieved by attribute nodes + support.attributes = assert(function( div ) { + div.innerHTML = ""; + var type = typeof div.lastChild.getAttribute("multiple"); + // IE8 returns a string for some attributes even when not present + return type !== "boolean" && type !== "string"; + }); + + // Check if getElementsByClassName can be trusted + support.getByClassName = assert(function( div ) { + // Opera can't find a second classname (in 9.6) + div.innerHTML = ""; + if ( !div.getElementsByClassName || !div.getElementsByClassName("e").length ) { + return false; + } + + // Safari 3.2 caches class attributes and doesn't catch changes + div.lastChild.className = "e"; + return div.getElementsByClassName("e").length === 2; + }); + + // Check if getElementById returns elements by name + // Check if getElementsByName privileges form controls or returns elements by ID + support.getByName = assert(function( div ) { + // Inject content + div.id = expando + 0; + div.innerHTML = "
"; + docElem.insertBefore( div, docElem.firstChild ); + + // Test + var pass = doc.getElementsByName && + // buggy browsers will return fewer than the correct 2 + doc.getElementsByName( expando ).length === 2 + + // buggy browsers will return more than the correct 0 + doc.getElementsByName( expando + 0 ).length; + support.getIdNotName = !doc.getElementById( expando ); + + // Cleanup + docElem.removeChild( div ); + + return pass; + }); + + // IE6/7 return modified attributes + Expr.attrHandle = assert(function( div ) { + div.innerHTML = ""; + return div.firstChild && typeof div.firstChild.getAttribute !== strundefined && + div.firstChild.getAttribute("href") === "#"; + }) ? + {} : + { + "href": function( elem ) { + return elem.getAttribute( "href", 2 ); + }, + "type": function( elem ) { + return elem.getAttribute("type"); + } + }; + + // ID find and filter + if ( support.getIdNotName ) { + Expr.find["ID"] = function( id, context ) { + if ( typeof context.getElementById !== strundefined && !documentIsXML ) { + var m = context.getElementById( id ); + // Check parentNode to catch when Blackberry 4.6 returns + // nodes that are no longer in the document #6963 + return m && m.parentNode ? [m] : []; + } + }; + Expr.filter["ID"] = function( id ) { + var attrId = id.replace( runescape, funescape ); + return function( elem ) { + return elem.getAttribute("id") === attrId; + }; + }; + } else { + Expr.find["ID"] = function( id, context ) { + if ( typeof context.getElementById !== strundefined && !documentIsXML ) { + var m = context.getElementById( id ); + + return m ? + m.id === id || typeof m.getAttributeNode !== strundefined && m.getAttributeNode("id").value === id ? + [m] : + undefined : + []; + } + }; + Expr.filter["ID"] = function( id ) { + var attrId = id.replace( runescape, funescape ); + return function( elem ) { + var node = typeof elem.getAttributeNode !== strundefined && elem.getAttributeNode("id"); + return node && node.value === attrId; + }; + }; + } + + // Tag + Expr.find["TAG"] = support.tagNameNoComments ? + function( tag, context ) { + if ( typeof context.getElementsByTagName !== strundefined ) { + return context.getElementsByTagName( tag ); + } + } : + function( tag, context ) { + var elem, + tmp = [], + i = 0, + results = context.getElementsByTagName( tag ); + + // Filter out possible comments + if ( tag === "*" ) { + for ( ; (elem = results[i]); i++ ) { + if ( elem.nodeType === 1 ) { + tmp.push( elem ); + } + } + + return tmp; + } + return results; + }; + + // Name + Expr.find["NAME"] = support.getByName && function( tag, context ) { + if ( typeof context.getElementsByName !== strundefined ) { + return context.getElementsByName( name ); + } + }; + + // Class + Expr.find["CLASS"] = support.getByClassName && function( className, context ) { + if ( typeof context.getElementsByClassName !== strundefined && !documentIsXML ) { + return context.getElementsByClassName( className ); + } + }; + + // QSA and matchesSelector support + + // matchesSelector(:active) reports false when true (IE9/Opera 11.5) + rbuggyMatches = []; + + // qSa(:focus) reports false when true (Chrome 21), + // no need to also add to buggyMatches since matches checks buggyQSA + // A support test would require too much code (would include document ready) + rbuggyQSA = [ ":focus" ]; + + if ( (support.qsa = isNative(doc.querySelectorAll)) ) { + // Build QSA regex + // Regex strategy adopted from Diego Perini + assert(function( div ) { + // Select is set to empty string on purpose + // This is to test IE's treatment of not explictly + // setting a boolean content attribute, + // since its presence should be enough + // http://bugs.jquery.com/ticket/12359 + div.innerHTML = ""; + + // IE8 - Some boolean attributes are not treated correctly + if ( !div.querySelectorAll("[selected]").length ) { + rbuggyQSA.push( "\\[" + whitespace + "*(?:checked|disabled|ismap|multiple|readonly|selected|value)" ); + } + + // Webkit/Opera - :checked should return selected option elements + // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked + // IE8 throws error here and will not see later tests + if ( !div.querySelectorAll(":checked").length ) { + rbuggyQSA.push(":checked"); + } + }); + + assert(function( div ) { + + // Opera 10-12/IE8 - ^= $= *= and empty values + // Should not select anything + div.innerHTML = ""; + if ( div.querySelectorAll("[i^='']").length ) { + rbuggyQSA.push( "[*^$]=" + whitespace + "*(?:\"\"|'')" ); + } + + // FF 3.5 - :enabled/:disabled and hidden elements (hidden elements are still enabled) + // IE8 throws error here and will not see later tests + if ( !div.querySelectorAll(":enabled").length ) { + rbuggyQSA.push( ":enabled", ":disabled" ); + } + + // Opera 10-11 does not throw on post-comma invalid pseudos + div.querySelectorAll("*,:x"); + rbuggyQSA.push(",.*:"); + }); + } + + if ( (support.matchesSelector = isNative( (matches = docElem.matchesSelector || + docElem.mozMatchesSelector || + docElem.webkitMatchesSelector || + docElem.oMatchesSelector || + docElem.msMatchesSelector) )) ) { + + assert(function( div ) { + // Check to see if it's possible to do matchesSelector + // on a disconnected node (IE 9) + support.disconnectedMatch = matches.call( div, "div" ); + + // This should fail with an exception + // Gecko does not error, returns false instead + matches.call( div, "[s!='']:x" ); + rbuggyMatches.push( "!=", pseudos ); + }); + } + + rbuggyQSA = new RegExp( rbuggyQSA.join("|") ); + rbuggyMatches = new RegExp( rbuggyMatches.join("|") ); + + // Element contains another + // Purposefully does not implement inclusive descendent + // As in, an element does not contain itself + contains = isNative(docElem.contains) || docElem.compareDocumentPosition ? + function( a, b ) { + var adown = a.nodeType === 9 ? a.documentElement : a, + bup = b && b.parentNode; + return a === bup || !!( bup && bup.nodeType === 1 && ( + adown.contains ? + adown.contains( bup ) : + a.compareDocumentPosition && a.compareDocumentPosition( bup ) & 16 + )); + } : + function( a, b ) { + if ( b ) { + while ( (b = b.parentNode) ) { + if ( b === a ) { + return true; + } + } + } + return false; + }; + + // Document order sorting + sortOrder = docElem.compareDocumentPosition ? + function( a, b ) { + var compare; + + if ( a === b ) { + hasDuplicate = true; + return 0; + } + + if ( (compare = b.compareDocumentPosition && a.compareDocumentPosition && a.compareDocumentPosition( b )) ) { + if ( compare & 1 || a.parentNode && a.parentNode.nodeType === 11 ) { + if ( a === doc || contains( preferredDoc, a ) ) { + return -1; + } + if ( b === doc || contains( preferredDoc, b ) ) { + return 1; + } + return 0; + } + return compare & 4 ? -1 : 1; + } + + return a.compareDocumentPosition ? -1 : 1; + } : + function( a, b ) { + var cur, + i = 0, + aup = a.parentNode, + bup = b.parentNode, + ap = [ a ], + bp = [ b ]; + + // The nodes are identical, we can exit early + if ( a === b ) { + hasDuplicate = true; + return 0; + + // Fallback to using sourceIndex (in IE) if it's available on both nodes + } else if ( a.sourceIndex && b.sourceIndex ) { + return ( ~b.sourceIndex || MAX_NEGATIVE ) - ( contains( preferredDoc, a ) && ~a.sourceIndex || MAX_NEGATIVE ); + + // Parentless nodes are either documents or disconnected + } else if ( !aup || !bup ) { + return a === doc ? -1 : + b === doc ? 1 : + aup ? -1 : + bup ? 1 : + 0; + + // If the nodes are siblings, we can do a quick check + } else if ( aup === bup ) { + return siblingCheck( a, b ); + } + + // Otherwise we need full lists of their ancestors for comparison + cur = a; + while ( (cur = cur.parentNode) ) { + ap.unshift( cur ); + } + cur = b; + while ( (cur = cur.parentNode) ) { + bp.unshift( cur ); + } + + // Walk down the tree looking for a discrepancy + while ( ap[i] === bp[i] ) { + i++; + } + + return i ? + // Do a sibling check if the nodes have a common ancestor + siblingCheck( ap[i], bp[i] ) : + + // Otherwise nodes in our document sort first + ap[i] === preferredDoc ? -1 : + bp[i] === preferredDoc ? 1 : + 0; + }; + + // Always assume the presence of duplicates if sort doesn't + // pass them to our comparison function (as in Google Chrome). + hasDuplicate = false; + [0, 0].sort( sortOrder ); + support.detectDuplicates = hasDuplicate; + + return document; +}; + +Sizzle.matches = function( expr, elements ) { + return Sizzle( expr, null, null, elements ); +}; + +Sizzle.matchesSelector = function( elem, expr ) { + // Set document vars if needed + if ( ( elem.ownerDocument || elem ) !== document ) { + setDocument( elem ); + } + + // Make sure that attribute selectors are quoted + expr = expr.replace( rattributeQuotes, "='$1']" ); + + // rbuggyQSA always contains :focus, so no need for an existence check + if ( support.matchesSelector && !documentIsXML && (!rbuggyMatches || !rbuggyMatches.test(expr)) && !rbuggyQSA.test(expr) ) { + try { + var ret = matches.call( elem, expr ); + + // IE 9's matchesSelector returns false on disconnected nodes + if ( ret || support.disconnectedMatch || + // As well, disconnected nodes are said to be in a document + // fragment in IE 9 + elem.document && elem.document.nodeType !== 11 ) { + return ret; + } + } catch(e) {} + } + + return Sizzle( expr, document, null, [elem] ).length > 0; +}; + +Sizzle.contains = function( context, elem ) { + // Set document vars if needed + if ( ( context.ownerDocument || context ) !== document ) { + setDocument( context ); + } + return contains( context, elem ); +}; + +Sizzle.attr = function( elem, name ) { + var val; + + // Set document vars if needed + if ( ( elem.ownerDocument || elem ) !== document ) { + setDocument( elem ); + } + + if ( !documentIsXML ) { + name = name.toLowerCase(); + } + if ( (val = Expr.attrHandle[ name ]) ) { + return val( elem ); + } + if ( documentIsXML || support.attributes ) { + return elem.getAttribute( name ); + } + return ( (val = elem.getAttributeNode( name )) || elem.getAttribute( name ) ) && elem[ name ] === true ? + name : + val && val.specified ? val.value : null; +}; + +Sizzle.error = function( msg ) { + throw new Error( "Syntax error, unrecognized expression: " + msg ); +}; + +// Document sorting and removing duplicates +Sizzle.uniqueSort = function( results ) { + var elem, + duplicates = [], + i = 1, + j = 0; + + // Unless we *know* we can detect duplicates, assume their presence + hasDuplicate = !support.detectDuplicates; + results.sort( sortOrder ); + + if ( hasDuplicate ) { + for ( ; (elem = results[i]); i++ ) { + if ( elem === results[ i - 1 ] ) { + j = duplicates.push( i ); + } + } + while ( j-- ) { + results.splice( duplicates[ j ], 1 ); + } + } + + return results; +}; + +function siblingCheck( a, b ) { + var cur = a && b && a.nextSibling; + + for ( ; cur; cur = cur.nextSibling ) { + if ( cur === b ) { + return -1; + } + } + + return a ? 1 : -1; +} + +// Returns a function to use in pseudos for input types +function createInputPseudo( type ) { + return function( elem ) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && elem.type === type; + }; +} + +// Returns a function to use in pseudos for buttons +function createButtonPseudo( type ) { + return function( elem ) { + var name = elem.nodeName.toLowerCase(); + return (name === "input" || name === "button") && elem.type === type; + }; +} + +// Returns a function to use in pseudos for positionals +function createPositionalPseudo( fn ) { + return markFunction(function( argument ) { + argument = +argument; + return markFunction(function( seed, matches ) { + var j, + matchIndexes = fn( [], seed.length, argument ), + i = matchIndexes.length; + + // Match elements found at the specified indexes + while ( i-- ) { + if ( seed[ (j = matchIndexes[i]) ] ) { + seed[j] = !(matches[j] = seed[j]); + } + } + }); + }); +} + +/** + * Utility function for retrieving the text value of an array of DOM nodes + * @param {Array|Element} elem + */ +getText = Sizzle.getText = function( elem ) { + var node, + ret = "", + i = 0, + nodeType = elem.nodeType; + + if ( !nodeType ) { + // If no nodeType, this is expected to be an array + for ( ; (node = elem[i]); i++ ) { + // Do not traverse comment nodes + ret += getText( node ); + } + } else if ( nodeType === 1 || nodeType === 9 || nodeType === 11 ) { + // Use textContent for elements + // innerText usage removed for consistency of new lines (see #11153) + if ( typeof elem.textContent === "string" ) { + return elem.textContent; + } else { + // Traverse its children + for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) { + ret += getText( elem ); + } + } + } else if ( nodeType === 3 || nodeType === 4 ) { + return elem.nodeValue; + } + // Do not include comment or processing instruction nodes + + return ret; +}; + +Expr = Sizzle.selectors = { + + // Can be adjusted by the user + cacheLength: 50, + + createPseudo: markFunction, + + match: matchExpr, + + find: {}, + + relative: { + ">": { dir: "parentNode", first: true }, + " ": { dir: "parentNode" }, + "+": { dir: "previousSibling", first: true }, + "~": { dir: "previousSibling" } + }, + + preFilter: { + "ATTR": function( match ) { + match[1] = match[1].replace( runescape, funescape ); + + // Move the given value to match[3] whether quoted or unquoted + match[3] = ( match[4] || match[5] || "" ).replace( runescape, funescape ); + + if ( match[2] === "~=" ) { + match[3] = " " + match[3] + " "; + } + + return match.slice( 0, 4 ); + }, + + "CHILD": function( match ) { + /* matches from matchExpr["CHILD"] + 1 type (only|nth|...) + 2 what (child|of-type) + 3 argument (even|odd|\d*|\d*n([+-]\d+)?|...) + 4 xn-component of xn+y argument ([+-]?\d*n|) + 5 sign of xn-component + 6 x of xn-component + 7 sign of y-component + 8 y of y-component + */ + match[1] = match[1].toLowerCase(); + + if ( match[1].slice( 0, 3 ) === "nth" ) { + // nth-* requires argument + if ( !match[3] ) { + Sizzle.error( match[0] ); + } + + // numeric x and y parameters for Expr.filter.CHILD + // remember that false/true cast respectively to 0/1 + match[4] = +( match[4] ? match[5] + (match[6] || 1) : 2 * ( match[3] === "even" || match[3] === "odd" ) ); + match[5] = +( ( match[7] + match[8] ) || match[3] === "odd" ); + + // other types prohibit arguments + } else if ( match[3] ) { + Sizzle.error( match[0] ); + } + + return match; + }, + + "PSEUDO": function( match ) { + var excess, + unquoted = !match[5] && match[2]; + + if ( matchExpr["CHILD"].test( match[0] ) ) { + return null; + } + + // Accept quoted arguments as-is + if ( match[4] ) { + match[2] = match[4]; + + // Strip excess characters from unquoted arguments + } else if ( unquoted && rpseudo.test( unquoted ) && + // Get excess from tokenize (recursively) + (excess = tokenize( unquoted, true )) && + // advance to the next closing parenthesis + (excess = unquoted.indexOf( ")", unquoted.length - excess ) - unquoted.length) ) { + + // excess is a negative index + match[0] = match[0].slice( 0, excess ); + match[2] = unquoted.slice( 0, excess ); + } + + // Return only captures needed by the pseudo filter method (type and argument) + return match.slice( 0, 3 ); + } + }, + + filter: { + + "TAG": function( nodeName ) { + if ( nodeName === "*" ) { + return function() { return true; }; + } + + nodeName = nodeName.replace( runescape, funescape ).toLowerCase(); + return function( elem ) { + return elem.nodeName && elem.nodeName.toLowerCase() === nodeName; + }; + }, + + "CLASS": function( className ) { + var pattern = classCache[ className + " " ]; + + return pattern || + (pattern = new RegExp( "(^|" + whitespace + ")" + className + "(" + whitespace + "|$)" )) && + classCache( className, function( elem ) { + return pattern.test( elem.className || (typeof elem.getAttribute !== strundefined && elem.getAttribute("class")) || "" ); + }); + }, + + "ATTR": function( name, operator, check ) { + return function( elem ) { + var result = Sizzle.attr( elem, name ); + + if ( result == null ) { + return operator === "!="; + } + if ( !operator ) { + return true; + } + + result += ""; + + return operator === "=" ? result === check : + operator === "!=" ? result !== check : + operator === "^=" ? check && result.indexOf( check ) === 0 : + operator === "*=" ? check && result.indexOf( check ) > -1 : + operator === "$=" ? check && result.substr( result.length - check.length ) === check : + operator === "~=" ? ( " " + result + " " ).indexOf( check ) > -1 : + operator === "|=" ? result === check || result.substr( 0, check.length + 1 ) === check + "-" : + false; + }; + }, + + "CHILD": function( type, what, argument, first, last ) { + var simple = type.slice( 0, 3 ) !== "nth", + forward = type.slice( -4 ) !== "last", + ofType = what === "of-type"; + + return first === 1 && last === 0 ? + + // Shortcut for :nth-*(n) + function( elem ) { + return !!elem.parentNode; + } : + + function( elem, context, xml ) { + var cache, outerCache, node, diff, nodeIndex, start, + dir = simple !== forward ? "nextSibling" : "previousSibling", + parent = elem.parentNode, + name = ofType && elem.nodeName.toLowerCase(), + useCache = !xml && !ofType; + + if ( parent ) { + + // :(first|last|only)-(child|of-type) + if ( simple ) { + while ( dir ) { + node = elem; + while ( (node = node[ dir ]) ) { + if ( ofType ? node.nodeName.toLowerCase() === name : node.nodeType === 1 ) { + return false; + } + } + // Reverse direction for :only-* (if we haven't yet done so) + start = dir = type === "only" && !start && "nextSibling"; + } + return true; + } + + start = [ forward ? parent.firstChild : parent.lastChild ]; + + // non-xml :nth-child(...) stores cache data on `parent` + if ( forward && useCache ) { + // Seek `elem` from a previously-cached index + outerCache = parent[ expando ] || (parent[ expando ] = {}); + cache = outerCache[ type ] || []; + nodeIndex = cache[0] === dirruns && cache[1]; + diff = cache[0] === dirruns && cache[2]; + node = nodeIndex && parent.childNodes[ nodeIndex ]; + + while ( (node = ++nodeIndex && node && node[ dir ] || + + // Fallback to seeking `elem` from the start + (diff = nodeIndex = 0) || start.pop()) ) { + + // When found, cache indexes on `parent` and break + if ( node.nodeType === 1 && ++diff && node === elem ) { + outerCache[ type ] = [ dirruns, nodeIndex, diff ]; + break; + } + } + + // Use previously-cached element index if available + } else if ( useCache && (cache = (elem[ expando ] || (elem[ expando ] = {}))[ type ]) && cache[0] === dirruns ) { + diff = cache[1]; + + // xml :nth-child(...) or :nth-last-child(...) or :nth(-last)?-of-type(...) + } else { + // Use the same loop as above to seek `elem` from the start + while ( (node = ++nodeIndex && node && node[ dir ] || + (diff = nodeIndex = 0) || start.pop()) ) { + + if ( ( ofType ? node.nodeName.toLowerCase() === name : node.nodeType === 1 ) && ++diff ) { + // Cache the index of each encountered element + if ( useCache ) { + (node[ expando ] || (node[ expando ] = {}))[ type ] = [ dirruns, diff ]; + } + + if ( node === elem ) { + break; + } + } + } + } + + // Incorporate the offset, then check against cycle size + diff -= last; + return diff === first || ( diff % first === 0 && diff / first >= 0 ); + } + }; + }, + + "PSEUDO": function( pseudo, argument ) { + // pseudo-class names are case-insensitive + // http://www.w3.org/TR/selectors/#pseudo-classes + // Prioritize by case sensitivity in case custom pseudos are added with uppercase letters + // Remember that setFilters inherits from pseudos + var args, + fn = Expr.pseudos[ pseudo ] || Expr.setFilters[ pseudo.toLowerCase() ] || + Sizzle.error( "unsupported pseudo: " + pseudo ); + + // The user may use createPseudo to indicate that + // arguments are needed to create the filter function + // just as Sizzle does + if ( fn[ expando ] ) { + return fn( argument ); + } + + // But maintain support for old signatures + if ( fn.length > 1 ) { + args = [ pseudo, pseudo, "", argument ]; + return Expr.setFilters.hasOwnProperty( pseudo.toLowerCase() ) ? + markFunction(function( seed, matches ) { + var idx, + matched = fn( seed, argument ), + i = matched.length; + while ( i-- ) { + idx = indexOf.call( seed, matched[i] ); + seed[ idx ] = !( matches[ idx ] = matched[i] ); + } + }) : + function( elem ) { + return fn( elem, 0, args ); + }; + } + + return fn; + } + }, + + pseudos: { + // Potentially complex pseudos + "not": markFunction(function( selector ) { + // Trim the selector passed to compile + // to avoid treating leading and trailing + // spaces as combinators + var input = [], + results = [], + matcher = compile( selector.replace( rtrim, "$1" ) ); + + return matcher[ expando ] ? + markFunction(function( seed, matches, context, xml ) { + var elem, + unmatched = matcher( seed, null, xml, [] ), + i = seed.length; + + // Match elements unmatched by `matcher` + while ( i-- ) { + if ( (elem = unmatched[i]) ) { + seed[i] = !(matches[i] = elem); + } + } + }) : + function( elem, context, xml ) { + input[0] = elem; + matcher( input, null, xml, results ); + return !results.pop(); + }; + }), + + "has": markFunction(function( selector ) { + return function( elem ) { + return Sizzle( selector, elem ).length > 0; + }; + }), + + "contains": markFunction(function( text ) { + return function( elem ) { + return ( elem.textContent || elem.innerText || getText( elem ) ).indexOf( text ) > -1; + }; + }), + + // "Whether an element is represented by a :lang() selector + // is based solely on the element's language value + // being equal to the identifier C, + // or beginning with the identifier C immediately followed by "-". + // The matching of C against the element's language value is performed case-insensitively. + // The identifier C does not have to be a valid language name." + // http://www.w3.org/TR/selectors/#lang-pseudo + "lang": markFunction( function( lang ) { + // lang value must be a valid identifider + if ( !ridentifier.test(lang || "") ) { + Sizzle.error( "unsupported lang: " + lang ); + } + lang = lang.replace( runescape, funescape ).toLowerCase(); + return function( elem ) { + var elemLang; + do { + if ( (elemLang = documentIsXML ? + elem.getAttribute("xml:lang") || elem.getAttribute("lang") : + elem.lang) ) { + + elemLang = elemLang.toLowerCase(); + return elemLang === lang || elemLang.indexOf( lang + "-" ) === 0; + } + } while ( (elem = elem.parentNode) && elem.nodeType === 1 ); + return false; + }; + }), + + // Miscellaneous + "target": function( elem ) { + var hash = window.location && window.location.hash; + return hash && hash.slice( 1 ) === elem.id; + }, + + "root": function( elem ) { + return elem === docElem; + }, + + "focus": function( elem ) { + return elem === document.activeElement && (!document.hasFocus || document.hasFocus()) && !!(elem.type || elem.href || ~elem.tabIndex); + }, + + // Boolean properties + "enabled": function( elem ) { + return elem.disabled === false; + }, + + "disabled": function( elem ) { + return elem.disabled === true; + }, + + "checked": function( elem ) { + // In CSS3, :checked should return both checked and selected elements + // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked + var nodeName = elem.nodeName.toLowerCase(); + return (nodeName === "input" && !!elem.checked) || (nodeName === "option" && !!elem.selected); + }, + + "selected": function( elem ) { + // Accessing this property makes selected-by-default + // options in Safari work properly + if ( elem.parentNode ) { + elem.parentNode.selectedIndex; + } + + return elem.selected === true; + }, + + // Contents + "empty": function( elem ) { + // http://www.w3.org/TR/selectors/#empty-pseudo + // :empty is only affected by element nodes and content nodes(including text(3), cdata(4)), + // not comment, processing instructions, or others + // Thanks to Diego Perini for the nodeName shortcut + // Greater than "@" means alpha characters (specifically not starting with "#" or "?") + for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) { + if ( elem.nodeName > "@" || elem.nodeType === 3 || elem.nodeType === 4 ) { + return false; + } + } + return true; + }, + + "parent": function( elem ) { + return !Expr.pseudos["empty"]( elem ); + }, + + // Element/input types + "header": function( elem ) { + return rheader.test( elem.nodeName ); + }, + + "input": function( elem ) { + return rinputs.test( elem.nodeName ); + }, + + "button": function( elem ) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && elem.type === "button" || name === "button"; + }, + + "text": function( elem ) { + var attr; + // IE6 and 7 will map elem.type to 'text' for new HTML5 types (search, etc) + // use getAttribute instead to test this case + return elem.nodeName.toLowerCase() === "input" && + elem.type === "text" && + ( (attr = elem.getAttribute("type")) == null || attr.toLowerCase() === elem.type ); + }, + + // Position-in-collection + "first": createPositionalPseudo(function() { + return [ 0 ]; + }), + + "last": createPositionalPseudo(function( matchIndexes, length ) { + return [ length - 1 ]; + }), + + "eq": createPositionalPseudo(function( matchIndexes, length, argument ) { + return [ argument < 0 ? argument + length : argument ]; + }), + + "even": createPositionalPseudo(function( matchIndexes, length ) { + var i = 0; + for ( ; i < length; i += 2 ) { + matchIndexes.push( i ); + } + return matchIndexes; + }), + + "odd": createPositionalPseudo(function( matchIndexes, length ) { + var i = 1; + for ( ; i < length; i += 2 ) { + matchIndexes.push( i ); + } + return matchIndexes; + }), + + "lt": createPositionalPseudo(function( matchIndexes, length, argument ) { + var i = argument < 0 ? argument + length : argument; + for ( ; --i >= 0; ) { + matchIndexes.push( i ); + } + return matchIndexes; + }), + + "gt": createPositionalPseudo(function( matchIndexes, length, argument ) { + var i = argument < 0 ? argument + length : argument; + for ( ; ++i < length; ) { + matchIndexes.push( i ); + } + return matchIndexes; + }) + } +}; + +// Add button/input type pseudos +for ( i in { radio: true, checkbox: true, file: true, password: true, image: true } ) { + Expr.pseudos[ i ] = createInputPseudo( i ); +} +for ( i in { submit: true, reset: true } ) { + Expr.pseudos[ i ] = createButtonPseudo( i ); +} + +function tokenize( selector, parseOnly ) { + var matched, match, tokens, type, + soFar, groups, preFilters, + cached = tokenCache[ selector + " " ]; + + if ( cached ) { + return parseOnly ? 0 : cached.slice( 0 ); + } + + soFar = selector; + groups = []; + preFilters = Expr.preFilter; + + while ( soFar ) { + + // Comma and first run + if ( !matched || (match = rcomma.exec( soFar )) ) { + if ( match ) { + // Don't consume trailing commas as valid + soFar = soFar.slice( match[0].length ) || soFar; + } + groups.push( tokens = [] ); + } + + matched = false; + + // Combinators + if ( (match = rcombinators.exec( soFar )) ) { + tokens.push( matched = new Token( match.shift() ) ); + soFar = soFar.slice( matched.length ); + + // Cast descendant combinators to space + matched.type = match[0].replace( rtrim, " " ); + } + + // Filters + for ( type in Expr.filter ) { + if ( (match = matchExpr[ type ].exec( soFar )) && (!preFilters[ type ] || + (match = preFilters[ type ]( match ))) ) { + + tokens.push( matched = new Token( match.shift() ) ); + soFar = soFar.slice( matched.length ); + matched.type = type; + matched.matches = match; + } + } + + if ( !matched ) { + break; + } + } + + // Return the length of the invalid excess + // if we're just parsing + // Otherwise, throw an error or return tokens + return parseOnly ? + soFar.length : + soFar ? + Sizzle.error( selector ) : + // Cache the tokens + tokenCache( selector, groups ).slice( 0 ); +} + +function addCombinator( matcher, combinator, base ) { + var dir = combinator.dir, + checkNonElements = base && combinator.dir === "parentNode", + doneName = done++; + + return combinator.first ? + // Check against closest ancestor/preceding element + function( elem, context, xml ) { + while ( (elem = elem[ dir ]) ) { + if ( elem.nodeType === 1 || checkNonElements ) { + return matcher( elem, context, xml ); + } + } + } : + + // Check against all ancestor/preceding elements + function( elem, context, xml ) { + var data, cache, outerCache, + dirkey = dirruns + " " + doneName; + + // We can't set arbitrary data on XML nodes, so they don't benefit from dir caching + if ( xml ) { + while ( (elem = elem[ dir ]) ) { + if ( elem.nodeType === 1 || checkNonElements ) { + if ( matcher( elem, context, xml ) ) { + return true; + } + } + } + } else { + while ( (elem = elem[ dir ]) ) { + if ( elem.nodeType === 1 || checkNonElements ) { + outerCache = elem[ expando ] || (elem[ expando ] = {}); + if ( (cache = outerCache[ dir ]) && cache[0] === dirkey ) { + if ( (data = cache[1]) === true || data === cachedruns ) { + return data === true; + } + } else { + cache = outerCache[ dir ] = [ dirkey ]; + cache[1] = matcher( elem, context, xml ) || cachedruns; + if ( cache[1] === true ) { + return true; + } + } + } + } + } + }; +} + +function elementMatcher( matchers ) { + return matchers.length > 1 ? + function( elem, context, xml ) { + var i = matchers.length; + while ( i-- ) { + if ( !matchers[i]( elem, context, xml ) ) { + return false; + } + } + return true; + } : + matchers[0]; +} + +function condense( unmatched, map, filter, context, xml ) { + var elem, + newUnmatched = [], + i = 0, + len = unmatched.length, + mapped = map != null; + + for ( ; i < len; i++ ) { + if ( (elem = unmatched[i]) ) { + if ( !filter || filter( elem, context, xml ) ) { + newUnmatched.push( elem ); + if ( mapped ) { + map.push( i ); + } + } + } + } + + return newUnmatched; +} + +function setMatcher( preFilter, selector, matcher, postFilter, postFinder, postSelector ) { + if ( postFilter && !postFilter[ expando ] ) { + postFilter = setMatcher( postFilter ); + } + if ( postFinder && !postFinder[ expando ] ) { + postFinder = setMatcher( postFinder, postSelector ); + } + return markFunction(function( seed, results, context, xml ) { + var temp, i, elem, + preMap = [], + postMap = [], + preexisting = results.length, + + // Get initial elements from seed or context + elems = seed || multipleContexts( selector || "*", context.nodeType ? [ context ] : context, [] ), + + // Prefilter to get matcher input, preserving a map for seed-results synchronization + matcherIn = preFilter && ( seed || !selector ) ? + condense( elems, preMap, preFilter, context, xml ) : + elems, + + matcherOut = matcher ? + // If we have a postFinder, or filtered seed, or non-seed postFilter or preexisting results, + postFinder || ( seed ? preFilter : preexisting || postFilter ) ? + + // ...intermediate processing is necessary + [] : + + // ...otherwise use results directly + results : + matcherIn; + + // Find primary matches + if ( matcher ) { + matcher( matcherIn, matcherOut, context, xml ); + } + + // Apply postFilter + if ( postFilter ) { + temp = condense( matcherOut, postMap ); + postFilter( temp, [], context, xml ); + + // Un-match failing elements by moving them back to matcherIn + i = temp.length; + while ( i-- ) { + if ( (elem = temp[i]) ) { + matcherOut[ postMap[i] ] = !(matcherIn[ postMap[i] ] = elem); + } + } + } + + if ( seed ) { + if ( postFinder || preFilter ) { + if ( postFinder ) { + // Get the final matcherOut by condensing this intermediate into postFinder contexts + temp = []; + i = matcherOut.length; + while ( i-- ) { + if ( (elem = matcherOut[i]) ) { + // Restore matcherIn since elem is not yet a final match + temp.push( (matcherIn[i] = elem) ); + } + } + postFinder( null, (matcherOut = []), temp, xml ); + } + + // Move matched elements from seed to results to keep them synchronized + i = matcherOut.length; + while ( i-- ) { + if ( (elem = matcherOut[i]) && + (temp = postFinder ? indexOf.call( seed, elem ) : preMap[i]) > -1 ) { + + seed[temp] = !(results[temp] = elem); + } + } + } + + // Add elements to results, through postFinder if defined + } else { + matcherOut = condense( + matcherOut === results ? + matcherOut.splice( preexisting, matcherOut.length ) : + matcherOut + ); + if ( postFinder ) { + postFinder( null, results, matcherOut, xml ); + } else { + push.apply( results, matcherOut ); + } + } + }); +} + +function matcherFromTokens( tokens ) { + var checkContext, matcher, j, + len = tokens.length, + leadingRelative = Expr.relative[ tokens[0].type ], + implicitRelative = leadingRelative || Expr.relative[" "], + i = leadingRelative ? 1 : 0, + + // The foundational matcher ensures that elements are reachable from top-level context(s) + matchContext = addCombinator( function( elem ) { + return elem === checkContext; + }, implicitRelative, true ), + matchAnyContext = addCombinator( function( elem ) { + return indexOf.call( checkContext, elem ) > -1; + }, implicitRelative, true ), + matchers = [ function( elem, context, xml ) { + return ( !leadingRelative && ( xml || context !== outermostContext ) ) || ( + (checkContext = context).nodeType ? + matchContext( elem, context, xml ) : + matchAnyContext( elem, context, xml ) ); + } ]; + + for ( ; i < len; i++ ) { + if ( (matcher = Expr.relative[ tokens[i].type ]) ) { + matchers = [ addCombinator(elementMatcher( matchers ), matcher) ]; + } else { + matcher = Expr.filter[ tokens[i].type ].apply( null, tokens[i].matches ); + + // Return special upon seeing a positional matcher + if ( matcher[ expando ] ) { + // Find the next relative operator (if any) for proper handling + j = ++i; + for ( ; j < len; j++ ) { + if ( Expr.relative[ tokens[j].type ] ) { + break; + } + } + return setMatcher( + i > 1 && elementMatcher( matchers ), + i > 1 && tokens.slice( 0, i - 1 ).join("").replace( rtrim, "$1" ), + matcher, + i < j && matcherFromTokens( tokens.slice( i, j ) ), + j < len && matcherFromTokens( (tokens = tokens.slice( j )) ), + j < len && tokens.join("") + ); + } + matchers.push( matcher ); + } + } + + return elementMatcher( matchers ); +} + +function matcherFromGroupMatchers( elementMatchers, setMatchers ) { + // A counter to specify which element is currently being matched + var matcherCachedRuns = 0, + bySet = setMatchers.length > 0, + byElement = elementMatchers.length > 0, + superMatcher = function( seed, context, xml, results, expandContext ) { + var elem, j, matcher, + setMatched = [], + matchedCount = 0, + i = "0", + unmatched = seed && [], + outermost = expandContext != null, + contextBackup = outermostContext, + // We must always have either seed elements or context + elems = seed || byElement && Expr.find["TAG"]( "*", expandContext && context.parentNode || context ), + // Nested matchers should use non-integer dirruns + dirrunsUnique = (dirruns += contextBackup == null ? 1 : Math.E); + + if ( outermost ) { + outermostContext = context !== document && context; + cachedruns = matcherCachedRuns; + } + + // Add elements passing elementMatchers directly to results + for ( ; (elem = elems[i]) != null; i++ ) { + if ( byElement && elem ) { + for ( j = 0; (matcher = elementMatchers[j]); j++ ) { + if ( matcher( elem, context, xml ) ) { + results.push( elem ); + break; + } + } + if ( outermost ) { + dirruns = dirrunsUnique; + cachedruns = ++matcherCachedRuns; + } + } + + // Track unmatched elements for set filters + if ( bySet ) { + // They will have gone through all possible matchers + if ( (elem = !matcher && elem) ) { + matchedCount--; + } + + // Lengthen the array for every element, matched or not + if ( seed ) { + unmatched.push( elem ); + } + } + } + + // Apply set filters to unmatched elements + // `i` starts as a string, so matchedCount would equal "00" if there are no elements + matchedCount += i; + if ( bySet && i !== matchedCount ) { + for ( j = 0; (matcher = setMatchers[j]); j++ ) { + matcher( unmatched, setMatched, context, xml ); + } + + if ( seed ) { + // Reintegrate element matches to eliminate the need for sorting + if ( matchedCount > 0 ) { + while ( i-- ) { + if ( !(unmatched[i] || setMatched[i]) ) { + setMatched[i] = pop.call( results ); + } + } + } + + // Discard index placeholder values to get only actual matches + setMatched = condense( setMatched ); + } + + // Add matches to results + push.apply( results, setMatched ); + + // Seedless set matches succeeding multiple successful matchers stipulate sorting + if ( outermost && !seed && setMatched.length > 0 && + ( matchedCount + setMatchers.length ) > 1 ) { + + Sizzle.uniqueSort( results ); + } + } + + // Override manipulation of globals by nested matchers + if ( outermost ) { + dirruns = dirrunsUnique; + outermostContext = contextBackup; + } + + return unmatched; + }; + + return bySet ? + markFunction( superMatcher ) : + superMatcher; +} + +compile = Sizzle.compile = function( selector, group /* Internal Use Only */ ) { + var i, + setMatchers = [], + elementMatchers = [], + cached = compilerCache[ selector + " " ]; + + if ( !cached ) { + // Generate a function of recursive functions that can be used to check each element + if ( !group ) { + group = tokenize( selector ); + } + i = group.length; + while ( i-- ) { + cached = matcherFromTokens( group[i] ); + if ( cached[ expando ] ) { + setMatchers.push( cached ); + } else { + elementMatchers.push( cached ); + } + } + + // Cache the compiled function + cached = compilerCache( selector, matcherFromGroupMatchers( elementMatchers, setMatchers ) ); + } + return cached; +}; + +function multipleContexts( selector, contexts, results ) { + var i = 0, + len = contexts.length; + for ( ; i < len; i++ ) { + Sizzle( selector, contexts[i], results ); + } + return results; +} + +function select( selector, context, results, seed ) { + var i, tokens, token, type, find, + match = tokenize( selector ); + + if ( !seed ) { + // Try to minimize operations if there is only one group + if ( match.length === 1 ) { + + // Take a shortcut and set the context if the root selector is an ID + tokens = match[0] = match[0].slice( 0 ); + if ( tokens.length > 2 && (token = tokens[0]).type === "ID" && + context.nodeType === 9 && !documentIsXML && + Expr.relative[ tokens[1].type ] ) { + + context = Expr.find["ID"]( token.matches[0].replace( runescape, funescape ), context )[0]; + if ( !context ) { + return results; + } + + selector = selector.slice( tokens.shift().length ); + } + + // Fetch a seed set for right-to-left matching + for ( i = matchExpr["needsContext"].test( selector ) ? -1 : tokens.length - 1; i >= 0; i-- ) { + token = tokens[i]; + + // Abort if we hit a combinator + if ( Expr.relative[ (type = token.type) ] ) { + break; + } + if ( (find = Expr.find[ type ]) ) { + // Search, expanding context for leading sibling combinators + if ( (seed = find( + token.matches[0].replace( runescape, funescape ), + rsibling.test( tokens[0].type ) && context.parentNode || context + )) ) { + + // If seed is empty or no tokens remain, we can return early + tokens.splice( i, 1 ); + selector = seed.length && tokens.join(""); + if ( !selector ) { + push.apply( results, slice.call( seed, 0 ) ); + return results; + } + + break; + } + } + } + } + } + + // Compile and execute a filtering function + // Provide `match` to avoid retokenization if we modified the selector above + compile( selector, match )( + seed, + context, + documentIsXML, + results, + rsibling.test( selector ) + ); + return results; +} + +// Deprecated +Expr.pseudos["nth"] = Expr.pseudos["eq"]; + +// Easy API for creating new setFilters +function setFilters() {} +Expr.filters = setFilters.prototype = Expr.pseudos; +Expr.setFilters = new setFilters(); + +// Initialize with the default document +setDocument(); + +// Override sizzle attribute retrieval +Sizzle.attr = jQuery.attr; +jQuery.find = Sizzle; +jQuery.expr = Sizzle.selectors; +jQuery.expr[":"] = jQuery.expr.pseudos; +jQuery.unique = Sizzle.uniqueSort; +jQuery.text = Sizzle.getText; +jQuery.isXMLDoc = Sizzle.isXML; +jQuery.contains = Sizzle.contains; + + +})( window ); +var runtil = /Until$/, + rparentsprev = /^(?:parents|prev(?:Until|All))/, + isSimple = /^.[^:#\[\.,]*$/, + rneedsContext = jQuery.expr.match.needsContext, + // methods guaranteed to produce a unique set when starting from a unique set + guaranteedUnique = { + children: true, + contents: true, + next: true, + prev: true + }; + +jQuery.fn.extend({ + find: function( selector ) { + var self, matched, i, + l = this.length; + + if ( typeof selector !== "string" ) { + self = this; + return this.pushStack( jQuery( selector ).filter(function() { + for ( i = 0; i < l; i++ ) { + if ( jQuery.contains( self[ i ], this ) ) { + return true; + } + } + }) ); + } + + matched = []; + for ( i = 0; i < l; i++ ) { + jQuery.find( selector, this[ i ], matched ); + } + + // Needed because $( selector, context ) becomes $( context ).find( selector ) + matched = this.pushStack( jQuery.unique( matched ) ); + matched.selector = ( this.selector ? this.selector + " " : "" ) + selector; + return matched; + }, + + has: function( target ) { + var targets = jQuery( target, this ), + l = targets.length; + + return this.filter(function() { + var i = 0; + for ( ; i < l; i++ ) { + if ( jQuery.contains( this, targets[i] ) ) { + return true; + } + } + }); + }, + + not: function( selector ) { + return this.pushStack( winnow(this, selector, false) ); + }, + + filter: function( selector ) { + return this.pushStack( winnow(this, selector, true) ); + }, + + is: function( selector ) { + return !!selector && ( + typeof selector === "string" ? + // If this is a positional/relative selector, check membership in the returned set + // so $("p:first").is("p:last") won't return true for a doc with two "p". + rneedsContext.test( selector ) ? + jQuery( selector, this.context ).index( this[ 0 ] ) >= 0 : + jQuery.filter( selector, this ).length > 0 : + this.filter( selector ).length > 0 ); + }, + + closest: function( selectors, context ) { + var cur, + i = 0, + l = this.length, + matched = [], + pos = ( rneedsContext.test( selectors ) || typeof selectors !== "string" ) ? + jQuery( selectors, context || this.context ) : + 0; + + for ( ; i < l; i++ ) { + cur = this[ i ]; + + while ( cur && cur.ownerDocument && cur !== context ) { + if ( pos ? pos.index( cur ) > -1 : jQuery.find.matchesSelector( cur, selectors ) ) { + matched.push( cur ); + break; + } + cur = cur.parentElement; + } + } + + return this.pushStack( matched.length > 1 ? jQuery.unique( matched ) : matched ); + }, + + // Determine the position of an element within + // the matched set of elements + index: function( elem ) { + + // No argument, return index in parent + if ( !elem ) { + return ( this[ 0 ] && this[ 0 ].parentNode ) ? this.first().prevAll().length : -1; + } + + // index in selector + if ( typeof elem === "string" ) { + return core_indexOf.call( jQuery( elem ), this[ 0 ] ); + } + + // Locate the position of the desired element + return core_indexOf.call( this, + + // If it receives a jQuery object, the first element is used + elem.jquery ? elem[ 0 ] : elem + ); + }, + + add: function( selector, context ) { + var set = typeof selector === "string" ? + jQuery( selector, context ) : + jQuery.makeArray( selector && selector.nodeType ? [ selector ] : selector ), + all = jQuery.merge( this.get(), set ); + + return this.pushStack( jQuery.unique(all) ); + }, + + addBack: function( selector ) { + return this.add( selector == null ? + this.prevObject : this.prevObject.filter(selector) + ); + } +}); + +jQuery.fn.andSelf = jQuery.fn.addBack; + +jQuery.each({ + parent: function( elem ) { + return elem.parentElement; + }, + parents: function( elem ) { + return jQuery.dir( elem, "parentElement" ); + }, + parentsUntil: function( elem, i, until ) { + return jQuery.dir( elem, "parentElement", until ); + }, + next: function( elem ) { + return elem.nextElementSibling; + }, + prev: function( elem ) { + return elem.previousElementSibling; + }, + nextAll: function( elem ) { + return jQuery.dir( elem, "nextElementSibling" ); + }, + prevAll: function( elem ) { + return jQuery.dir( elem, "previousElementSibling" ); + }, + nextUntil: function( elem, i, until ) { + return jQuery.dir( elem, "nextElementSibling", until ); + }, + prevUntil: function( elem, i, until ) { + return jQuery.dir( elem, "previousElementSibling", until ); + }, + siblings: function( elem ) { + return jQuery.sibling( ( elem.parentNode || {} ).firstChild, elem ); + }, + children: function( elem ) { + var children = elem.children; + + // documentFragment or document does not have children property + return children ? jQuery.merge( [], children ) : jQuery.sibling( elem.firstChild ); + }, + contents: function( elem ) { + return jQuery.nodeName( elem, "iframe" ) ? + elem.contentDocument || elem.contentWindow.document : + jQuery.merge( [], elem.childNodes ); + } +}, function( name, fn ) { + jQuery.fn[ name ] = function( until, selector ) { + var matched = jQuery.map( this, fn, until ); + + if ( !runtil.test( name ) ) { + selector = until; + } + + if ( selector && typeof selector === "string" ) { + matched = jQuery.filter( selector, matched ); + } + + if ( this.length > 1 ) { + if ( !guaranteedUnique[ name ] ) { + jQuery.unique( matched ); + } + + if ( rparentsprev.test( name ) ) { + matched.reverse(); + } + } + + return this.pushStack( matched ); + }; +}); + +jQuery.extend({ + filter: function( expr, elems, not ) { + if ( not ) { + expr = ":not(" + expr + ")"; + } + + return elems.length === 1 ? + jQuery.find.matchesSelector( elems[ 0 ], expr ) ? [ elems[ 0 ] ] : [] : + jQuery.find.matches( expr, elems ); + }, + + dir: function( elem, dir, until ) { + var cur = elem[ dir ], + matched = []; + + while ( cur && ( !until || !jQuery( cur ).is( until ) ) ) { + matched.push( cur ); + cur = cur[ dir ]; + } + + return matched; + }, + + sibling: function( n, elem ) { + var matched = []; + + for ( ; n; n = n.nextSibling ) { + if ( n.nodeType === 1 && n !== elem ) { + matched.push( n ); + } + } + + return matched; + } +}); + +// Implement the identical functionality for filter and not +function winnow( elements, qualifier, keep ) { + + // Can't pass null or undefined to indexOf in Firefox 4 + // Set to 0 to skip string check + qualifier = qualifier || 0; + + var filtered; + + if ( jQuery.isFunction( qualifier ) ) { + return jQuery.grep(elements, function( elem, i ) { + var retVal = !!qualifier.call( elem, i, elem ); + return retVal === keep; + }); + } + + if ( qualifier.nodeType ) { + return jQuery.grep(elements, function( elem ) { + return ( elem === qualifier ) === keep; + }); + } + + if ( typeof qualifier === "string" ) { + filtered = jQuery.grep(elements, function( elem ) { + return elem.nodeType === 1; + }); + + if ( isSimple.test( qualifier ) ) { + return jQuery.filter( qualifier, filtered, !keep ); + } + + qualifier = jQuery.filter( qualifier, filtered ); + } + + return jQuery.grep(elements, function( elem ) { + return ( core_indexOf.call( qualifier, elem ) >= 0 ) === keep; + }); +} +var rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/gi, + rtagName = /<([\w:]+)/, + rhtml = /<|&#?\w+;/, + rnoInnerhtml = /<(?:script|style|link)/i, + manipulation_rcheckableType = /^(?:checkbox|radio)$/i, + // checked="checked" or checked + rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i, + rscriptType = /^$|\/(?:java|ecma)script/i, + rscriptTypeMasked = /^true\/(.*)/, + rcleanScript = /^\s*\s*$/g, + wrapMap = { + + // Support: IE 9 + option: [ 1, "'); + this._dialogInput.keydown(this._doKeyDown); + $('body').append(this._dialogInput); + inst = this._dialogInst = this._newInst(this._dialogInput, false); + inst.settings = {}; + $.data(this._dialogInput[0], PROP_NAME, inst); + } + extendRemove(inst.settings, settings || {}); + date = (date && date.constructor == Date ? this._formatDate(inst, date) : date); + this._dialogInput.val(date); + + this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null); + if (!this._pos) { + var browserWidth = document.documentElement.clientWidth; + var browserHeight = document.documentElement.clientHeight; + var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft; + var scrollY = document.documentElement.scrollTop || document.body.scrollTop; + this._pos = // should use actual width/height below + [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY]; + } + + // move input on screen for focus, but hidden behind dialog + this._dialogInput.css('left', (this._pos[0] + 20) + 'px').css('top', this._pos[1] + 'px'); + inst.settings.onSelect = onSelect; + this._inDialog = true; + this.dpDiv.addClass(this._dialogClass); + this._showDatepicker(this._dialogInput[0]); + if ($.blockUI) + $.blockUI(this.dpDiv); + $.data(this._dialogInput[0], PROP_NAME, inst); + return this; + }, + + /* Detach a datepicker from its control. + @param target element - the target input field or division or span */ + _destroyDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + $.removeData(target, PROP_NAME); + if (nodeName == 'input') { + inst.append.remove(); + inst.trigger.remove(); + $target.removeClass(this.markerClassName). + unbind('focus', this._showDatepicker). + unbind('keydown', this._doKeyDown). + unbind('keypress', this._doKeyPress). + unbind('keyup', this._doKeyUp); + } else if (nodeName == 'div' || nodeName == 'span') + $target.removeClass(this.markerClassName).empty(); + }, + + /* Enable the date picker to a jQuery selection. + @param target element - the target input field or division or span */ + _enableDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + if (nodeName == 'input') { + target.disabled = false; + inst.trigger.filter('button'). + each(function() { this.disabled = false; }).end(). + filter('img').css({opacity: '1.0', cursor: ''}); + } + else if (nodeName == 'div' || nodeName == 'span') { + var inline = $target.children('.' + this._inlineClass); + inline.children().removeClass('ui-state-disabled'); + inline.find("select.ui-datepicker-month, select.ui-datepicker-year"). + removeAttr("disabled"); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value == target ? null : value); }); // delete entry + }, + + /* Disable the date picker to a jQuery selection. + @param target element - the target input field or division or span */ + _disableDatepicker: function(target) { + var $target = $(target); + var inst = $.data(target, PROP_NAME); + if (!$target.hasClass(this.markerClassName)) { + return; + } + var nodeName = target.nodeName.toLowerCase(); + if (nodeName == 'input') { + target.disabled = true; + inst.trigger.filter('button'). + each(function() { this.disabled = true; }).end(). + filter('img').css({opacity: '0.5', cursor: 'default'}); + } + else if (nodeName == 'div' || nodeName == 'span') { + var inline = $target.children('.' + this._inlineClass); + inline.children().addClass('ui-state-disabled'); + inline.find("select.ui-datepicker-month, select.ui-datepicker-year"). + attr("disabled", "disabled"); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value == target ? null : value); }); // delete entry + this._disabledInputs[this._disabledInputs.length] = target; + }, + + /* Is the first field in a jQuery collection disabled as a datepicker? + @param target element - the target input field or division or span + @return boolean - true if disabled, false if enabled */ + _isDisabledDatepicker: function(target) { + if (!target) { + return false; + } + for (var i = 0; i < this._disabledInputs.length; i++) { + if (this._disabledInputs[i] == target) + return true; + } + return false; + }, + + /* Retrieve the instance data for the target control. + @param target element - the target input field or division or span + @return object - the associated instance data + @throws error if a jQuery problem getting data */ + _getInst: function(target) { + try { + return $.data(target, PROP_NAME); + } + catch (err) { + throw 'Missing instance data for this datepicker'; + } + }, + + /* Update or retrieve the settings for a date picker attached to an input field or division. + @param target element - the target input field or division or span + @param name object - the new settings to update or + string - the name of the setting to change or retrieve, + when retrieving also 'all' for all instance settings or + 'defaults' for all global defaults + @param value any - the new value for the setting + (omit if above is an object or to retrieve a value) */ + _optionDatepicker: function(target, name, value) { + var inst = this._getInst(target); + if (arguments.length == 2 && typeof name == 'string') { + return (name == 'defaults' ? $.extend({}, $.datepicker._defaults) : + (inst ? (name == 'all' ? $.extend({}, inst.settings) : + this._get(inst, name)) : null)); + } + var settings = name || {}; + if (typeof name == 'string') { + settings = {}; + settings[name] = value; + } + if (inst) { + if (this._curInst == inst) { + this._hideDatepicker(); + } + var date = this._getDateDatepicker(target, true); + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + extendRemove(inst.settings, settings); + // reformat the old minDate/maxDate values if dateFormat changes and a new minDate/maxDate isn't provided + if (minDate !== null && settings['dateFormat'] !== undefined && settings['minDate'] === undefined) + inst.settings.minDate = this._formatDate(inst, minDate); + if (maxDate !== null && settings['dateFormat'] !== undefined && settings['maxDate'] === undefined) + inst.settings.maxDate = this._formatDate(inst, maxDate); + this._attachments($(target), inst); + this._autoSize(inst); + this._setDate(inst, date); + this._updateAlternate(inst); + this._updateDatepicker(inst); + } + }, + + // change method deprecated + _changeDatepicker: function(target, name, value) { + this._optionDatepicker(target, name, value); + }, + + /* Redraw the date picker attached to an input field or division. + @param target element - the target input field or division or span */ + _refreshDatepicker: function(target) { + var inst = this._getInst(target); + if (inst) { + this._updateDatepicker(inst); + } + }, + + /* Set the dates for a jQuery selection. + @param target element - the target input field or division or span + @param date Date - the new date */ + _setDateDatepicker: function(target, date) { + var inst = this._getInst(target); + if (inst) { + this._setDate(inst, date); + this._updateDatepicker(inst); + this._updateAlternate(inst); + } + }, + + /* Get the date(s) for the first entry in a jQuery selection. + @param target element - the target input field or division or span + @param noDefault boolean - true if no default date is to be used + @return Date - the current date */ + _getDateDatepicker: function(target, noDefault) { + var inst = this._getInst(target); + if (inst && !inst.inline) + this._setDateFromField(inst, noDefault); + return (inst ? this._getDate(inst) : null); + }, + + /* Handle keystrokes. */ + _doKeyDown: function(event) { + var inst = $.datepicker._getInst(event.target); + var handled = true; + var isRTL = inst.dpDiv.is('.ui-datepicker-rtl'); + inst._keyEvent = true; + if ($.datepicker._datepickerShowing) + switch (event.keyCode) { + case 9: $.datepicker._hideDatepicker(); + handled = false; + break; // hide on tab out + case 13: var sel = $('td.' + $.datepicker._dayOverClass + ':not(.' + + $.datepicker._currentClass + ')', inst.dpDiv); + if (sel[0]) + $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]); + var onSelect = $.datepicker._get(inst, 'onSelect'); + if (onSelect) { + var dateStr = $.datepicker._formatDate(inst); + + // trigger custom callback + onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); + } + else + $.datepicker._hideDatepicker(); + return false; // don't submit the form + break; // select the value on enter + case 27: $.datepicker._hideDatepicker(); + break; // hide on escape + case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, 'stepBigMonths') : + -$.datepicker._get(inst, 'stepMonths')), 'M'); + break; // previous month/year on page up/+ ctrl + case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, 'stepBigMonths') : + +$.datepicker._get(inst, 'stepMonths')), 'M'); + break; // next month/year on page down/+ ctrl + case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target); + handled = event.ctrlKey || event.metaKey; + break; // clear on ctrl or command +end + case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target); + handled = event.ctrlKey || event.metaKey; + break; // current on ctrl or command +home + case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D'); + handled = event.ctrlKey || event.metaKey; + // -1 day on ctrl or command +left + if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, 'stepBigMonths') : + -$.datepicker._get(inst, 'stepMonths')), 'M'); + // next month/year on alt +left on Mac + break; + case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D'); + handled = event.ctrlKey || event.metaKey; + break; // -1 week on ctrl or command +up + case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D'); + handled = event.ctrlKey || event.metaKey; + // +1 day on ctrl or command +right + if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, 'stepBigMonths') : + +$.datepicker._get(inst, 'stepMonths')), 'M'); + // next month/year on alt +right + break; + case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D'); + handled = event.ctrlKey || event.metaKey; + break; // +1 week on ctrl or command +down + default: handled = false; + } + else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home + $.datepicker._showDatepicker(this); + else { + handled = false; + } + if (handled) { + event.preventDefault(); + event.stopPropagation(); + } + }, + + /* Filter entered characters - based on date format. */ + _doKeyPress: function(event) { + var inst = $.datepicker._getInst(event.target); + if ($.datepicker._get(inst, 'constrainInput')) { + var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat')); + var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode); + return event.ctrlKey || event.metaKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1); + } + }, + + /* Synchronise manual entry and field/alternate field. */ + _doKeyUp: function(event) { + var inst = $.datepicker._getInst(event.target); + if (inst.input.val() != inst.lastVal) { + try { + var date = $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), + (inst.input ? inst.input.val() : null), + $.datepicker._getFormatConfig(inst)); + if (date) { // only if valid + $.datepicker._setDateFromField(inst); + $.datepicker._updateAlternate(inst); + $.datepicker._updateDatepicker(inst); + } + } + catch (err) { + $.datepicker.log(err); + } + } + return true; + }, + + /* Pop-up the date picker for a given input field. + If false returned from beforeShow event handler do not show. + @param input element - the input field attached to the date picker or + event - if triggered by focus */ + _showDatepicker: function(input) { + input = input.target || input; + if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger + input = $('input', input.parentNode)[0]; + if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here + return; + var inst = $.datepicker._getInst(input); + if ($.datepicker._curInst && $.datepicker._curInst != inst) { + $.datepicker._curInst.dpDiv.stop(true, true); + if ( inst && $.datepicker._datepickerShowing ) { + $.datepicker._hideDatepicker( $.datepicker._curInst.input[0] ); + } + } + var beforeShow = $.datepicker._get(inst, 'beforeShow'); + var beforeShowSettings = beforeShow ? beforeShow.apply(input, [input, inst]) : {}; + if(beforeShowSettings === false){ + //false + return; + } + extendRemove(inst.settings, beforeShowSettings); + inst.lastVal = null; + $.datepicker._lastInput = input; + $.datepicker._setDateFromField(inst); + if ($.datepicker._inDialog) // hide cursor + input.value = ''; + if (!$.datepicker._pos) { // position below input + $.datepicker._pos = $.datepicker._findPos(input); + $.datepicker._pos[1] += input.offsetHeight; // add the height + } + var isFixed = false; + $(input).parents().each(function() { + isFixed |= $(this).css('position') == 'fixed'; + return !isFixed; + }); + if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled + $.datepicker._pos[0] -= document.documentElement.scrollLeft; + $.datepicker._pos[1] -= document.documentElement.scrollTop; + } + var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]}; + $.datepicker._pos = null; + //to avoid flashes on Firefox + inst.dpDiv.empty(); + // determine sizing offscreen + inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'}); + $.datepicker._updateDatepicker(inst); + // fix width for dynamic number of date pickers + // and adjust position before showing + offset = $.datepicker._checkOffset(inst, offset, isFixed); + inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ? + 'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none', + left: offset.left + 'px', top: offset.top + 'px'}); + if (!inst.inline) { + var showAnim = $.datepicker._get(inst, 'showAnim'); + var duration = $.datepicker._get(inst, 'duration'); + var postProcess = function() { + var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only + if( !! cover.length ){ + var borders = $.datepicker._getBorders(inst.dpDiv); + cover.css({left: -borders[0], top: -borders[1], + width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}); + } + }; + inst.dpDiv.zIndex($(input).zIndex()+1); + $.datepicker._datepickerShowing = true; + if ($.effects && $.effects[showAnim]) + inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); + else + inst.dpDiv[showAnim || 'show']((showAnim ? duration : null), postProcess); + if (!showAnim || !duration) + postProcess(); + if (inst.input.is(':visible') && !inst.input.is(':disabled')) + inst.input.focus(); + $.datepicker._curInst = inst; + } + }, + + /* Generate the date picker content. */ + _updateDatepicker: function(inst) { + var self = this; + self.maxRows = 4; //Reset the max number of rows being displayed (see #7043) + var borders = $.datepicker._getBorders(inst.dpDiv); + instActive = inst; // for delegate hover events + inst.dpDiv.empty().append(this._generateHTML(inst)); + this._attachHandlers(inst); + var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only + if( !!cover.length ){ //avoid call to outerXXXX() when not in IE6 + cover.css({left: -borders[0], top: -borders[1], width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()}) + } + inst.dpDiv.find('.' + this._dayOverClass + ' a').mouseover(); + var numMonths = this._getNumberOfMonths(inst); + var cols = numMonths[1]; + var width = 17; + inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width(''); + if (cols > 1) + inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em'); + inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') + + 'Class']('ui-datepicker-multi'); + inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') + + 'Class']('ui-datepicker-rtl'); + if (inst == $.datepicker._curInst && $.datepicker._datepickerShowing && inst.input && + // #6694 - don't focus the input if it's already focused + // this breaks the change event in IE + inst.input.is(':visible') && !inst.input.is(':disabled') && inst.input[0] != document.activeElement) + inst.input.focus(); + // deffered render of the years select (to avoid flashes on Firefox) + if( inst.yearshtml ){ + var origyearshtml = inst.yearshtml; + setTimeout(function(){ + //assure that inst.yearshtml didn't change. + if( origyearshtml === inst.yearshtml && inst.yearshtml ){ + inst.dpDiv.find('select.ui-datepicker-year:first').replaceWith(inst.yearshtml); + } + origyearshtml = inst.yearshtml = null; + }, 0); + } + }, + + /* Retrieve the size of left and top borders for an element. + @param elem (jQuery object) the element of interest + @return (number[2]) the left and top borders */ + _getBorders: function(elem) { + var convert = function(value) { + return {thin: 1, medium: 2, thick: 3}[value] || value; + }; + return [parseFloat(convert(elem.css('border-left-width'))), + parseFloat(convert(elem.css('border-top-width')))]; + }, + + /* Check positioning to remain on screen. */ + _checkOffset: function(inst, offset, isFixed) { + var dpWidth = inst.dpDiv.outerWidth(); + var dpHeight = inst.dpDiv.outerHeight(); + var inputWidth = inst.input ? inst.input.outerWidth() : 0; + var inputHeight = inst.input ? inst.input.outerHeight() : 0; + var viewWidth = document.documentElement.clientWidth + (isFixed ? 0 : $(document).scrollLeft()); + var viewHeight = document.documentElement.clientHeight + (isFixed ? 0 : $(document).scrollTop()); + + offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0); + offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0; + offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0; + + // now check if datepicker is showing outside window viewport - move to a better place if so. + offset.left -= Math.min(offset.left, (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ? + Math.abs(offset.left + dpWidth - viewWidth) : 0); + offset.top -= Math.min(offset.top, (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ? + Math.abs(dpHeight + inputHeight) : 0); + + return offset; + }, + + /* Find an object's position on the screen. */ + _findPos: function(obj) { + var inst = this._getInst(obj); + var isRTL = this._get(inst, 'isRTL'); + while (obj && (obj.type == 'hidden' || obj.nodeType != 1 || $.expr.filters.hidden(obj))) { + obj = obj[isRTL ? 'previousSibling' : 'nextSibling']; + } + var position = $(obj).offset(); + return [position.left, position.top]; + }, + + /* Hide the date picker from view. + @param input element - the input field attached to the date picker */ + _hideDatepicker: function(input) { + var inst = this._curInst; + if (!inst || (input && inst != $.data(input, PROP_NAME))) + return; + if (this._datepickerShowing) { + var showAnim = this._get(inst, 'showAnim'); + var duration = this._get(inst, 'duration'); + var postProcess = function() { + $.datepicker._tidyDialog(inst); + }; + if ($.effects && $.effects[showAnim]) + inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess); + else + inst.dpDiv[(showAnim == 'slideDown' ? 'slideUp' : + (showAnim == 'fadeIn' ? 'fadeOut' : 'hide'))]((showAnim ? duration : null), postProcess); + if (!showAnim) + postProcess(); + this._datepickerShowing = false; + var onClose = this._get(inst, 'onClose'); + if (onClose) + onClose.apply((inst.input ? inst.input[0] : null), + [(inst.input ? inst.input.val() : ''), inst]); + this._lastInput = null; + if (this._inDialog) { + this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' }); + if ($.blockUI) { + $.unblockUI(); + $('body').append(this.dpDiv); + } + } + this._inDialog = false; + } + }, + + /* Tidy up after a dialog display. */ + _tidyDialog: function(inst) { + inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar'); + }, + + /* Close date picker if clicked elsewhere. */ + _checkExternalClick: function(event) { + if (!$.datepicker._curInst) + return; + + var $target = $(event.target), + inst = $.datepicker._getInst($target[0]); + + if ( ( ( $target[0].id != $.datepicker._mainDivId && + $target.parents('#' + $.datepicker._mainDivId).length == 0 && + !$target.hasClass($.datepicker.markerClassName) && + !$target.closest("." + $.datepicker._triggerClass).length && + $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI) ) ) || + ( $target.hasClass($.datepicker.markerClassName) && $.datepicker._curInst != inst ) ) + $.datepicker._hideDatepicker(); + }, + + /* Adjust one of the date sub-fields. */ + _adjustDate: function(id, offset, period) { + var target = $(id); + var inst = this._getInst(target[0]); + if (this._isDisabledDatepicker(target[0])) { + return; + } + this._adjustInstDate(inst, offset + + (period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning + period); + this._updateDatepicker(inst); + }, + + /* Action for current link. */ + _gotoToday: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + if (this._get(inst, 'gotoCurrent') && inst.currentDay) { + inst.selectedDay = inst.currentDay; + inst.drawMonth = inst.selectedMonth = inst.currentMonth; + inst.drawYear = inst.selectedYear = inst.currentYear; + } + else { + var date = new Date(); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + } + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Action for selecting a new month/year. */ + _selectMonthYear: function(id, select, period) { + var target = $(id); + var inst = this._getInst(target[0]); + inst['selected' + (period == 'M' ? 'Month' : 'Year')] = + inst['draw' + (period == 'M' ? 'Month' : 'Year')] = + parseInt(select.options[select.selectedIndex].value,10); + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Action for selecting a day. */ + _selectDay: function(id, month, year, td) { + var target = $(id); + if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) { + return; + } + var inst = this._getInst(target[0]); + inst.selectedDay = inst.currentDay = $('a', td).html(); + inst.selectedMonth = inst.currentMonth = month; + inst.selectedYear = inst.currentYear = year; + this._selectDate(id, this._formatDate(inst, + inst.currentDay, inst.currentMonth, inst.currentYear)); + }, + + /* Erase the input field and hide the date picker. */ + _clearDate: function(id) { + var target = $(id); + var inst = this._getInst(target[0]); + this._selectDate(target, ''); + }, + + /* Update the input field with the selected date. */ + _selectDate: function(id, dateStr) { + var target = $(id); + var inst = this._getInst(target[0]); + dateStr = (dateStr != null ? dateStr : this._formatDate(inst)); + if (inst.input) + inst.input.val(dateStr); + this._updateAlternate(inst); + var onSelect = this._get(inst, 'onSelect'); + if (onSelect) + onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback + else if (inst.input) + inst.input.trigger('change'); // fire the change event + if (inst.inline) + this._updateDatepicker(inst); + else { + this._hideDatepicker(); + this._lastInput = inst.input[0]; + if (typeof(inst.input[0]) != 'object') + inst.input.focus(); // restore focus + this._lastInput = null; + } + }, + + /* Update any alternate field to synchronise with the main field. */ + _updateAlternate: function(inst) { + var altField = this._get(inst, 'altField'); + if (altField) { // update alternate field too + var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat'); + var date = this._getDate(inst); + var dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst)); + $(altField).each(function() { $(this).val(dateStr); }); + } + }, + + /* Set as beforeShowDay function to prevent selection of weekends. + @param date Date - the date to customise + @return [boolean, string] - is this date selectable?, what is its CSS class? */ + noWeekends: function(date) { + var day = date.getDay(); + return [(day > 0 && day < 6), '']; + }, + + /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition. + @param date Date - the date to get the week for + @return number - the number of the week within the year that contains this date */ + iso8601Week: function(date) { + var checkDate = new Date(date.getTime()); + // Find Thursday of this week starting on Monday + checkDate.setDate(checkDate.getDate() + 4 - (checkDate.getDay() || 7)); + var time = checkDate.getTime(); + checkDate.setMonth(0); // Compare with Jan 1 + checkDate.setDate(1); + return Math.floor(Math.round((time - checkDate) / 86400000) / 7) + 1; + }, + + /* Parse a string value into a date object. + See formatDate below for the possible formats. + + @param format string - the expected format of the date + @param value string - the date in the above format + @param settings Object - attributes include: + shortYearCutoff number - the cutoff year for determining the century (optional) + dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + dayNames string[7] - names of the days from Sunday (optional) + monthNamesShort string[12] - abbreviated names of the months (optional) + monthNames string[12] - names of the months (optional) + @return Date - the extracted date value or null if value is blank */ + parseDate: function (format, value, settings) { + if (format == null || value == null) + throw 'Invalid arguments'; + value = (typeof value == 'object' ? value.toString() : value + ''); + if (value == '') + return null; + var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff; + shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : + new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); + var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; + var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; + var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; + var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; + var year = -1; + var month = -1; + var day = -1; + var doy = -1; + var literal = false; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + // Extract a number from the string value + var getNumber = function(match) { + var isDoubled = lookAhead(match); + var size = (match == '@' ? 14 : (match == '!' ? 20 : + (match == 'y' && isDoubled ? 4 : (match == 'o' ? 3 : 2)))); + var digits = new RegExp('^\\d{1,' + size + '}'); + var num = value.substring(iValue).match(digits); + if (!num) + throw 'Missing number at position ' + iValue; + iValue += num[0].length; + return parseInt(num[0], 10); + }; + // Extract a name from the string value and convert to an index + var getName = function(match, shortNames, longNames) { + var names = $.map(lookAhead(match) ? longNames : shortNames, function (v, k) { + return [ [k, v] ]; + }).sort(function (a, b) { + return -(a[1].length - b[1].length); + }); + var index = -1; + $.each(names, function (i, pair) { + var name = pair[1]; + if (value.substr(iValue, name.length).toLowerCase() == name.toLowerCase()) { + index = pair[0]; + iValue += name.length; + return false; + } + }); + if (index != -1) + return index + 1; + else + throw 'Unknown name at position ' + iValue; + }; + // Confirm that a literal character matches the string value + var checkLiteral = function() { + if (value.charAt(iValue) != format.charAt(iFormat)) + throw 'Unexpected literal at position ' + iValue; + iValue++; + }; + var iValue = 0; + for (var iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + checkLiteral(); + else + switch (format.charAt(iFormat)) { + case 'd': + day = getNumber('d'); + break; + case 'D': + getName('D', dayNamesShort, dayNames); + break; + case 'o': + doy = getNumber('o'); + break; + case 'm': + month = getNumber('m'); + break; + case 'M': + month = getName('M', monthNamesShort, monthNames); + break; + case 'y': + year = getNumber('y'); + break; + case '@': + var date = new Date(getNumber('@')); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case '!': + var date = new Date((getNumber('!') - this._ticksTo1970) / 10000); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case "'": + if (lookAhead("'")) + checkLiteral(); + else + literal = true; + break; + default: + checkLiteral(); + } + } + if (iValue < value.length){ + throw "Extra/unparsed characters found in date: " + value.substring(iValue); + } + if (year == -1) + year = new Date().getFullYear(); + else if (year < 100) + year += new Date().getFullYear() - new Date().getFullYear() % 100 + + (year <= shortYearCutoff ? 0 : -100); + if (doy > -1) { + month = 1; + day = doy; + do { + var dim = this._getDaysInMonth(year, month - 1); + if (day <= dim) + break; + month++; + day -= dim; + } while (true); + } + var date = this._daylightSavingAdjust(new Date(year, month - 1, day)); + if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day) + throw 'Invalid date'; // E.g. 31/02/00 + return date; + }, + + /* Standard date formats. */ + ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601) + COOKIE: 'D, dd M yy', + ISO_8601: 'yy-mm-dd', + RFC_822: 'D, d M y', + RFC_850: 'DD, dd-M-y', + RFC_1036: 'D, d M y', + RFC_1123: 'D, d M yy', + RFC_2822: 'D, d M yy', + RSS: 'D, d M y', // RFC 822 + TICKS: '!', + TIMESTAMP: '@', + W3C: 'yy-mm-dd', // ISO 8601 + + _ticksTo1970: (((1970 - 1) * 365 + Math.floor(1970 / 4) - Math.floor(1970 / 100) + + Math.floor(1970 / 400)) * 24 * 60 * 60 * 10000000), + + /* Format a date object into a string value. + The format can be combinations of the following: + d - day of month (no leading zero) + dd - day of month (two digit) + o - day of year (no leading zeros) + oo - day of year (three digit) + D - day name short + DD - day name long + m - month of year (no leading zero) + mm - month of year (two digit) + M - month name short + MM - month name long + y - year (two digit) + yy - year (four digit) + @ - Unix timestamp (ms since 01/01/1970) + ! - Windows ticks (100ns since 01/01/0001) + '...' - literal text + '' - single quote + + @param format string - the desired format of the date + @param date Date - the date value to format + @param settings Object - attributes include: + dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + dayNames string[7] - names of the days from Sunday (optional) + monthNamesShort string[12] - abbreviated names of the months (optional) + monthNames string[12] - names of the months (optional) + @return string - the date in the above format */ + formatDate: function (format, date, settings) { + if (!date) + return ''; + var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort; + var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames; + var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort; + var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + // Format a number, with leading zero if necessary + var formatNumber = function(match, value, len) { + var num = '' + value; + if (lookAhead(match)) + while (num.length < len) + num = '0' + num; + return num; + }; + // Format a name, short or long as requested + var formatName = function(match, value, shortNames, longNames) { + return (lookAhead(match) ? longNames[value] : shortNames[value]); + }; + var output = ''; + var literal = false; + if (date) + for (var iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + output += format.charAt(iFormat); + else + switch (format.charAt(iFormat)) { + case 'd': + output += formatNumber('d', date.getDate(), 2); + break; + case 'D': + output += formatName('D', date.getDay(), dayNamesShort, dayNames); + break; + case 'o': + output += formatNumber('o', + Math.round((new Date(date.getFullYear(), date.getMonth(), date.getDate()).getTime() - new Date(date.getFullYear(), 0, 0).getTime()) / 86400000), 3); + break; + case 'm': + output += formatNumber('m', date.getMonth() + 1, 2); + break; + case 'M': + output += formatName('M', date.getMonth(), monthNamesShort, monthNames); + break; + case 'y': + output += (lookAhead('y') ? date.getFullYear() : + (date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100); + break; + case '@': + output += date.getTime(); + break; + case '!': + output += date.getTime() * 10000 + this._ticksTo1970; + break; + case "'": + if (lookAhead("'")) + output += "'"; + else + literal = true; + break; + default: + output += format.charAt(iFormat); + } + } + return output; + }, + + /* Extract all possible characters from the date format. */ + _possibleChars: function (format) { + var chars = ''; + var literal = false; + // Check whether a format character is doubled + var lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match); + if (matches) + iFormat++; + return matches; + }; + for (var iFormat = 0; iFormat < format.length; iFormat++) + if (literal) + if (format.charAt(iFormat) == "'" && !lookAhead("'")) + literal = false; + else + chars += format.charAt(iFormat); + else + switch (format.charAt(iFormat)) { + case 'd': case 'm': case 'y': case '@': + chars += '0123456789'; + break; + case 'D': case 'M': + return null; // Accept anything + case "'": + if (lookAhead("'")) + chars += "'"; + else + literal = true; + break; + default: + chars += format.charAt(iFormat); + } + return chars; + }, + + /* Get a setting value, defaulting if necessary. */ + _get: function(inst, name) { + return inst.settings[name] !== undefined ? + inst.settings[name] : this._defaults[name]; + }, + + /* Parse existing date and initialise date picker. */ + _setDateFromField: function(inst, noDefault) { + if (inst.input.val() == inst.lastVal) { + return; + } + var dateFormat = this._get(inst, 'dateFormat'); + var dates = inst.lastVal = inst.input ? inst.input.val() : null; + var date, defaultDate; + date = defaultDate = this._getDefaultDate(inst); + var settings = this._getFormatConfig(inst); + try { + date = this.parseDate(dateFormat, dates, settings) || defaultDate; + } catch (event) { + this.log(event); + dates = (noDefault ? '' : dates); + } + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + inst.currentDay = (dates ? date.getDate() : 0); + inst.currentMonth = (dates ? date.getMonth() : 0); + inst.currentYear = (dates ? date.getFullYear() : 0); + this._adjustInstDate(inst); + }, + + /* Retrieve the default date shown on opening. */ + _getDefaultDate: function(inst) { + return this._restrictMinMax(inst, + this._determineDate(inst, this._get(inst, 'defaultDate'), new Date())); + }, + + /* A date may be specified as an exact value or a relative one. */ + _determineDate: function(inst, date, defaultDate) { + var offsetNumeric = function(offset) { + var date = new Date(); + date.setDate(date.getDate() + offset); + return date; + }; + var offsetString = function(offset) { + try { + return $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'), + offset, $.datepicker._getFormatConfig(inst)); + } + catch (e) { + // Ignore + } + var date = (offset.toLowerCase().match(/^c/) ? + $.datepicker._getDate(inst) : null) || new Date(); + var year = date.getFullYear(); + var month = date.getMonth(); + var day = date.getDate(); + var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g; + var matches = pattern.exec(offset); + while (matches) { + switch (matches[2] || 'd') { + case 'd' : case 'D' : + day += parseInt(matches[1],10); break; + case 'w' : case 'W' : + day += parseInt(matches[1],10) * 7; break; + case 'm' : case 'M' : + month += parseInt(matches[1],10); + day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); + break; + case 'y': case 'Y' : + year += parseInt(matches[1],10); + day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); + break; + } + matches = pattern.exec(offset); + } + return new Date(year, month, day); + }; + var newDate = (date == null || date === '' ? defaultDate : (typeof date == 'string' ? offsetString(date) : + (typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : new Date(date.getTime())))); + newDate = (newDate && newDate.toString() == 'Invalid Date' ? defaultDate : newDate); + if (newDate) { + newDate.setHours(0); + newDate.setMinutes(0); + newDate.setSeconds(0); + newDate.setMilliseconds(0); + } + return this._daylightSavingAdjust(newDate); + }, + + /* Handle switch to/from daylight saving. + Hours may be non-zero on daylight saving cut-over: + > 12 when midnight changeover, but then cannot generate + midnight datetime, so jump to 1AM, otherwise reset. + @param date (Date) the date to check + @return (Date) the corrected date */ + _daylightSavingAdjust: function(date) { + if (!date) return null; + date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0); + return date; + }, + + /* Set the date(s) directly. */ + _setDate: function(inst, date, noChange) { + var clear = !date; + var origMonth = inst.selectedMonth; + var origYear = inst.selectedYear; + var newDate = this._restrictMinMax(inst, this._determineDate(inst, date, new Date())); + inst.selectedDay = inst.currentDay = newDate.getDate(); + inst.drawMonth = inst.selectedMonth = inst.currentMonth = newDate.getMonth(); + inst.drawYear = inst.selectedYear = inst.currentYear = newDate.getFullYear(); + if ((origMonth != inst.selectedMonth || origYear != inst.selectedYear) && !noChange) + this._notifyChange(inst); + this._adjustInstDate(inst); + if (inst.input) { + inst.input.val(clear ? '' : this._formatDate(inst)); + } + }, + + /* Retrieve the date(s) directly. */ + _getDate: function(inst) { + var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null : + this._daylightSavingAdjust(new Date( + inst.currentYear, inst.currentMonth, inst.currentDay))); + return startDate; + }, + + /* Attach the onxxx handlers. These are declared statically so + * they work with static code transformers like Caja. + */ + _attachHandlers: function(inst) { + var stepMonths = this._get(inst, 'stepMonths'); + var id = '#' + inst.id.replace( /\\\\/g, "\\" ); + inst.dpDiv.find('[data-handler]').map(function () { + var handler = { + prev: function () { + window['DP_jQuery_' + dpuuid].datepicker._adjustDate(id, -stepMonths, 'M'); + }, + next: function () { + window['DP_jQuery_' + dpuuid].datepicker._adjustDate(id, +stepMonths, 'M'); + }, + hide: function () { + window['DP_jQuery_' + dpuuid].datepicker._hideDatepicker(); + }, + today: function () { + window['DP_jQuery_' + dpuuid].datepicker._gotoToday(id); + }, + selectDay: function () { + window['DP_jQuery_' + dpuuid].datepicker._selectDay(id, +this.getAttribute('data-month'), +this.getAttribute('data-year'), this); + return false; + }, + selectMonth: function () { + window['DP_jQuery_' + dpuuid].datepicker._selectMonthYear(id, this, 'M'); + return false; + }, + selectYear: function () { + window['DP_jQuery_' + dpuuid].datepicker._selectMonthYear(id, this, 'Y'); + return false; + } + }; + $(this).bind(this.getAttribute('data-event'), handler[this.getAttribute('data-handler')]); + }); + }, + + /* Generate the HTML for the current state of the date picker. */ + _generateHTML: function(inst) { + var today = new Date(); + today = this._daylightSavingAdjust( + new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time + var isRTL = this._get(inst, 'isRTL'); + var showButtonPanel = this._get(inst, 'showButtonPanel'); + var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext'); + var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat'); + var numMonths = this._getNumberOfMonths(inst); + var showCurrentAtPos = this._get(inst, 'showCurrentAtPos'); + var stepMonths = this._get(inst, 'stepMonths'); + var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1); + var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) : + new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + var drawMonth = inst.drawMonth - showCurrentAtPos; + var drawYear = inst.drawYear; + if (drawMonth < 0) { + drawMonth += 12; + drawYear--; + } + if (maxDate) { + var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(), + maxDate.getMonth() - (numMonths[0] * numMonths[1]) + 1, maxDate.getDate())); + maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw); + while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) { + drawMonth--; + if (drawMonth < 0) { + drawMonth = 11; + drawYear--; + } + } + } + inst.drawMonth = drawMonth; + inst.drawYear = drawYear; + var prevText = this._get(inst, 'prevText'); + prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)), + this._getFormatConfig(inst))); + var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ? + '' + prevText + '' : + (hideIfNoPrevNext ? '' : '' + prevText + '')); + var nextText = this._get(inst, 'nextText'); + nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)), + this._getFormatConfig(inst))); + var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ? + '' + nextText + '' : + (hideIfNoPrevNext ? '' : '' + nextText + '')); + var currentText = this._get(inst, 'currentText'); + var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today); + currentText = (!navigationAsDateFormat ? currentText : + this.formatDate(currentText, gotoDate, this._getFormatConfig(inst))); + var controls = (!inst.inline ? '' : ''); + var buttonPanel = (showButtonPanel) ? '
' + (isRTL ? controls : '') + + (this._isInRange(inst, gotoDate) ? '' : '') + (isRTL ? '' : controls) + '
' : ''; + var firstDay = parseInt(this._get(inst, 'firstDay'),10); + firstDay = (isNaN(firstDay) ? 0 : firstDay); + var showWeek = this._get(inst, 'showWeek'); + var dayNames = this._get(inst, 'dayNames'); + var dayNamesShort = this._get(inst, 'dayNamesShort'); + var dayNamesMin = this._get(inst, 'dayNamesMin'); + var monthNames = this._get(inst, 'monthNames'); + var monthNamesShort = this._get(inst, 'monthNamesShort'); + var beforeShowDay = this._get(inst, 'beforeShowDay'); + var showOtherMonths = this._get(inst, 'showOtherMonths'); + var selectOtherMonths = this._get(inst, 'selectOtherMonths'); + var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week; + var defaultDate = this._getDefaultDate(inst); + var html = ''; + for (var row = 0; row < numMonths[0]; row++) { + var group = ''; + this.maxRows = 4; + for (var col = 0; col < numMonths[1]; col++) { + var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay)); + var cornerClass = ' ui-corner-all'; + var calender = ''; + if (isMultiMonth) { + calender += '
'; + } + calender += '
' + + (/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') + + (/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') + + this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate, + row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers + '
' + + ''; + var thead = (showWeek ? '' : ''); + for (var dow = 0; dow < 7; dow++) { // days of the week + var day = (dow + firstDay) % 7; + thead += '= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' + + '' + dayNamesMin[day] + ''; + } + calender += thead + ''; + var daysInMonth = this._getDaysInMonth(drawYear, drawMonth); + if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth) + inst.selectedDay = Math.min(inst.selectedDay, daysInMonth); + var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7; + var curRows = Math.ceil((leadDays + daysInMonth) / 7); // calculate the number of rows to generate + var numRows = (isMultiMonth ? this.maxRows > curRows ? this.maxRows : curRows : curRows); //If multiple months, use the higher number of rows (see #7043) + this.maxRows = numRows; + var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays)); + for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows + calender += ''; + var tbody = (!showWeek ? '' : ''); + for (var dow = 0; dow < 7; dow++) { // create date picker days + var daySettings = (beforeShowDay ? + beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']); + var otherMonth = (printDate.getMonth() != drawMonth); + var unselectable = (otherMonth && !selectOtherMonths) || !daySettings[0] || + (minDate && printDate < minDate) || (maxDate && printDate > maxDate); + tbody += ''; // display selectable date + printDate.setDate(printDate.getDate() + 1); + printDate = this._daylightSavingAdjust(printDate); + } + calender += tbody + ''; + } + drawMonth++; + if (drawMonth > 11) { + drawMonth = 0; + drawYear++; + } + calender += '
' + this._get(inst, 'weekHeader') + '
' + + this._get(inst, 'calculateWeek')(printDate) + '' + // actions + (otherMonth && !showOtherMonths ? ' ' : // display for other months + (unselectable ? '' + printDate.getDate() + '' : '' + printDate.getDate() + '')) + '
' + (isMultiMonth ? '
' + + ((numMonths[0] > 0 && col == numMonths[1]-1) ? '
' : '') : ''); + group += calender; + } + html += group; + } + html += buttonPanel + ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ? + '' : ''); + inst._keyEvent = false; + return html; + }, + + /* Generate the month and year header. */ + _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate, + secondary, monthNames, monthNamesShort) { + var changeMonth = this._get(inst, 'changeMonth'); + var changeYear = this._get(inst, 'changeYear'); + var showMonthAfterYear = this._get(inst, 'showMonthAfterYear'); + var html = '
'; + var monthHtml = ''; + // month selection + if (secondary || !changeMonth) + monthHtml += '' + monthNames[drawMonth] + ''; + else { + var inMinYear = (minDate && minDate.getFullYear() == drawYear); + var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear); + monthHtml += ''; + } + if (!showMonthAfterYear) + html += monthHtml + (secondary || !(changeMonth && changeYear) ? ' ' : ''); + // year selection + if ( !inst.yearshtml ) { + inst.yearshtml = ''; + if (secondary || !changeYear) + html += '' + drawYear + ''; + else { + // determine range of years to display + var years = this._get(inst, 'yearRange').split(':'); + var thisYear = new Date().getFullYear(); + var determineYear = function(value) { + var year = (value.match(/c[+-].*/) ? drawYear + parseInt(value.substring(1), 10) : + (value.match(/[+-].*/) ? thisYear + parseInt(value, 10) : + parseInt(value, 10))); + return (isNaN(year) ? thisYear : year); + }; + var year = determineYear(years[0]); + var endYear = Math.max(year, determineYear(years[1] || '')); + year = (minDate ? Math.max(year, minDate.getFullYear()) : year); + endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear); + inst.yearshtml += ''; + + html += inst.yearshtml; + inst.yearshtml = null; + } + } + html += this._get(inst, 'yearSuffix'); + if (showMonthAfterYear) + html += (secondary || !(changeMonth && changeYear) ? ' ' : '') + monthHtml; + html += '
'; // Close datepicker_header + return html; + }, + + /* Adjust one of the date sub-fields. */ + _adjustInstDate: function(inst, offset, period) { + var year = inst.drawYear + (period == 'Y' ? offset : 0); + var month = inst.drawMonth + (period == 'M' ? offset : 0); + var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) + + (period == 'D' ? offset : 0); + var date = this._restrictMinMax(inst, + this._daylightSavingAdjust(new Date(year, month, day))); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + if (period == 'M' || period == 'Y') + this._notifyChange(inst); + }, + + /* Ensure a date is within any min/max bounds. */ + _restrictMinMax: function(inst, date) { + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + var newDate = (minDate && date < minDate ? minDate : date); + newDate = (maxDate && newDate > maxDate ? maxDate : newDate); + return newDate; + }, + + /* Notify change of month/year. */ + _notifyChange: function(inst) { + var onChange = this._get(inst, 'onChangeMonthYear'); + if (onChange) + onChange.apply((inst.input ? inst.input[0] : null), + [inst.selectedYear, inst.selectedMonth + 1, inst]); + }, + + /* Determine the number of months to show. */ + _getNumberOfMonths: function(inst) { + var numMonths = this._get(inst, 'numberOfMonths'); + return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths)); + }, + + /* Determine the current maximum date - ensure no time components are set. */ + _getMinMaxDate: function(inst, minMax) { + return this._determineDate(inst, this._get(inst, minMax + 'Date'), null); + }, + + /* Find the number of days in a given month. */ + _getDaysInMonth: function(year, month) { + return 32 - this._daylightSavingAdjust(new Date(year, month, 32)).getDate(); + }, + + /* Find the day of the week of the first of a month. */ + _getFirstDayOfMonth: function(year, month) { + return new Date(year, month, 1).getDay(); + }, + + /* Determines if we should allow a "next/prev" month display change. */ + _canAdjustMonth: function(inst, offset, curYear, curMonth) { + var numMonths = this._getNumberOfMonths(inst); + var date = this._daylightSavingAdjust(new Date(curYear, + curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1)); + if (offset < 0) + date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth())); + return this._isInRange(inst, date); + }, + + /* Is the given date in the accepted range? */ + _isInRange: function(inst, date) { + var minDate = this._getMinMaxDate(inst, 'min'); + var maxDate = this._getMinMaxDate(inst, 'max'); + return ((!minDate || date.getTime() >= minDate.getTime()) && + (!maxDate || date.getTime() <= maxDate.getTime())); + }, + + /* Provide the configuration settings for formatting/parsing. */ + _getFormatConfig: function(inst) { + var shortYearCutoff = this._get(inst, 'shortYearCutoff'); + shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff : + new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); + return {shortYearCutoff: shortYearCutoff, + dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'), + monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')}; + }, + + /* Format the given date for display. */ + _formatDate: function(inst, day, month, year) { + if (!day) { + inst.currentDay = inst.selectedDay; + inst.currentMonth = inst.selectedMonth; + inst.currentYear = inst.selectedYear; + } + var date = (day ? (typeof day == 'object' ? day : + this._daylightSavingAdjust(new Date(year, month, day))) : + this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst)); + } +}); + +/* + * Bind hover events for datepicker elements. + * Done via delegate so the binding only occurs once in the lifetime of the parent div. + * Global instActive, set by _updateDatepicker allows the handlers to find their way back to the active picker. + */ +function bindHover(dpDiv) { + var selector = 'button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a'; + return dpDiv.bind('mouseout', function(event) { + var elem = $( event.target ).closest( selector ); + if ( !elem.length ) { + return; + } + elem.removeClass( "ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover" ); + }) + .bind('mouseover', function(event) { + var elem = $( event.target ).closest( selector ); + if ($.datepicker._isDisabledDatepicker( instActive.inline ? dpDiv.parent()[0] : instActive.input[0]) || + !elem.length ) { + return; + } + elem.parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover'); + elem.addClass('ui-state-hover'); + if (elem.hasClass('ui-datepicker-prev')) elem.addClass('ui-datepicker-prev-hover'); + if (elem.hasClass('ui-datepicker-next')) elem.addClass('ui-datepicker-next-hover'); + }); +} + +/* jQuery extend now ignores nulls! */ +function extendRemove(target, props) { + $.extend(target, props); + for (var name in props) + if (props[name] == null || props[name] == undefined) + target[name] = props[name]; + return target; +}; + +/* Determine whether an object is an array. */ +function isArray(a) { + return (a && (($.browser.safari && typeof a == 'object' && a.length) || + (a.constructor && a.constructor.toString().match(/\Array\(\)/)))); +}; + +/* Invoke the datepicker functionality. + @param options string - a command, optionally followed by additional parameters or + Object - settings for attaching new datepicker functionality + @return jQuery object */ +$.fn.datepicker = function(options){ + + /* Verify an empty collection wasn't passed - Fixes #6976 */ + if ( !this.length ) { + return this; + } + + /* Initialise the date picker. */ + if (!$.datepicker.initialized) { + $(document).mousedown($.datepicker._checkExternalClick). + find('body').append($.datepicker.dpDiv); + $.datepicker.initialized = true; + } + + var otherArgs = Array.prototype.slice.call(arguments, 1); + if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate' || options == 'widget')) + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + if (options == 'option' && arguments.length == 2 && typeof arguments[1] == 'string') + return $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this[0]].concat(otherArgs)); + return this.each(function() { + typeof options == 'string' ? + $.datepicker['_' + options + 'Datepicker']. + apply($.datepicker, [this].concat(otherArgs)) : + $.datepicker._attachDatepicker(this, options); + }); +}; + +$.datepicker = new Datepicker(); // singleton instance +$.datepicker.initialized = false; +$.datepicker.uuid = new Date().getTime(); +$.datepicker.version = "1.8.24"; + +// Workaround for #4055 +// Add another global to avoid noConflict issues with inline event handlers +window['DP_jQuery_' + dpuuid] = $; + +})(jQuery); + +(function( $, undefined ) { + +var uiDialogClasses = + 'ui-dialog ' + + 'ui-widget ' + + 'ui-widget-content ' + + 'ui-corner-all ', + sizeRelatedOptions = { + buttons: true, + height: true, + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true, + width: true + }, + resizableRelatedOptions = { + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true + }; + +$.widget("ui.dialog", { + options: { + autoOpen: true, + buttons: {}, + closeOnEscape: true, + closeText: 'close', + dialogClass: '', + draggable: true, + hide: null, + height: 'auto', + maxHeight: false, + maxWidth: false, + minHeight: 150, + minWidth: 150, + modal: false, + position: { + my: 'center', + at: 'center', + collision: 'fit', + // ensure that the titlebar is never outside the document + using: function(pos) { + var topOffset = $(this).css(pos).offset().top; + if (topOffset < 0) { + $(this).css('top', pos.top - topOffset); + } + } + }, + resizable: true, + show: null, + stack: true, + title: '', + width: 300, + zIndex: 1000 + }, + + _create: function() { + this.originalTitle = this.element.attr('title'); + // #5742 - .attr() might return a DOMElement + if ( typeof this.originalTitle !== "string" ) { + this.originalTitle = ""; + } + + this.options.title = this.options.title || this.originalTitle; + var self = this, + options = self.options, + + title = options.title || ' ', + titleId = $.ui.dialog.getTitleId(self.element), + + uiDialog = (self.uiDialog = $('
')) + .appendTo(document.body) + .hide() + .addClass(uiDialogClasses + options.dialogClass) + .css({ + zIndex: options.zIndex + }) + // setting tabIndex makes the div focusable + // setting outline to 0 prevents a border on focus in Mozilla + .attr('tabIndex', -1).css('outline', 0).keydown(function(event) { + if (options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + self.close(event); + event.preventDefault(); + } + }) + .attr({ + role: 'dialog', + 'aria-labelledby': titleId + }) + .mousedown(function(event) { + self.moveToTop(false, event); + }), + + uiDialogContent = self.element + .show() + .removeAttr('title') + .addClass( + 'ui-dialog-content ' + + 'ui-widget-content') + .appendTo(uiDialog), + + uiDialogTitlebar = (self.uiDialogTitlebar = $('
')) + .addClass( + 'ui-dialog-titlebar ' + + 'ui-widget-header ' + + 'ui-corner-all ' + + 'ui-helper-clearfix' + ) + .prependTo(uiDialog), + + uiDialogTitlebarClose = $('') + .addClass( + 'ui-dialog-titlebar-close ' + + 'ui-corner-all' + ) + .attr('role', 'button') + .hover( + function() { + uiDialogTitlebarClose.addClass('ui-state-hover'); + }, + function() { + uiDialogTitlebarClose.removeClass('ui-state-hover'); + } + ) + .focus(function() { + uiDialogTitlebarClose.addClass('ui-state-focus'); + }) + .blur(function() { + uiDialogTitlebarClose.removeClass('ui-state-focus'); + }) + .click(function(event) { + self.close(event); + return false; + }) + .appendTo(uiDialogTitlebar), + + uiDialogTitlebarCloseText = (self.uiDialogTitlebarCloseText = $('')) + .addClass( + 'ui-icon ' + + 'ui-icon-closethick' + ) + .text(options.closeText) + .appendTo(uiDialogTitlebarClose), + + uiDialogTitle = $('') + .addClass('ui-dialog-title') + .attr('id', titleId) + .html(title) + .prependTo(uiDialogTitlebar); + + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + if ($.isFunction(options.beforeclose) && !$.isFunction(options.beforeClose)) { + options.beforeClose = options.beforeclose; + } + + uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection(); + + if (options.draggable && $.fn.draggable) { + self._makeDraggable(); + } + if (options.resizable && $.fn.resizable) { + self._makeResizable(); + } + + self._createButtons(options.buttons); + self._isOpen = false; + + if ($.fn.bgiframe) { + uiDialog.bgiframe(); + } + }, + + _init: function() { + if ( this.options.autoOpen ) { + this.open(); + } + }, + + destroy: function() { + var self = this; + + if (self.overlay) { + self.overlay.destroy(); + } + self.uiDialog.hide(); + self.element + .unbind('.dialog') + .removeData('dialog') + .removeClass('ui-dialog-content ui-widget-content') + .hide().appendTo('body'); + self.uiDialog.remove(); + + if (self.originalTitle) { + self.element.attr('title', self.originalTitle); + } + + return self; + }, + + widget: function() { + return this.uiDialog; + }, + + close: function(event) { + var self = this, + maxZ, thisZ; + + if (false === self._trigger('beforeClose', event)) { + return; + } + + if (self.overlay) { + self.overlay.destroy(); + } + self.uiDialog.unbind('keypress.ui-dialog'); + + self._isOpen = false; + + if (self.options.hide) { + self.uiDialog.hide(self.options.hide, function() { + self._trigger('close', event); + }); + } else { + self.uiDialog.hide(); + self._trigger('close', event); + } + + $.ui.dialog.overlay.resize(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + if (self.options.modal) { + maxZ = 0; + $('.ui-dialog').each(function() { + if (this !== self.uiDialog[0]) { + thisZ = $(this).css('z-index'); + if(!isNaN(thisZ)) { + maxZ = Math.max(maxZ, thisZ); + } + } + }); + $.ui.dialog.maxZ = maxZ; + } + + return self; + }, + + isOpen: function() { + return this._isOpen; + }, + + // the force parameter allows us to move modal dialogs to their correct + // position on open + moveToTop: function(force, event) { + var self = this, + options = self.options, + saveScroll; + + if ((options.modal && !force) || + (!options.stack && !options.modal)) { + return self._trigger('focus', event); + } + + if (options.zIndex > $.ui.dialog.maxZ) { + $.ui.dialog.maxZ = options.zIndex; + } + if (self.overlay) { + $.ui.dialog.maxZ += 1; + self.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = $.ui.dialog.maxZ); + } + + //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed. + // http://ui.jquery.com/bugs/ticket/3193 + saveScroll = { scrollTop: self.element.scrollTop(), scrollLeft: self.element.scrollLeft() }; + $.ui.dialog.maxZ += 1; + self.uiDialog.css('z-index', $.ui.dialog.maxZ); + self.element.attr(saveScroll); + self._trigger('focus', event); + + return self; + }, + + open: function() { + if (this._isOpen) { return; } + + var self = this, + options = self.options, + uiDialog = self.uiDialog; + + self.overlay = options.modal ? new $.ui.dialog.overlay(self) : null; + self._size(); + self._position(options.position); + uiDialog.show(options.show); + self.moveToTop(true); + + // prevent tabbing out of modal dialogs + if ( options.modal ) { + uiDialog.bind( "keydown.ui-dialog", function( event ) { + if ( event.keyCode !== $.ui.keyCode.TAB ) { + return; + } + + var tabbables = $(':tabbable', this), + first = tabbables.filter(':first'), + last = tabbables.filter(':last'); + + if (event.target === last[0] && !event.shiftKey) { + first.focus(1); + return false; + } else if (event.target === first[0] && event.shiftKey) { + last.focus(1); + return false; + } + }); + } + + // set focus to the first tabbable element in the content area or the first button + // if there are no tabbable elements, set focus on the dialog itself + $(self.element.find(':tabbable').get().concat( + uiDialog.find('.ui-dialog-buttonpane :tabbable').get().concat( + uiDialog.get()))).eq(0).focus(); + + self._isOpen = true; + self._trigger('open'); + + return self; + }, + + _createButtons: function(buttons) { + var self = this, + hasButtons = false, + uiDialogButtonPane = $('
') + .addClass( + 'ui-dialog-buttonpane ' + + 'ui-widget-content ' + + 'ui-helper-clearfix' + ), + uiButtonSet = $( "
" ) + .addClass( "ui-dialog-buttonset" ) + .appendTo( uiDialogButtonPane ); + + // if we already have a button pane, remove it + self.uiDialog.find('.ui-dialog-buttonpane').remove(); + + if (typeof buttons === 'object' && buttons !== null) { + $.each(buttons, function() { + return !(hasButtons = true); + }); + } + if (hasButtons) { + $.each(buttons, function(name, props) { + props = $.isFunction( props ) ? + { click: props, text: name } : + props; + var button = $('') + .click(function() { + props.click.apply(self.element[0], arguments); + }) + .appendTo(uiButtonSet); + // can't use .attr( props, true ) with jQuery 1.3.2. + $.each( props, function( key, value ) { + if ( key === "click" ) { + return; + } + if ( key in button ) { + button[ key ]( value ); + } else { + button.attr( key, value ); + } + }); + if ($.fn.button) { + button.button(); + } + }); + uiDialogButtonPane.appendTo(self.uiDialog); + } + }, + + _makeDraggable: function() { + var self = this, + options = self.options, + doc = $(document), + heightBeforeDrag; + + function filteredUi(ui) { + return { + position: ui.position, + offset: ui.offset + }; + } + + self.uiDialog.draggable({ + cancel: '.ui-dialog-content, .ui-dialog-titlebar-close', + handle: '.ui-dialog-titlebar', + containment: 'document', + start: function(event, ui) { + heightBeforeDrag = options.height === "auto" ? "auto" : $(this).height(); + $(this).height($(this).height()).addClass("ui-dialog-dragging"); + self._trigger('dragStart', event, filteredUi(ui)); + }, + drag: function(event, ui) { + self._trigger('drag', event, filteredUi(ui)); + }, + stop: function(event, ui) { + options.position = [ui.position.left - doc.scrollLeft(), + ui.position.top - doc.scrollTop()]; + $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag); + self._trigger('dragStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }); + }, + + _makeResizable: function(handles) { + handles = (handles === undefined ? this.options.resizable : handles); + var self = this, + options = self.options, + // .ui-resizable has position: relative defined in the stylesheet + // but dialogs have to use absolute or fixed positioning + position = self.uiDialog.css('position'), + resizeHandles = (typeof handles === 'string' ? + handles : + 'n,e,s,w,se,sw,ne,nw' + ); + + function filteredUi(ui) { + return { + originalPosition: ui.originalPosition, + originalSize: ui.originalSize, + position: ui.position, + size: ui.size + }; + } + + self.uiDialog.resizable({ + cancel: '.ui-dialog-content', + containment: 'document', + alsoResize: self.element, + maxWidth: options.maxWidth, + maxHeight: options.maxHeight, + minWidth: options.minWidth, + minHeight: self._minHeight(), + handles: resizeHandles, + start: function(event, ui) { + $(this).addClass("ui-dialog-resizing"); + self._trigger('resizeStart', event, filteredUi(ui)); + }, + resize: function(event, ui) { + self._trigger('resize', event, filteredUi(ui)); + }, + stop: function(event, ui) { + $(this).removeClass("ui-dialog-resizing"); + options.height = $(this).height(); + options.width = $(this).width(); + self._trigger('resizeStop', event, filteredUi(ui)); + $.ui.dialog.overlay.resize(); + } + }) + .css('position', position) + .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se'); + }, + + _minHeight: function() { + var options = this.options; + + if (options.height === 'auto') { + return options.minHeight; + } else { + return Math.min(options.minHeight, options.height); + } + }, + + _position: function(position) { + var myAt = [], + offset = [0, 0], + isVisible; + + if (position) { + // deep extending converts arrays to objects in jQuery <= 1.3.2 :-( + // if (typeof position == 'string' || $.isArray(position)) { + // myAt = $.isArray(position) ? position : position.split(' '); + + if (typeof position === 'string' || (typeof position === 'object' && '0' in position)) { + myAt = position.split ? position.split(' ') : [position[0], position[1]]; + if (myAt.length === 1) { + myAt[1] = myAt[0]; + } + + $.each(['left', 'top'], function(i, offsetPosition) { + if (+myAt[i] === myAt[i]) { + offset[i] = myAt[i]; + myAt[i] = offsetPosition; + } + }); + + position = { + my: myAt.join(" "), + at: myAt.join(" "), + offset: offset.join(" ") + }; + } + + position = $.extend({}, $.ui.dialog.prototype.options.position, position); + } else { + position = $.ui.dialog.prototype.options.position; + } + + // need to show the dialog to get the actual offset in the position plugin + isVisible = this.uiDialog.is(':visible'); + if (!isVisible) { + this.uiDialog.show(); + } + this.uiDialog + // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781 + .css({ top: 0, left: 0 }) + .position($.extend({ of: window }, position)); + if (!isVisible) { + this.uiDialog.hide(); + } + }, + + _setOptions: function( options ) { + var self = this, + resizableOptions = {}, + resize = false; + + $.each( options, function( key, value ) { + self._setOption( key, value ); + + if ( key in sizeRelatedOptions ) { + resize = true; + } + if ( key in resizableRelatedOptions ) { + resizableOptions[ key ] = value; + } + }); + + if ( resize ) { + this._size(); + } + if ( this.uiDialog.is( ":data(resizable)" ) ) { + this.uiDialog.resizable( "option", resizableOptions ); + } + }, + + _setOption: function(key, value){ + var self = this, + uiDialog = self.uiDialog; + + switch (key) { + //handling of deprecated beforeclose (vs beforeClose) option + //Ticket #4669 http://dev.jqueryui.com/ticket/4669 + //TODO: remove in 1.9pre + case "beforeclose": + key = "beforeClose"; + break; + case "buttons": + self._createButtons(value); + break; + case "closeText": + // ensure that we always pass a string + self.uiDialogTitlebarCloseText.text("" + value); + break; + case "dialogClass": + uiDialog + .removeClass(self.options.dialogClass) + .addClass(uiDialogClasses + value); + break; + case "disabled": + if (value) { + uiDialog.addClass('ui-dialog-disabled'); + } else { + uiDialog.removeClass('ui-dialog-disabled'); + } + break; + case "draggable": + var isDraggable = uiDialog.is( ":data(draggable)" ); + if ( isDraggable && !value ) { + uiDialog.draggable( "destroy" ); + } + + if ( !isDraggable && value ) { + self._makeDraggable(); + } + break; + case "position": + self._position(value); + break; + case "resizable": + // currently resizable, becoming non-resizable + var isResizable = uiDialog.is( ":data(resizable)" ); + if (isResizable && !value) { + uiDialog.resizable('destroy'); + } + + // currently resizable, changing handles + if (isResizable && typeof value === 'string') { + uiDialog.resizable('option', 'handles', value); + } + + // currently non-resizable, becoming resizable + if (!isResizable && value !== false) { + self._makeResizable(value); + } + break; + case "title": + // convert whatever was passed in o a string, for html() to not throw up + $(".ui-dialog-title", self.uiDialogTitlebar).html("" + (value || ' ')); + break; + } + + $.Widget.prototype._setOption.apply(self, arguments); + }, + + _size: function() { + /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content + * divs will both have width and height set, so we need to reset them + */ + var options = this.options, + nonContentHeight, + minContentHeight, + isVisible = this.uiDialog.is( ":visible" ); + + // reset content sizing + this.element.show().css({ + width: 'auto', + minHeight: 0, + height: 0 + }); + + if (options.minWidth > options.width) { + options.width = options.minWidth; + } + + // reset wrapper sizing + // determine the height of all the non-content elements + nonContentHeight = this.uiDialog.css({ + height: 'auto', + width: options.width + }) + .height(); + minContentHeight = Math.max( 0, options.minHeight - nonContentHeight ); + + if ( options.height === "auto" ) { + // only needed for IE6 support + if ( $.support.minHeight ) { + this.element.css({ + minHeight: minContentHeight, + height: "auto" + }); + } else { + this.uiDialog.show(); + var autoHeight = this.element.css( "height", "auto" ).height(); + if ( !isVisible ) { + this.uiDialog.hide(); + } + this.element.height( Math.max( autoHeight, minContentHeight ) ); + } + } else { + this.element.height( Math.max( options.height - nonContentHeight, 0 ) ); + } + + if (this.uiDialog.is(':data(resizable)')) { + this.uiDialog.resizable('option', 'minHeight', this._minHeight()); + } + } +}); + +$.extend($.ui.dialog, { + version: "1.8.24", + + uuid: 0, + maxZ: 0, + + getTitleId: function($el) { + var id = $el.attr('id'); + if (!id) { + this.uuid += 1; + id = this.uuid; + } + return 'ui-dialog-title-' + id; + }, + + overlay: function(dialog) { + this.$el = $.ui.dialog.overlay.create(dialog); + } +}); + +$.extend($.ui.dialog.overlay, { + instances: [], + // reuse old instances due to IE memory leak with alpha transparency (see #5185) + oldInstances: [], + maxZ: 0, + events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','), + function(event) { return event + '.dialog-overlay'; }).join(' '), + create: function(dialog) { + if (this.instances.length === 0) { + // prevent use of anchors and inputs + // we use a setTimeout in case the overlay is created from an + // event that we're going to be cancelling (see #2804) + setTimeout(function() { + // handle $(el).dialog().dialog('close') (see #4065) + if ($.ui.dialog.overlay.instances.length) { + $(document).bind($.ui.dialog.overlay.events, function(event) { + // stop events if the z-index of the target is < the z-index of the overlay + // we cannot return true when we don't want to cancel the event (#3523) + if ($(event.target).zIndex() < $.ui.dialog.overlay.maxZ) { + return false; + } + }); + } + }, 1); + + // allow closing by pressing the escape key + $(document).bind('keydown.dialog-overlay', function(event) { + if (dialog.options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE) { + + dialog.close(event); + event.preventDefault(); + } + }); + + // handle window resize + $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize); + } + + var $el = (this.oldInstances.pop() || $('
').addClass('ui-widget-overlay')) + .appendTo(document.body) + .css({ + width: this.width(), + height: this.height() + }); + + if ($.fn.bgiframe) { + $el.bgiframe(); + } + + this.instances.push($el); + return $el; + }, + + destroy: function($el) { + var indexOf = $.inArray($el, this.instances); + if (indexOf != -1){ + this.oldInstances.push(this.instances.splice(indexOf, 1)[0]); + } + + if (this.instances.length === 0) { + $([document, window]).unbind('.dialog-overlay'); + } + + $el.remove(); + + // adjust the maxZ to allow other modal dialogs to continue to work (see #4309) + var maxZ = 0; + $.each(this.instances, function() { + maxZ = Math.max(maxZ, this.css('z-index')); + }); + this.maxZ = maxZ; + }, + + height: function() { + var scrollHeight, + offsetHeight; + // handle IE 6 + if ($.browser.msie && $.browser.version < 7) { + scrollHeight = Math.max( + document.documentElement.scrollHeight, + document.body.scrollHeight + ); + offsetHeight = Math.max( + document.documentElement.offsetHeight, + document.body.offsetHeight + ); + + if (scrollHeight < offsetHeight) { + return $(window).height() + 'px'; + } else { + return scrollHeight + 'px'; + } + // handle "good" browsers + } else { + return $(document).height() + 'px'; + } + }, + + width: function() { + var scrollWidth, + offsetWidth; + // handle IE + if ( $.browser.msie ) { + scrollWidth = Math.max( + document.documentElement.scrollWidth, + document.body.scrollWidth + ); + offsetWidth = Math.max( + document.documentElement.offsetWidth, + document.body.offsetWidth + ); + + if (scrollWidth < offsetWidth) { + return $(window).width() + 'px'; + } else { + return scrollWidth + 'px'; + } + // handle "good" browsers + } else { + return $(document).width() + 'px'; + } + }, + + resize: function() { + /* If the dialog is draggable and the user drags it past the + * right edge of the window, the document becomes wider so we + * need to stretch the overlay. If the user then drags the + * dialog back to the left, the document will become narrower, + * so we need to shrink the overlay to the appropriate size. + * This is handled by shrinking the overlay before setting it + * to the full document size. + */ + var $overlays = $([]); + $.each($.ui.dialog.overlay.instances, function() { + $overlays = $overlays.add(this); + }); + + $overlays.css({ + width: 0, + height: 0 + }).css({ + width: $.ui.dialog.overlay.width(), + height: $.ui.dialog.overlay.height() + }); + } +}); + +$.extend($.ui.dialog.overlay.prototype, { + destroy: function() { + $.ui.dialog.overlay.destroy(this.$el); + } +}); + +}(jQuery)); + +(function( $, undefined ) { + +$.ui = $.ui || {}; + +var horizontalPositions = /left|center|right/, + verticalPositions = /top|center|bottom/, + center = "center", + support = {}, + _position = $.fn.position, + _offset = $.fn.offset; + +$.fn.position = function( options ) { + if ( !options || !options.of ) { + return _position.apply( this, arguments ); + } + + // make a copy, we don't want to modify arguments + options = $.extend( {}, options ); + + var target = $( options.of ), + targetElem = target[0], + collision = ( options.collision || "flip" ).split( " " ), + offset = options.offset ? options.offset.split( " " ) : [ 0, 0 ], + targetWidth, + targetHeight, + basePosition; + + if ( targetElem.nodeType === 9 ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: 0, left: 0 }; + // TODO: use $.isWindow() in 1.9 + } else if ( targetElem.setTimeout ) { + targetWidth = target.width(); + targetHeight = target.height(); + basePosition = { top: target.scrollTop(), left: target.scrollLeft() }; + } else if ( targetElem.preventDefault ) { + // force left top to allow flipping + options.at = "left top"; + targetWidth = targetHeight = 0; + basePosition = { top: options.of.pageY, left: options.of.pageX }; + } else { + targetWidth = target.outerWidth(); + targetHeight = target.outerHeight(); + basePosition = target.offset(); + } + + // force my and at to have valid horizontal and veritcal positions + // if a value is missing or invalid, it will be converted to center + $.each( [ "my", "at" ], function() { + var pos = ( options[this] || "" ).split( " " ); + if ( pos.length === 1) { + pos = horizontalPositions.test( pos[0] ) ? + pos.concat( [center] ) : + verticalPositions.test( pos[0] ) ? + [ center ].concat( pos ) : + [ center, center ]; + } + pos[ 0 ] = horizontalPositions.test( pos[0] ) ? pos[ 0 ] : center; + pos[ 1 ] = verticalPositions.test( pos[1] ) ? pos[ 1 ] : center; + options[ this ] = pos; + }); + + // normalize collision option + if ( collision.length === 1 ) { + collision[ 1 ] = collision[ 0 ]; + } + + // normalize offset option + offset[ 0 ] = parseInt( offset[0], 10 ) || 0; + if ( offset.length === 1 ) { + offset[ 1 ] = offset[ 0 ]; + } + offset[ 1 ] = parseInt( offset[1], 10 ) || 0; + + if ( options.at[0] === "right" ) { + basePosition.left += targetWidth; + } else if ( options.at[0] === center ) { + basePosition.left += targetWidth / 2; + } + + if ( options.at[1] === "bottom" ) { + basePosition.top += targetHeight; + } else if ( options.at[1] === center ) { + basePosition.top += targetHeight / 2; + } + + basePosition.left += offset[ 0 ]; + basePosition.top += offset[ 1 ]; + + return this.each(function() { + var elem = $( this ), + elemWidth = elem.outerWidth(), + elemHeight = elem.outerHeight(), + marginLeft = parseInt( $.curCSS( this, "marginLeft", true ) ) || 0, + marginTop = parseInt( $.curCSS( this, "marginTop", true ) ) || 0, + collisionWidth = elemWidth + marginLeft + + ( parseInt( $.curCSS( this, "marginRight", true ) ) || 0 ), + collisionHeight = elemHeight + marginTop + + ( parseInt( $.curCSS( this, "marginBottom", true ) ) || 0 ), + position = $.extend( {}, basePosition ), + collisionPosition; + + if ( options.my[0] === "right" ) { + position.left -= elemWidth; + } else if ( options.my[0] === center ) { + position.left -= elemWidth / 2; + } + + if ( options.my[1] === "bottom" ) { + position.top -= elemHeight; + } else if ( options.my[1] === center ) { + position.top -= elemHeight / 2; + } + + // prevent fractions if jQuery version doesn't support them (see #5280) + if ( !support.fractions ) { + position.left = Math.round( position.left ); + position.top = Math.round( position.top ); + } + + collisionPosition = { + left: position.left - marginLeft, + top: position.top - marginTop + }; + + $.each( [ "left", "top" ], function( i, dir ) { + if ( $.ui.position[ collision[i] ] ) { + $.ui.position[ collision[i] ][ dir ]( position, { + targetWidth: targetWidth, + targetHeight: targetHeight, + elemWidth: elemWidth, + elemHeight: elemHeight, + collisionPosition: collisionPosition, + collisionWidth: collisionWidth, + collisionHeight: collisionHeight, + offset: offset, + my: options.my, + at: options.at + }); + } + }); + + if ( $.fn.bgiframe ) { + elem.bgiframe(); + } + elem.offset( $.extend( position, { using: options.using } ) ); + }); +}; + +$.ui.position = { + fit: { + left: function( position, data ) { + var win = $( window ), + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(); + position.left = over > 0 ? position.left - over : Math.max( position.left - data.collisionPosition.left, position.left ); + }, + top: function( position, data ) { + var win = $( window ), + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(); + position.top = over > 0 ? position.top - over : Math.max( position.top - data.collisionPosition.top, position.top ); + } + }, + + flip: { + left: function( position, data ) { + if ( data.at[0] === center ) { + return; + } + var win = $( window ), + over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(), + myOffset = data.my[ 0 ] === "left" ? + -data.elemWidth : + data.my[ 0 ] === "right" ? + data.elemWidth : + 0, + atOffset = data.at[ 0 ] === "left" ? + data.targetWidth : + -data.targetWidth, + offset = -2 * data.offset[ 0 ]; + position.left += data.collisionPosition.left < 0 ? + myOffset + atOffset + offset : + over > 0 ? + myOffset + atOffset + offset : + 0; + }, + top: function( position, data ) { + if ( data.at[1] === center ) { + return; + } + var win = $( window ), + over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(), + myOffset = data.my[ 1 ] === "top" ? + -data.elemHeight : + data.my[ 1 ] === "bottom" ? + data.elemHeight : + 0, + atOffset = data.at[ 1 ] === "top" ? + data.targetHeight : + -data.targetHeight, + offset = -2 * data.offset[ 1 ]; + position.top += data.collisionPosition.top < 0 ? + myOffset + atOffset + offset : + over > 0 ? + myOffset + atOffset + offset : + 0; + } + } +}; + +// offset setter from jQuery 1.4 +if ( !$.offset.setOffset ) { + $.offset.setOffset = function( elem, options ) { + // set position first, in-case top/left are set even on static elem + if ( /static/.test( $.curCSS( elem, "position" ) ) ) { + elem.style.position = "relative"; + } + var curElem = $( elem ), + curOffset = curElem.offset(), + curTop = parseInt( $.curCSS( elem, "top", true ), 10 ) || 0, + curLeft = parseInt( $.curCSS( elem, "left", true ), 10) || 0, + props = { + top: (options.top - curOffset.top) + curTop, + left: (options.left - curOffset.left) + curLeft + }; + + if ( 'using' in options ) { + options.using.call( elem, props ); + } else { + curElem.css( props ); + } + }; + + $.fn.offset = function( options ) { + var elem = this[ 0 ]; + if ( !elem || !elem.ownerDocument ) { return null; } + if ( options ) { + if ( $.isFunction( options ) ) { + return this.each(function( i ) { + $( this ).offset( options.call( this, i, $( this ).offset() ) ); + }); + } + return this.each(function() { + $.offset.setOffset( this, options ); + }); + } + return _offset.call( this ); + }; +} + +// jQuery <1.4.3 uses curCSS, in 1.4.3 - 1.7.2 curCSS = css, 1.8+ only has css +if ( !$.curCSS ) { + $.curCSS = $.css; +} + +// fraction support test (older versions of jQuery don't support fractions) +(function () { + var body = document.getElementsByTagName( "body" )[ 0 ], + div = document.createElement( "div" ), + testElement, testElementParent, testElementStyle, offset, offsetTotal; + + //Create a "fake body" for testing based on method used in jQuery.support + testElement = document.createElement( body ? "div" : "body" ); + testElementStyle = { + visibility: "hidden", + width: 0, + height: 0, + border: 0, + margin: 0, + background: "none" + }; + if ( body ) { + $.extend( testElementStyle, { + position: "absolute", + left: "-1000px", + top: "-1000px" + }); + } + for ( var i in testElementStyle ) { + testElement.style[ i ] = testElementStyle[ i ]; + } + testElement.appendChild( div ); + testElementParent = body || document.documentElement; + testElementParent.insertBefore( testElement, testElementParent.firstChild ); + + div.style.cssText = "position: absolute; left: 10.7432222px; top: 10.432325px; height: 30px; width: 201px;"; + + offset = $( div ).offset( function( _, offset ) { + return offset; + }).offset(); + + testElement.innerHTML = ""; + testElementParent.removeChild( testElement ); + + offsetTotal = offset.top + offset.left + ( body ? 2000 : 0 ); + support.fractions = offsetTotal > 21 && offsetTotal < 22; +})(); + +}( jQuery )); + +(function( $, undefined ) { + +$.widget( "ui.progressbar", { + options: { + value: 0, + max: 100 + }, + + min: 0, + + _create: function() { + this.element + .addClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) + .attr({ + role: "progressbar", + "aria-valuemin": this.min, + "aria-valuemax": this.options.max, + "aria-valuenow": this._value() + }); + + this.valueDiv = $( "
" ) + .appendTo( this.element ); + + this.oldValue = this._value(); + this._refreshValue(); + }, + + destroy: function() { + this.element + .removeClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) + .removeAttr( "role" ) + .removeAttr( "aria-valuemin" ) + .removeAttr( "aria-valuemax" ) + .removeAttr( "aria-valuenow" ); + + this.valueDiv.remove(); + + $.Widget.prototype.destroy.apply( this, arguments ); + }, + + value: function( newValue ) { + if ( newValue === undefined ) { + return this._value(); + } + + this._setOption( "value", newValue ); + return this; + }, + + _setOption: function( key, value ) { + if ( key === "value" ) { + this.options.value = value; + this._refreshValue(); + if ( this._value() === this.options.max ) { + this._trigger( "complete" ); + } + } + + $.Widget.prototype._setOption.apply( this, arguments ); + }, + + _value: function() { + var val = this.options.value; + // normalize invalid value + if ( typeof val !== "number" ) { + val = 0; + } + return Math.min( this.options.max, Math.max( this.min, val ) ); + }, + + _percentage: function() { + return 100 * this._value() / this.options.max; + }, + + _refreshValue: function() { + var value = this.value(); + var percentage = this._percentage(); + + if ( this.oldValue !== value ) { + this.oldValue = value; + this._trigger( "change" ); + } + + this.valueDiv + .toggle( value > this.min ) + .toggleClass( "ui-corner-right", value === this.options.max ) + .width( percentage.toFixed(0) + "%" ); + this.element.attr( "aria-valuenow", value ); + } +}); + +$.extend( $.ui.progressbar, { + version: "1.8.24" +}); + +})( jQuery ); + +(function( $, undefined ) { + +// number of pages in a slider +// (how many times can you page up/down to go through the whole range) +var numPages = 5; + +$.widget( "ui.slider", $.ui.mouse, { + + widgetEventPrefix: "slide", + + options: { + animate: false, + distance: 0, + max: 100, + min: 0, + orientation: "horizontal", + range: false, + step: 1, + value: 0, + values: null + }, + + _create: function() { + var self = this, + o = this.options, + existingHandles = this.element.find( ".ui-slider-handle" ).addClass( "ui-state-default ui-corner-all" ), + handle = "", + handleCount = ( o.values && o.values.length ) || 1, + handles = []; + + this._keySliding = false; + this._mouseSliding = false; + this._animateOff = true; + this._handleIndex = null; + this._detectOrientation(); + this._mouseInit(); + + this.element + .addClass( "ui-slider" + + " ui-slider-" + this.orientation + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" + + ( o.disabled ? " ui-slider-disabled ui-disabled" : "" ) ); + + this.range = $([]); + + if ( o.range ) { + if ( o.range === true ) { + if ( !o.values ) { + o.values = [ this._valueMin(), this._valueMin() ]; + } + if ( o.values.length && o.values.length !== 2 ) { + o.values = [ o.values[0], o.values[0] ]; + } + } + + this.range = $( "
" ) + .appendTo( this.element ) + .addClass( "ui-slider-range" + + // note: this isn't the most fittingly semantic framework class for this element, + // but worked best visually with a variety of themes + " ui-widget-header" + + ( ( o.range === "min" || o.range === "max" ) ? " ui-slider-range-" + o.range : "" ) ); + } + + for ( var i = existingHandles.length; i < handleCount; i += 1 ) { + handles.push( handle ); + } + + this.handles = existingHandles.add( $( handles.join( "" ) ).appendTo( self.element ) ); + + this.handle = this.handles.eq( 0 ); + + this.handles.add( this.range ).filter( "a" ) + .click(function( event ) { + event.preventDefault(); + }) + .hover(function() { + if ( !o.disabled ) { + $( this ).addClass( "ui-state-hover" ); + } + }, function() { + $( this ).removeClass( "ui-state-hover" ); + }) + .focus(function() { + if ( !o.disabled ) { + $( ".ui-slider .ui-state-focus" ).removeClass( "ui-state-focus" ); + $( this ).addClass( "ui-state-focus" ); + } else { + $( this ).blur(); + } + }) + .blur(function() { + $( this ).removeClass( "ui-state-focus" ); + }); + + this.handles.each(function( i ) { + $( this ).data( "index.ui-slider-handle", i ); + }); + + this.handles + .keydown(function( event ) { + var index = $( this ).data( "index.ui-slider-handle" ), + allowed, + curVal, + newVal, + step; + + if ( self.options.disabled ) { + return; + } + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + case $.ui.keyCode.END: + case $.ui.keyCode.PAGE_UP: + case $.ui.keyCode.PAGE_DOWN: + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + event.preventDefault(); + if ( !self._keySliding ) { + self._keySliding = true; + $( this ).addClass( "ui-state-active" ); + allowed = self._start( event, index ); + if ( allowed === false ) { + return; + } + } + break; + } + + step = self.options.step; + if ( self.options.values && self.options.values.length ) { + curVal = newVal = self.values( index ); + } else { + curVal = newVal = self.value(); + } + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + newVal = self._valueMin(); + break; + case $.ui.keyCode.END: + newVal = self._valueMax(); + break; + case $.ui.keyCode.PAGE_UP: + newVal = self._trimAlignValue( curVal + ( (self._valueMax() - self._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.PAGE_DOWN: + newVal = self._trimAlignValue( curVal - ( (self._valueMax() - self._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + if ( curVal === self._valueMax() ) { + return; + } + newVal = self._trimAlignValue( curVal + step ); + break; + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + if ( curVal === self._valueMin() ) { + return; + } + newVal = self._trimAlignValue( curVal - step ); + break; + } + + self._slide( event, index, newVal ); + }) + .keyup(function( event ) { + var index = $( this ).data( "index.ui-slider-handle" ); + + if ( self._keySliding ) { + self._keySliding = false; + self._stop( event, index ); + self._change( event, index ); + $( this ).removeClass( "ui-state-active" ); + } + + }); + + this._refreshValue(); + + this._animateOff = false; + }, + + destroy: function() { + this.handles.remove(); + this.range.remove(); + + this.element + .removeClass( "ui-slider" + + " ui-slider-horizontal" + + " ui-slider-vertical" + + " ui-slider-disabled" + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" ) + .removeData( "slider" ) + .unbind( ".slider" ); + + this._mouseDestroy(); + + return this; + }, + + _mouseCapture: function( event ) { + var o = this.options, + position, + normValue, + distance, + closestHandle, + self, + index, + allowed, + offset, + mouseOverHandle; + + if ( o.disabled ) { + return false; + } + + this.elementSize = { + width: this.element.outerWidth(), + height: this.element.outerHeight() + }; + this.elementOffset = this.element.offset(); + + position = { x: event.pageX, y: event.pageY }; + normValue = this._normValueFromMouse( position ); + distance = this._valueMax() - this._valueMin() + 1; + self = this; + this.handles.each(function( i ) { + var thisDistance = Math.abs( normValue - self.values(i) ); + if ( distance > thisDistance ) { + distance = thisDistance; + closestHandle = $( this ); + index = i; + } + }); + + // workaround for bug #3736 (if both handles of a range are at 0, + // the first is always used as the one with least distance, + // and moving it is obviously prevented by preventing negative ranges) + if( o.range === true && this.values(1) === o.min ) { + index += 1; + closestHandle = $( this.handles[index] ); + } + + allowed = this._start( event, index ); + if ( allowed === false ) { + return false; + } + this._mouseSliding = true; + + self._handleIndex = index; + + closestHandle + .addClass( "ui-state-active" ) + .focus(); + + offset = closestHandle.offset(); + mouseOverHandle = !$( event.target ).parents().andSelf().is( ".ui-slider-handle" ); + this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : { + left: event.pageX - offset.left - ( closestHandle.width() / 2 ), + top: event.pageY - offset.top - + ( closestHandle.height() / 2 ) - + ( parseInt( closestHandle.css("borderTopWidth"), 10 ) || 0 ) - + ( parseInt( closestHandle.css("borderBottomWidth"), 10 ) || 0) + + ( parseInt( closestHandle.css("marginTop"), 10 ) || 0) + }; + + if ( !this.handles.hasClass( "ui-state-hover" ) ) { + this._slide( event, index, normValue ); + } + this._animateOff = true; + return true; + }, + + _mouseStart: function( event ) { + return true; + }, + + _mouseDrag: function( event ) { + var position = { x: event.pageX, y: event.pageY }, + normValue = this._normValueFromMouse( position ); + + this._slide( event, this._handleIndex, normValue ); + + return false; + }, + + _mouseStop: function( event ) { + this.handles.removeClass( "ui-state-active" ); + this._mouseSliding = false; + + this._stop( event, this._handleIndex ); + this._change( event, this._handleIndex ); + + this._handleIndex = null; + this._clickOffset = null; + this._animateOff = false; + + return false; + }, + + _detectOrientation: function() { + this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal"; + }, + + _normValueFromMouse: function( position ) { + var pixelTotal, + pixelMouse, + percentMouse, + valueTotal, + valueMouse; + + if ( this.orientation === "horizontal" ) { + pixelTotal = this.elementSize.width; + pixelMouse = position.x - this.elementOffset.left - ( this._clickOffset ? this._clickOffset.left : 0 ); + } else { + pixelTotal = this.elementSize.height; + pixelMouse = position.y - this.elementOffset.top - ( this._clickOffset ? this._clickOffset.top : 0 ); + } + + percentMouse = ( pixelMouse / pixelTotal ); + if ( percentMouse > 1 ) { + percentMouse = 1; + } + if ( percentMouse < 0 ) { + percentMouse = 0; + } + if ( this.orientation === "vertical" ) { + percentMouse = 1 - percentMouse; + } + + valueTotal = this._valueMax() - this._valueMin(); + valueMouse = this._valueMin() + percentMouse * valueTotal; + + return this._trimAlignValue( valueMouse ); + }, + + _start: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + return this._trigger( "start", event, uiHash ); + }, + + _slide: function( event, index, newVal ) { + var otherVal, + newValues, + allowed; + + if ( this.options.values && this.options.values.length ) { + otherVal = this.values( index ? 0 : 1 ); + + if ( ( this.options.values.length === 2 && this.options.range === true ) && + ( ( index === 0 && newVal > otherVal) || ( index === 1 && newVal < otherVal ) ) + ) { + newVal = otherVal; + } + + if ( newVal !== this.values( index ) ) { + newValues = this.values(); + newValues[ index ] = newVal; + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal, + values: newValues + } ); + otherVal = this.values( index ? 0 : 1 ); + if ( allowed !== false ) { + this.values( index, newVal, true ); + } + } + } else { + if ( newVal !== this.value() ) { + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal + } ); + if ( allowed !== false ) { + this.value( newVal ); + } + } + } + }, + + _stop: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + + this._trigger( "stop", event, uiHash ); + }, + + _change: function( event, index ) { + if ( !this._keySliding && !this._mouseSliding ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + + this._trigger( "change", event, uiHash ); + } + }, + + value: function( newValue ) { + if ( arguments.length ) { + this.options.value = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, 0 ); + return; + } + + return this._value(); + }, + + values: function( index, newValue ) { + var vals, + newValues, + i; + + if ( arguments.length > 1 ) { + this.options.values[ index ] = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, index ); + return; + } + + if ( arguments.length ) { + if ( $.isArray( arguments[ 0 ] ) ) { + vals = this.options.values; + newValues = arguments[ 0 ]; + for ( i = 0; i < vals.length; i += 1 ) { + vals[ i ] = this._trimAlignValue( newValues[ i ] ); + this._change( null, i ); + } + this._refreshValue(); + } else { + if ( this.options.values && this.options.values.length ) { + return this._values( index ); + } else { + return this.value(); + } + } + } else { + return this._values(); + } + }, + + _setOption: function( key, value ) { + var i, + valsLength = 0; + + if ( $.isArray( this.options.values ) ) { + valsLength = this.options.values.length; + } + + $.Widget.prototype._setOption.apply( this, arguments ); + + switch ( key ) { + case "disabled": + if ( value ) { + this.handles.filter( ".ui-state-focus" ).blur(); + this.handles.removeClass( "ui-state-hover" ); + this.handles.propAttr( "disabled", true ); + this.element.addClass( "ui-disabled" ); + } else { + this.handles.propAttr( "disabled", false ); + this.element.removeClass( "ui-disabled" ); + } + break; + case "orientation": + this._detectOrientation(); + this.element + .removeClass( "ui-slider-horizontal ui-slider-vertical" ) + .addClass( "ui-slider-" + this.orientation ); + this._refreshValue(); + break; + case "value": + this._animateOff = true; + this._refreshValue(); + this._change( null, 0 ); + this._animateOff = false; + break; + case "values": + this._animateOff = true; + this._refreshValue(); + for ( i = 0; i < valsLength; i += 1 ) { + this._change( null, i ); + } + this._animateOff = false; + break; + } + }, + + //internal value getter + // _value() returns value trimmed by min and max, aligned by step + _value: function() { + var val = this.options.value; + val = this._trimAlignValue( val ); + + return val; + }, + + //internal values getter + // _values() returns array of values trimmed by min and max, aligned by step + // _values( index ) returns single value trimmed by min and max, aligned by step + _values: function( index ) { + var val, + vals, + i; + + if ( arguments.length ) { + val = this.options.values[ index ]; + val = this._trimAlignValue( val ); + + return val; + } else { + // .slice() creates a copy of the array + // this copy gets trimmed by min and max and then returned + vals = this.options.values.slice(); + for ( i = 0; i < vals.length; i+= 1) { + vals[ i ] = this._trimAlignValue( vals[ i ] ); + } + + return vals; + } + }, + + // returns the step-aligned value that val is closest to, between (inclusive) min and max + _trimAlignValue: function( val ) { + if ( val <= this._valueMin() ) { + return this._valueMin(); + } + if ( val >= this._valueMax() ) { + return this._valueMax(); + } + var step = ( this.options.step > 0 ) ? this.options.step : 1, + valModStep = (val - this._valueMin()) % step, + alignValue = val - valModStep; + + if ( Math.abs(valModStep) * 2 >= step ) { + alignValue += ( valModStep > 0 ) ? step : ( -step ); + } + + // Since JavaScript has problems with large floats, round + // the final value to 5 digits after the decimal point (see #4124) + return parseFloat( alignValue.toFixed(5) ); + }, + + _valueMin: function() { + return this.options.min; + }, + + _valueMax: function() { + return this.options.max; + }, + + _refreshValue: function() { + var oRange = this.options.range, + o = this.options, + self = this, + animate = ( !this._animateOff ) ? o.animate : false, + valPercent, + _set = {}, + lastValPercent, + value, + valueMin, + valueMax; + + if ( this.options.values && this.options.values.length ) { + this.handles.each(function( i, j ) { + valPercent = ( self.values(i) - self._valueMin() ) / ( self._valueMax() - self._valueMin() ) * 100; + _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + $( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + if ( self.options.range === true ) { + if ( self.orientation === "horizontal" ) { + if ( i === 0 ) { + self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { left: valPercent + "%" }, o.animate ); + } + if ( i === 1 ) { + self.range[ animate ? "animate" : "css" ]( { width: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } else { + if ( i === 0 ) { + self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { bottom: ( valPercent ) + "%" }, o.animate ); + } + if ( i === 1 ) { + self.range[ animate ? "animate" : "css" ]( { height: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } + } + lastValPercent = valPercent; + }); + } else { + value = this.value(); + valueMin = this._valueMin(); + valueMax = this._valueMax(); + valPercent = ( valueMax !== valueMin ) ? + ( value - valueMin ) / ( valueMax - valueMin ) * 100 : + 0; + _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + + if ( oRange === "min" && this.orientation === "horizontal" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { width: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "horizontal" ) { + this.range[ animate ? "animate" : "css" ]( { width: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + if ( oRange === "min" && this.orientation === "vertical" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { height: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "vertical" ) { + this.range[ animate ? "animate" : "css" ]( { height: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } + } + +}); + +$.extend( $.ui.slider, { + version: "1.8.24" +}); + +}(jQuery)); + +(function( $, undefined ) { + +var tabId = 0, + listId = 0; + +function getNextTabId() { + return ++tabId; +} + +function getNextListId() { + return ++listId; +} + +$.widget( "ui.tabs", { + options: { + add: null, + ajaxOptions: null, + cache: false, + cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true } + collapsible: false, + disable: null, + disabled: [], + enable: null, + event: "click", + fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 } + idPrefix: "ui-tabs-", + load: null, + panelTemplate: "
", + remove: null, + select: null, + show: null, + spinner: "Loading…", + tabTemplate: "
  • #{label}
  • " + }, + + _create: function() { + this._tabify( true ); + }, + + _setOption: function( key, value ) { + if ( key == "selected" ) { + if (this.options.collapsible && value == this.options.selected ) { + return; + } + this.select( value ); + } else { + this.options[ key ] = value; + this._tabify(); + } + }, + + _tabId: function( a ) { + return a.title && a.title.replace( /\s/g, "_" ).replace( /[^\w\u00c0-\uFFFF-]/g, "" ) || + this.options.idPrefix + getNextTabId(); + }, + + _sanitizeSelector: function( hash ) { + // we need this because an id may contain a ":" + return hash.replace( /:/g, "\\:" ); + }, + + _cookie: function() { + var cookie = this.cookie || + ( this.cookie = this.options.cookie.name || "ui-tabs-" + getNextListId() ); + return $.cookie.apply( null, [ cookie ].concat( $.makeArray( arguments ) ) ); + }, + + _ui: function( tab, panel ) { + return { + tab: tab, + panel: panel, + index: this.anchors.index( tab ) + }; + }, + + _cleanup: function() { + // restore all former loading tabs labels + this.lis.filter( ".ui-state-processing" ) + .removeClass( "ui-state-processing" ) + .find( "span:data(label.tabs)" ) + .each(function() { + var el = $( this ); + el.html( el.data( "label.tabs" ) ).removeData( "label.tabs" ); + }); + }, + + _tabify: function( init ) { + var self = this, + o = this.options, + fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash + + this.list = this.element.find( "ol,ul" ).eq( 0 ); + this.lis = $( " > li:has(a[href])", this.list ); + this.anchors = this.lis.map(function() { + return $( "a", this )[ 0 ]; + }); + this.panels = $( [] ); + + this.anchors.each(function( i, a ) { + var href = $( a ).attr( "href" ); + // For dynamically created HTML that contains a hash as href IE < 8 expands + // such href to the full page url with hash and then misinterprets tab as ajax. + // Same consideration applies for an added tab with a fragment identifier + // since a[href=#fragment-identifier] does unexpectedly not match. + // Thus normalize href attribute... + var hrefBase = href.split( "#" )[ 0 ], + baseEl; + if ( hrefBase && ( hrefBase === location.toString().split( "#" )[ 0 ] || + ( baseEl = $( "base" )[ 0 ]) && hrefBase === baseEl.href ) ) { + href = a.hash; + a.href = href; + } + + // inline tab + if ( fragmentId.test( href ) ) { + self.panels = self.panels.add( self.element.find( self._sanitizeSelector( href ) ) ); + // remote tab + // prevent loading the page itself if href is just "#" + } else if ( href && href !== "#" ) { + // required for restore on destroy + $.data( a, "href.tabs", href ); + + // TODO until #3808 is fixed strip fragment identifier from url + // (IE fails to load from such url) + $.data( a, "load.tabs", href.replace( /#.*$/, "" ) ); + + var id = self._tabId( a ); + a.href = "#" + id; + var $panel = self.element.find( "#" + id ); + if ( !$panel.length ) { + $panel = $( o.panelTemplate ) + .attr( "id", id ) + .addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ) + .insertAfter( self.panels[ i - 1 ] || self.list ); + $panel.data( "destroy.tabs", true ); + } + self.panels = self.panels.add( $panel ); + // invalid tab href + } else { + o.disabled.push( i ); + } + }); + + // initialization from scratch + if ( init ) { + // attach necessary classes for styling + this.element.addClass( "ui-tabs ui-widget ui-widget-content ui-corner-all" ); + this.list.addClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ); + this.lis.addClass( "ui-state-default ui-corner-top" ); + this.panels.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ); + + // Selected tab + // use "selected" option or try to retrieve: + // 1. from fragment identifier in url + // 2. from cookie + // 3. from selected class attribute on
  • + if ( o.selected === undefined ) { + if ( location.hash ) { + this.anchors.each(function( i, a ) { + if ( a.hash == location.hash ) { + o.selected = i; + return false; + } + }); + } + if ( typeof o.selected !== "number" && o.cookie ) { + o.selected = parseInt( self._cookie(), 10 ); + } + if ( typeof o.selected !== "number" && this.lis.filter( ".ui-tabs-selected" ).length ) { + o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) ); + } + o.selected = o.selected || ( this.lis.length ? 0 : -1 ); + } else if ( o.selected === null ) { // usage of null is deprecated, TODO remove in next release + o.selected = -1; + } + + // sanity check - default to first tab... + o.selected = ( ( o.selected >= 0 && this.anchors[ o.selected ] ) || o.selected < 0 ) + ? o.selected + : 0; + + // Take disabling tabs via class attribute from HTML + // into account and update option properly. + // A selected tab cannot become disabled. + o.disabled = $.unique( o.disabled.concat( + $.map( this.lis.filter( ".ui-state-disabled" ), function( n, i ) { + return self.lis.index( n ); + }) + ) ).sort(); + + if ( $.inArray( o.selected, o.disabled ) != -1 ) { + o.disabled.splice( $.inArray( o.selected, o.disabled ), 1 ); + } + + // highlight selected tab + this.panels.addClass( "ui-tabs-hide" ); + this.lis.removeClass( "ui-tabs-selected ui-state-active" ); + // check for length avoids error when initializing empty list + if ( o.selected >= 0 && this.anchors.length ) { + self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) ).removeClass( "ui-tabs-hide" ); + this.lis.eq( o.selected ).addClass( "ui-tabs-selected ui-state-active" ); + + // seems to be expected behavior that the show callback is fired + self.element.queue( "tabs", function() { + self._trigger( "show", null, + self._ui( self.anchors[ o.selected ], self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) )[ 0 ] ) ); + }); + + this.load( o.selected ); + } + + // clean up to avoid memory leaks in certain versions of IE 6 + // TODO: namespace this event + $( window ).bind( "unload", function() { + self.lis.add( self.anchors ).unbind( ".tabs" ); + self.lis = self.anchors = self.panels = null; + }); + // update selected after add/remove + } else { + o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) ); + } + + // update collapsible + // TODO: use .toggleClass() + this.element[ o.collapsible ? "addClass" : "removeClass" ]( "ui-tabs-collapsible" ); + + // set or update cookie after init and add/remove respectively + if ( o.cookie ) { + this._cookie( o.selected, o.cookie ); + } + + // disable tabs + for ( var i = 0, li; ( li = this.lis[ i ] ); i++ ) { + $( li )[ $.inArray( i, o.disabled ) != -1 && + // TODO: use .toggleClass() + !$( li ).hasClass( "ui-tabs-selected" ) ? "addClass" : "removeClass" ]( "ui-state-disabled" ); + } + + // reset cache if switching from cached to not cached + if ( o.cache === false ) { + this.anchors.removeData( "cache.tabs" ); + } + + // remove all handlers before, tabify may run on existing tabs after add or option change + this.lis.add( this.anchors ).unbind( ".tabs" ); + + if ( o.event !== "mouseover" ) { + var addState = function( state, el ) { + if ( el.is( ":not(.ui-state-disabled)" ) ) { + el.addClass( "ui-state-" + state ); + } + }; + var removeState = function( state, el ) { + el.removeClass( "ui-state-" + state ); + }; + this.lis.bind( "mouseover.tabs" , function() { + addState( "hover", $( this ) ); + }); + this.lis.bind( "mouseout.tabs", function() { + removeState( "hover", $( this ) ); + }); + this.anchors.bind( "focus.tabs", function() { + addState( "focus", $( this ).closest( "li" ) ); + }); + this.anchors.bind( "blur.tabs", function() { + removeState( "focus", $( this ).closest( "li" ) ); + }); + } + + // set up animations + var hideFx, showFx; + if ( o.fx ) { + if ( $.isArray( o.fx ) ) { + hideFx = o.fx[ 0 ]; + showFx = o.fx[ 1 ]; + } else { + hideFx = showFx = o.fx; + } + } + + // Reset certain styles left over from animation + // and prevent IE's ClearType bug... + function resetStyle( $el, fx ) { + $el.css( "display", "" ); + if ( !$.support.opacity && fx.opacity ) { + $el[ 0 ].style.removeAttribute( "filter" ); + } + } + + // Show a tab... + var showTab = showFx + ? function( clicked, $show ) { + $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" ); + $show.hide().removeClass( "ui-tabs-hide" ) // avoid flicker that way + .animate( showFx, showFx.duration || "normal", function() { + resetStyle( $show, showFx ); + self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) ); + }); + } + : function( clicked, $show ) { + $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" ); + $show.removeClass( "ui-tabs-hide" ); + self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) ); + }; + + // Hide a tab, $show is optional... + var hideTab = hideFx + ? function( clicked, $hide ) { + $hide.animate( hideFx, hideFx.duration || "normal", function() { + self.lis.removeClass( "ui-tabs-selected ui-state-active" ); + $hide.addClass( "ui-tabs-hide" ); + resetStyle( $hide, hideFx ); + self.element.dequeue( "tabs" ); + }); + } + : function( clicked, $hide, $show ) { + self.lis.removeClass( "ui-tabs-selected ui-state-active" ); + $hide.addClass( "ui-tabs-hide" ); + self.element.dequeue( "tabs" ); + }; + + // attach tab event handler, unbind to avoid duplicates from former tabifying... + this.anchors.bind( o.event + ".tabs", function() { + var el = this, + $li = $(el).closest( "li" ), + $hide = self.panels.filter( ":not(.ui-tabs-hide)" ), + $show = self.element.find( self._sanitizeSelector( el.hash ) ); + + // If tab is already selected and not collapsible or tab disabled or + // or is already loading or click callback returns false stop here. + // Check if click handler returns false last so that it is not executed + // for a disabled or loading tab! + if ( ( $li.hasClass( "ui-tabs-selected" ) && !o.collapsible) || + $li.hasClass( "ui-state-disabled" ) || + $li.hasClass( "ui-state-processing" ) || + self.panels.filter( ":animated" ).length || + self._trigger( "select", null, self._ui( this, $show[ 0 ] ) ) === false ) { + this.blur(); + return false; + } + + o.selected = self.anchors.index( this ); + + self.abort(); + + // if tab may be closed + if ( o.collapsible ) { + if ( $li.hasClass( "ui-tabs-selected" ) ) { + o.selected = -1; + + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + self.element.queue( "tabs", function() { + hideTab( el, $hide ); + }).dequeue( "tabs" ); + + this.blur(); + return false; + } else if ( !$hide.length ) { + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + self.element.queue( "tabs", function() { + showTab( el, $show ); + }); + + // TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171 + self.load( self.anchors.index( this ) ); + + this.blur(); + return false; + } + } + + if ( o.cookie ) { + self._cookie( o.selected, o.cookie ); + } + + // show new tab + if ( $show.length ) { + if ( $hide.length ) { + self.element.queue( "tabs", function() { + hideTab( el, $hide ); + }); + } + self.element.queue( "tabs", function() { + showTab( el, $show ); + }); + + self.load( self.anchors.index( this ) ); + } else { + throw "jQuery UI Tabs: Mismatching fragment identifier."; + } + + // Prevent IE from keeping other link focussed when using the back button + // and remove dotted border from clicked link. This is controlled via CSS + // in modern browsers; blur() removes focus from address bar in Firefox + // which can become a usability and annoying problem with tabs('rotate'). + if ( $.browser.msie ) { + this.blur(); + } + }); + + // disable click in any case + this.anchors.bind( "click.tabs", function(){ + return false; + }); + }, + + _getIndex: function( index ) { + // meta-function to give users option to provide a href string instead of a numerical index. + // also sanitizes numerical indexes to valid values. + if ( typeof index == "string" ) { + index = this.anchors.index( this.anchors.filter( "[href$='" + index + "']" ) ); + } + + return index; + }, + + destroy: function() { + var o = this.options; + + this.abort(); + + this.element + .unbind( ".tabs" ) + .removeClass( "ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible" ) + .removeData( "tabs" ); + + this.list.removeClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ); + + this.anchors.each(function() { + var href = $.data( this, "href.tabs" ); + if ( href ) { + this.href = href; + } + var $this = $( this ).unbind( ".tabs" ); + $.each( [ "href", "load", "cache" ], function( i, prefix ) { + $this.removeData( prefix + ".tabs" ); + }); + }); + + this.lis.unbind( ".tabs" ).add( this.panels ).each(function() { + if ( $.data( this, "destroy.tabs" ) ) { + $( this ).remove(); + } else { + $( this ).removeClass([ + "ui-state-default", + "ui-corner-top", + "ui-tabs-selected", + "ui-state-active", + "ui-state-hover", + "ui-state-focus", + "ui-state-disabled", + "ui-tabs-panel", + "ui-widget-content", + "ui-corner-bottom", + "ui-tabs-hide" + ].join( " " ) ); + } + }); + + if ( o.cookie ) { + this._cookie( null, o.cookie ); + } + + return this; + }, + + add: function( url, label, index ) { + if ( index === undefined ) { + index = this.anchors.length; + } + + var self = this, + o = this.options, + $li = $( o.tabTemplate.replace( /#\{href\}/g, url ).replace( /#\{label\}/g, label ) ), + id = !url.indexOf( "#" ) ? url.replace( "#", "" ) : this._tabId( $( "a", $li )[ 0 ] ); + + $li.addClass( "ui-state-default ui-corner-top" ).data( "destroy.tabs", true ); + + // try to find an existing element before creating a new one + var $panel = self.element.find( "#" + id ); + if ( !$panel.length ) { + $panel = $( o.panelTemplate ) + .attr( "id", id ) + .data( "destroy.tabs", true ); + } + $panel.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide" ); + + if ( index >= this.lis.length ) { + $li.appendTo( this.list ); + $panel.appendTo( this.list[ 0 ].parentNode ); + } else { + $li.insertBefore( this.lis[ index ] ); + $panel.insertBefore( this.panels[ index ] ); + } + + o.disabled = $.map( o.disabled, function( n, i ) { + return n >= index ? ++n : n; + }); + + this._tabify(); + + if ( this.anchors.length == 1 ) { + o.selected = 0; + $li.addClass( "ui-tabs-selected ui-state-active" ); + $panel.removeClass( "ui-tabs-hide" ); + this.element.queue( "tabs", function() { + self._trigger( "show", null, self._ui( self.anchors[ 0 ], self.panels[ 0 ] ) ); + }); + + this.load( 0 ); + } + + this._trigger( "add", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + return this; + }, + + remove: function( index ) { + index = this._getIndex( index ); + var o = this.options, + $li = this.lis.eq( index ).remove(), + $panel = this.panels.eq( index ).remove(); + + // If selected tab was removed focus tab to the right or + // in case the last tab was removed the tab to the left. + if ( $li.hasClass( "ui-tabs-selected" ) && this.anchors.length > 1) { + this.select( index + ( index + 1 < this.anchors.length ? 1 : -1 ) ); + } + + o.disabled = $.map( + $.grep( o.disabled, function(n, i) { + return n != index; + }), + function( n, i ) { + return n >= index ? --n : n; + }); + + this._tabify(); + + this._trigger( "remove", null, this._ui( $li.find( "a" )[ 0 ], $panel[ 0 ] ) ); + return this; + }, + + enable: function( index ) { + index = this._getIndex( index ); + var o = this.options; + if ( $.inArray( index, o.disabled ) == -1 ) { + return; + } + + this.lis.eq( index ).removeClass( "ui-state-disabled" ); + o.disabled = $.grep( o.disabled, function( n, i ) { + return n != index; + }); + + this._trigger( "enable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + return this; + }, + + disable: function( index ) { + index = this._getIndex( index ); + var self = this, o = this.options; + // cannot disable already selected tab + if ( index != o.selected ) { + this.lis.eq( index ).addClass( "ui-state-disabled" ); + + o.disabled.push( index ); + o.disabled.sort(); + + this._trigger( "disable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) ); + } + + return this; + }, + + select: function( index ) { + index = this._getIndex( index ); + if ( index == -1 ) { + if ( this.options.collapsible && this.options.selected != -1 ) { + index = this.options.selected; + } else { + return this; + } + } + this.anchors.eq( index ).trigger( this.options.event + ".tabs" ); + return this; + }, + + load: function( index ) { + index = this._getIndex( index ); + var self = this, + o = this.options, + a = this.anchors.eq( index )[ 0 ], + url = $.data( a, "load.tabs" ); + + this.abort(); + + // not remote or from cache + if ( !url || this.element.queue( "tabs" ).length !== 0 && $.data( a, "cache.tabs" ) ) { + this.element.dequeue( "tabs" ); + return; + } + + // load remote from here on + this.lis.eq( index ).addClass( "ui-state-processing" ); + + if ( o.spinner ) { + var span = $( "span", a ); + span.data( "label.tabs", span.html() ).html( o.spinner ); + } + + this.xhr = $.ajax( $.extend( {}, o.ajaxOptions, { + url: url, + success: function( r, s ) { + self.element.find( self._sanitizeSelector( a.hash ) ).html( r ); + + // take care of tab labels + self._cleanup(); + + if ( o.cache ) { + $.data( a, "cache.tabs", true ); + } + + self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) ); + try { + o.ajaxOptions.success( r, s ); + } + catch ( e ) {} + }, + error: function( xhr, s, e ) { + // take care of tab labels + self._cleanup(); + + self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) ); + try { + // Passing index avoid a race condition when this method is + // called after the user has selected another tab. + // Pass the anchor that initiated this request allows + // loadError to manipulate the tab content panel via $(a.hash) + o.ajaxOptions.error( xhr, s, index, a ); + } + catch ( e ) {} + } + } ) ); + + // last, so that load event is fired before show... + self.element.dequeue( "tabs" ); + + return this; + }, + + abort: function() { + // stop possibly running animations + this.element.queue( [] ); + this.panels.stop( false, true ); + + // "tabs" queue must not contain more than two elements, + // which are the callbacks for the latest clicked tab... + this.element.queue( "tabs", this.element.queue( "tabs" ).splice( -2, 2 ) ); + + // terminate pending requests from other tabs + if ( this.xhr ) { + this.xhr.abort(); + delete this.xhr; + } + + // take care of tab labels + this._cleanup(); + return this; + }, + + url: function( index, url ) { + this.anchors.eq( index ).removeData( "cache.tabs" ).data( "load.tabs", url ); + return this; + }, + + length: function() { + return this.anchors.length; + } +}); + +$.extend( $.ui.tabs, { + version: "1.8.24" +}); + +/* + * Tabs Extensions + */ + +/* + * Rotate + */ +$.extend( $.ui.tabs.prototype, { + rotation: null, + rotate: function( ms, continuing ) { + var self = this, + o = this.options; + + var rotate = self._rotate || ( self._rotate = function( e ) { + clearTimeout( self.rotation ); + self.rotation = setTimeout(function() { + var t = o.selected; + self.select( ++t < self.anchors.length ? t : 0 ); + }, ms ); + + if ( e ) { + e.stopPropagation(); + } + }); + + var stop = self._unrotate || ( self._unrotate = !continuing + ? function(e) { + if (e.clientX) { // in case of a true click + self.rotate(null); + } + } + : function( e ) { + rotate(); + }); + + // start rotation + if ( ms ) { + this.element.bind( "tabsshow", rotate ); + this.anchors.bind( o.event + ".tabs", stop ); + rotate(); + // stop rotation + } else { + clearTimeout( self.rotation ); + this.element.unbind( "tabsshow", rotate ); + this.anchors.unbind( o.event + ".tabs", stop ); + delete this._rotate; + delete this._unrotate; + } + + return this; + } +}); + +})( jQuery ); diff --git a/Plugins/org.mitk.gui.qt.measurementtoolbox/src/internal/QmitkImageStatisticsView.cpp b/Plugins/org.mitk.gui.qt.measurementtoolbox/src/internal/QmitkImageStatisticsView.cpp index f4b23ce932..4a7f2d3d74 100644 --- a/Plugins/org.mitk.gui.qt.measurementtoolbox/src/internal/QmitkImageStatisticsView.cpp +++ b/Plugins/org.mitk.gui.qt.measurementtoolbox/src/internal/QmitkImageStatisticsView.cpp @@ -1,696 +1,722 @@ /*=================================================================== The Medical Imaging Interaction Toolkit (MITK) Copyright (c) German Cancer Research Center, Division of Medical and Biological Informatics. All rights reserved. This software is distributed WITHOUT ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See LICENSE.txt or http://www.mitk.org for details. ===================================================================*/ #include "QmitkImageStatisticsView.h" // Qt includes #include // berry includes #include // mitk includes #include "mitkNodePredicateDataType.h" #include "mitkPlanarFigureInteractor.h" // itk includes #include "itksys/SystemTools.hxx" #include #include const std::string QmitkImageStatisticsView::VIEW_ID = "org.mitk.views.imagestatistics"; QmitkImageStatisticsView::QmitkImageStatisticsView(QObject* /*parent*/, const char* /*name*/) : m_Controls( NULL ), m_TimeStepperAdapter( NULL ), m_SelectedImage( NULL ), m_SelectedImageMask( NULL ), m_SelectedPlanarFigure( NULL ), m_ImageObserverTag( -1 ), m_ImageMaskObserverTag( -1 ), m_PlanarFigureObserverTag( -1 ), m_CurrentStatisticsValid( false ), m_StatisticsUpdatePending( false ), m_DataNodeSelectionChanged ( false ), m_Visible(false) { this->m_CalculationThread = new QmitkImageStatisticsCalculationThread; } QmitkImageStatisticsView::~QmitkImageStatisticsView() { if ( m_SelectedImage != NULL ) m_SelectedImage->RemoveObserver( m_ImageObserverTag ); if ( m_SelectedImageMask != NULL ) m_SelectedImageMask->RemoveObserver( m_ImageMaskObserverTag ); if ( m_SelectedPlanarFigure != NULL ) m_SelectedPlanarFigure->RemoveObserver( m_PlanarFigureObserverTag ); while(this->m_CalculationThread->isRunning()) // wait until thread has finished { itksys::SystemTools::Delay(100); } delete this->m_CalculationThread; } void QmitkImageStatisticsView::CreateQtPartControl(QWidget *parent) { if (m_Controls == NULL) { m_Controls = new Ui::QmitkImageStatisticsViewControls; m_Controls->setupUi(parent); this->CreateConnections(); m_Controls->m_ErrorMessageLabel->hide(); m_Controls->m_StatisticsWidgetStack->setCurrentIndex( 0 ); m_Controls->m_LineProfileWidget->SetPathModeToPlanarFigure(); } } void QmitkImageStatisticsView::CreateConnections() { if ( m_Controls ) { connect( (QObject*)(this->m_Controls->m_ButtonCopyHistogramToClipboard), SIGNAL(clicked()),(QObject*) this, SLOT(OnClipboardHistogramButtonClicked()) ); connect( (QObject*)(this->m_Controls->m_ButtonCopyStatisticsToClipboard), SIGNAL(clicked()),(QObject*) this, SLOT(OnClipboardStatisticsButtonClicked()) ); connect( (QObject*)(this->m_Controls->m_IgnoreZerosCheckbox), SIGNAL(clicked()),(QObject*) this, SLOT(OnIgnoreZerosCheckboxClicked()) ); connect( (QObject*) this->m_CalculationThread, SIGNAL(finished()),this, SLOT( OnThreadedStatisticsCalculationEnds()),Qt::QueuedConnection); connect( (QObject*) this, SIGNAL(StatisticsUpdate()),this, SLOT( RequestStatisticsUpdate()), Qt::QueuedConnection); - connect( (QObject*) this->m_Controls->m_StatisticsTable, SIGNAL(cellDoubleClicked(int,int)),this, SLOT( JumpToCoordinates(int,int)) ); + connect( (QObject*) (this->m_Controls->m_barRadioButton), SIGNAL(clicked()), (QObject*) (this->m_Controls->m_JSHistogram), SLOT(OnBarRadioButtonSelected())); + connect( (QObject*) (this->m_Controls->m_lineRadioButton), SIGNAL(clicked()), (QObject*) (this->m_Controls->m_JSHistogram), SLOT(OnLineRadioButtonSelected())); } } void QmitkImageStatisticsView::JumpToCoordinates(int row ,int col) { mitk::Point3D world; if (row==4) world = m_WorldMin; else if (row==3) world = m_WorldMax; else return; mitk::IRenderWindowPart* part = this->GetRenderWindowPart(); if (part) { part->GetRenderWindow("axial")->GetSliceNavigationController()->SelectSliceByPoint(world); part->GetRenderWindow("sagittal")->GetSliceNavigationController()->SelectSliceByPoint(world); part->GetRenderWindow("coronal")->GetSliceNavigationController()->SelectSliceByPoint(world); } } void QmitkImageStatisticsView::OnIgnoreZerosCheckboxClicked() { emit StatisticsUpdate(); } void QmitkImageStatisticsView::OnClipboardHistogramButtonClicked() { if ( m_CurrentStatisticsValid ) { typedef mitk::ImageStatisticsCalculator::HistogramType HistogramType; const HistogramType *histogram = this->m_CalculationThread->GetTimeStepHistogram().GetPointer(); QString clipboard( "Measurement \t Frequency\n" ); for ( HistogramType::ConstIterator it = histogram->Begin(); it != histogram->End(); ++it ) { clipboard = clipboard.append( "%L1 \t %L2\n" ) .arg( it.GetMeasurementVector()[0], 0, 'f', 2 ) .arg( it.GetFrequency() ); } QApplication::clipboard()->setText( clipboard, QClipboard::Clipboard ); } else { QApplication::clipboard()->clear(); } } void QmitkImageStatisticsView::OnClipboardStatisticsButtonClicked() { if ( this->m_CurrentStatisticsValid ) { const mitk::ImageStatisticsCalculator::Statistics &statistics = this->m_CalculationThread->GetStatisticsData(); // Copy statistics to clipboard ("%Ln" will use the default locale for // number formatting) QString clipboard( "Mean \t StdDev \t RMS \t Max \t Min \t N \t V (mm³)\n" ); clipboard = clipboard.append( "%L1 \t %L2 \t %L3 \t %L4 \t %L5 \t %L6 \t %L7" ) .arg( statistics.Mean, 0, 'f', 10 ) .arg( statistics.Sigma, 0, 'f', 10 ) .arg( statistics.RMS, 0, 'f', 10 ) .arg( statistics.Max, 0, 'f', 10 ) .arg( statistics.Min, 0, 'f', 10 ) .arg( statistics.N ) .arg( m_Controls->m_StatisticsTable->item( 0, 6 )->text() ); QApplication::clipboard()->setText( clipboard, QClipboard::Clipboard ); } else { QApplication::clipboard()->clear(); } } void QmitkImageStatisticsView::OnSelectionChanged( berry::IWorkbenchPart::Pointer /*part*/, const QList &selectedNodes ) { if (this->m_Visible) { this->SelectionChanged( selectedNodes ); } else { this->m_DataNodeSelectionChanged = true; } } void QmitkImageStatisticsView::SelectionChanged(const QList &selectedNodes) { if( this->m_StatisticsUpdatePending ) { this->m_DataNodeSelectionChanged = true; return; // not ready for new data now! } if (selectedNodes.size() == this->m_SelectedDataNodes.size()) { int i = 0; for (; i < selectedNodes.size(); ++i) { if (selectedNodes.at(i) != this->m_SelectedDataNodes.at(i)) { break; } } // node selection did not change if (i == selectedNodes.size()) return; } this->ReinitData(); + if (!selectedNodes.size()) + { + m_Controls->m_JSHistogram->ClearHistogram(); + m_Controls->m_lineRadioButton->setEnabled(true); + m_Controls->m_barRadioButton->setEnabled(true); + m_Controls->m_InfoLabel->setText(QString("")); + } if(selectedNodes.size() == 1 || selectedNodes.size() == 2) { + bool isBinary = false; + selectedNodes.value(0)->GetBoolProperty("binary",isBinary); + if(isBinary) + { + m_Controls->m_JSHistogram->ClearHistogram(); + m_Controls->m_lineRadioButton->setEnabled(true); + m_Controls->m_barRadioButton->setEnabled(true); + m_Controls->m_InfoLabel->setText(QString("")); + } for (int i= 0; i< selectedNodes.size(); ++i) { this->m_SelectedDataNodes.push_back(selectedNodes.at(i)); } this->m_DataNodeSelectionChanged = false; this->m_Controls->m_ErrorMessageLabel->setText( "" ); this->m_Controls->m_ErrorMessageLabel->hide(); emit StatisticsUpdate(); } else { this->m_DataNodeSelectionChanged = false; } } void QmitkImageStatisticsView::ReinitData() { while( this->m_CalculationThread->isRunning()) // wait until thread has finished { itksys::SystemTools::Delay(100); } if(this->m_SelectedImage != NULL) { this->m_SelectedImage->RemoveObserver( this->m_ImageObserverTag); this->m_SelectedImage = NULL; } if(this->m_SelectedImageMask != NULL) { this->m_SelectedImageMask->RemoveObserver( this->m_ImageMaskObserverTag); this->m_SelectedImageMask = NULL; } if(this->m_SelectedPlanarFigure != NULL) { this->m_SelectedPlanarFigure->RemoveObserver( this->m_PlanarFigureObserverTag); this->m_SelectedPlanarFigure = NULL; } this->m_SelectedDataNodes.clear(); this->m_StatisticsUpdatePending = false; m_Controls->m_ErrorMessageLabel->setText( "" ); m_Controls->m_ErrorMessageLabel->hide(); this->InvalidateStatisticsTableView(); m_Controls->m_StatisticsWidgetStack->setCurrentIndex( 0 ); - m_Controls->m_HistogramWidget->ClearItemModel(); - m_Controls->m_LineProfileWidget->ClearItemModel(); } void QmitkImageStatisticsView::OnThreadedStatisticsCalculationEnds() { std::stringstream message; message << ""; m_Controls->m_ErrorMessageLabel->setText( message.str().c_str() ); m_Controls->m_ErrorMessageLabel->hide(); this->WriteStatisticsToGUI(); } void QmitkImageStatisticsView::UpdateStatistics() { mitk::IRenderWindowPart* renderPart = this->GetRenderWindowPart(); if ( renderPart == NULL ) { this->m_StatisticsUpdatePending = false; return; } m_WorldMin.Fill(-1); m_WorldMax.Fill(-1); // classify selected nodes mitk::NodePredicateDataType::Pointer imagePredicate = mitk::NodePredicateDataType::New("Image"); std::string maskName = std::string(); std::string maskType = std::string(); unsigned int maskDimension = 0; // reset data from last run ITKCommandType::Pointer changeListener = ITKCommandType::New(); changeListener->SetCallbackFunction( this, &QmitkImageStatisticsView::SelectedDataModified ); mitk::DataNode::Pointer planarFigureNode; for( int i= 0 ; i < this->m_SelectedDataNodes.size(); ++i) { mitk::PlanarFigure::Pointer planarFig = dynamic_cast(this->m_SelectedDataNodes.at(i)->GetData()); if( imagePredicate->CheckNode(this->m_SelectedDataNodes.at(i)) ) { bool isMask = false; this->m_SelectedDataNodes.at(i)->GetPropertyValue("binary", isMask); if( this->m_SelectedImageMask == NULL && isMask) { this->m_SelectedImageMask = dynamic_cast(this->m_SelectedDataNodes.at(i)->GetData()); this->m_ImageMaskObserverTag = this->m_SelectedImageMask->AddObserver(itk::ModifiedEvent(), changeListener); maskName = this->m_SelectedDataNodes.at(i)->GetName(); maskType = m_SelectedImageMask->GetNameOfClass(); maskDimension = 3; } else if( !isMask ) { if(this->m_SelectedImage == NULL) { this->m_SelectedImage = static_cast(this->m_SelectedDataNodes.at(i)->GetData()); this->m_ImageObserverTag = this->m_SelectedImage->AddObserver(itk::ModifiedEvent(), changeListener); } } } else if (planarFig.IsNotNull()) { if(this->m_SelectedPlanarFigure == NULL) { this->m_SelectedPlanarFigure = planarFig; this->m_PlanarFigureObserverTag = this->m_SelectedPlanarFigure->AddObserver(mitk::EndInteractionPlanarFigureEvent(), changeListener); maskName = this->m_SelectedDataNodes.at(i)->GetName(); maskType = this->m_SelectedPlanarFigure->GetNameOfClass(); maskDimension = 2; planarFigureNode = m_SelectedDataNodes.at(i); } } else { std::stringstream message; message << "" << "Invalid data node type!" << ""; m_Controls->m_ErrorMessageLabel->setText( message.str().c_str() ); m_Controls->m_ErrorMessageLabel->show(); } } if(maskName == "") { maskName = "None"; maskType = ""; maskDimension = 0; } if (m_SelectedPlanarFigure != NULL && m_SelectedImage == NULL) { mitk::DataStorage::SetOfObjects::ConstPointer parentSet = this->GetDataStorage()->GetSources(planarFigureNode); for (int i=0; iSize(); i++) { mitk::DataNode::Pointer node = parentSet->ElementAt(i); if( imagePredicate->CheckNode(node) ) { bool isMask = false; node->GetPropertyValue("binary", isMask); if( !isMask ) { if(this->m_SelectedImage == NULL) { this->m_SelectedImage = static_cast(node->GetData()); this->m_ImageObserverTag = this->m_SelectedImage->AddObserver(itk::ModifiedEvent(), changeListener); } } } } } unsigned int timeStep = renderPart->GetTimeNavigationController()->GetTime()->GetPos(); if ( m_SelectedImage != NULL && m_SelectedImage->IsInitialized()) { // Check if a the selected image is a multi-channel image. If yes, statistics // cannot be calculated currently. if ( m_SelectedImage->GetPixelType().GetNumberOfComponents() > 1 ) { std::stringstream message; message << "Multi-component images not supported."; m_Controls->m_ErrorMessageLabel->setText( message.str().c_str() ); m_Controls->m_ErrorMessageLabel->show(); this->InvalidateStatisticsTableView(); m_Controls->m_StatisticsWidgetStack->setCurrentIndex( 0 ); - m_Controls->m_HistogramWidget->ClearItemModel(); - m_Controls->m_LineProfileWidget->ClearItemModel(); + m_Controls->m_JSHistogram->ClearHistogram(); m_CurrentStatisticsValid = false; this->m_StatisticsUpdatePending = false; + m_Controls->m_lineRadioButton->setEnabled(true); + m_Controls->m_barRadioButton->setEnabled(true); + m_Controls->m_InfoLabel->setText(QString("")); return; } std::stringstream maskLabel; maskLabel << maskName; if ( maskDimension > 0 ) { maskLabel << " [" << maskDimension << "D " << maskType << "]"; } m_Controls->m_SelectedMaskLabel->setText( maskLabel.str().c_str() ); // check time step validity if(m_SelectedImage->GetDimension() <= 3 && timeStep > m_SelectedImage->GetDimension(3)-1) { timeStep = m_SelectedImage->GetDimension(3)-1; } //// initialize thread and trigger it this->m_CalculationThread->SetIgnoreZeroValueVoxel( m_Controls->m_IgnoreZerosCheckbox->isChecked() ); this->m_CalculationThread->Initialize( m_SelectedImage, m_SelectedImageMask, m_SelectedPlanarFigure ); this->m_CalculationThread->SetTimeStep( timeStep ); std::stringstream message; message << "Calculating statistics..."; m_Controls->m_ErrorMessageLabel->setText( message.str().c_str() ); m_Controls->m_ErrorMessageLabel->show(); try { // Compute statistics this->m_CalculationThread->start(); } catch ( const mitk::Exception& e) { std::stringstream message; message << "" << e.GetDescription() << ""; m_Controls->m_ErrorMessageLabel->setText( message.str().c_str() ); m_Controls->m_ErrorMessageLabel->show(); this->m_StatisticsUpdatePending = false; } catch ( const std::runtime_error &e ) { // In case of exception, print error message on GUI std::stringstream message; message << "" << e.what() << ""; m_Controls->m_ErrorMessageLabel->setText( message.str().c_str() ); m_Controls->m_ErrorMessageLabel->show(); this->m_StatisticsUpdatePending = false; } catch ( const std::exception &e ) { MITK_ERROR << "Caught exception: " << e.what(); // In case of exception, print error message on GUI std::stringstream message; message << "Error! Unequal Dimensions of Image and Segmentation. No recompute possible "; m_Controls->m_ErrorMessageLabel->setText( message.str().c_str() ); m_Controls->m_ErrorMessageLabel->show(); this->m_StatisticsUpdatePending = false; } } else { this->m_StatisticsUpdatePending = false; } } void QmitkImageStatisticsView::SelectedDataModified() { if( !m_StatisticsUpdatePending ) { emit StatisticsUpdate(); } } void QmitkImageStatisticsView::NodeRemoved(const mitk::DataNode *node) { while(this->m_CalculationThread->isRunning()) // wait until thread has finished { itksys::SystemTools::Delay(100); } if (node->GetData() == m_SelectedImage) { m_SelectedImage = NULL; } } void QmitkImageStatisticsView::RequestStatisticsUpdate() { if ( !m_StatisticsUpdatePending ) { if(this->m_DataNodeSelectionChanged) { this->SelectionChanged(this->GetCurrentSelection()); } else { this->m_StatisticsUpdatePending = true; this->UpdateStatistics(); } } if (this->GetRenderWindowPart()) this->GetRenderWindowPart()->RequestUpdate(); } void QmitkImageStatisticsView::WriteStatisticsToGUI() { + m_Controls->m_lineRadioButton->setEnabled(true); + m_Controls->m_barRadioButton->setEnabled(true); + m_Controls->m_InfoLabel->setText(QString("")); + if(m_DataNodeSelectionChanged) { this->m_StatisticsUpdatePending = false; this->RequestStatisticsUpdate(); return; // stop visualization of results and calculate statistics of new selection } if ( this->m_CalculationThread->GetStatisticsUpdateSuccessFlag()) { if ( this->m_CalculationThread->GetStatisticsChangedFlag() ) { // Do not show any error messages m_Controls->m_ErrorMessageLabel->hide(); m_CurrentStatisticsValid = true; } + if (m_Controls->m_barRadioButton->isChecked()) + { + m_Controls->m_JSHistogram->OnBarRadioButtonSelected(); + } m_Controls->m_StatisticsWidgetStack->setCurrentIndex( 0 ); - m_Controls->m_HistogramWidget->SetHistogramModeToDirectHistogram(); - m_Controls->m_HistogramWidget->SetHistogram( this->m_CalculationThread->GetTimeStepHistogram().GetPointer() ); - m_Controls->m_HistogramWidget->UpdateItemModelFromHistogram(); - //int timeStep = this->m_CalculationThread->GetTimeStep(); + m_Controls->m_JSHistogram->ComputeHistogram( this->m_CalculationThread->GetTimeStepHistogram().GetPointer() ); this->FillStatisticsTableView( this->m_CalculationThread->GetStatisticsData(), this->m_CalculationThread->GetStatisticsImage()); } else { m_Controls->m_SelectedMaskLabel->setText( "None" ); m_Controls->m_ErrorMessageLabel->setText( m_CalculationThread->GetLastErrorMessage().c_str() ); m_Controls->m_ErrorMessageLabel->show(); // Clear statistics and histogram this->InvalidateStatisticsTableView(); m_Controls->m_StatisticsWidgetStack->setCurrentIndex( 0 ); - m_Controls->m_HistogramWidget->ClearItemModel(); - m_Controls->m_LineProfileWidget->ClearItemModel(); + //m_Controls->m_JSHistogram->clearHistogram(); m_CurrentStatisticsValid = false; + // If a (non-closed) PlanarFigure is selected, display a line profile widget if ( m_SelectedPlanarFigure != NULL ) { // check whether PlanarFigure is initialized const mitk::Geometry2D *planarFigureGeometry2D = m_SelectedPlanarFigure->GetGeometry2D(); if ( planarFigureGeometry2D == NULL ) { // Clear statistics, histogram, and GUI this->InvalidateStatisticsTableView(); m_Controls->m_StatisticsWidgetStack->setCurrentIndex( 0 ); - m_Controls->m_HistogramWidget->ClearItemModel(); - m_Controls->m_LineProfileWidget->ClearItemModel(); + m_Controls->m_JSHistogram->ClearHistogram(); m_CurrentStatisticsValid = false; m_Controls->m_ErrorMessageLabel->hide(); m_Controls->m_SelectedMaskLabel->setText( "None" ); this->m_StatisticsUpdatePending = false; + m_Controls->m_lineRadioButton->setEnabled(true); + m_Controls->m_barRadioButton->setEnabled(true); + m_Controls->m_InfoLabel->setText(QString("")); return; } - // TODO: enable line profile widget - m_Controls->m_StatisticsWidgetStack->setCurrentIndex( 1 ); - m_Controls->m_LineProfileWidget->SetImage( this->m_CalculationThread->GetStatisticsImage() ); - m_Controls->m_LineProfileWidget->SetPlanarFigure( m_SelectedPlanarFigure ); - m_Controls->m_LineProfileWidget->UpdateItemModelFromPath(); + unsigned int timeStep = this->GetRenderWindowPart()->GetTimeNavigationController()->GetTime()->GetPos(); + m_Controls->m_JSHistogram->SetImage(this->m_CalculationThread->GetStatisticsImage()); + m_Controls->m_JSHistogram->SetPlanarFigure(m_SelectedPlanarFigure); + m_Controls->m_JSHistogram->ComputeIntensityProfile(timeStep); + m_Controls->m_lineRadioButton->setEnabled(false); + m_Controls->m_barRadioButton->setEnabled(false); + std::stringstream message; + message << "Only linegraph available for an intesityprofile!"; + m_Controls->m_InfoLabel->setText(message.str().c_str()); } } this->m_StatisticsUpdatePending = false; } void QmitkImageStatisticsView::ComputeIntensityProfile( mitk::PlanarLine* line ) { double sampling = 300; QmitkVtkHistogramWidget::HistogramType::Pointer histogram = QmitkVtkHistogramWidget::HistogramType::New(); itk::Size<1> siz; siz[0] = sampling; itk::FixedArray lower, higher; lower.Fill(0); mitk::Point3D begin = line->GetWorldControlPoint(0); mitk::Point3D end = line->GetWorldControlPoint(1); itk::Vector direction = (end - begin); higher.Fill(direction.GetNorm()); histogram->Initialize(siz, lower, higher); for(int i = 0; i < sampling; i++) { double d = m_SelectedImage->GetPixelValueByWorldCoordinate(begin + double(i)/sampling * direction); histogram->SetFrequency(i,d); } - m_Controls->m_HistogramWidget->SetHistogramModeToDirectHistogram(); - m_Controls->m_HistogramWidget->SetHistogram( histogram ); - m_Controls->m_HistogramWidget->UpdateItemModelFromHistogram(); + m_Controls->m_JSHistogram->ComputeHistogram( histogram ); } void QmitkImageStatisticsView::FillStatisticsTableView( const mitk::ImageStatisticsCalculator::Statistics &s, const mitk::Image *image ) { if (s.MaxIndex.size()==3) { mitk::Point3D index; index[0] = s.MaxIndex[0]; index[1] = s.MaxIndex[1]; index[2] = s.MaxIndex[2]; m_SelectedImage->GetGeometry()->IndexToWorld(index, m_WorldMax); index[0] = s.MinIndex[0]; index[1] = s.MinIndex[1]; index[2] = s.MinIndex[2]; m_SelectedImage->GetGeometry()->IndexToWorld(index, m_WorldMin); } int decimals = 2; mitk::PixelType doublePix = mitk::MakeScalarPixelType< double >(); mitk::PixelType floatPix = mitk::MakeScalarPixelType< float >(); if (image->GetPixelType()==doublePix || image->GetPixelType()==floatPix) decimals = 5; this->m_Controls->m_StatisticsTable->setItem( 0, 0, new QTableWidgetItem( QString("%1").arg(s.Mean, 0, 'f', decimals) ) ); this->m_Controls->m_StatisticsTable->setItem( 0, 1, new QTableWidgetItem( QString("%1").arg(s.Sigma, 0, 'f', decimals) ) ); this->m_Controls->m_StatisticsTable->setItem( 0, 2, new QTableWidgetItem( QString("%1").arg(s.RMS, 0, 'f', decimals) ) ); QString max; max.append(QString("%1").arg(s.Max, 0, 'f', decimals)); max += " ("; for (int i=0; im_Controls->m_StatisticsTable->setItem( 0, 3, new QTableWidgetItem( max ) ); QString min; min.append(QString("%1").arg(s.Min, 0, 'f', decimals)); min += " ("; for (int i=0; im_Controls->m_StatisticsTable->setItem( 0, 4, new QTableWidgetItem( min ) ); this->m_Controls->m_StatisticsTable->setItem( 0, 5, new QTableWidgetItem( QString("%1").arg(s.N) ) ); const mitk::Geometry3D *geometry = image->GetGeometry(); if ( geometry != NULL ) { const mitk::Vector3D &spacing = image->GetGeometry()->GetSpacing(); double volume = spacing[0] * spacing[1] * spacing[2] * (double) s.N; this->m_Controls->m_StatisticsTable->setItem( 0, 6, new QTableWidgetItem( QString("%1").arg(volume, 0, 'f', decimals) ) ); } else { this->m_Controls->m_StatisticsTable->setItem( 0, 6, new QTableWidgetItem( "NA" ) ); } } void QmitkImageStatisticsView::InvalidateStatisticsTableView() { for ( unsigned int i = 0; i < 7; ++i ) { this->m_Controls->m_StatisticsTable->setItem( 0, i, new QTableWidgetItem( "NA" ) ); } } void QmitkImageStatisticsView::Activated() { } void QmitkImageStatisticsView::Deactivated() { } void QmitkImageStatisticsView::Visible() { m_Visible = true; if (m_DataNodeSelectionChanged) { if (this->IsCurrentSelectionValid()) { this->SelectionChanged(this->GetCurrentSelection()); } else { this->SelectionChanged(this->GetDataManagerSelection()); } m_DataNodeSelectionChanged = false; } } void QmitkImageStatisticsView::Hidden() { m_Visible = false; } void QmitkImageStatisticsView::SetFocus() { } diff --git a/Plugins/org.mitk.gui.qt.measurementtoolbox/src/internal/QmitkImageStatisticsViewControls.ui b/Plugins/org.mitk.gui.qt.measurementtoolbox/src/internal/QmitkImageStatisticsViewControls.ui index 0fde924582..711c668e07 100644 --- a/Plugins/org.mitk.gui.qt.measurementtoolbox/src/internal/QmitkImageStatisticsViewControls.ui +++ b/Plugins/org.mitk.gui.qt.measurementtoolbox/src/internal/QmitkImageStatisticsViewControls.ui @@ -1,342 +1,477 @@ QmitkImageStatisticsViewControls true 0 0 465 800 Form - + 0 0 Mask: None 2 Qt::Horizontal 40 20 color: rgb(255, 0, 0); Error Message Qt::AutoText Ignore zero-valued voxels Statistics - 0 + 9 - 0 + 9 - 0 + 9 - + 0 0 100 175 16777215 170 Qt::ScrollBarAlwaysOff Qt::ScrollBarAsNeeded true true true Qt::DotLine true false false 80 true 80 false true true false 25 25 false false Mean StdDev RMS Max Min N V (mm³) Component 1 0 0 Copy to Clipboard Qt::Horizontal 40 20 150 160 Histogram false - - + + 0 - + + + + 0 + 0 + + + + + + + 0 + 0 + + + - + 0 0 Copy to Clipboard Qt::Horizontal 40 20 + + + + + 0 + 0 + + + + + 0 + 50 + + + + + 16777215 + 16777215 + + + + Plot + + + + + 0 + 20 + 411 + 31 + + + + + QLayout::SetDefaultConstraint + + + + + Qt::Horizontal + + + QSizePolicy::Preferred + + + + 10 + 0 + + + + + + + + + 0 + 0 + + + + + + + Use barchart + + + true + + + + + + + + 0 + 0 + + + + + 0 + 0 + + + + Use linegraph + + + + + + + Qt::Horizontal + + + + 40 + 20 + + + + + + + + + + + + + + + - + Qt::Vertical 20 40 QmitkVtkHistogramWidget QWidget
    QmitkVtkHistogramWidget.h
    1
    QmitkVtkLineProfileWidget QWidget
    QmitkVtkLineProfileWidget.h
    1
    + + QmitkHistogramJSWidget + QWidget +
    QmitkHistogramJSWidget.h
    + 1 +